zte's code,first commit
Change-Id: I9a04da59e459a9bc0d67f101f700d9d7dc8d681b
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/Kconfig b/ap/os/linux/linux-3.4.x/arch/arm/mm/Kconfig
new file mode 100644
index 0000000..7c8a7d8
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/Kconfig
@@ -0,0 +1,920 @@
+comment "Processor Type"
+
+# Select CPU types depending on the architecture selected. This selects
+# which CPUs we support in the kernel image, and the compiler instruction
+# optimiser behaviour.
+
+# ARM610
+config CPU_ARM610
+ bool "Support ARM610 processor" if ARCH_RPC
+ select CPU_32v3
+ select CPU_CACHE_V3
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V3 if MMU
+ select CPU_TLB_V3 if MMU
+ select CPU_PABRT_LEGACY
+ help
+ The ARM610 is the successor to the ARM3 processor
+ and was produced by VLSI Technology Inc.
+
+ Say Y if you want support for the ARM610 processor.
+ Otherwise, say N.
+
+# ARM7TDMI
+config CPU_ARM7TDMI
+ bool "Support ARM7TDMI processor"
+ depends on !MMU
+ select CPU_32v4T
+ select CPU_ABRT_LV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4
+ help
+ A 32-bit RISC microprocessor based on the ARM7 processor core
+ which has no memory control unit and cache.
+
+ Say Y if you want support for the ARM7TDMI processor.
+ Otherwise, say N.
+
+# ARM710
+config CPU_ARM710
+ bool "Support ARM710 processor" if ARCH_RPC
+ select CPU_32v3
+ select CPU_CACHE_V3
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V3 if MMU
+ select CPU_TLB_V3 if MMU
+ select CPU_PABRT_LEGACY
+ help
+ A 32-bit RISC microprocessor based on the ARM7 processor core
+ designed by Advanced RISC Machines Ltd. The ARM710 is the
+ successor to the ARM610 processor. It was released in
+ July 1994 by VLSI Technology Inc.
+
+ Say Y if you want support for the ARM710 processor.
+ Otherwise, say N.
+
+# ARM720T
+config CPU_ARM720T
+ bool "Support ARM720T processor" if ARCH_INTEGRATOR
+ select CPU_32v4T
+ select CPU_ABRT_LV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WT if MMU
+ select CPU_TLB_V4WT if MMU
+ help
+ A 32-bit RISC processor with 8kByte Cache, Write Buffer and
+ MMU built around an ARM7TDMI core.
+
+ Say Y if you want support for the ARM720T processor.
+ Otherwise, say N.
+
+# ARM740T
+config CPU_ARM740T
+ bool "Support ARM740T processor" if ARCH_INTEGRATOR
+ depends on !MMU
+ select CPU_32v4T
+ select CPU_ABRT_LV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V3 # although the core is v4t
+ select CPU_CP15_MPU
+ help
+ A 32-bit RISC processor with 8KB cache or 4KB variants,
+ write buffer and MPU(Protection Unit) built around
+ an ARM7TDMI core.
+
+ Say Y if you want support for the ARM740T processor.
+ Otherwise, say N.
+
+# ARM9TDMI
+config CPU_ARM9TDMI
+ bool "Support ARM9TDMI processor"
+ depends on !MMU
+ select CPU_32v4T
+ select CPU_ABRT_NOMMU
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4
+ help
+ A 32-bit RISC microprocessor based on the ARM9 processor core
+ which has no memory control unit and cache.
+
+ Say Y if you want support for the ARM9TDMI processor.
+ Otherwise, say N.
+
+# ARM920T
+config CPU_ARM920T
+ bool "Support ARM920T processor" if ARCH_INTEGRATOR
+ select CPU_32v4T
+ select CPU_ABRT_EV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WT
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WBI if MMU
+ help
+ The ARM920T is licensed to be produced by numerous vendors,
+ and is used in the Cirrus EP93xx and the Samsung S3C2410.
+
+ Say Y if you want support for the ARM920T processor.
+ Otherwise, say N.
+
+# ARM922T
+config CPU_ARM922T
+ bool "Support ARM922T processor" if ARCH_INTEGRATOR
+ select CPU_32v4T
+ select CPU_ABRT_EV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WT
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WBI if MMU
+ help
+ The ARM922T is a version of the ARM920T, but with smaller
+ instruction and data caches. It is used in Altera's
+ Excalibur XA device family and Micrel's KS8695 Centaur.
+
+ Say Y if you want support for the ARM922T processor.
+ Otherwise, say N.
+
+# ARM925T
+config CPU_ARM925T
+ bool "Support ARM925T processor" if ARCH_OMAP1
+ select CPU_32v4T
+ select CPU_ABRT_EV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WT
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WBI if MMU
+ help
+ The ARM925T is a mix between the ARM920T and ARM926T, but with
+ different instruction and data caches. It is used in TI's OMAP
+ device family.
+
+ Say Y if you want support for the ARM925T processor.
+ Otherwise, say N.
+
+# ARM926T
+config CPU_ARM926T
+ bool "Support ARM926T processor" if ARCH_INTEGRATOR || MACH_REALVIEW_EB
+ select CPU_32v5
+ select CPU_ABRT_EV5TJ
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WBI if MMU
+ help
+ This is a variant of the ARM920. It has slightly different
+ instruction sequences for cache and TLB operations. Curiously,
+ there is no documentation on it at the ARM corporate website.
+
+ Say Y if you want support for the ARM926T processor.
+ Otherwise, say N.
+
+# FA526
+config CPU_FA526
+ bool
+ select CPU_32v4
+ select CPU_ABRT_EV4
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_CACHE_FA
+ select CPU_COPY_FA if MMU
+ select CPU_TLB_FA if MMU
+ help
+ The FA526 is a version of the ARMv4 compatible processor with
+ Branch Target Buffer, Unified TLB and cache line size 16.
+
+ Say Y if you want support for the FA526 processor.
+ Otherwise, say N.
+
+# ARM940T
+config CPU_ARM940T
+ bool "Support ARM940T processor" if ARCH_INTEGRATOR
+ depends on !MMU
+ select CPU_32v4T
+ select CPU_ABRT_NOMMU
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MPU
+ help
+ ARM940T is a member of the ARM9TDMI family of general-
+ purpose microprocessors with MPU and separate 4KB
+ instruction and 4KB data cases, each with a 4-word line
+ length.
+
+ Say Y if you want support for the ARM940T processor.
+ Otherwise, say N.
+
+# ARM946E-S
+config CPU_ARM946E
+ bool "Support ARM946E-S processor" if ARCH_INTEGRATOR
+ depends on !MMU
+ select CPU_32v5
+ select CPU_ABRT_NOMMU
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MPU
+ help
+ ARM946E-S is a member of the ARM9E-S family of high-
+ performance, 32-bit system-on-chip processor solutions.
+ The TCM and ARMv5TE 32-bit instruction set is supported.
+
+ Say Y if you want support for the ARM946E-S processor.
+ Otherwise, say N.
+
+# ARM1020 - needs validating
+config CPU_ARM1020
+ bool "Support ARM1020T (rev 0) processor" if ARCH_INTEGRATOR
+ select CPU_32v5
+ select CPU_ABRT_EV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WT
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WBI if MMU
+ help
+ The ARM1020 is the 32K cached version of the ARM10 processor,
+ with an addition of a floating-point unit.
+
+ Say Y if you want support for the ARM1020 processor.
+ Otherwise, say N.
+
+# ARM1020E - needs validating
+config CPU_ARM1020E
+ bool "Support ARM1020E processor" if ARCH_INTEGRATOR
+ select CPU_32v5
+ select CPU_ABRT_EV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WT
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WBI if MMU
+ depends on n
+
+# ARM1022E
+config CPU_ARM1022
+ bool "Support ARM1022E processor" if ARCH_INTEGRATOR
+ select CPU_32v5
+ select CPU_ABRT_EV4T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU # can probably do better
+ select CPU_TLB_V4WBI if MMU
+ help
+ The ARM1022E is an implementation of the ARMv5TE architecture
+ based upon the ARM10 integer core with a 16KiB L1 Harvard cache,
+ embedded trace macrocell, and a floating-point unit.
+
+ Say Y if you want support for the ARM1022E processor.
+ Otherwise, say N.
+
+# ARM1026EJ-S
+config CPU_ARM1026
+ bool "Support ARM1026EJ-S processor" if ARCH_INTEGRATOR
+ select CPU_32v5
+ select CPU_ABRT_EV5T # But need Jazelle, but EV5TJ ignores bit 10
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU # can probably do better
+ select CPU_TLB_V4WBI if MMU
+ help
+ The ARM1026EJ-S is an implementation of the ARMv5TEJ architecture
+ based upon the ARM10 integer core.
+
+ Say Y if you want support for the ARM1026EJ-S processor.
+ Otherwise, say N.
+
+# SA110
+config CPU_SA110
+ bool "Support StrongARM(R) SA-110 processor" if ARCH_RPC
+ select CPU_32v3 if ARCH_RPC
+ select CPU_32v4 if !ARCH_RPC
+ select CPU_ABRT_EV4
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WB
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_V4WB if MMU
+ select CPU_TLB_V4WB if MMU
+ help
+ The Intel StrongARM(R) SA-110 is a 32-bit microprocessor and
+ is available at five speeds ranging from 100 MHz to 233 MHz.
+ More information is available at
+ <http://developer.intel.com/design/strong/sa110.htm>.
+
+ Say Y if you want support for the SA-110 processor.
+ Otherwise, say N.
+
+# SA1100
+config CPU_SA1100
+ bool
+ select CPU_32v4
+ select CPU_ABRT_EV4
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_V4WB
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_TLB_V4WB if MMU
+
+# XScale
+config CPU_XSCALE
+ bool
+ select CPU_32v5
+ select CPU_ABRT_EV5T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_TLB_V4WBI if MMU
+
+# XScale Core Version 3
+config CPU_XSC3
+ bool
+ select CPU_32v5
+ select CPU_ABRT_EV5T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_TLB_V4WBI if MMU
+ select IO_36
+
+# Marvell PJ1 (Mohawk)
+config CPU_MOHAWK
+ bool
+ select CPU_32v5
+ select CPU_ABRT_EV5T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_TLB_V4WBI if MMU
+ select CPU_COPY_V4WB if MMU
+
+# Feroceon
+config CPU_FEROCEON
+ bool
+ select CPU_32v5
+ select CPU_ABRT_EV5T
+ select CPU_PABRT_LEGACY
+ select CPU_CACHE_VIVT
+ select CPU_CP15_MMU
+ select CPU_COPY_FEROCEON if MMU
+ select CPU_TLB_FEROCEON if MMU
+
+config CPU_FEROCEON_OLD_ID
+ bool "Accept early Feroceon cores with an ARM926 ID"
+ depends on CPU_FEROCEON && !CPU_ARM926T
+ default y
+ help
+ This enables the usage of some old Feroceon cores
+ for which the CPU ID is equal to the ARM926 ID.
+ Relevant for Feroceon-1850 and early Feroceon-2850.
+
+# Marvell PJ4
+config CPU_PJ4
+ bool
+ select CPU_V7
+ select ARM_THUMBEE
+
+# ARMv6
+config CPU_V6
+ bool "Support ARM V6 processor" if ARCH_INTEGRATOR || MACH_REALVIEW_EB || MACH_REALVIEW_PBX
+ select CPU_32v6
+ select CPU_ABRT_EV6
+ select CPU_PABRT_V6
+ select CPU_CACHE_V6
+ select CPU_CACHE_VIPT
+ select CPU_CP15_MMU
+ select CPU_HAS_ASID if MMU
+ select CPU_COPY_V6 if MMU
+ select CPU_TLB_V6 if MMU
+
+# ARMv6k
+config CPU_V6K
+ bool "Support ARM V6K processor" if ARCH_INTEGRATOR || MACH_REALVIEW_EB || MACH_REALVIEW_PBX
+ select CPU_32v6
+ select CPU_32v6K
+ select CPU_ABRT_EV6
+ select CPU_PABRT_V6
+ select CPU_CACHE_V6
+ select CPU_CACHE_VIPT
+ select CPU_CP15_MMU
+ select CPU_HAS_ASID if MMU
+ select CPU_COPY_V6 if MMU
+ select CPU_TLB_V6 if MMU
+
+# ARMv7
+config CPU_V7
+ bool "Support ARM V7 processor" if ARCH_INTEGRATOR || MACH_REALVIEW_EB || MACH_REALVIEW_PBX
+ select CPU_32v6K
+ select CPU_32v7
+ select CPU_ABRT_EV7
+ select CPU_PABRT_V7
+ select CPU_CACHE_V7
+ select CPU_CACHE_VIPT
+ select CPU_CP15_MMU
+ select CPU_HAS_ASID if MMU
+ select CPU_COPY_V6 if MMU
+ select CPU_TLB_V7 if MMU
+
+# Figure out what processor architecture version we should be using.
+# This defines the compiler instruction set which depends on the machine type.
+config CPU_32v3
+ bool
+ select TLS_REG_EMUL if SMP || !MMU
+ select NEEDS_SYSCALL_FOR_CMPXCHG if SMP
+ select CPU_USE_DOMAINS if MMU
+
+config CPU_32v4
+ bool
+ select TLS_REG_EMUL if SMP || !MMU
+ select NEEDS_SYSCALL_FOR_CMPXCHG if SMP
+ select CPU_USE_DOMAINS if MMU
+
+config CPU_32v4T
+ bool
+ select TLS_REG_EMUL if SMP || !MMU
+ select NEEDS_SYSCALL_FOR_CMPXCHG if SMP
+ select CPU_USE_DOMAINS if MMU
+
+config CPU_32v5
+ bool
+ select TLS_REG_EMUL if SMP || !MMU
+ select NEEDS_SYSCALL_FOR_CMPXCHG if SMP
+ select CPU_USE_DOMAINS if MMU
+
+config CPU_32v6
+ bool
+ select TLS_REG_EMUL if !CPU_32v6K && !MMU
+ select CPU_USE_DOMAINS if CPU_V6 && MMU
+
+config CPU_32v6K
+ bool
+
+config CPU_32v7
+ bool
+
+# The abort model
+config CPU_ABRT_NOMMU
+ bool
+
+config CPU_ABRT_EV4
+ bool
+
+config CPU_ABRT_EV4T
+ bool
+
+config CPU_ABRT_LV4T
+ bool
+
+config CPU_ABRT_EV5T
+ bool
+
+config CPU_ABRT_EV5TJ
+ bool
+
+config CPU_ABRT_EV6
+ bool
+
+config CPU_ABRT_EV7
+ bool
+
+config CPU_PABRT_LEGACY
+ bool
+
+config CPU_PABRT_V6
+ bool
+
+config CPU_PABRT_V7
+ bool
+
+# The cache model
+config CPU_CACHE_V3
+ bool
+
+config CPU_CACHE_V4
+ bool
+
+config CPU_CACHE_V4WT
+ bool
+
+config CPU_CACHE_V4WB
+ bool
+
+config CPU_CACHE_V6
+ bool
+
+config CPU_CACHE_V7
+ bool
+
+config CPU_CACHE_VIVT
+ bool
+
+config CPU_CACHE_VIPT
+ bool
+
+config CPU_CACHE_FA
+ bool
+
+if MMU
+# The copy-page model
+config CPU_COPY_V3
+ bool
+
+config CPU_COPY_V4WT
+ bool
+
+config CPU_COPY_V4WB
+ bool
+
+config CPU_COPY_FEROCEON
+ bool
+
+config CPU_COPY_FA
+ bool
+
+config CPU_COPY_V6
+ bool
+
+# This selects the TLB model
+config CPU_TLB_V3
+ bool
+ help
+ ARM Architecture Version 3 TLB.
+
+config CPU_TLB_V4WT
+ bool
+ help
+ ARM Architecture Version 4 TLB with writethrough cache.
+
+config CPU_TLB_V4WB
+ bool
+ help
+ ARM Architecture Version 4 TLB with writeback cache.
+
+config CPU_TLB_V4WBI
+ bool
+ help
+ ARM Architecture Version 4 TLB with writeback cache and invalidate
+ instruction cache entry.
+
+config CPU_TLB_FEROCEON
+ bool
+ help
+ Feroceon TLB (v4wbi with non-outer-cachable page table walks).
+
+config CPU_TLB_FA
+ bool
+ help
+ Faraday ARM FA526 architecture, unified TLB with writeback cache
+ and invalidate instruction cache entry. Branch target buffer is
+ also supported.
+
+config CPU_TLB_V6
+ bool
+
+config CPU_TLB_V7
+ bool
+
+config VERIFY_PERMISSION_FAULT
+ bool
+endif
+
+config CPU_HAS_ASID
+ bool
+ help
+ This indicates whether the CPU has the ASID register; used to
+ tag TLB and possibly cache entries.
+
+config CPU_CP15
+ bool
+ help
+ Processor has the CP15 register.
+
+config CPU_CP15_MMU
+ bool
+ select CPU_CP15
+ help
+ Processor has the CP15 register, which has MMU related registers.
+
+config CPU_CP15_MPU
+ bool
+ select CPU_CP15
+ help
+ Processor has the CP15 register, which has MPU related registers.
+
+config CPU_USE_DOMAINS
+ bool
+ help
+ This option enables or disables the use of domain switching
+ via the set_fs() function.
+
+#
+# CPU supports 36-bit I/O
+#
+config IO_36
+ bool
+
+comment "Processor Features"
+
+config ARM_LPAE
+ bool "Support for the Large Physical Address Extension"
+ depends on MMU && CPU_32v7 && !CPU_32v6 && !CPU_32v5 && \
+ !CPU_32v4 && !CPU_32v3
+ help
+ Say Y if you have an ARMv7 processor supporting the LPAE page
+ table format and you would like to access memory beyond the
+ 4GB limit. The resulting kernel image will not run on
+ processors without the LPA extension.
+
+ If unsure, say N.
+
+config ARCH_PHYS_ADDR_T_64BIT
+ def_bool ARM_LPAE
+
+config ARCH_DMA_ADDR_T_64BIT
+ bool
+
+config ARM_THUMB
+ bool "Support Thumb user binaries"
+ depends on CPU_ARM720T || CPU_ARM740T || CPU_ARM920T || CPU_ARM922T || CPU_ARM925T || CPU_ARM926T || CPU_ARM940T || CPU_ARM946E || CPU_ARM1020 || CPU_ARM1020E || CPU_ARM1022 || CPU_ARM1026 || CPU_XSCALE || CPU_XSC3 || CPU_MOHAWK || CPU_V6 || CPU_V6K || CPU_V7 || CPU_FEROCEON
+ default y
+ help
+ Say Y if you want to include kernel support for running user space
+ Thumb binaries.
+
+ The Thumb instruction set is a compressed form of the standard ARM
+ instruction set resulting in smaller binaries at the expense of
+ slightly less efficient code.
+
+ If you don't know what this all is, saying Y is a safe choice.
+
+config ARM_THUMBEE
+ bool "Enable ThumbEE CPU extension"
+ depends on CPU_V7
+ help
+ Say Y here if you have a CPU with the ThumbEE extension and code to
+ make use of it. Say N for code that can run on CPUs without ThumbEE.
+
+config SWP_EMULATE
+ bool "Emulate SWP/SWPB instructions"
+ depends on !CPU_USE_DOMAINS && CPU_V7
+ select HAVE_PROC_CPU if PROC_FS
+ default y if SMP
+ help
+ ARMv6 architecture deprecates use of the SWP/SWPB instructions.
+ ARMv7 multiprocessing extensions introduce the ability to disable
+ these instructions, triggering an undefined instruction exception
+ when executed. Say Y here to enable software emulation of these
+ instructions for userspace (not kernel) using LDREX/STREX.
+ Also creates /proc/cpu/swp_emulation for statistics.
+
+ In some older versions of glibc [<=2.8] SWP is used during futex
+ trylock() operations with the assumption that the code will not
+ be preempted. This invalid assumption may be more likely to fail
+ with SWP emulation enabled, leading to deadlock of the user
+ application.
+
+ NOTE: when accessing uncached shared regions, LDREX/STREX rely
+ on an external transaction monitoring block called a global
+ monitor to maintain update atomicity. If your system does not
+ implement a global monitor, this option can cause programs that
+ perform SWP operations to uncached memory to deadlock.
+
+ If unsure, say Y.
+
+config CPU_BIG_ENDIAN
+ bool "Build big-endian kernel"
+ depends on ARCH_SUPPORTS_BIG_ENDIAN
+ help
+ Say Y if you plan on running a kernel in big-endian mode.
+ Note that your board must be properly built and your board
+ port must properly enable any big-endian related features
+ of your chipset/board/processor.
+
+config CPU_ENDIAN_BE8
+ bool
+ depends on CPU_BIG_ENDIAN
+ default CPU_V6 || CPU_V6K || CPU_V7
+ help
+ Support for the BE-8 (big-endian) mode on ARMv6 and ARMv7 processors.
+
+config CPU_ENDIAN_BE32
+ bool
+ depends on CPU_BIG_ENDIAN
+ default !CPU_ENDIAN_BE8
+ help
+ Support for the BE-32 (big-endian) mode on pre-ARMv6 processors.
+
+config CPU_HIGH_VECTOR
+ depends on !MMU && CPU_CP15 && !CPU_ARM740T
+ bool "Select the High exception vector"
+ help
+ Say Y here to select high exception vector(0xFFFF0000~).
+ The exception vector can vary depending on the platform
+ design in nommu mode. If your platform needs to select
+ high exception vector, say Y.
+ Otherwise or if you are unsure, say N, and the low exception
+ vector (0x00000000~) will be used.
+
+config CPU_ICACHE_DISABLE
+ bool "Disable I-Cache (I-bit)"
+ depends on CPU_CP15 && !(CPU_ARM610 || CPU_ARM710 || CPU_ARM720T || CPU_ARM740T || CPU_XSCALE || CPU_XSC3)
+ help
+ Say Y here to disable the processor instruction cache. Unless
+ you have a reason not to or are unsure, say N.
+
+config CPU_DCACHE_DISABLE
+ bool "Disable D-Cache (C-bit)"
+ depends on CPU_CP15
+ help
+ Say Y here to disable the processor data cache. Unless
+ you have a reason not to or are unsure, say N.
+
+config CPU_DCACHE_SIZE
+ hex
+ depends on CPU_ARM740T || CPU_ARM946E
+ default 0x00001000 if CPU_ARM740T
+ default 0x00002000 # default size for ARM946E-S
+ help
+ Some cores are synthesizable to have various sized cache. For
+ ARM946E-S case, it can vary from 0KB to 1MB.
+ To support such cache operations, it is efficient to know the size
+ before compile time.
+ If your SoC is configured to have a different size, define the value
+ here with proper conditions.
+
+config CPU_DCACHE_WRITETHROUGH
+ bool "Force write through D-cache"
+ depends on (CPU_ARM740T || CPU_ARM920T || CPU_ARM922T || CPU_ARM925T || CPU_ARM926T || CPU_ARM940T || CPU_ARM946E || CPU_ARM1020 || CPU_FA526) && !CPU_DCACHE_DISABLE
+ default y if CPU_ARM925T
+ help
+ Say Y here to use the data cache in writethrough mode. Unless you
+ specifically require this or are unsure, say N.
+
+config CPU_CACHE_ROUND_ROBIN
+ bool "Round robin I and D cache replacement algorithm"
+ depends on (CPU_ARM926T || CPU_ARM946E || CPU_ARM1020) && (!CPU_ICACHE_DISABLE || !CPU_DCACHE_DISABLE)
+ help
+ Say Y here to use the predictable round-robin cache replacement
+ policy. Unless you specifically require this or are unsure, say N.
+
+config CPU_BPREDICT_DISABLE
+ bool "Disable branch prediction"
+ depends on CPU_ARM1020 || CPU_V6 || CPU_V6K || CPU_MOHAWK || CPU_XSC3 || CPU_V7 || CPU_FA526
+ help
+ Say Y here to disable branch prediction. If unsure, say N.
+
+config TLS_REG_EMUL
+ bool
+ help
+ An SMP system using a pre-ARMv6 processor (there are apparently
+ a few prototypes like that in existence) and therefore access to
+ that required register must be emulated.
+
+config NEEDS_SYSCALL_FOR_CMPXCHG
+ bool
+ help
+ SMP on a pre-ARMv6 processor? Well OK then.
+ Forget about fast user space cmpxchg support.
+ It is just not possible.
+
+config DMA_CACHE_RWFO
+ bool "Enable read/write for ownership DMA cache maintenance"
+ depends on CPU_V6K && SMP
+ default y
+ help
+ The Snoop Control Unit on ARM11MPCore does not detect the
+ cache maintenance operations and the dma_{map,unmap}_area()
+ functions may leave stale cache entries on other CPUs. By
+ enabling this option, Read or Write For Ownership in the ARMv6
+ DMA cache maintenance functions is performed. These LDR/STR
+ instructions change the cache line state to shared or modified
+ so that the cache operation has the desired effect.
+
+ Note that the workaround is only valid on processors that do
+ not perform speculative loads into the D-cache. For such
+ processors, if cache maintenance operations are not broadcast
+ in hardware, other workarounds are needed (e.g. cache
+ maintenance broadcasting in software via FIQ).
+
+config OUTER_CACHE
+ bool
+
+config OUTER_CACHE_SYNC
+ bool
+ help
+ The outer cache has a outer_cache_fns.sync function pointer
+ that can be used to drain the write buffer of the outer cache.
+
+config CACHE_FEROCEON_L2
+ bool "Enable the Feroceon L2 cache controller"
+ depends on ARCH_KIRKWOOD || ARCH_MV78XX0
+ default y
+ select OUTER_CACHE
+ help
+ This option enables the Feroceon L2 cache controller.
+
+config CACHE_FEROCEON_L2_WRITETHROUGH
+ bool "Force Feroceon L2 cache write through"
+ depends on CACHE_FEROCEON_L2
+ help
+ Say Y here to use the Feroceon L2 cache in writethrough mode.
+ Unless you specifically require this, say N for writeback mode.
+
+config MIGHT_HAVE_CACHE_L2X0
+ bool
+ help
+ This option should be selected by machines which have a L2x0
+ or PL310 cache controller, but where its use is optional.
+
+ The only effect of this option is to make CACHE_L2X0 and
+ related options available to the user for configuration.
+
+ Boards or SoCs which always require the cache controller
+ support to be present should select CACHE_L2X0 directly
+ instead of this option, thus preventing the user from
+ inadvertently configuring a broken kernel.
+
+config CACHE_L2X0
+ bool "Enable the L2x0 outer cache controller" if MIGHT_HAVE_CACHE_L2X0
+ default MIGHT_HAVE_CACHE_L2X0
+ select OUTER_CACHE
+ select OUTER_CACHE_SYNC
+ help
+ This option enables the L2x0 PrimeCell.
+
+config CACHE_PL310
+ bool
+ depends on CACHE_L2X0
+ default y if CPU_V7 && !(CPU_V6 || CPU_V6K)
+ help
+ This option enables optimisations for the PL310 cache
+ controller.
+
+config CACHE_TAUROS2
+ bool "Enable the Tauros2 L2 cache controller"
+ depends on (ARCH_DOVE || ARCH_MMP || CPU_PJ4)
+ default y
+ select OUTER_CACHE
+ help
+ This option enables the Tauros2 L2 cache controller (as
+ found on PJ1/PJ4).
+
+config CACHE_XSC3L2
+ bool "Enable the L2 cache on XScale3"
+ depends on CPU_XSC3
+ default y
+ select OUTER_CACHE
+ help
+ This option enables the L2 cache on XScale3.
+
+config ARM_L1_CACHE_SHIFT_6
+ bool
+ default y if CPU_V7
+ help
+ Setting ARM L1 cache line size to 64 Bytes.
+
+config ARM_L1_CACHE_SHIFT
+ int
+ default 6 if ARM_L1_CACHE_SHIFT_6
+ default 5
+
+config ARM_DMA_MEM_BUFFERABLE
+ bool "Use non-cacheable memory for DMA" if (CPU_V6 || CPU_V6K) && !CPU_V7
+ depends on !(MACH_REALVIEW_PB1176 || REALVIEW_EB_ARM11MP || \
+ MACH_REALVIEW_PB11MP)
+ default y if CPU_V6 || CPU_V6K || CPU_V7
+ help
+ Historically, the kernel has used strongly ordered mappings to
+ provide DMA coherent memory. With the advent of ARMv7, mapping
+ memory with differing types results in unpredictable behaviour,
+ so on these CPUs, this option is forced on.
+
+ Multiple mappings with differing attributes is also unpredictable
+ on ARMv6 CPUs, but since they do not have aggressive speculative
+ prefetch, no harm appears to occur.
+
+ However, drivers may be missing the necessary barriers for ARMv6,
+ and therefore turning this on may result in unpredictable driver
+ behaviour. Therefore, we offer this as an option.
+
+ You are recommended say 'Y' here and debug any affected drivers.
+
+config ARCH_HAS_BARRIERS
+ bool
+ help
+ This option allows the use of custom mandatory barriers
+ included via the mach/barriers.h file.
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/Makefile b/ap/os/linux/linux-3.4.x/arch/arm/mm/Makefile
new file mode 100644
index 0000000..c046b92
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/Makefile
@@ -0,0 +1,116 @@
+#
+# Makefile for the linux arm-specific parts of the memory manager.
+#
+
+obj-y := dma-mapping.o extable.o fault.o init.o \
+ iomap.o
+
+obj-$(CONFIG_MMU) += fault-armv.o flush.o idmap.o ioremap.o \
+ mmap.o pgd.o mmu.o vmregion.o
+obj-$(CONFIG_DEBUG_RODATA) += rodata.o
+
+ifneq ($(CONFIG_MMU),y)
+obj-y += nommu.o
+endif
+
+obj-$(CONFIG_MODULES) += proc-syms.o
+
+obj-$(CONFIG_ALIGNMENT_TRAP) += alignment.o
+obj-$(CONFIG_HIGHMEM) += highmem.o
+
+obj-$(CONFIG_CPU_ABRT_NOMMU) += abort-nommu.o
+obj-$(CONFIG_CPU_ABRT_EV4) += abort-ev4.o
+obj-$(CONFIG_CPU_ABRT_EV4T) += abort-ev4t.o
+obj-$(CONFIG_CPU_ABRT_LV4T) += abort-lv4t.o
+obj-$(CONFIG_CPU_ABRT_EV5T) += abort-ev5t.o
+obj-$(CONFIG_CPU_ABRT_EV5TJ) += abort-ev5tj.o
+obj-$(CONFIG_CPU_ABRT_EV6) += abort-ev6.o
+obj-$(CONFIG_CPU_ABRT_EV7) += abort-ev7.o
+
+AFLAGS_abort-ev6.o :=-Wa,-march=armv6k
+AFLAGS_abort-ev7.o :=-Wa,-march=armv7-a
+
+obj-$(CONFIG_CPU_PABRT_LEGACY) += pabort-legacy.o
+obj-$(CONFIG_CPU_PABRT_V6) += pabort-v6.o
+obj-$(CONFIG_CPU_PABRT_V7) += pabort-v7.o
+
+obj-$(CONFIG_CPU_CACHE_V3) += cache-v3.o
+obj-$(CONFIG_CPU_CACHE_V4) += cache-v4.o
+obj-$(CONFIG_CPU_CACHE_V4WT) += cache-v4wt.o
+obj-$(CONFIG_CPU_CACHE_V4WB) += cache-v4wb.o
+obj-$(CONFIG_CPU_CACHE_V6) += cache-v6.o
+obj-$(CONFIG_CPU_CACHE_V7) += cache-v7.o
+obj-$(CONFIG_CPU_CACHE_FA) += cache-fa.o
+
+AFLAGS_cache-v6.o :=-Wa,-march=armv6
+AFLAGS_cache-v7.o :=-Wa,-march=armv7-a
+
+obj-$(CONFIG_CPU_COPY_V3) += copypage-v3.o
+obj-$(CONFIG_CPU_COPY_V4WT) += copypage-v4wt.o
+obj-$(CONFIG_CPU_COPY_V4WB) += copypage-v4wb.o
+obj-$(CONFIG_CPU_COPY_FEROCEON) += copypage-feroceon.o
+obj-$(CONFIG_CPU_COPY_V6) += copypage-v6.o context.o
+obj-$(CONFIG_CPU_SA1100) += copypage-v4mc.o
+obj-$(CONFIG_CPU_XSCALE) += copypage-xscale.o
+obj-$(CONFIG_CPU_XSC3) += copypage-xsc3.o
+obj-$(CONFIG_CPU_COPY_FA) += copypage-fa.o
+
+obj-$(CONFIG_CPU_TLB_V3) += tlb-v3.o
+obj-$(CONFIG_CPU_TLB_V4WT) += tlb-v4.o
+obj-$(CONFIG_CPU_TLB_V4WB) += tlb-v4wb.o
+obj-$(CONFIG_CPU_TLB_V4WBI) += tlb-v4wbi.o
+obj-$(CONFIG_CPU_TLB_FEROCEON) += tlb-v4wbi.o # reuse v4wbi TLB functions
+obj-$(CONFIG_CPU_TLB_V6) += tlb-v6.o
+obj-$(CONFIG_CPU_TLB_V7) += tlb-v7.o
+obj-$(CONFIG_CPU_TLB_FA) += tlb-fa.o
+
+AFLAGS_tlb-v6.o :=-Wa,-march=armv6
+AFLAGS_tlb-v7.o :=-Wa,-march=armv7-a
+
+obj-$(CONFIG_CPU_ARM610) += proc-arm6_7.o
+obj-$(CONFIG_CPU_ARM710) += proc-arm6_7.o
+obj-$(CONFIG_CPU_ARM7TDMI) += proc-arm7tdmi.o
+obj-$(CONFIG_CPU_ARM720T) += proc-arm720.o
+obj-$(CONFIG_CPU_ARM740T) += proc-arm740.o
+obj-$(CONFIG_CPU_ARM9TDMI) += proc-arm9tdmi.o
+obj-$(CONFIG_CPU_ARM920T) += proc-arm920.o
+obj-$(CONFIG_CPU_ARM922T) += proc-arm922.o
+obj-$(CONFIG_CPU_ARM925T) += proc-arm925.o
+obj-$(CONFIG_CPU_ARM926T) += proc-arm926.o
+obj-$(CONFIG_CPU_ARM940T) += proc-arm940.o
+obj-$(CONFIG_CPU_ARM946E) += proc-arm946.o
+obj-$(CONFIG_CPU_FA526) += proc-fa526.o
+obj-$(CONFIG_CPU_ARM1020) += proc-arm1020.o
+obj-$(CONFIG_CPU_ARM1020E) += proc-arm1020e.o
+obj-$(CONFIG_CPU_ARM1022) += proc-arm1022.o
+obj-$(CONFIG_CPU_ARM1026) += proc-arm1026.o
+obj-$(CONFIG_CPU_SA110) += proc-sa110.o
+obj-$(CONFIG_CPU_SA1100) += proc-sa1100.o
+obj-$(CONFIG_CPU_XSCALE) += proc-xscale.o
+obj-$(CONFIG_CPU_XSC3) += proc-xsc3.o
+obj-$(CONFIG_CPU_MOHAWK) += proc-mohawk.o
+obj-$(CONFIG_CPU_FEROCEON) += proc-feroceon.o
+obj-$(CONFIG_CPU_V6) += proc-v6.o
+obj-$(CONFIG_CPU_V6K) += proc-v6.o
+obj-$(CONFIG_CPU_V7) += proc-v7.o
+
+AFLAGS_proc-v6.o :=-Wa,-march=armv6
+AFLAGS_proc-v7.o :=-Wa,-march=armv7-a
+
+obj-$(CONFIG_CACHE_FEROCEON_L2) += cache-feroceon-l2.o
+obj-$(CONFIG_CACHE_L2X0) += cache-l2x0.o
+obj-$(CONFIG_CACHE_XSC3L2) += cache-xsc3l2.o
+obj-$(CONFIG_CACHE_TAUROS2) += cache-tauros2.o
+
+ifeq ($(CONFIG_CPU_V7),y)
+ifeq ($(CONFIG_ARCH_ZX297520V2),y)
+ccflags-y += -D__USE_ARCH_ZX297520V2__
+endif
+ifeq ($(CONFIG_MMU),y)
+ccflags-y += -D__USE_MMU__
+endif
+ccflags-y += -D_OS_LINUX
+ccflags-y += -I$(srctree)/include/linux/ramdump
+obj-$(CONFIG_RAMDUMP) += ramdump_v7.o
+obj-$(CONFIG_RAMDUMP) += ramdump_v7_asm.o
+endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev4.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev4.S
new file mode 100644
index 0000000..54473cd
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev4.S
@@ -0,0 +1,25 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+/*
+ * Function: v4_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ * Note: we read user space. This means we might cause a data
+ * abort here if the I-TLB and D-TLB aren't seeing the same
+ * picture. Unfortunately, this does happen. We live with it.
+ */
+ .align 5
+ENTRY(v4_early_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ ldr r3, [r4] @ read aborted ARM instruction
+ bic r1, r1, #1 << 11 | 1 << 10 @ clear bits 11 and 10 of FSR
+ tst r3, #1 << 20 @ L = 1 -> write?
+ orreq r1, r1, #1 << 11 @ yes.
+ b do_DataAbort
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev4t.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev4t.S
new file mode 100644
index 0000000..9da704e
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev4t.S
@@ -0,0 +1,27 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include "abort-macro.S"
+/*
+ * Function: v4t_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ * Note: we read user space. This means we might cause a data
+ * abort here if the I-TLB and D-TLB aren't seeing the same
+ * picture. Unfortunately, this does happen. We live with it.
+ */
+ .align 5
+ENTRY(v4t_early_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ do_thumb_abort fsr=r1, pc=r4, psr=r5, tmp=r3
+ ldreq r3, [r4] @ read aborted ARM instruction
+ bic r1, r1, #1 << 11 | 1 << 10 @ clear bits 11 and 10 of FSR
+ tst r3, #1 << 20 @ check write
+ orreq r1, r1, #1 << 11
+ b do_DataAbort
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev5t.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev5t.S
new file mode 100644
index 0000000..a0908d4
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev5t.S
@@ -0,0 +1,28 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include "abort-macro.S"
+/*
+ * Function: v5t_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ * Note: we read user space. This means we might cause a data
+ * abort here if the I-TLB and D-TLB aren't seeing the same
+ * picture. Unfortunately, this does happen. We live with it.
+ */
+ .align 5
+ENTRY(v5t_early_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ do_thumb_abort fsr=r1, pc=r4, psr=r5, tmp=r3
+ ldreq r3, [r4] @ read aborted ARM instruction
+ bic r1, r1, #1 << 11 @ clear bits 11 of FSR
+ do_ldrd_abort tmp=ip, insn=r3
+ tst r3, #1 << 20 @ check write
+ orreq r1, r1, #1 << 11
+ b do_DataAbort
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev5tj.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev5tj.S
new file mode 100644
index 0000000..4006b7a
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev5tj.S
@@ -0,0 +1,30 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include "abort-macro.S"
+/*
+ * Function: v5tj_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ * Note: we read user space. This means we might cause a data
+ * abort here if the I-TLB and D-TLB aren't seeing the same
+ * picture. Unfortunately, this does happen. We live with it.
+ */
+ .align 5
+ENTRY(v5tj_early_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ bic r1, r1, #1 << 11 | 1 << 10 @ clear bits 11 and 10 of FSR
+ tst r5, #PSR_J_BIT @ Java?
+ bne do_DataAbort
+ do_thumb_abort fsr=r1, pc=r4, psr=r5, tmp=r3
+ ldreq r3, [r4] @ read aborted ARM instruction
+ do_ldrd_abort tmp=ip, insn=r3
+ tst r3, #1 << 20 @ L = 0 -> write
+ orreq r1, r1, #1 << 11 @ yes.
+ b do_DataAbort
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev6.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev6.S
new file mode 100644
index 0000000..5d777a5
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev6.S
@@ -0,0 +1,42 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include "abort-macro.S"
+/*
+ * Function: v6_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ * Note: we read user space. This means we might cause a data
+ * abort here if the I-TLB and D-TLB aren't seeing the same
+ * picture. Unfortunately, this does happen. We live with it.
+ */
+ .align 5
+ENTRY(v6_early_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+/*
+ * Faulty SWP instruction on 1136 doesn't set bit 11 in DFSR.
+ */
+#ifdef CONFIG_ARM_ERRATA_326103
+ ldr ip, =0x4107b36
+ mrc p15, 0, r3, c0, c0, 0 @ get processor id
+ teq ip, r3, lsr #4 @ r0 ARM1136?
+ bne do_DataAbort
+ tst r5, #PSR_J_BIT @ Java?
+ tsteq r5, #PSR_T_BIT @ Thumb?
+ bne do_DataAbort
+ bic r1, r1, #1 << 11 @ clear bit 11 of FSR
+ ldr r3, [r4] @ read aborted ARM instruction
+#ifdef CONFIG_CPU_ENDIAN_BE8
+ rev r3, r3
+#endif
+ do_ldrd_abort tmp=ip, insn=r3
+ tst r3, #1 << 20 @ L = 0 -> write
+ orreq r1, r1, #1 << 11 @ yes.
+#endif
+ b do_DataAbort
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev7.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev7.S
new file mode 100644
index 0000000..4812ad0
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-ev7.S
@@ -0,0 +1,45 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+/*
+ * Function: v7_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ */
+ .align 5
+ENTRY(v7_early_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+
+ /*
+ * V6 code adjusts the returned DFSR.
+ * New designs should not need to patch up faults.
+ */
+
+#if defined(CONFIG_VERIFY_PERMISSION_FAULT)
+ /*
+ * Detect erroneous permission failures and fix
+ */
+ ldr r3, =0x40d @ On permission fault
+ and r3, r1, r3
+ cmp r3, #0x0d
+ bne do_DataAbort
+
+ mcr p15, 0, r0, c7, c8, 0 @ Retranslate FAR
+ isb
+ mrc p15, 0, ip, c7, c4, 0 @ Read the PAR
+ and r3, ip, #0x7b @ On translation fault
+ cmp r3, #0x0b
+ bne do_DataAbort
+ bic r1, r1, #0xf @ Fix up FSR FS[5:0]
+ and ip, ip, #0x7e
+ orr r1, r1, ip, LSR #1
+#endif
+
+ b do_DataAbort
+ENDPROC(v7_early_abort)
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-lv4t.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-lv4t.S
new file mode 100644
index 0000000..f398258
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-lv4t.S
@@ -0,0 +1,220 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+/*
+ * Function: v4t_late_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4-r5, r10-r11, r13 preserved
+ *
+ * Purpose : obtain information about current aborted instruction.
+ * Note: we read user space. This means we might cause a data
+ * abort here if the I-TLB and D-TLB aren't seeing the same
+ * picture. Unfortunately, this does happen. We live with it.
+ */
+ENTRY(v4t_late_abort)
+ tst r5, #PSR_T_BIT @ check for thumb mode
+#ifdef CONFIG_CPU_CP15_MMU
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ bic r1, r1, #1 << 11 | 1 << 10 @ clear bits 11 and 10 of FSR
+#else
+ mov r0, #0 @ clear r0, r1 (no FSR/FAR)
+ mov r1, #0
+#endif
+ bne .data_thumb_abort
+ ldr r8, [r4] @ read arm instruction
+ tst r8, #1 << 20 @ L = 1 -> write?
+ orreq r1, r1, #1 << 11 @ yes.
+ and r7, r8, #15 << 24
+ add pc, pc, r7, lsr #22 @ Now branch to the relevant processing routine
+ nop
+
+/* 0 */ b .data_arm_lateldrhpost @ ldrh rd, [rn], #m/rm
+/* 1 */ b .data_arm_lateldrhpre @ ldrh rd, [rn, #m/rm]
+/* 2 */ b .data_unknown
+/* 3 */ b .data_unknown
+/* 4 */ b .data_arm_lateldrpostconst @ ldr rd, [rn], #m
+/* 5 */ b .data_arm_lateldrpreconst @ ldr rd, [rn, #m]
+/* 6 */ b .data_arm_lateldrpostreg @ ldr rd, [rn], rm
+/* 7 */ b .data_arm_lateldrprereg @ ldr rd, [rn, rm]
+/* 8 */ b .data_arm_ldmstm @ ldm*a rn, <rlist>
+/* 9 */ b .data_arm_ldmstm @ ldm*b rn, <rlist>
+/* a */ b .data_unknown
+/* b */ b .data_unknown
+/* c */ b do_DataAbort @ ldc rd, [rn], #m @ Same as ldr rd, [rn], #m
+/* d */ b do_DataAbort @ ldc rd, [rn, #m]
+/* e */ b .data_unknown
+/* f */
+.data_unknown: @ Part of jumptable
+ mov r0, r4
+ mov r1, r8
+ b baddataabort
+
+.data_arm_ldmstm:
+ tst r8, #1 << 21 @ check writeback bit
+ beq do_DataAbort @ no writeback -> no fixup
+ mov r7, #0x11
+ orr r7, r7, #0x1100
+ and r6, r8, r7
+ and r9, r8, r7, lsl #1
+ add r6, r6, r9, lsr #1
+ and r9, r8, r7, lsl #2
+ add r6, r6, r9, lsr #2
+ and r9, r8, r7, lsl #3
+ add r6, r6, r9, lsr #3
+ add r6, r6, r6, lsr #8
+ add r6, r6, r6, lsr #4
+ and r6, r6, #15 @ r6 = no. of registers to transfer.
+ and r9, r8, #15 << 16 @ Extract 'n' from instruction
+ ldr r7, [r2, r9, lsr #14] @ Get register 'Rn'
+ tst r8, #1 << 23 @ Check U bit
+ subne r7, r7, r6, lsl #2 @ Undo increment
+ addeq r7, r7, r6, lsl #2 @ Undo decrement
+ str r7, [r2, r9, lsr #14] @ Put register 'Rn'
+ b do_DataAbort
+
+.data_arm_lateldrhpre:
+ tst r8, #1 << 21 @ Check writeback bit
+ beq do_DataAbort @ No writeback -> no fixup
+.data_arm_lateldrhpost:
+ and r9, r8, #0x00f @ get Rm / low nibble of immediate value
+ tst r8, #1 << 22 @ if (immediate offset)
+ andne r6, r8, #0xf00 @ { immediate high nibble
+ orrne r6, r9, r6, lsr #4 @ combine nibbles } else
+ ldreq r6, [r2, r9, lsl #2] @ { load Rm value }
+.data_arm_apply_r6_and_rn:
+ and r9, r8, #15 << 16 @ Extract 'n' from instruction
+ ldr r7, [r2, r9, lsr #14] @ Get register 'Rn'
+ tst r8, #1 << 23 @ Check U bit
+ subne r7, r7, r6 @ Undo incrmenet
+ addeq r7, r7, r6 @ Undo decrement
+ str r7, [r2, r9, lsr #14] @ Put register 'Rn'
+ b do_DataAbort
+
+.data_arm_lateldrpreconst:
+ tst r8, #1 << 21 @ check writeback bit
+ beq do_DataAbort @ no writeback -> no fixup
+.data_arm_lateldrpostconst:
+ movs r6, r8, lsl #20 @ Get offset
+ beq do_DataAbort @ zero -> no fixup
+ and r9, r8, #15 << 16 @ Extract 'n' from instruction
+ ldr r7, [r2, r9, lsr #14] @ Get register 'Rn'
+ tst r8, #1 << 23 @ Check U bit
+ subne r7, r7, r6, lsr #20 @ Undo increment
+ addeq r7, r7, r6, lsr #20 @ Undo decrement
+ str r7, [r2, r9, lsr #14] @ Put register 'Rn'
+ b do_DataAbort
+
+.data_arm_lateldrprereg:
+ tst r8, #1 << 21 @ check writeback bit
+ beq do_DataAbort @ no writeback -> no fixup
+.data_arm_lateldrpostreg:
+ and r7, r8, #15 @ Extract 'm' from instruction
+ ldr r6, [r2, r7, lsl #2] @ Get register 'Rm'
+ mov r9, r8, lsr #7 @ get shift count
+ ands r9, r9, #31
+ and r7, r8, #0x70 @ get shift type
+ orreq r7, r7, #8 @ shift count = 0
+ add pc, pc, r7
+ nop
+
+ mov r6, r6, lsl r9 @ 0: LSL #!0
+ b .data_arm_apply_r6_and_rn
+ b .data_arm_apply_r6_and_rn @ 1: LSL #0
+ nop
+ b .data_unknown @ 2: MUL?
+ nop
+ b .data_unknown @ 3: MUL?
+ nop
+ mov r6, r6, lsr r9 @ 4: LSR #!0
+ b .data_arm_apply_r6_and_rn
+ mov r6, r6, lsr #32 @ 5: LSR #32
+ b .data_arm_apply_r6_and_rn
+ b .data_unknown @ 6: MUL?
+ nop
+ b .data_unknown @ 7: MUL?
+ nop
+ mov r6, r6, asr r9 @ 8: ASR #!0
+ b .data_arm_apply_r6_and_rn
+ mov r6, r6, asr #32 @ 9: ASR #32
+ b .data_arm_apply_r6_and_rn
+ b .data_unknown @ A: MUL?
+ nop
+ b .data_unknown @ B: MUL?
+ nop
+ mov r6, r6, ror r9 @ C: ROR #!0
+ b .data_arm_apply_r6_and_rn
+ mov r6, r6, rrx @ D: RRX
+ b .data_arm_apply_r6_and_rn
+ b .data_unknown @ E: MUL?
+ nop
+ b .data_unknown @ F: MUL?
+
+.data_thumb_abort:
+ ldrh r8, [r4] @ read instruction
+ tst r8, #1 << 11 @ L = 1 -> write?
+ orreq r1, r1, #1 << 8 @ yes
+ and r7, r8, #15 << 12
+ add pc, pc, r7, lsr #10 @ lookup in table
+ nop
+
+/* 0 */ b .data_unknown
+/* 1 */ b .data_unknown
+/* 2 */ b .data_unknown
+/* 3 */ b .data_unknown
+/* 4 */ b .data_unknown
+/* 5 */ b .data_thumb_reg
+/* 6 */ b do_DataAbort
+/* 7 */ b do_DataAbort
+/* 8 */ b do_DataAbort
+/* 9 */ b do_DataAbort
+/* A */ b .data_unknown
+/* B */ b .data_thumb_pushpop
+/* C */ b .data_thumb_ldmstm
+/* D */ b .data_unknown
+/* E */ b .data_unknown
+/* F */ b .data_unknown
+
+.data_thumb_reg:
+ tst r8, #1 << 9
+ beq do_DataAbort
+ tst r8, #1 << 10 @ If 'S' (signed) bit is set
+ movne r1, #0 @ it must be a load instr
+ b do_DataAbort
+
+.data_thumb_pushpop:
+ tst r8, #1 << 10
+ beq .data_unknown
+ and r6, r8, #0x55 @ hweight8(r8) + R bit
+ and r9, r8, #0xaa
+ add r6, r6, r9, lsr #1
+ and r9, r6, #0xcc
+ and r6, r6, #0x33
+ add r6, r6, r9, lsr #2
+ movs r7, r8, lsr #9 @ C = r8 bit 8 (R bit)
+ adc r6, r6, r6, lsr #4 @ high + low nibble + R bit
+ and r6, r6, #15 @ number of regs to transfer
+ ldr r7, [r2, #13 << 2]
+ tst r8, #1 << 11
+ addeq r7, r7, r6, lsl #2 @ increment SP if PUSH
+ subne r7, r7, r6, lsl #2 @ decrement SP if POP
+ str r7, [r2, #13 << 2]
+ b do_DataAbort
+
+.data_thumb_ldmstm:
+ and r6, r8, #0x55 @ hweight8(r8)
+ and r9, r8, #0xaa
+ add r6, r6, r9, lsr #1
+ and r9, r6, #0xcc
+ and r6, r6, #0x33
+ add r6, r6, r9, lsr #2
+ add r6, r6, r6, lsr #4
+ and r9, r8, #7 << 8
+ ldr r7, [r2, r9, lsr #6]
+ and r6, r6, #15 @ number of regs to transfer
+ sub r7, r7, r6, lsl #2 @ always decrement
+ str r7, [r2, r9, lsr #6]
+ b do_DataAbort
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-macro.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-macro.S
new file mode 100644
index 0000000..2cbf68e
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-macro.S
@@ -0,0 +1,40 @@
+/*
+ * The ARM LDRD and Thumb LDRSB instructions use bit 20/11 (ARM/Thumb)
+ * differently than every other instruction, so it is set to 0 (write)
+ * even though the instructions are read instructions. This means that
+ * during an abort the instructions will be treated as a write and the
+ * handler will raise a signal from unwriteable locations if they
+ * fault. We have to specifically check for these instructions
+ * from the abort handlers to treat them properly.
+ *
+ */
+
+ .macro do_thumb_abort, fsr, pc, psr, tmp
+ tst \psr, #PSR_T_BIT
+ beq not_thumb
+ ldrh \tmp, [\pc] @ Read aborted Thumb instruction
+ and \tmp, \tmp, # 0xfe00 @ Mask opcode field
+ cmp \tmp, # 0x5600 @ Is it ldrsb?
+ orreq \tmp, \tmp, #1 << 11 @ Set L-bit if yes
+ tst \tmp, #1 << 11 @ L = 0 -> write
+ orreq \fsr, \fsr, #1 << 11 @ yes.
+ b do_DataAbort
+not_thumb:
+ .endm
+
+/*
+ * We check for the following instruction encoding for LDRD.
+ *
+ * [27:25] == 000
+ * [7:4] == 1101
+ * [20] == 0
+ */
+ .macro do_ldrd_abort, tmp, insn
+ tst \insn, #0x0e100000 @ [27:25,20] == 0
+ bne not_ldrd
+ and \tmp, \insn, #0x000000f0 @ [7:4] == 1101
+ cmp \tmp, #0x000000d0
+ beq do_DataAbort
+not_ldrd:
+ .endm
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-nommu.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-nommu.S
new file mode 100644
index 0000000..119cb47
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/abort-nommu.S
@@ -0,0 +1,20 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+/*
+ * Function: nommu_early_abort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Note: There is no FSR/FAR on !CPU_CP15_MMU cores.
+ * Just fill zero into the registers.
+ */
+ .align 5
+ENTRY(nommu_early_abort)
+ mov r0, #0 @ clear r0, r1 (no FSR/FAR)
+ mov r1, #0
+ b do_DataAbort
+ENDPROC(nommu_early_abort)
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/alignment.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/alignment.c
new file mode 100644
index 0000000..17f4ea2
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/alignment.c
@@ -0,0 +1,990 @@
+/*
+ * linux/arch/arm/mm/alignment.c
+ *
+ * Copyright (C) 1995 Linus Torvalds
+ * Modifications for ARM processor (c) 1995-2001 Russell King
+ * Thumb alignment fault fixups (c) 2004 MontaVista Software, Inc.
+ * - Adapted from gdb/sim/arm/thumbemu.c -- Thumb instruction emulation.
+ * Copyright (C) 1996, Cygnus Software Technologies Ltd.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/moduleparam.h>
+#include <linux/compiler.h>
+#include <linux/kernel.h>
+#include <linux/errno.h>
+#include <linux/string.h>
+#include <linux/proc_fs.h>
+#include <linux/seq_file.h>
+#include <linux/init.h>
+#include <linux/sched.h>
+#include <linux/uaccess.h>
+
+#include <asm/cp15.h>
+#include <asm/system_info.h>
+#include <asm/unaligned.h>
+
+#include "fault.h"
+
+/*
+ * 32-bit misaligned trap handler (c) 1998 San Mehat (CCC) -July 1998
+ * /proc/sys/debug/alignment, modified and integrated into
+ * Linux 2.1 by Russell King
+ *
+ * Speed optimisations and better fault handling by Russell King.
+ *
+ * *** NOTE ***
+ * This code is not portable to processors with late data abort handling.
+ */
+#define CODING_BITS(i) (i & 0x0e000000)
+#define COND_BITS(i) (i & 0xf0000000)
+
+#define LDST_I_BIT(i) (i & (1 << 26)) /* Immediate constant */
+#define LDST_P_BIT(i) (i & (1 << 24)) /* Preindex */
+#define LDST_U_BIT(i) (i & (1 << 23)) /* Add offset */
+#define LDST_W_BIT(i) (i & (1 << 21)) /* Writeback */
+#define LDST_L_BIT(i) (i & (1 << 20)) /* Load */
+
+#define LDST_P_EQ_U(i) ((((i) ^ ((i) >> 1)) & (1 << 23)) == 0)
+
+#define LDSTHD_I_BIT(i) (i & (1 << 22)) /* double/half-word immed */
+#define LDM_S_BIT(i) (i & (1 << 22)) /* write CPSR from SPSR */
+
+#define RN_BITS(i) ((i >> 16) & 15) /* Rn */
+#define RD_BITS(i) ((i >> 12) & 15) /* Rd */
+#define RM_BITS(i) (i & 15) /* Rm */
+
+#define REGMASK_BITS(i) (i & 0xffff)
+#define OFFSET_BITS(i) (i & 0x0fff)
+
+#define IS_SHIFT(i) (i & 0x0ff0)
+#define SHIFT_BITS(i) ((i >> 7) & 0x1f)
+#define SHIFT_TYPE(i) (i & 0x60)
+#define SHIFT_LSL 0x00
+#define SHIFT_LSR 0x20
+#define SHIFT_ASR 0x40
+#define SHIFT_RORRRX 0x60
+
+#define BAD_INSTR 0xdeadc0de
+
+/* Thumb-2 32 bit format per ARMv7 DDI0406A A6.3, either f800h,e800h,f800h */
+#define IS_T32(hi16) \
+ (((hi16) & 0xe000) == 0xe000 && ((hi16) & 0x1800))
+
+static unsigned long ai_user;
+static unsigned long ai_sys;
+static unsigned long ai_skipped;
+static unsigned long ai_half;
+static unsigned long ai_word;
+static unsigned long ai_dword;
+static unsigned long ai_multi;
+static int ai_usermode;
+
+core_param(alignment, ai_usermode, int, 0600);
+
+#define UM_WARN (1 << 0)
+#define UM_FIXUP (1 << 1)
+#define UM_SIGNAL (1 << 2)
+
+/* Return true if and only if the ARMv6 unaligned access model is in use. */
+static bool cpu_is_v6_unaligned(void)
+{
+ return cpu_architecture() >= CPU_ARCH_ARMv6 && (cr_alignment & CR_U);
+}
+
+static int safe_usermode(int new_usermode, bool warn)
+{
+ /*
+ * ARMv6 and later CPUs can perform unaligned accesses for
+ * most single load and store instructions up to word size.
+ * LDM, STM, LDRD and STRD still need to be handled.
+ *
+ * Ignoring the alignment fault is not an option on these
+ * CPUs since we spin re-faulting the instruction without
+ * making any progress.
+ */
+ if (cpu_is_v6_unaligned() && !(new_usermode & (UM_FIXUP | UM_SIGNAL))) {
+ new_usermode |= UM_FIXUP;
+
+ if (warn)
+ printk(KERN_WARNING "alignment: ignoring faults is unsafe on this CPU. Defaulting to fixup mode.\n");
+ }
+
+ return new_usermode;
+}
+
+#ifdef CONFIG_PROC_FS
+static const char *usermode_action[] = {
+ "ignored",
+ "warn",
+ "fixup",
+ "fixup+warn",
+ "signal",
+ "signal+warn"
+};
+
+static int alignment_proc_show(struct seq_file *m, void *v)
+{
+ seq_printf(m, "User:\t\t%lu\n", ai_user);
+ seq_printf(m, "System:\t\t%lu\n", ai_sys);
+ seq_printf(m, "Skipped:\t%lu\n", ai_skipped);
+ seq_printf(m, "Half:\t\t%lu\n", ai_half);
+ seq_printf(m, "Word:\t\t%lu\n", ai_word);
+ if (cpu_architecture() >= CPU_ARCH_ARMv5TE)
+ seq_printf(m, "DWord:\t\t%lu\n", ai_dword);
+ seq_printf(m, "Multi:\t\t%lu\n", ai_multi);
+ seq_printf(m, "User faults:\t%i (%s)\n", ai_usermode,
+ usermode_action[ai_usermode]);
+
+ return 0;
+}
+
+static int alignment_proc_open(struct inode *inode, struct file *file)
+{
+ return single_open(file, alignment_proc_show, NULL);
+}
+
+static ssize_t alignment_proc_write(struct file *file, const char __user *buffer,
+ size_t count, loff_t *pos)
+{
+ char mode;
+
+ if (count > 0) {
+ if (get_user(mode, buffer))
+ return -EFAULT;
+ if (mode >= '0' && mode <= '5')
+ ai_usermode = safe_usermode(mode - '0', true);
+ }
+ return count;
+}
+
+static const struct file_operations alignment_proc_fops = {
+ .open = alignment_proc_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = single_release,
+ .write = alignment_proc_write,
+};
+#endif /* CONFIG_PROC_FS */
+
+union offset_union {
+ unsigned long un;
+ signed long sn;
+};
+
+#define TYPE_ERROR 0
+#define TYPE_FAULT 1
+#define TYPE_LDST 2
+#define TYPE_DONE 3
+
+#ifdef __ARMEB__
+#define BE 1
+#define FIRST_BYTE_16 "mov %1, %1, ror #8\n"
+#define FIRST_BYTE_32 "mov %1, %1, ror #24\n"
+#define NEXT_BYTE "ror #24"
+#else
+#define BE 0
+#define FIRST_BYTE_16
+#define FIRST_BYTE_32
+#define NEXT_BYTE "lsr #8"
+#endif
+
+#define __get8_unaligned_check(ins,val,addr,err) \
+ __asm__( \
+ ARM( "1: "ins" %1, [%2], #1\n" ) \
+ THUMB( "1: "ins" %1, [%2]\n" ) \
+ THUMB( " add %2, %2, #1\n" ) \
+ "2:\n" \
+ " .pushsection .fixup,\"ax\"\n" \
+ " .align 2\n" \
+ "3: mov %0, #1\n" \
+ " b 2b\n" \
+ " .popsection\n" \
+ " .pushsection __ex_table,\"a\"\n" \
+ " .align 3\n" \
+ " .long 1b, 3b\n" \
+ " .popsection\n" \
+ : "=r" (err), "=&r" (val), "=r" (addr) \
+ : "0" (err), "2" (addr))
+
+#define __get16_unaligned_check(ins,val,addr) \
+ do { \
+ unsigned int err = 0, v, a = addr; \
+ __get8_unaligned_check(ins,v,a,err); \
+ val = v << ((BE) ? 8 : 0); \
+ __get8_unaligned_check(ins,v,a,err); \
+ val |= v << ((BE) ? 0 : 8); \
+ if (err) \
+ goto fault; \
+ } while (0)
+
+#define get16_unaligned_check(val,addr) \
+ __get16_unaligned_check("ldrb",val,addr)
+
+#define get16t_unaligned_check(val,addr) \
+ __get16_unaligned_check("ldrbt",val,addr)
+
+#define __get32_unaligned_check(ins,val,addr) \
+ do { \
+ unsigned int err = 0, v, a = addr; \
+ __get8_unaligned_check(ins,v,a,err); \
+ val = v << ((BE) ? 24 : 0); \
+ __get8_unaligned_check(ins,v,a,err); \
+ val |= v << ((BE) ? 16 : 8); \
+ __get8_unaligned_check(ins,v,a,err); \
+ val |= v << ((BE) ? 8 : 16); \
+ __get8_unaligned_check(ins,v,a,err); \
+ val |= v << ((BE) ? 0 : 24); \
+ if (err) \
+ goto fault; \
+ } while (0)
+
+#define get32_unaligned_check(val,addr) \
+ __get32_unaligned_check("ldrb",val,addr)
+
+#define get32t_unaligned_check(val,addr) \
+ __get32_unaligned_check("ldrbt",val,addr)
+
+#define __put16_unaligned_check(ins,val,addr) \
+ do { \
+ unsigned int err = 0, v = val, a = addr; \
+ __asm__( FIRST_BYTE_16 \
+ ARM( "1: "ins" %1, [%2], #1\n" ) \
+ THUMB( "1: "ins" %1, [%2]\n" ) \
+ THUMB( " add %2, %2, #1\n" ) \
+ " mov %1, %1, "NEXT_BYTE"\n" \
+ "2: "ins" %1, [%2]\n" \
+ "3:\n" \
+ " .pushsection .fixup,\"ax\"\n" \
+ " .align 2\n" \
+ "4: mov %0, #1\n" \
+ " b 3b\n" \
+ " .popsection\n" \
+ " .pushsection __ex_table,\"a\"\n" \
+ " .align 3\n" \
+ " .long 1b, 4b\n" \
+ " .long 2b, 4b\n" \
+ " .popsection\n" \
+ : "=r" (err), "=&r" (v), "=&r" (a) \
+ : "0" (err), "1" (v), "2" (a)); \
+ if (err) \
+ goto fault; \
+ } while (0)
+
+#define put16_unaligned_check(val,addr) \
+ __put16_unaligned_check("strb",val,addr)
+
+#define put16t_unaligned_check(val,addr) \
+ __put16_unaligned_check("strbt",val,addr)
+
+#define __put32_unaligned_check(ins,val,addr) \
+ do { \
+ unsigned int err = 0, v = val, a = addr; \
+ __asm__( FIRST_BYTE_32 \
+ ARM( "1: "ins" %1, [%2], #1\n" ) \
+ THUMB( "1: "ins" %1, [%2]\n" ) \
+ THUMB( " add %2, %2, #1\n" ) \
+ " mov %1, %1, "NEXT_BYTE"\n" \
+ ARM( "2: "ins" %1, [%2], #1\n" ) \
+ THUMB( "2: "ins" %1, [%2]\n" ) \
+ THUMB( " add %2, %2, #1\n" ) \
+ " mov %1, %1, "NEXT_BYTE"\n" \
+ ARM( "3: "ins" %1, [%2], #1\n" ) \
+ THUMB( "3: "ins" %1, [%2]\n" ) \
+ THUMB( " add %2, %2, #1\n" ) \
+ " mov %1, %1, "NEXT_BYTE"\n" \
+ "4: "ins" %1, [%2]\n" \
+ "5:\n" \
+ " .pushsection .fixup,\"ax\"\n" \
+ " .align 2\n" \
+ "6: mov %0, #1\n" \
+ " b 5b\n" \
+ " .popsection\n" \
+ " .pushsection __ex_table,\"a\"\n" \
+ " .align 3\n" \
+ " .long 1b, 6b\n" \
+ " .long 2b, 6b\n" \
+ " .long 3b, 6b\n" \
+ " .long 4b, 6b\n" \
+ " .popsection\n" \
+ : "=r" (err), "=&r" (v), "=&r" (a) \
+ : "0" (err), "1" (v), "2" (a)); \
+ if (err) \
+ goto fault; \
+ } while (0)
+
+#define put32_unaligned_check(val,addr) \
+ __put32_unaligned_check("strb", val, addr)
+
+#define put32t_unaligned_check(val,addr) \
+ __put32_unaligned_check("strbt", val, addr)
+
+static void
+do_alignment_finish_ldst(unsigned long addr, unsigned long instr, struct pt_regs *regs, union offset_union offset)
+{
+ if (!LDST_U_BIT(instr))
+ offset.un = -offset.un;
+
+ if (!LDST_P_BIT(instr))
+ addr += offset.un;
+
+ if (!LDST_P_BIT(instr) || LDST_W_BIT(instr))
+ regs->uregs[RN_BITS(instr)] = addr;
+}
+
+static int
+do_alignment_ldrhstrh(unsigned long addr, unsigned long instr, struct pt_regs *regs)
+{
+ unsigned int rd = RD_BITS(instr);
+
+ ai_half += 1;
+
+ if (user_mode(regs))
+ goto user;
+
+ if (LDST_L_BIT(instr)) {
+ unsigned long val;
+ get16_unaligned_check(val, addr);
+
+ /* signed half-word? */
+ if (instr & 0x40)
+ val = (signed long)((signed short) val);
+
+ regs->uregs[rd] = val;
+ } else
+ put16_unaligned_check(regs->uregs[rd], addr);
+
+ return TYPE_LDST;
+
+ user:
+ if (LDST_L_BIT(instr)) {
+ unsigned long val;
+ get16t_unaligned_check(val, addr);
+
+ /* signed half-word? */
+ if (instr & 0x40)
+ val = (signed long)((signed short) val);
+
+ regs->uregs[rd] = val;
+ } else
+ put16t_unaligned_check(regs->uregs[rd], addr);
+
+ return TYPE_LDST;
+
+ fault:
+ return TYPE_FAULT;
+}
+
+static int
+do_alignment_ldrdstrd(unsigned long addr, unsigned long instr,
+ struct pt_regs *regs)
+{
+ unsigned int rd = RD_BITS(instr);
+ unsigned int rd2;
+ int load;
+
+ if ((instr & 0xfe000000) == 0xe8000000) {
+ /* ARMv7 Thumb-2 32-bit LDRD/STRD */
+ rd2 = (instr >> 8) & 0xf;
+ load = !!(LDST_L_BIT(instr));
+ } else if (((rd & 1) == 1) || (rd == 14))
+ goto bad;
+ else {
+ load = ((instr & 0xf0) == 0xd0);
+ rd2 = rd + 1;
+ }
+
+ ai_dword += 1;
+
+ if (user_mode(regs))
+ goto user;
+
+ if (load) {
+ unsigned long val;
+ get32_unaligned_check(val, addr);
+ regs->uregs[rd] = val;
+ get32_unaligned_check(val, addr + 4);
+ regs->uregs[rd2] = val;
+ } else {
+ put32_unaligned_check(regs->uregs[rd], addr);
+ put32_unaligned_check(regs->uregs[rd2], addr + 4);
+ }
+
+ return TYPE_LDST;
+
+ user:
+ if (load) {
+ unsigned long val;
+ get32t_unaligned_check(val, addr);
+ regs->uregs[rd] = val;
+ get32t_unaligned_check(val, addr + 4);
+ regs->uregs[rd2] = val;
+ } else {
+ put32t_unaligned_check(regs->uregs[rd], addr);
+ put32t_unaligned_check(regs->uregs[rd2], addr + 4);
+ }
+
+ return TYPE_LDST;
+ bad:
+ return TYPE_ERROR;
+ fault:
+ return TYPE_FAULT;
+}
+
+static int
+do_alignment_ldrstr(unsigned long addr, unsigned long instr, struct pt_regs *regs)
+{
+ unsigned int rd = RD_BITS(instr);
+
+ ai_word += 1;
+
+ if ((!LDST_P_BIT(instr) && LDST_W_BIT(instr)) || user_mode(regs))
+ goto trans;
+
+ if (LDST_L_BIT(instr)) {
+ unsigned int val;
+ get32_unaligned_check(val, addr);
+ regs->uregs[rd] = val;
+ } else
+ put32_unaligned_check(regs->uregs[rd], addr);
+ return TYPE_LDST;
+
+ trans:
+ if (LDST_L_BIT(instr)) {
+ unsigned int val;
+ get32t_unaligned_check(val, addr);
+ regs->uregs[rd] = val;
+ } else
+ put32t_unaligned_check(regs->uregs[rd], addr);
+ return TYPE_LDST;
+
+ fault:
+ return TYPE_FAULT;
+}
+
+/*
+ * LDM/STM alignment handler.
+ *
+ * There are 4 variants of this instruction:
+ *
+ * B = rn pointer before instruction, A = rn pointer after instruction
+ * ------ increasing address ----->
+ * | | r0 | r1 | ... | rx | |
+ * PU = 01 B A
+ * PU = 11 B A
+ * PU = 00 A B
+ * PU = 10 A B
+ */
+static int
+do_alignment_ldmstm(unsigned long addr, unsigned long instr, struct pt_regs *regs)
+{
+ unsigned int rd, rn, correction, nr_regs, regbits;
+ unsigned long eaddr, newaddr;
+
+ if (LDM_S_BIT(instr))
+ goto bad;
+
+ correction = 4; /* processor implementation defined */
+ regs->ARM_pc += correction;
+
+ ai_multi += 1;
+
+ /* count the number of registers in the mask to be transferred */
+ nr_regs = hweight16(REGMASK_BITS(instr)) * 4;
+
+ rn = RN_BITS(instr);
+ newaddr = eaddr = regs->uregs[rn];
+
+ if (!LDST_U_BIT(instr))
+ nr_regs = -nr_regs;
+ newaddr += nr_regs;
+ if (!LDST_U_BIT(instr))
+ eaddr = newaddr;
+
+ if (LDST_P_EQ_U(instr)) /* U = P */
+ eaddr += 4;
+
+ /*
+ * For alignment faults on the ARM922T/ARM920T the MMU makes
+ * the FSR (and hence addr) equal to the updated base address
+ * of the multiple access rather than the restored value.
+ * Switch this message off if we've got a ARM92[02], otherwise
+ * [ls]dm alignment faults are noisy!
+ */
+#if !(defined CONFIG_CPU_ARM922T) && !(defined CONFIG_CPU_ARM920T)
+ /*
+ * This is a "hint" - we already have eaddr worked out by the
+ * processor for us.
+ */
+ if (addr != eaddr) {
+ printk(KERN_ERR "LDMSTM: PC = %08lx, instr = %08lx, "
+ "addr = %08lx, eaddr = %08lx\n",
+ instruction_pointer(regs), instr, addr, eaddr);
+ show_regs(regs);
+ }
+#endif
+
+ if (user_mode(regs)) {
+ for (regbits = REGMASK_BITS(instr), rd = 0; regbits;
+ regbits >>= 1, rd += 1)
+ if (regbits & 1) {
+ if (LDST_L_BIT(instr)) {
+ unsigned int val;
+ get32t_unaligned_check(val, eaddr);
+ regs->uregs[rd] = val;
+ } else
+ put32t_unaligned_check(regs->uregs[rd], eaddr);
+ eaddr += 4;
+ }
+ } else {
+ for (regbits = REGMASK_BITS(instr), rd = 0; regbits;
+ regbits >>= 1, rd += 1)
+ if (regbits & 1) {
+ if (LDST_L_BIT(instr)) {
+ unsigned int val;
+ get32_unaligned_check(val, eaddr);
+ regs->uregs[rd] = val;
+ } else
+ put32_unaligned_check(regs->uregs[rd], eaddr);
+ eaddr += 4;
+ }
+ }
+
+ if (LDST_W_BIT(instr))
+ regs->uregs[rn] = newaddr;
+ if (!LDST_L_BIT(instr) || !(REGMASK_BITS(instr) & (1 << 15)))
+ regs->ARM_pc -= correction;
+ return TYPE_DONE;
+
+fault:
+ regs->ARM_pc -= correction;
+ return TYPE_FAULT;
+
+bad:
+ printk(KERN_ERR "Alignment trap: not handling ldm with s-bit set\n");
+ return TYPE_ERROR;
+}
+
+/*
+ * Convert Thumb ld/st instruction forms to equivalent ARM instructions so
+ * we can reuse ARM userland alignment fault fixups for Thumb.
+ *
+ * This implementation was initially based on the algorithm found in
+ * gdb/sim/arm/thumbemu.c. It is basically just a code reduction of same
+ * to convert only Thumb ld/st instruction forms to equivalent ARM forms.
+ *
+ * NOTES:
+ * 1. Comments below refer to ARM ARM DDI0100E Thumb Instruction sections.
+ * 2. If for some reason we're passed an non-ld/st Thumb instruction to
+ * decode, we return 0xdeadc0de. This should never happen under normal
+ * circumstances but if it does, we've got other problems to deal with
+ * elsewhere and we obviously can't fix those problems here.
+ */
+
+static unsigned long
+thumb2arm(u16 tinstr)
+{
+ u32 L = (tinstr & (1<<11)) >> 11;
+
+ switch ((tinstr & 0xf800) >> 11) {
+ /* 6.5.1 Format 1: */
+ case 0x6000 >> 11: /* 7.1.52 STR(1) */
+ case 0x6800 >> 11: /* 7.1.26 LDR(1) */
+ case 0x7000 >> 11: /* 7.1.55 STRB(1) */
+ case 0x7800 >> 11: /* 7.1.30 LDRB(1) */
+ return 0xe5800000 |
+ ((tinstr & (1<<12)) << (22-12)) | /* fixup */
+ (L<<20) | /* L==1? */
+ ((tinstr & (7<<0)) << (12-0)) | /* Rd */
+ ((tinstr & (7<<3)) << (16-3)) | /* Rn */
+ ((tinstr & (31<<6)) >> /* immed_5 */
+ (6 - ((tinstr & (1<<12)) ? 0 : 2)));
+ case 0x8000 >> 11: /* 7.1.57 STRH(1) */
+ case 0x8800 >> 11: /* 7.1.32 LDRH(1) */
+ return 0xe1c000b0 |
+ (L<<20) | /* L==1? */
+ ((tinstr & (7<<0)) << (12-0)) | /* Rd */
+ ((tinstr & (7<<3)) << (16-3)) | /* Rn */
+ ((tinstr & (7<<6)) >> (6-1)) | /* immed_5[2:0] */
+ ((tinstr & (3<<9)) >> (9-8)); /* immed_5[4:3] */
+
+ /* 6.5.1 Format 2: */
+ case 0x5000 >> 11:
+ case 0x5800 >> 11:
+ {
+ static const u32 subset[8] = {
+ 0xe7800000, /* 7.1.53 STR(2) */
+ 0xe18000b0, /* 7.1.58 STRH(2) */
+ 0xe7c00000, /* 7.1.56 STRB(2) */
+ 0xe19000d0, /* 7.1.34 LDRSB */
+ 0xe7900000, /* 7.1.27 LDR(2) */
+ 0xe19000b0, /* 7.1.33 LDRH(2) */
+ 0xe7d00000, /* 7.1.31 LDRB(2) */
+ 0xe19000f0 /* 7.1.35 LDRSH */
+ };
+ return subset[(tinstr & (7<<9)) >> 9] |
+ ((tinstr & (7<<0)) << (12-0)) | /* Rd */
+ ((tinstr & (7<<3)) << (16-3)) | /* Rn */
+ ((tinstr & (7<<6)) >> (6-0)); /* Rm */
+ }
+
+ /* 6.5.1 Format 3: */
+ case 0x4800 >> 11: /* 7.1.28 LDR(3) */
+ /* NOTE: This case is not technically possible. We're
+ * loading 32-bit memory data via PC relative
+ * addressing mode. So we can and should eliminate
+ * this case. But I'll leave it here for now.
+ */
+ return 0xe59f0000 |
+ ((tinstr & (7<<8)) << (12-8)) | /* Rd */
+ ((tinstr & 255) << (2-0)); /* immed_8 */
+
+ /* 6.5.1 Format 4: */
+ case 0x9000 >> 11: /* 7.1.54 STR(3) */
+ case 0x9800 >> 11: /* 7.1.29 LDR(4) */
+ return 0xe58d0000 |
+ (L<<20) | /* L==1? */
+ ((tinstr & (7<<8)) << (12-8)) | /* Rd */
+ ((tinstr & 255) << 2); /* immed_8 */
+
+ /* 6.6.1 Format 1: */
+ case 0xc000 >> 11: /* 7.1.51 STMIA */
+ case 0xc800 >> 11: /* 7.1.25 LDMIA */
+ {
+ u32 Rn = (tinstr & (7<<8)) >> 8;
+ u32 W = ((L<<Rn) & (tinstr&255)) ? 0 : 1<<21;
+
+ return 0xe8800000 | W | (L<<20) | (Rn<<16) |
+ (tinstr&255);
+ }
+
+ /* 6.6.1 Format 2: */
+ case 0xb000 >> 11: /* 7.1.48 PUSH */
+ case 0xb800 >> 11: /* 7.1.47 POP */
+ if ((tinstr & (3 << 9)) == 0x0400) {
+ static const u32 subset[4] = {
+ 0xe92d0000, /* STMDB sp!,{registers} */
+ 0xe92d4000, /* STMDB sp!,{registers,lr} */
+ 0xe8bd0000, /* LDMIA sp!,{registers} */
+ 0xe8bd8000 /* LDMIA sp!,{registers,pc} */
+ };
+ return subset[(L<<1) | ((tinstr & (1<<8)) >> 8)] |
+ (tinstr & 255); /* register_list */
+ }
+ /* Else fall through for illegal instruction case */
+
+ default:
+ return BAD_INSTR;
+ }
+}
+
+/*
+ * Convert Thumb-2 32 bit LDM, STM, LDRD, STRD to equivalent instruction
+ * handlable by ARM alignment handler, also find the corresponding handler,
+ * so that we can reuse ARM userland alignment fault fixups for Thumb.
+ *
+ * @pinstr: original Thumb-2 instruction; returns new handlable instruction
+ * @regs: register context.
+ * @poffset: return offset from faulted addr for later writeback
+ *
+ * NOTES:
+ * 1. Comments below refer to ARMv7 DDI0406A Thumb Instruction sections.
+ * 2. Register name Rt from ARMv7 is same as Rd from ARMv6 (Rd is Rt)
+ */
+static void *
+do_alignment_t32_to_handler(unsigned long *pinstr, struct pt_regs *regs,
+ union offset_union *poffset)
+{
+ unsigned long instr = *pinstr;
+ u16 tinst1 = (instr >> 16) & 0xffff;
+ u16 tinst2 = instr & 0xffff;
+ poffset->un = 0;
+
+ switch (tinst1 & 0xffe0) {
+ /* A6.3.5 Load/Store multiple */
+ case 0xe880: /* STM/STMIA/STMEA,LDM/LDMIA, PUSH/POP T2 */
+ case 0xe8a0: /* ...above writeback version */
+ case 0xe900: /* STMDB/STMFD, LDMDB/LDMEA */
+ case 0xe920: /* ...above writeback version */
+ /* no need offset decision since handler calculates it */
+ return do_alignment_ldmstm;
+
+ case 0xf840: /* POP/PUSH T3 (single register) */
+ if (RN_BITS(instr) == 13 && (tinst2 & 0x09ff) == 0x0904) {
+ u32 L = !!(LDST_L_BIT(instr));
+ const u32 subset[2] = {
+ 0xe92d0000, /* STMDB sp!,{registers} */
+ 0xe8bd0000, /* LDMIA sp!,{registers} */
+ };
+ *pinstr = subset[L] | (1<<RD_BITS(instr));
+ return do_alignment_ldmstm;
+ }
+ /* Else fall through for illegal instruction case */
+ break;
+
+ /* A6.3.6 Load/store double, STRD/LDRD(immed, lit, reg) */
+ case 0xe860:
+ case 0xe960:
+ case 0xe8e0:
+ case 0xe9e0:
+ poffset->un = (tinst2 & 0xff) << 2;
+ case 0xe940:
+ case 0xe9c0:
+ return do_alignment_ldrdstrd;
+
+ /*
+ * No need to handle load/store instructions up to word size
+ * since ARMv6 and later CPUs can perform unaligned accesses.
+ */
+ default:
+ break;
+ }
+ return NULL;
+}
+
+static int
+do_alignment(unsigned long addr, unsigned int fsr, struct pt_regs *regs)
+{
+ union offset_union offset;
+ unsigned long instr = 0, instrptr;
+ int (*handler)(unsigned long addr, unsigned long instr, struct pt_regs *regs);
+ unsigned int type;
+ unsigned int fault;
+ u16 tinstr = 0;
+ int isize = 4;
+ int thumb2_32b = 0;
+
+ if (interrupts_enabled(regs))
+ local_irq_enable();
+
+ instrptr = instruction_pointer(regs);
+
+ if (thumb_mode(regs)) {
+ u16 *ptr = (u16 *)(instrptr & ~1);
+ fault = probe_kernel_address(ptr, tinstr);
+ if (!fault) {
+ if (cpu_architecture() >= CPU_ARCH_ARMv7 &&
+ IS_T32(tinstr)) {
+ /* Thumb-2 32-bit */
+ u16 tinst2 = 0;
+ fault = probe_kernel_address(ptr + 1, tinst2);
+ instr = (tinstr << 16) | tinst2;
+ thumb2_32b = 1;
+ } else {
+ isize = 2;
+ instr = thumb2arm(tinstr);
+ }
+ }
+ } else
+ fault = probe_kernel_address(instrptr, instr);
+
+ if (fault) {
+ type = TYPE_FAULT;
+ goto bad_or_fault;
+ }
+
+ if (user_mode(regs))
+ goto user;
+
+ ai_sys += 1;
+
+ fixup:
+
+ regs->ARM_pc += isize;
+
+ switch (CODING_BITS(instr)) {
+ case 0x00000000: /* 3.13.4 load/store instruction extensions */
+ if (LDSTHD_I_BIT(instr))
+ offset.un = (instr & 0xf00) >> 4 | (instr & 15);
+ else
+ offset.un = regs->uregs[RM_BITS(instr)];
+
+ if ((instr & 0x000000f0) == 0x000000b0 || /* LDRH, STRH */
+ (instr & 0x001000f0) == 0x001000f0) /* LDRSH */
+ handler = do_alignment_ldrhstrh;
+ else if ((instr & 0x001000f0) == 0x000000d0 || /* LDRD */
+ (instr & 0x001000f0) == 0x000000f0) /* STRD */
+ handler = do_alignment_ldrdstrd;
+ else if ((instr & 0x01f00ff0) == 0x01000090) /* SWP */
+ goto swp;
+ else
+ goto bad;
+ break;
+
+ case 0x04000000: /* ldr or str immediate */
+ if (COND_BITS(instr) == 0xf0000000) /* NEON VLDn, VSTn */
+ goto bad;
+ offset.un = OFFSET_BITS(instr);
+ handler = do_alignment_ldrstr;
+ break;
+
+ case 0x06000000: /* ldr or str register */
+ offset.un = regs->uregs[RM_BITS(instr)];
+
+ if (IS_SHIFT(instr)) {
+ unsigned int shiftval = SHIFT_BITS(instr);
+
+ switch(SHIFT_TYPE(instr)) {
+ case SHIFT_LSL:
+ offset.un <<= shiftval;
+ break;
+
+ case SHIFT_LSR:
+ offset.un >>= shiftval;
+ break;
+
+ case SHIFT_ASR:
+ offset.sn >>= shiftval;
+ break;
+
+ case SHIFT_RORRRX:
+ if (shiftval == 0) {
+ offset.un >>= 1;
+ if (regs->ARM_cpsr & PSR_C_BIT)
+ offset.un |= 1 << 31;
+ } else
+ offset.un = offset.un >> shiftval |
+ offset.un << (32 - shiftval);
+ break;
+ }
+ }
+ handler = do_alignment_ldrstr;
+ break;
+
+ case 0x08000000: /* ldm or stm, or thumb-2 32bit instruction */
+ if (thumb2_32b)
+ handler = do_alignment_t32_to_handler(&instr, regs, &offset);
+ else
+ handler = do_alignment_ldmstm;
+ break;
+
+ default:
+ goto bad;
+ }
+
+ if (!handler)
+ goto bad;
+ type = handler(addr, instr, regs);
+
+ if (type == TYPE_ERROR || type == TYPE_FAULT) {
+ regs->ARM_pc -= isize;
+ goto bad_or_fault;
+ }
+
+ if (type == TYPE_LDST)
+ do_alignment_finish_ldst(addr, instr, regs, offset);
+
+ return 0;
+
+ bad_or_fault:
+ if (type == TYPE_ERROR)
+ goto bad;
+ /*
+ * We got a fault - fix it up, or die.
+ */
+ do_bad_area(addr, fsr, regs);
+ return 0;
+
+ swp:
+ printk(KERN_ERR "Alignment trap: not handling swp instruction\n");
+
+ bad:
+ /*
+ * Oops, we didn't handle the instruction.
+ */
+ printk(KERN_ERR "Alignment trap: not handling instruction "
+ "%0*lx at [<%08lx>]\n",
+ isize << 1,
+ isize == 2 ? tinstr : instr, instrptr);
+ ai_skipped += 1;
+ return 1;
+
+ user:
+ ai_user += 1;
+
+ if (ai_usermode & UM_WARN)
+ printk("Alignment trap: %s (%d) PC=0x%08lx Instr=0x%0*lx "
+ "Address=0x%08lx FSR 0x%03x\n", current->comm,
+ task_pid_nr(current), instrptr,
+ isize << 1,
+ isize == 2 ? tinstr : instr,
+ addr, fsr);
+
+ if (ai_usermode & UM_FIXUP)
+ goto fixup;
+
+ if (ai_usermode & UM_SIGNAL) {
+ siginfo_t si;
+
+ si.si_signo = SIGBUS;
+ si.si_errno = 0;
+ si.si_code = BUS_ADRALN;
+ si.si_addr = (void __user *)addr;
+
+ force_sig_info(si.si_signo, &si, current);
+ } else {
+ /*
+ * We're about to disable the alignment trap and return to
+ * user space. But if an interrupt occurs before actually
+ * reaching user space, then the IRQ vector entry code will
+ * notice that we were still in kernel space and therefore
+ * the alignment trap won't be re-enabled in that case as it
+ * is presumed to be always on from kernel space.
+ * Let's prevent that race by disabling interrupts here (they
+ * are disabled on the way back to user space anyway in
+ * entry-common.S) and disable the alignment trap only if
+ * there is no work pending for this thread.
+ */
+ raw_local_irq_disable();
+ if (!(current_thread_info()->flags & _TIF_WORK_MASK))
+ set_cr(cr_no_alignment);
+ }
+
+ return 0;
+}
+
+/*
+ * This needs to be done after sysctl_init, otherwise sys/ will be
+ * overwritten. Actually, this shouldn't be in sys/ at all since
+ * it isn't a sysctl, and it doesn't contain sysctl information.
+ * We now locate it in /proc/cpu/alignment instead.
+ */
+static int __init alignment_init(void)
+{
+#ifdef CONFIG_PROC_FS
+ struct proc_dir_entry *res;
+
+ res = proc_create("cpu/alignment", S_IWUSR | S_IRUGO, NULL,
+ &alignment_proc_fops);
+ if (!res)
+ return -ENOMEM;
+#endif
+
+ if (cpu_is_v6_unaligned()) {
+ cr_alignment &= ~CR_A;
+ cr_no_alignment &= ~CR_A;
+ set_cr(cr_alignment);
+ ai_usermode = safe_usermode(ai_usermode, false);
+ }
+
+ hook_fault_code(FAULT_CODE_ALIGNMENT, do_alignment, SIGBUS, BUS_ADRALN,
+ "alignment exception");
+
+ /*
+ * ARMv6K and ARMv7 use fault status 3 (0b00011) as Access Flag section
+ * fault, not as alignment error.
+ *
+ * TODO: handle ARMv6K properly. Runtime check for 'K' extension is
+ * needed.
+ */
+ if (cpu_architecture() <= CPU_ARCH_ARMv6) {
+ hook_fault_code(3, do_alignment, SIGBUS, BUS_ADRALN,
+ "alignment exception");
+ }
+
+ return 0;
+}
+
+fs_initcall(alignment_init);
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-fa.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-fa.S
new file mode 100644
index 0000000..0720163
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-fa.S
@@ -0,0 +1,246 @@
+/*
+ * linux/arch/arm/mm/cache-fa.S
+ *
+ * Copyright (C) 2005 Faraday Corp.
+ * Copyright (C) 2008-2009 Paulius Zaleckas <paulius.zaleckas@teltonika.lt>
+ *
+ * Based on cache-v4wb.S:
+ * Copyright (C) 1997-2002 Russell king
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * Processors: FA520 FA526 FA626
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/memory.h>
+#include <asm/page.h>
+
+#include "proc-macros.S"
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 16
+
+/*
+ * The total size of the data cache.
+ */
+#ifdef CONFIG_ARCH_GEMINI
+#define CACHE_DSIZE 8192
+#else
+#define CACHE_DSIZE 16384
+#endif
+
+/* FIXME: put optimal value here. Current one is just estimation */
+#define CACHE_DLIMIT (CACHE_DSIZE * 2)
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(fa_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(fa_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(fa_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(fa_flush_kern_cache_all)
+ mov ip, #0
+ mov r2, #VM_EXEC
+__flush_whole_cache:
+ mcr p15, 0, ip, c7, c14, 0 @ clean/invalidate D cache
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c5, 6 @ invalidate BTB
+ mcrne p15, 0, ip, c7, c10, 4 @ drain write buffer
+ mcrne p15, 0, ip, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive, page aligned)
+ * - end - end address (exclusive, page aligned)
+ * - flags - vma_area_struct flags describing address space
+ */
+ENTRY(fa_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT @ total size >= limit?
+ bhs __flush_whole_cache @ flush whole D cache
+
+1: tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I line
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 6 @ invalidate BTB
+ mcrne p15, 0, ip, c7, c10, 4 @ data write barrier
+ mcrne p15, 0, ip, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(fa_coherent_kern_range)
+ /* fall through */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(fa_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 6 @ invalidate BTB
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mcr p15, 0, r0, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure that the data held in the page kaddr is written back
+ * to the page in question.
+ *
+ * - addr - kernel address
+ * - size - size of region
+ */
+ENTRY(fa_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean & invalidate D line
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+fa_dma_inv_range:
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c14, 1 @ clean & invalidate D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ bic r1, r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c14, 1 @ clean & invalidate D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean (write back) the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+fa_dma_clean_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * dma_flush_range(start,end)
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+ENTRY(fa_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean & invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(fa_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq fa_dma_clean_range
+ bcs fa_dma_inv_range
+ b fa_dma_flush_range
+ENDPROC(fa_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(fa_dma_unmap_area)
+ mov pc, lr
+ENDPROC(fa_dma_unmap_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions fa
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-feroceon-l2.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-feroceon-l2.c
new file mode 100644
index 0000000..48bc3c0
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-feroceon-l2.c
@@ -0,0 +1,352 @@
+/*
+ * arch/arm/mm/cache-feroceon-l2.c - Feroceon L2 cache controller support
+ *
+ * Copyright (C) 2008 Marvell Semiconductor
+ *
+ * This file is licensed under the terms of the GNU General Public
+ * License version 2. This program is licensed "as is" without any
+ * warranty of any kind, whether express or implied.
+ *
+ * References:
+ * - Unified Layer 2 Cache for Feroceon CPU Cores,
+ * Document ID MV-S104858-00, Rev. A, October 23 2007.
+ */
+
+#include <linux/init.h>
+#include <linux/highmem.h>
+#include <asm/cacheflush.h>
+#include <asm/cp15.h>
+#include <plat/cache-feroceon-l2.h>
+
+/*
+ * Low-level cache maintenance operations.
+ *
+ * As well as the regular 'clean/invalidate/flush L2 cache line by
+ * MVA' instructions, the Feroceon L2 cache controller also features
+ * 'clean/invalidate L2 range by MVA' operations.
+ *
+ * Cache range operations are initiated by writing the start and
+ * end addresses to successive cp15 registers, and process every
+ * cache line whose first byte address lies in the inclusive range
+ * [start:end].
+ *
+ * The cache range operations stall the CPU pipeline until completion.
+ *
+ * The range operations require two successive cp15 writes, in
+ * between which we don't want to be preempted.
+ */
+
+static inline unsigned long l2_get_va(unsigned long paddr)
+{
+#ifdef CONFIG_HIGHMEM
+ /*
+ * Because range ops can't be done on physical addresses,
+ * we simply install a virtual mapping for it only for the
+ * TLB lookup to occur, hence no need to flush the untouched
+ * memory mapping afterwards (note: a cache flush may happen
+ * in some circumstances depending on the path taken in kunmap_atomic).
+ */
+ void *vaddr = kmap_atomic_pfn(paddr >> PAGE_SHIFT);
+ return (unsigned long)vaddr + (paddr & ~PAGE_MASK);
+#else
+ return __phys_to_virt(paddr);
+#endif
+}
+
+static inline void l2_put_va(unsigned long vaddr)
+{
+#ifdef CONFIG_HIGHMEM
+ kunmap_atomic((void *)vaddr);
+#endif
+}
+
+static inline void l2_clean_pa(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c15, c9, 3" : : "r" (addr));
+}
+
+static inline void l2_clean_pa_range(unsigned long start, unsigned long end)
+{
+ unsigned long va_start, va_end, flags;
+
+ /*
+ * Make sure 'start' and 'end' reference the same page, as
+ * L2 is PIPT and range operations only do a TLB lookup on
+ * the start address.
+ */
+ BUG_ON((start ^ end) >> PAGE_SHIFT);
+
+ va_start = l2_get_va(start);
+ va_end = va_start + (end - start);
+ raw_local_irq_save(flags);
+ __asm__("mcr p15, 1, %0, c15, c9, 4\n\t"
+ "mcr p15, 1, %1, c15, c9, 5"
+ : : "r" (va_start), "r" (va_end));
+ raw_local_irq_restore(flags);
+ l2_put_va(va_start);
+}
+
+static inline void l2_clean_inv_pa(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c15, c10, 3" : : "r" (addr));
+}
+
+static inline void l2_inv_pa(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c15, c11, 3" : : "r" (addr));
+}
+
+static inline void l2_inv_pa_range(unsigned long start, unsigned long end)
+{
+ unsigned long va_start, va_end, flags;
+
+ /*
+ * Make sure 'start' and 'end' reference the same page, as
+ * L2 is PIPT and range operations only do a TLB lookup on
+ * the start address.
+ */
+ BUG_ON((start ^ end) >> PAGE_SHIFT);
+
+ va_start = l2_get_va(start);
+ va_end = va_start + (end - start);
+ raw_local_irq_save(flags);
+ __asm__("mcr p15, 1, %0, c15, c11, 4\n\t"
+ "mcr p15, 1, %1, c15, c11, 5"
+ : : "r" (va_start), "r" (va_end));
+ raw_local_irq_restore(flags);
+ l2_put_va(va_start);
+}
+
+static inline void l2_inv_all(void)
+{
+ __asm__("mcr p15, 1, %0, c15, c11, 0" : : "r" (0));
+}
+
+/*
+ * Linux primitives.
+ *
+ * Note that the end addresses passed to Linux primitives are
+ * noninclusive, while the hardware cache range operations use
+ * inclusive start and end addresses.
+ */
+#define CACHE_LINE_SIZE 32
+#define MAX_RANGE_SIZE 1024
+
+static int l2_wt_override;
+
+static unsigned long calc_range_end(unsigned long start, unsigned long end)
+{
+ unsigned long range_end;
+
+ BUG_ON(start & (CACHE_LINE_SIZE - 1));
+ BUG_ON(end & (CACHE_LINE_SIZE - 1));
+
+ /*
+ * Try to process all cache lines between 'start' and 'end'.
+ */
+ range_end = end;
+
+ /*
+ * Limit the number of cache lines processed at once,
+ * since cache range operations stall the CPU pipeline
+ * until completion.
+ */
+ if (range_end > start + MAX_RANGE_SIZE)
+ range_end = start + MAX_RANGE_SIZE;
+
+ /*
+ * Cache range operations can't straddle a page boundary.
+ */
+ if (range_end > (start | (PAGE_SIZE - 1)) + 1)
+ range_end = (start | (PAGE_SIZE - 1)) + 1;
+
+ return range_end;
+}
+
+static void feroceon_l2_inv_range(unsigned long start, unsigned long end)
+{
+ /*
+ * Clean and invalidate partial first cache line.
+ */
+ if (start & (CACHE_LINE_SIZE - 1)) {
+ l2_clean_inv_pa(start & ~(CACHE_LINE_SIZE - 1));
+ start = (start | (CACHE_LINE_SIZE - 1)) + 1;
+ }
+
+ /*
+ * Clean and invalidate partial last cache line.
+ */
+ if (start < end && end & (CACHE_LINE_SIZE - 1)) {
+ l2_clean_inv_pa(end & ~(CACHE_LINE_SIZE - 1));
+ end &= ~(CACHE_LINE_SIZE - 1);
+ }
+
+ /*
+ * Invalidate all full cache lines between 'start' and 'end'.
+ */
+ while (start < end) {
+ unsigned long range_end = calc_range_end(start, end);
+ l2_inv_pa_range(start, range_end - CACHE_LINE_SIZE);
+ start = range_end;
+ }
+
+ dsb();
+}
+
+static void feroceon_l2_clean_range(unsigned long start, unsigned long end)
+{
+ /*
+ * If L2 is forced to WT, the L2 will always be clean and we
+ * don't need to do anything here.
+ */
+ if (!l2_wt_override) {
+ start &= ~(CACHE_LINE_SIZE - 1);
+ end = (end + CACHE_LINE_SIZE - 1) & ~(CACHE_LINE_SIZE - 1);
+ while (start != end) {
+ unsigned long range_end = calc_range_end(start, end);
+ l2_clean_pa_range(start, range_end - CACHE_LINE_SIZE);
+ start = range_end;
+ }
+ }
+
+ dsb();
+}
+
+static void feroceon_l2_flush_range(unsigned long start, unsigned long end)
+{
+ start &= ~(CACHE_LINE_SIZE - 1);
+ end = (end + CACHE_LINE_SIZE - 1) & ~(CACHE_LINE_SIZE - 1);
+ while (start != end) {
+ unsigned long range_end = calc_range_end(start, end);
+ if (!l2_wt_override)
+ l2_clean_pa_range(start, range_end - CACHE_LINE_SIZE);
+ l2_inv_pa_range(start, range_end - CACHE_LINE_SIZE);
+ start = range_end;
+ }
+
+ dsb();
+}
+
+
+/*
+ * Routines to disable and re-enable the D-cache and I-cache at run
+ * time. These are necessary because the L2 cache can only be enabled
+ * or disabled while the L1 Dcache and Icache are both disabled.
+ */
+static int __init flush_and_disable_dcache(void)
+{
+ u32 cr;
+
+ cr = get_cr();
+ if (cr & CR_C) {
+ unsigned long flags;
+
+ raw_local_irq_save(flags);
+ flush_cache_all();
+ set_cr(cr & ~CR_C);
+ raw_local_irq_restore(flags);
+ return 1;
+ }
+ return 0;
+}
+
+static void __init enable_dcache(void)
+{
+ u32 cr;
+
+ cr = get_cr();
+ set_cr(cr | CR_C);
+}
+
+static void __init __invalidate_icache(void)
+{
+ __asm__("mcr p15, 0, %0, c7, c5, 0" : : "r" (0));
+}
+
+static int __init invalidate_and_disable_icache(void)
+{
+ u32 cr;
+
+ cr = get_cr();
+ if (cr & CR_I) {
+ set_cr(cr & ~CR_I);
+ __invalidate_icache();
+ return 1;
+ }
+ return 0;
+}
+
+static void __init enable_icache(void)
+{
+ u32 cr;
+
+ cr = get_cr();
+ set_cr(cr | CR_I);
+}
+
+static inline u32 read_extra_features(void)
+{
+ u32 u;
+
+ __asm__("mrc p15, 1, %0, c15, c1, 0" : "=r" (u));
+
+ return u;
+}
+
+static inline void write_extra_features(u32 u)
+{
+ __asm__("mcr p15, 1, %0, c15, c1, 0" : : "r" (u));
+}
+
+static void __init disable_l2_prefetch(void)
+{
+ u32 u;
+
+ /*
+ * Read the CPU Extra Features register and verify that the
+ * Disable L2 Prefetch bit is set.
+ */
+ u = read_extra_features();
+ if (!(u & 0x01000000)) {
+ printk(KERN_INFO "Feroceon L2: Disabling L2 prefetch.\n");
+ write_extra_features(u | 0x01000000);
+ }
+}
+
+static void __init enable_l2(void)
+{
+ u32 u;
+
+ u = read_extra_features();
+ if (!(u & 0x00400000)) {
+ int i, d;
+
+ printk(KERN_INFO "Feroceon L2: Enabling L2\n");
+
+ d = flush_and_disable_dcache();
+ i = invalidate_and_disable_icache();
+ l2_inv_all();
+ write_extra_features(u | 0x00400000);
+ if (i)
+ enable_icache();
+ if (d)
+ enable_dcache();
+ }
+}
+
+void __init feroceon_l2_init(int __l2_wt_override)
+{
+ l2_wt_override = __l2_wt_override;
+
+ disable_l2_prefetch();
+
+ outer_cache.inv_range = feroceon_l2_inv_range;
+ outer_cache.clean_range = feroceon_l2_clean_range;
+ outer_cache.flush_range = feroceon_l2_flush_range;
+ outer_cache.inv_all = l2_inv_all;
+
+ enable_l2();
+
+ printk(KERN_INFO "Feroceon L2: Cache support initialised%s.\n",
+ l2_wt_override ? ", in WT override mode" : "");
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-l2x0.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-l2x0.c
new file mode 100644
index 0000000..eaa6847
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-l2x0.c
@@ -0,0 +1,631 @@
+/*
+ * arch/arm/mm/cache-l2x0.c - L210/L220 cache controller support
+ *
+ * Copyright (C) 2007 ARM Limited
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+#include <linux/err.h>
+#include <linux/init.h>
+#include <linux/spinlock.h>
+#include <linux/io.h>
+#include <linux/of.h>
+#include <linux/of_address.h>
+
+#include <asm/cacheflush.h>
+#include <asm/hardware/cache-l2x0.h>
+
+#define CACHE_LINE_SIZE 32
+
+static void __iomem *l2x0_base;
+static DEFINE_RAW_SPINLOCK(l2x0_lock);
+static u32 l2x0_way_mask; /* Bitmask of active ways */
+static u32 l2x0_size;
+static u32 l2x0_cache_id;
+static unsigned int l2x0_sets;
+static unsigned int l2x0_ways;
+static unsigned long sync_reg_offset = L2X0_CACHE_SYNC;
+
+static inline bool is_pl310_rev(int rev)
+{
+ return (l2x0_cache_id &
+ (L2X0_CACHE_ID_PART_MASK | L2X0_CACHE_ID_REV_MASK)) ==
+ (L2X0_CACHE_ID_PART_L310 | rev);
+}
+
+struct l2x0_regs l2x0_saved_regs;
+
+struct l2x0_of_data {
+ void (*setup)(const struct device_node *, u32 *, u32 *);
+ void (*save)(void);
+ void (*resume)(void);
+};
+
+static inline void cache_wait_way(void __iomem *reg, unsigned long mask)
+{
+ /* wait for cache operation by line or way to complete */
+ while (readl_relaxed(reg) & mask)
+ cpu_relax();
+}
+
+#ifdef CONFIG_CACHE_PL310
+static inline void cache_wait(void __iomem *reg, unsigned long mask)
+{
+ /* cache operations by line are atomic on PL310 */
+}
+#else
+#define cache_wait cache_wait_way
+#endif
+
+static inline void cache_sync(void)
+{
+ void __iomem *base = l2x0_base;
+
+ writel_relaxed(0, base + sync_reg_offset);
+ cache_wait(base + L2X0_CACHE_SYNC, 1);
+}
+
+static inline void l2x0_clean_line(unsigned long addr)
+{
+ void __iomem *base = l2x0_base;
+ cache_wait(base + L2X0_CLEAN_LINE_PA, 1);
+ writel_relaxed(addr, base + L2X0_CLEAN_LINE_PA);
+}
+
+static inline void l2x0_inv_line(unsigned long addr)
+{
+ void __iomem *base = l2x0_base;
+ cache_wait(base + L2X0_INV_LINE_PA, 1);
+ writel_relaxed(addr, base + L2X0_INV_LINE_PA);
+}
+
+#if defined(CONFIG_PL310_ERRATA_588369) || defined(CONFIG_PL310_ERRATA_727915)
+static inline void debug_writel(unsigned long val)
+{
+ if (outer_cache.set_debug)
+ outer_cache.set_debug(val);
+}
+
+static void pl310_set_debug(unsigned long val)
+{
+ writel_relaxed(val, l2x0_base + L2X0_DEBUG_CTRL);
+}
+#else
+/* Optimised out for non-errata case */
+static inline void debug_writel(unsigned long val)
+{
+}
+
+#define pl310_set_debug NULL
+#endif
+
+#ifdef CONFIG_PL310_ERRATA_588369
+static inline void l2x0_flush_line(unsigned long addr)
+{
+ void __iomem *base = l2x0_base;
+
+ /* Clean by PA followed by Invalidate by PA */
+ cache_wait(base + L2X0_CLEAN_LINE_PA, 1);
+ writel_relaxed(addr, base + L2X0_CLEAN_LINE_PA);
+ cache_wait(base + L2X0_INV_LINE_PA, 1);
+ writel_relaxed(addr, base + L2X0_INV_LINE_PA);
+}
+#else
+
+static inline void l2x0_flush_line(unsigned long addr)
+{
+ void __iomem *base = l2x0_base;
+ cache_wait(base + L2X0_CLEAN_INV_LINE_PA, 1);
+ writel_relaxed(addr, base + L2X0_CLEAN_INV_LINE_PA);
+}
+#endif
+
+static void l2x0_cache_sync(void)
+{
+ unsigned long flags;
+
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ cache_sync();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+#ifdef CONFIG_PL310_ERRATA_727915
+static void l2x0_for_each_set_way(void __iomem *reg)
+{
+ int set;
+ int way;
+ unsigned long flags;
+
+ for (way = 0; way < l2x0_ways; way++) {
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ for (set = 0; set < l2x0_sets; set++)
+ writel_relaxed((way << 28) | (set << 5), reg);
+ cache_sync();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+ }
+}
+#endif
+
+static void __l2x0_flush_all(void)
+{
+ debug_writel(0x03);
+ writel_relaxed(l2x0_way_mask, l2x0_base + L2X0_CLEAN_INV_WAY);
+ cache_wait_way(l2x0_base + L2X0_CLEAN_INV_WAY, l2x0_way_mask);
+ cache_sync();
+ debug_writel(0x00);
+}
+
+static void l2x0_flush_all(void)
+{
+ unsigned long flags;
+
+#ifdef CONFIG_PL310_ERRATA_727915
+ if (is_pl310_rev(REV_PL310_R2P0)) {
+ l2x0_for_each_set_way(l2x0_base + L2X0_CLEAN_INV_LINE_IDX);
+ return;
+ }
+#endif
+
+ /* clean all ways */
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ __l2x0_flush_all();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_clean_all(void)
+{
+ unsigned long flags;
+
+#ifdef CONFIG_PL310_ERRATA_727915
+ if (is_pl310_rev(REV_PL310_R2P0)) {
+ l2x0_for_each_set_way(l2x0_base + L2X0_CLEAN_LINE_IDX);
+ return;
+ }
+#endif
+
+ /* clean all ways */
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ debug_writel(0x03);
+ writel_relaxed(l2x0_way_mask, l2x0_base + L2X0_CLEAN_WAY);
+ cache_wait_way(l2x0_base + L2X0_CLEAN_WAY, l2x0_way_mask);
+ cache_sync();
+ debug_writel(0x00);
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_inv_all(void)
+{
+ unsigned long flags;
+
+ /* invalidate all ways */
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ /* Invalidating when L2 is enabled is a nono */
+ BUG_ON(readl(l2x0_base + L2X0_CTRL) & 1);
+ writel_relaxed(l2x0_way_mask, l2x0_base + L2X0_INV_WAY);
+ cache_wait_way(l2x0_base + L2X0_INV_WAY, l2x0_way_mask);
+ cache_sync();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_inv_range(unsigned long start, unsigned long end)
+{
+ void __iomem *base = l2x0_base;
+ unsigned long flags;
+
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ if (start & (CACHE_LINE_SIZE - 1)) {
+ start &= ~(CACHE_LINE_SIZE - 1);
+ debug_writel(0x03);
+ l2x0_flush_line(start);
+ debug_writel(0x00);
+ start += CACHE_LINE_SIZE;
+ }
+
+ if (end & (CACHE_LINE_SIZE - 1)) {
+ end &= ~(CACHE_LINE_SIZE - 1);
+ debug_writel(0x03);
+ l2x0_flush_line(end);
+ debug_writel(0x00);
+ }
+
+ while (start < end) {
+ unsigned long blk_end = start + min(end - start, 4096UL);
+
+ while (start < blk_end) {
+ l2x0_inv_line(start);
+ start += CACHE_LINE_SIZE;
+ }
+
+ if (blk_end < end) {
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ }
+ }
+ cache_wait(base + L2X0_INV_LINE_PA, 1);
+ cache_sync();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_clean_range(unsigned long start, unsigned long end)
+{
+ void __iomem *base = l2x0_base;
+ unsigned long flags;
+
+ if ((end - start) >= l2x0_size) {
+ l2x0_clean_all();
+ return;
+ }
+
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ start &= ~(CACHE_LINE_SIZE - 1);
+ while (start < end) {
+ unsigned long blk_end = start + min(end - start, 4096UL);
+
+ while (start < blk_end) {
+ l2x0_clean_line(start);
+ start += CACHE_LINE_SIZE;
+ }
+
+ if (blk_end < end) {
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ }
+ }
+ cache_wait(base + L2X0_CLEAN_LINE_PA, 1);
+ cache_sync();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_flush_range(unsigned long start, unsigned long end)
+{
+ void __iomem *base = l2x0_base;
+ unsigned long flags;
+
+ if ((end - start) >= l2x0_size) {
+ l2x0_flush_all();
+ return;
+ }
+
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ start &= ~(CACHE_LINE_SIZE - 1);
+ while (start < end) {
+ unsigned long blk_end = start + min(end - start, 4096UL);
+
+ debug_writel(0x03);
+ while (start < blk_end) {
+ l2x0_flush_line(start);
+ start += CACHE_LINE_SIZE;
+ }
+ debug_writel(0x00);
+
+ if (blk_end < end) {
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ }
+ }
+ cache_wait(base + L2X0_CLEAN_INV_LINE_PA, 1);
+ cache_sync();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_disable(void)
+{
+ unsigned long flags;
+
+ raw_spin_lock_irqsave(&l2x0_lock, flags);
+ __l2x0_flush_all();
+ writel_relaxed(0, l2x0_base + L2X0_CTRL);
+ dsb();
+ raw_spin_unlock_irqrestore(&l2x0_lock, flags);
+}
+
+static void l2x0_unlock(u32 cache_id)
+{
+ int lockregs;
+ int i;
+
+ if (cache_id == L2X0_CACHE_ID_PART_L310)
+ lockregs = 8;
+ else
+ /* L210 and unknown types */
+ lockregs = 1;
+
+ for (i = 0; i < lockregs; i++) {
+ writel_relaxed(0x0, l2x0_base + L2X0_LOCKDOWN_WAY_D_BASE +
+ i * L2X0_LOCKDOWN_STRIDE);
+ writel_relaxed(0x0, l2x0_base + L2X0_LOCKDOWN_WAY_I_BASE +
+ i * L2X0_LOCKDOWN_STRIDE);
+ }
+}
+
+void __init l2x0_init(void __iomem *base, u32 aux_val, u32 aux_mask)
+{
+ u32 aux;
+ u32 way_size = 0;
+ const char *type;
+
+ l2x0_base = base;
+
+ l2x0_cache_id = readl_relaxed(l2x0_base + L2X0_CACHE_ID);
+ aux = readl_relaxed(l2x0_base + L2X0_AUX_CTRL);
+
+ aux &= aux_mask;
+ aux |= aux_val;
+
+ /* Determine the number of ways */
+ switch (l2x0_cache_id & L2X0_CACHE_ID_PART_MASK) {
+ case L2X0_CACHE_ID_PART_L310:
+ if (aux & (1 << 16))
+ l2x0_ways = 16;
+ else
+ l2x0_ways = 8;
+ type = "L310";
+#ifdef CONFIG_PL310_ERRATA_753970
+ /* Unmapped register. */
+ sync_reg_offset = L2X0_DUMMY_REG;
+#endif
+ outer_cache.set_debug = pl310_set_debug;
+ break;
+ case L2X0_CACHE_ID_PART_L210:
+ l2x0_ways = (aux >> 13) & 0xf;
+ type = "L210";
+ break;
+ default:
+ /* Assume unknown chips have 8 ways */
+ l2x0_ways = 8;
+ type = "L2x0 series";
+ break;
+ }
+
+ l2x0_way_mask = (1 << l2x0_ways) - 1;
+
+ /*
+ * L2 cache Size = Way size * Number of ways
+ */
+ way_size = (aux & L2X0_AUX_CTRL_WAY_SIZE_MASK) >> 17;
+ way_size = SZ_1K << (way_size + 3);
+ l2x0_size = l2x0_ways * way_size;
+ l2x0_sets = way_size / CACHE_LINE_SIZE;
+
+ /*
+ * Check if l2x0 controller is already enabled.
+ * If you are booting from non-secure mode
+ * accessing the below registers will fault.
+ */
+ if (!(readl_relaxed(l2x0_base + L2X0_CTRL) & 1)) {
+ /* Make sure that I&D is not locked down when starting */
+ l2x0_unlock(l2x0_cache_id);
+
+ /* l2x0 controller is disabled */
+ writel_relaxed(aux, l2x0_base + L2X0_AUX_CTRL);
+
+ l2x0_saved_regs.aux_ctrl = aux;
+
+ l2x0_inv_all();
+
+ /* enable L2X0 */
+ writel_relaxed(1, l2x0_base + L2X0_CTRL);
+ }
+
+ outer_cache.inv_range = l2x0_inv_range;
+ outer_cache.clean_range = l2x0_clean_range;
+ outer_cache.flush_range = l2x0_flush_range;
+ outer_cache.sync = l2x0_cache_sync;
+ outer_cache.flush_all = l2x0_flush_all;
+ outer_cache.inv_all = l2x0_inv_all;
+ outer_cache.disable = l2x0_disable;
+
+ printk(KERN_INFO "%s cache controller enabled\n", type);
+ printk(KERN_INFO "l2x0: %d ways, CACHE_ID 0x%08x, AUX_CTRL 0x%08x, Cache size: %d B\n",
+ l2x0_ways, l2x0_cache_id, aux, l2x0_size);
+}
+
+#ifdef CONFIG_OF
+static void __init l2x0_of_setup(const struct device_node *np,
+ u32 *aux_val, u32 *aux_mask)
+{
+ u32 data[2] = { 0, 0 };
+ u32 tag = 0;
+ u32 dirty = 0;
+ u32 val = 0, mask = 0;
+
+ of_property_read_u32(np, "arm,tag-latency", &tag);
+ if (tag) {
+ mask |= L2X0_AUX_CTRL_TAG_LATENCY_MASK;
+ val |= (tag - 1) << L2X0_AUX_CTRL_TAG_LATENCY_SHIFT;
+ }
+
+ of_property_read_u32_array(np, "arm,data-latency",
+ data, ARRAY_SIZE(data));
+ if (data[0] && data[1]) {
+ mask |= L2X0_AUX_CTRL_DATA_RD_LATENCY_MASK |
+ L2X0_AUX_CTRL_DATA_WR_LATENCY_MASK;
+ val |= ((data[0] - 1) << L2X0_AUX_CTRL_DATA_RD_LATENCY_SHIFT) |
+ ((data[1] - 1) << L2X0_AUX_CTRL_DATA_WR_LATENCY_SHIFT);
+ }
+
+ of_property_read_u32(np, "arm,dirty-latency", &dirty);
+ if (dirty) {
+ mask |= L2X0_AUX_CTRL_DIRTY_LATENCY_MASK;
+ val |= (dirty - 1) << L2X0_AUX_CTRL_DIRTY_LATENCY_SHIFT;
+ }
+
+ *aux_val &= ~mask;
+ *aux_val |= val;
+ *aux_mask &= ~mask;
+}
+
+static void __init pl310_of_setup(const struct device_node *np,
+ u32 *aux_val, u32 *aux_mask)
+{
+ u32 data[3] = { 0, 0, 0 };
+ u32 tag[3] = { 0, 0, 0 };
+ u32 filter[2] = { 0, 0 };
+
+ of_property_read_u32_array(np, "arm,tag-latency", tag, ARRAY_SIZE(tag));
+ if (tag[0] && tag[1] && tag[2])
+ writel_relaxed(
+ ((tag[0] - 1) << L2X0_LATENCY_CTRL_RD_SHIFT) |
+ ((tag[1] - 1) << L2X0_LATENCY_CTRL_WR_SHIFT) |
+ ((tag[2] - 1) << L2X0_LATENCY_CTRL_SETUP_SHIFT),
+ l2x0_base + L2X0_TAG_LATENCY_CTRL);
+
+ of_property_read_u32_array(np, "arm,data-latency",
+ data, ARRAY_SIZE(data));
+ if (data[0] && data[1] && data[2])
+ writel_relaxed(
+ ((data[0] - 1) << L2X0_LATENCY_CTRL_RD_SHIFT) |
+ ((data[1] - 1) << L2X0_LATENCY_CTRL_WR_SHIFT) |
+ ((data[2] - 1) << L2X0_LATENCY_CTRL_SETUP_SHIFT),
+ l2x0_base + L2X0_DATA_LATENCY_CTRL);
+
+ of_property_read_u32_array(np, "arm,filter-ranges",
+ filter, ARRAY_SIZE(filter));
+ if (filter[1]) {
+ writel_relaxed(ALIGN(filter[0] + filter[1], SZ_1M),
+ l2x0_base + L2X0_ADDR_FILTER_END);
+ writel_relaxed((filter[0] & ~(SZ_1M - 1)) | L2X0_ADDR_FILTER_EN,
+ l2x0_base + L2X0_ADDR_FILTER_START);
+ }
+}
+
+static void __init pl310_save(void)
+{
+ u32 l2x0_revision = readl_relaxed(l2x0_base + L2X0_CACHE_ID) &
+ L2X0_CACHE_ID_RTL_MASK;
+
+ l2x0_saved_regs.tag_latency = readl_relaxed(l2x0_base +
+ L2X0_TAG_LATENCY_CTRL);
+ l2x0_saved_regs.data_latency = readl_relaxed(l2x0_base +
+ L2X0_DATA_LATENCY_CTRL);
+ l2x0_saved_regs.filter_end = readl_relaxed(l2x0_base +
+ L2X0_ADDR_FILTER_END);
+ l2x0_saved_regs.filter_start = readl_relaxed(l2x0_base +
+ L2X0_ADDR_FILTER_START);
+
+ if (l2x0_revision >= L2X0_CACHE_ID_RTL_R2P0) {
+ /*
+ * From r2p0, there is Prefetch offset/control register
+ */
+ l2x0_saved_regs.prefetch_ctrl = readl_relaxed(l2x0_base +
+ L2X0_PREFETCH_CTRL);
+ /*
+ * From r3p0, there is Power control register
+ */
+ if (l2x0_revision >= L2X0_CACHE_ID_RTL_R3P0)
+ l2x0_saved_regs.pwr_ctrl = readl_relaxed(l2x0_base +
+ L2X0_POWER_CTRL);
+ }
+}
+
+static void l2x0_resume(void)
+{
+ if (!(readl_relaxed(l2x0_base + L2X0_CTRL) & 1)) {
+ /* restore aux ctrl and enable l2 */
+ l2x0_unlock(readl_relaxed(l2x0_base + L2X0_CACHE_ID));
+
+ writel_relaxed(l2x0_saved_regs.aux_ctrl, l2x0_base +
+ L2X0_AUX_CTRL);
+
+ l2x0_inv_all();
+
+ writel_relaxed(1, l2x0_base + L2X0_CTRL);
+ }
+}
+
+static void pl310_resume(void)
+{
+ u32 l2x0_revision;
+
+ if (!(readl_relaxed(l2x0_base + L2X0_CTRL) & 1)) {
+ /* restore pl310 setup */
+ writel_relaxed(l2x0_saved_regs.tag_latency,
+ l2x0_base + L2X0_TAG_LATENCY_CTRL);
+ writel_relaxed(l2x0_saved_regs.data_latency,
+ l2x0_base + L2X0_DATA_LATENCY_CTRL);
+ writel_relaxed(l2x0_saved_regs.filter_end,
+ l2x0_base + L2X0_ADDR_FILTER_END);
+ writel_relaxed(l2x0_saved_regs.filter_start,
+ l2x0_base + L2X0_ADDR_FILTER_START);
+
+ l2x0_revision = readl_relaxed(l2x0_base + L2X0_CACHE_ID) &
+ L2X0_CACHE_ID_RTL_MASK;
+
+ if (l2x0_revision >= L2X0_CACHE_ID_RTL_R2P0) {
+ writel_relaxed(l2x0_saved_regs.prefetch_ctrl,
+ l2x0_base + L2X0_PREFETCH_CTRL);
+ if (l2x0_revision >= L2X0_CACHE_ID_RTL_R3P0)
+ writel_relaxed(l2x0_saved_regs.pwr_ctrl,
+ l2x0_base + L2X0_POWER_CTRL);
+ }
+ }
+
+ l2x0_resume();
+}
+
+static const struct l2x0_of_data pl310_data = {
+ pl310_of_setup,
+ pl310_save,
+ pl310_resume,
+};
+
+static const struct l2x0_of_data l2x0_data = {
+ l2x0_of_setup,
+ NULL,
+ l2x0_resume,
+};
+
+static const struct of_device_id l2x0_ids[] __initconst = {
+ { .compatible = "arm,pl310-cache", .data = (void *)&pl310_data },
+ { .compatible = "arm,l220-cache", .data = (void *)&l2x0_data },
+ { .compatible = "arm,l210-cache", .data = (void *)&l2x0_data },
+ {}
+};
+
+int __init l2x0_of_init(u32 aux_val, u32 aux_mask)
+{
+ struct device_node *np;
+ struct l2x0_of_data *data;
+ struct resource res;
+
+ np = of_find_matching_node(NULL, l2x0_ids);
+ if (!np)
+ return -ENODEV;
+
+ if (of_address_to_resource(np, 0, &res))
+ return -ENODEV;
+
+ l2x0_base = ioremap(res.start, resource_size(&res));
+ if (!l2x0_base)
+ return -ENOMEM;
+
+ l2x0_saved_regs.phy_base = res.start;
+
+ data = of_match_node(l2x0_ids, np)->data;
+
+ /* L2 configuration can only be changed if the cache is disabled */
+ if (!(readl_relaxed(l2x0_base + L2X0_CTRL) & 1)) {
+ if (data->setup)
+ data->setup(np, &aux_val, &aux_mask);
+ }
+
+ if (data->save)
+ data->save();
+
+ l2x0_init(l2x0_base, aux_val, aux_mask);
+
+ outer_cache.resume = data->resume;
+ return 0;
+}
+#endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-tauros2.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-tauros2.c
new file mode 100644
index 0000000..1fbca05
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-tauros2.c
@@ -0,0 +1,264 @@
+/*
+ * arch/arm/mm/cache-tauros2.c - Tauros2 L2 cache controller support
+ *
+ * Copyright (C) 2008 Marvell Semiconductor
+ *
+ * This file is licensed under the terms of the GNU General Public
+ * License version 2. This program is licensed "as is" without any
+ * warranty of any kind, whether express or implied.
+ *
+ * References:
+ * - PJ1 CPU Core Datasheet,
+ * Document ID MV-S104837-01, Rev 0.7, January 24 2008.
+ * - PJ4 CPU Core Datasheet,
+ * Document ID MV-S105190-00, Rev 0.7, March 14 2008.
+ */
+
+#include <linux/init.h>
+#include <asm/cacheflush.h>
+#include <asm/cp15.h>
+#include <asm/hardware/cache-tauros2.h>
+
+
+/*
+ * When Tauros2 is used on a CPU that supports the v7 hierarchical
+ * cache operations, the cache handling code in proc-v7.S takes care
+ * of everything, including handling DMA coherency.
+ *
+ * So, we only need to register outer cache operations here if we're
+ * being used on a pre-v7 CPU, and we only need to build support for
+ * outer cache operations into the kernel image if the kernel has been
+ * configured to support a pre-v7 CPU.
+ */
+#if __LINUX_ARM_ARCH__ < 7
+/*
+ * Low-level cache maintenance operations.
+ */
+static inline void tauros2_clean_pa(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c7, c11, 3" : : "r" (addr));
+}
+
+static inline void tauros2_clean_inv_pa(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c7, c15, 3" : : "r" (addr));
+}
+
+static inline void tauros2_inv_pa(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c7, c7, 3" : : "r" (addr));
+}
+
+
+/*
+ * Linux primitives.
+ *
+ * Note that the end addresses passed to Linux primitives are
+ * noninclusive.
+ */
+#define CACHE_LINE_SIZE 32
+
+static void tauros2_inv_range(unsigned long start, unsigned long end)
+{
+ /*
+ * Clean and invalidate partial first cache line.
+ */
+ if (start & (CACHE_LINE_SIZE - 1)) {
+ tauros2_clean_inv_pa(start & ~(CACHE_LINE_SIZE - 1));
+ start = (start | (CACHE_LINE_SIZE - 1)) + 1;
+ }
+
+ /*
+ * Clean and invalidate partial last cache line.
+ */
+ if (end & (CACHE_LINE_SIZE - 1)) {
+ tauros2_clean_inv_pa(end & ~(CACHE_LINE_SIZE - 1));
+ end &= ~(CACHE_LINE_SIZE - 1);
+ }
+
+ /*
+ * Invalidate all full cache lines between 'start' and 'end'.
+ */
+ while (start < end) {
+ tauros2_inv_pa(start);
+ start += CACHE_LINE_SIZE;
+ }
+
+ dsb();
+}
+
+static void tauros2_clean_range(unsigned long start, unsigned long end)
+{
+ start &= ~(CACHE_LINE_SIZE - 1);
+ while (start < end) {
+ tauros2_clean_pa(start);
+ start += CACHE_LINE_SIZE;
+ }
+
+ dsb();
+}
+
+static void tauros2_flush_range(unsigned long start, unsigned long end)
+{
+ start &= ~(CACHE_LINE_SIZE - 1);
+ while (start < end) {
+ tauros2_clean_inv_pa(start);
+ start += CACHE_LINE_SIZE;
+ }
+
+ dsb();
+}
+#endif
+
+static inline u32 __init read_extra_features(void)
+{
+ u32 u;
+
+ __asm__("mrc p15, 1, %0, c15, c1, 0" : "=r" (u));
+
+ return u;
+}
+
+static inline void __init write_extra_features(u32 u)
+{
+ __asm__("mcr p15, 1, %0, c15, c1, 0" : : "r" (u));
+}
+
+static void __init disable_l2_prefetch(void)
+{
+ u32 u;
+
+ /*
+ * Read the CPU Extra Features register and verify that the
+ * Disable L2 Prefetch bit is set.
+ */
+ u = read_extra_features();
+ if (!(u & 0x01000000)) {
+ printk(KERN_INFO "Tauros2: Disabling L2 prefetch.\n");
+ write_extra_features(u | 0x01000000);
+ }
+}
+
+static inline int __init cpuid_scheme(void)
+{
+ extern int processor_id;
+
+ return !!((processor_id & 0x000f0000) == 0x000f0000);
+}
+
+static inline u32 __init read_mmfr3(void)
+{
+ u32 mmfr3;
+
+ __asm__("mrc p15, 0, %0, c0, c1, 7\n" : "=r" (mmfr3));
+
+ return mmfr3;
+}
+
+static inline u32 __init read_actlr(void)
+{
+ u32 actlr;
+
+ __asm__("mrc p15, 0, %0, c1, c0, 1\n" : "=r" (actlr));
+
+ return actlr;
+}
+
+static inline void __init write_actlr(u32 actlr)
+{
+ __asm__("mcr p15, 0, %0, c1, c0, 1\n" : : "r" (actlr));
+}
+
+void __init tauros2_init(void)
+{
+ extern int processor_id;
+ char *mode;
+
+ disable_l2_prefetch();
+
+#ifdef CONFIG_CPU_32v5
+ if ((processor_id & 0xff0f0000) == 0x56050000) {
+ u32 feat;
+
+ /*
+ * v5 CPUs with Tauros2 have the L2 cache enable bit
+ * located in the CPU Extra Features register.
+ */
+ feat = read_extra_features();
+ if (!(feat & 0x00400000)) {
+ printk(KERN_INFO "Tauros2: Enabling L2 cache.\n");
+ write_extra_features(feat | 0x00400000);
+ }
+
+ mode = "ARMv5";
+ outer_cache.inv_range = tauros2_inv_range;
+ outer_cache.clean_range = tauros2_clean_range;
+ outer_cache.flush_range = tauros2_flush_range;
+ }
+#endif
+
+#ifdef CONFIG_CPU_32v6
+ /*
+ * Check whether this CPU lacks support for the v7 hierarchical
+ * cache ops. (PJ4 is in its v6 personality mode if the MMFR3
+ * register indicates no support for the v7 hierarchical cache
+ * ops.)
+ */
+ if (cpuid_scheme() && (read_mmfr3() & 0xf) == 0) {
+ /*
+ * When Tauros2 is used in an ARMv6 system, the L2
+ * enable bit is in the ARMv6 ARM-mandated position
+ * (bit [26] of the System Control Register).
+ */
+ if (!(get_cr() & 0x04000000)) {
+ printk(KERN_INFO "Tauros2: Enabling L2 cache.\n");
+ adjust_cr(0x04000000, 0x04000000);
+ }
+
+ mode = "ARMv6";
+ outer_cache.inv_range = tauros2_inv_range;
+ outer_cache.clean_range = tauros2_clean_range;
+ outer_cache.flush_range = tauros2_flush_range;
+ }
+#endif
+
+#ifdef CONFIG_CPU_32v7
+ /*
+ * Check whether this CPU has support for the v7 hierarchical
+ * cache ops. (PJ4 is in its v7 personality mode if the MMFR3
+ * register indicates support for the v7 hierarchical cache
+ * ops.)
+ *
+ * (Although strictly speaking there may exist CPUs that
+ * implement the v7 cache ops but are only ARMv6 CPUs (due to
+ * not complying with all of the other ARMv7 requirements),
+ * there are no real-life examples of Tauros2 being used on
+ * such CPUs as of yet.)
+ */
+ if (cpuid_scheme() && (read_mmfr3() & 0xf) == 1) {
+ u32 actlr;
+
+ /*
+ * When Tauros2 is used in an ARMv7 system, the L2
+ * enable bit is located in the Auxiliary System Control
+ * Register (which is the only register allowed by the
+ * ARMv7 spec to contain fine-grained cache control bits).
+ */
+ actlr = read_actlr();
+ if (!(actlr & 0x00000002)) {
+ printk(KERN_INFO "Tauros2: Enabling L2 cache.\n");
+ write_actlr(actlr | 0x00000002);
+ }
+
+ mode = "ARMv7";
+ }
+#endif
+
+ if (mode == NULL) {
+ printk(KERN_CRIT "Tauros2: Unable to detect CPU mode.\n");
+ return;
+ }
+
+ printk(KERN_INFO "Tauros2: L2 cache support initialised "
+ "in %s mode.\n", mode);
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v3.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v3.S
new file mode 100644
index 0000000..c2301f2
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v3.S
@@ -0,0 +1,133 @@
+/*
+ * linux/arch/arm/mm/cache-v3.S
+ *
+ * Copyright (C) 1997-2002 Russell king
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/page.h>
+#include "proc-macros.S"
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(v3_flush_icache_all)
+ mov pc, lr
+ENDPROC(v3_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ *
+ * - mm - mm_struct describing address space
+ */
+ENTRY(v3_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(v3_flush_kern_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - flags - vma_area_struct flags describing address space
+ */
+ENTRY(v3_flush_user_cache_range)
+ mov ip, #0
+ mcreq p15, 0, ip, c7, c0, 0 @ flush ID cache
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v3_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v3_coherent_user_range)
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *page, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(v3_flush_kern_dcache_area)
+ /* FALLTHROUGH */
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v3_dma_flush_range)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c0, 0 @ flush ID cache
+ mov pc, lr
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v3_dma_unmap_area)
+ teq r2, #DMA_TO_DEVICE
+ bne v3_dma_flush_range
+ /* FALLTHROUGH */
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v3_dma_map_area)
+ mov pc, lr
+ENDPROC(v3_dma_unmap_area)
+ENDPROC(v3_dma_map_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions v3
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4.S
new file mode 100644
index 0000000..fd9bb7a
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4.S
@@ -0,0 +1,145 @@
+/*
+ * linux/arch/arm/mm/cache-v4.S
+ *
+ * Copyright (C) 1997-2002 Russell king
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/page.h>
+#include "proc-macros.S"
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(v4_flush_icache_all)
+ mov pc, lr
+ENDPROC(v4_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ *
+ * - mm - mm_struct describing address space
+ */
+ENTRY(v4_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(v4_flush_kern_cache_all)
+#ifdef CONFIG_CPU_CP15
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7, 0 @ flush ID cache
+ mov pc, lr
+#else
+ /* FALLTHROUGH */
+#endif
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - flags - vma_area_struct flags describing address space
+ */
+ENTRY(v4_flush_user_cache_range)
+#ifdef CONFIG_CPU_CP15
+ mov ip, #0
+ mcreq p15, 0, ip, c7, c7, 0 @ flush ID cache
+ mov pc, lr
+#else
+ /* FALLTHROUGH */
+#endif
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4_coherent_user_range)
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(v4_flush_kern_dcache_area)
+ /* FALLTHROUGH */
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4_dma_flush_range)
+#ifdef CONFIG_CPU_CP15
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7, 0 @ flush ID cache
+#endif
+ mov pc, lr
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v4_dma_unmap_area)
+ teq r2, #DMA_TO_DEVICE
+ bne v4_dma_flush_range
+ /* FALLTHROUGH */
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v4_dma_map_area)
+ mov pc, lr
+ENDPROC(v4_dma_unmap_area)
+ENDPROC(v4_dma_map_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions v4
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4wb.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4wb.S
new file mode 100644
index 0000000..4f2c141
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4wb.S
@@ -0,0 +1,257 @@
+/*
+ * linux/arch/arm/mm/cache-v4wb.S
+ *
+ * Copyright (C) 1997-2002 Russell king
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/memory.h>
+#include <asm/page.h>
+#include "proc-macros.S"
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The total size of the data cache.
+ */
+#if defined(CONFIG_CPU_SA110)
+# define CACHE_DSIZE 16384
+#elif defined(CONFIG_CPU_SA1100)
+# define CACHE_DSIZE 8192
+#else
+# error Unknown cache size
+#endif
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ *
+ * Size Clean (ticks) Dirty (ticks)
+ * 4096 21 20 21 53 55 54
+ * 8192 40 41 40 106 100 102
+ * 16384 77 77 76 140 140 138
+ * 32768 150 149 150 214 216 212 <---
+ * 65536 296 297 296 351 358 361
+ * 131072 591 591 591 656 657 651
+ * Whole 132 136 132 221 217 207 <---
+ */
+#define CACHE_DLIMIT (CACHE_DSIZE * 4)
+
+ .data
+flush_base:
+ .long FLUSH_BASE
+ .text
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(v4wb_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(v4wb_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(v4wb_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(v4wb_flush_kern_cache_all)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+__flush_whole_cache:
+ ldr r3, =flush_base
+ ldr r1, [r3, #0]
+ eor r1, r1, #CACHE_DSIZE
+ str r1, [r3, #0]
+ add r2, r1, #CACHE_DSIZE
+1: ldr r3, [r1], #32
+ cmp r1, r2
+ blo 1b
+#ifdef FLUSH_BASE_MINICACHE
+ add r2, r2, #FLUSH_BASE_MINICACHE - FLUSH_BASE
+ sub r1, r2, #512 @ only 512 bytes
+1: ldr r3, [r1], #32
+ cmp r1, r2
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive, page aligned)
+ * - end - end address (exclusive, page aligned)
+ * - flags - vma_area_struct flags describing address space
+ */
+ENTRY(v4wb_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ tst r2, #VM_EXEC @ executable region?
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+
+ cmp r3, #CACHE_DLIMIT @ total size >= limit?
+ bhs __flush_whole_cache @ flush whole D cache
+
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(v4wb_flush_kern_dcache_area)
+ add r1, r0, r1
+ /* fall through */
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4wb_coherent_kern_range)
+ /* fall through */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4wb_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov ip, #0
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+v4wb_dma_inv_range:
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean (write back) the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+v4wb_dma_clean_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * This is actually the same as v4wb_coherent_kern_range()
+ */
+ .globl v4wb_dma_flush_range
+ .set v4wb_dma_flush_range, v4wb_coherent_kern_range
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v4wb_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq v4wb_dma_clean_range
+ bcs v4wb_dma_inv_range
+ b v4wb_dma_flush_range
+ENDPROC(v4wb_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v4wb_dma_unmap_area)
+ mov pc, lr
+ENDPROC(v4wb_dma_unmap_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions v4wb
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4wt.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4wt.S
new file mode 100644
index 0000000..4d7b467
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v4wt.S
@@ -0,0 +1,201 @@
+/*
+ * linux/arch/arm/mm/cache-v4wt.S
+ *
+ * Copyright (C) 1997-2002 Russell king
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARMv4 write through cache operations support.
+ *
+ * We assume that the write buffer is not enabled.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/page.h>
+#include "proc-macros.S"
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 8
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ *
+ * *** This needs benchmarking
+ */
+#define CACHE_DLIMIT 16384
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(v4wt_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(v4wt_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(v4wt_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(v4wt_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive, page aligned)
+ * - end - end address (exclusive, page aligned)
+ * - flags - vma_area_struct flags describing address space
+ */
+ENTRY(v4wt_flush_user_cache_range)
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4wt_coherent_kern_range)
+ /* FALLTRHOUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(v4wt_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(v4wt_flush_kern_dcache_area)
+ mov r2, #0
+ mcr p15, 0, r2, c7, c5, 0 @ invalidate I cache
+ add r1, r0, r1
+ /* fallthrough */
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+v4wt_dma_inv_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ .globl v4wt_dma_flush_range
+ .equ v4wt_dma_flush_range, v4wt_dma_inv_range
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v4wt_dma_unmap_area)
+ add r1, r1, r0
+ teq r2, #DMA_TO_DEVICE
+ bne v4wt_dma_inv_range
+ /* FALLTHROUGH */
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v4wt_dma_map_area)
+ mov pc, lr
+ENDPROC(v4wt_dma_unmap_area)
+ENDPROC(v4wt_dma_map_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions v4wt
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v6.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v6.S
new file mode 100644
index 0000000..2edb6f6
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v6.S
@@ -0,0 +1,351 @@
+/*
+ * linux/arch/arm/mm/cache-v6.S
+ *
+ * Copyright (C) 2001 Deep Blue Solutions Ltd.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This is the "shell" of the ARMv6 processor support.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/unwind.h>
+
+#include "proc-macros.S"
+
+#define HARVARD_CACHE
+#define CACHE_LINE_SIZE 32
+#define D_CACHE_LINE_SIZE 32
+#define BTB_FLUSH_SIZE 8
+
+/*
+ * v6_flush_icache_all()
+ *
+ * Flush the whole I-cache.
+ *
+ * ARM1136 erratum 411920 - Invalidate Instruction Cache operation can fail.
+ * This erratum is present in 1136, 1156 and 1176. It does not affect the
+ * MPCore.
+ *
+ * Registers:
+ * r0 - set to 0
+ * r1 - corrupted
+ */
+ENTRY(v6_flush_icache_all)
+ mov r0, #0
+#ifdef CONFIG_ARM_ERRATA_411920
+ mrs r1, cpsr
+ cpsid ifa @ disable interrupts
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate entire I-cache
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate entire I-cache
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate entire I-cache
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate entire I-cache
+ msr cpsr_cx, r1 @ restore interrupts
+ .rept 11 @ ARM Ltd recommends at least
+ nop @ 11 NOPs
+ .endr
+#else
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I-cache
+#endif
+ mov pc, lr
+ENDPROC(v6_flush_icache_all)
+
+/*
+ * v6_flush_cache_all()
+ *
+ * Flush the entire cache.
+ *
+ * It is assumed that:
+ */
+ENTRY(v6_flush_kern_cache_all)
+ mov r0, #0
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c14, 0 @ D cache clean+invalidate
+#ifndef CONFIG_ARM_ERRATA_411920
+ mcr p15, 0, r0, c7, c5, 0 @ I+BTB cache invalidate
+#else
+ b v6_flush_icache_all
+#endif
+#else
+ mcr p15, 0, r0, c7, c15, 0 @ Cache clean+invalidate
+#endif
+ mov pc, lr
+
+/*
+ * v6_flush_cache_all()
+ *
+ * Flush all TLB entries in a particular address space
+ *
+ * - mm - mm_struct describing address space
+ */
+ENTRY(v6_flush_user_cache_all)
+ /*FALLTHROUGH*/
+
+/*
+ * v6_flush_cache_range(start, end, flags)
+ *
+ * Flush a range of TLB entries in the specified address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - flags - vm_area_struct flags describing address space
+ *
+ * It is assumed that:
+ * - we have a VIPT cache.
+ */
+ENTRY(v6_flush_user_cache_range)
+ mov pc, lr
+
+/*
+ * v6_coherent_kern_range(start,end)
+ *
+ * Ensure that the I and D caches are coherent within specified
+ * region. This is typically used when code has been written to
+ * a memory region, and will be executed.
+ *
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ *
+ * It is assumed that:
+ * - the Icache does not read data from the write buffer
+ */
+ENTRY(v6_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * v6_coherent_user_range(start,end)
+ *
+ * Ensure that the I and D caches are coherent within specified
+ * region. This is typically used when code has been written to
+ * a memory region, and will be executed.
+ *
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ *
+ * It is assumed that:
+ * - the Icache does not read data from the write buffer
+ */
+ENTRY(v6_coherent_user_range)
+ UNWIND(.fnstart )
+#ifdef HARVARD_CACHE
+ bic r0, r0, #CACHE_LINE_SIZE - 1
+1:
+ USER( mcr p15, 0, r0, c7, c10, 1 ) @ clean D line
+ add r0, r0, #CACHE_LINE_SIZE
+2:
+ cmp r0, r1
+ blo 1b
+#endif
+ mov r0, #0
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+#ifndef CONFIG_ARM_ERRATA_411920
+ mcr p15, 0, r0, c7, c5, 0 @ I+BTB cache invalidate
+#else
+ b v6_flush_icache_all
+#endif
+#else
+ mcr p15, 0, r0, c7, c5, 6 @ invalidate BTB
+#endif
+ mov pc, lr
+
+/*
+ * Fault handling for the cache operation above. If the virtual address in r0
+ * isn't mapped, just try the next page.
+ */
+9001:
+ mov r0, r0, lsr #12
+ mov r0, r0, lsl #12
+ add r0, r0, #4096
+ b 2b
+ UNWIND(.fnend )
+ENDPROC(v6_coherent_user_range)
+ENDPROC(v6_coherent_kern_range)
+
+/*
+ * v6_flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure that the data held in the page kaddr is written back
+ * to the page in question.
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(v6_flush_kern_dcache_area)
+ add r1, r0, r1
+ bic r0, r0, #D_CACHE_LINE_SIZE - 1
+1:
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c14, 1 @ clean & invalidate D line
+#else
+ mcr p15, 0, r0, c7, c15, 1 @ clean & invalidate unified line
+#endif
+ add r0, r0, #D_CACHE_LINE_SIZE
+ cmp r0, r1
+ blo 1b
+#ifdef HARVARD_CACHE
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4
+#endif
+ mov pc, lr
+
+
+/*
+ * v6_dma_inv_range(start,end)
+ *
+ * Invalidate the data cache within the specified region; we will
+ * be performing a DMA operation in this region and we want to
+ * purge old data in the cache.
+ *
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+v6_dma_inv_range:
+#ifdef CONFIG_DMA_CACHE_RWFO
+ ldrb r2, [r0] @ read for ownership
+ strb r2, [r0] @ write for ownership
+#endif
+ tst r0, #D_CACHE_LINE_SIZE - 1
+ bic r0, r0, #D_CACHE_LINE_SIZE - 1
+#ifdef HARVARD_CACHE
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D line
+#else
+ mcrne p15, 0, r0, c7, c11, 1 @ clean unified line
+#endif
+ tst r1, #D_CACHE_LINE_SIZE - 1
+#ifdef CONFIG_DMA_CACHE_RWFO
+ ldrneb r2, [r1, #-1] @ read for ownership
+ strneb r2, [r1, #-1] @ write for ownership
+#endif
+ bic r1, r1, #D_CACHE_LINE_SIZE - 1
+#ifdef HARVARD_CACHE
+ mcrne p15, 0, r1, c7, c14, 1 @ clean & invalidate D line
+#else
+ mcrne p15, 0, r1, c7, c15, 1 @ clean & invalidate unified line
+#endif
+1:
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D line
+#else
+ mcr p15, 0, r0, c7, c7, 1 @ invalidate unified line
+#endif
+ add r0, r0, #D_CACHE_LINE_SIZE
+ cmp r0, r1
+#ifdef CONFIG_DMA_CACHE_RWFO
+ ldrlo r2, [r0] @ read for ownership
+ strlo r2, [r0] @ write for ownership
+#endif
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * v6_dma_clean_range(start,end)
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+v6_dma_clean_range:
+ bic r0, r0, #D_CACHE_LINE_SIZE - 1
+1:
+#ifdef CONFIG_DMA_CACHE_RWFO
+ ldr r2, [r0] @ read for ownership
+#endif
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D line
+#else
+ mcr p15, 0, r0, c7, c11, 1 @ clean unified line
+#endif
+ add r0, r0, #D_CACHE_LINE_SIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+/*
+ * v6_dma_flush_range(start,end)
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+ENTRY(v6_dma_flush_range)
+#ifdef CONFIG_CACHE_FLUSH_RANGE_LIMIT
+ sub r2, r1, r0
+ cmp r2, #CONFIG_CACHE_FLUSH_RANGE_LIMIT
+ bhi v6_dma_flush_dcache_all
+#endif
+#ifdef CONFIG_DMA_CACHE_RWFO
+ ldrb r2, [r0] @ read for ownership
+ strb r2, [r0] @ write for ownership
+#endif
+ bic r0, r0, #D_CACHE_LINE_SIZE - 1
+1:
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c14, 1 @ clean & invalidate D line
+#else
+ mcr p15, 0, r0, c7, c15, 1 @ clean & invalidate line
+#endif
+ add r0, r0, #D_CACHE_LINE_SIZE
+ cmp r0, r1
+#ifdef CONFIG_DMA_CACHE_RWFO
+ ldrlob r2, [r0] @ read for ownership
+ strlob r2, [r0] @ write for ownership
+#endif
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+
+#ifdef CONFIG_CACHE_FLUSH_RANGE_LIMIT
+v6_dma_flush_dcache_all:
+ mov r0, #0
+#ifdef HARVARD_CACHE
+ mcr p15, 0, r0, c7, c14, 0 @ D cache clean+invalidate
+#else
+ mcr p15, 0, r0, c7, c15, 0 @ Cache clean+invalidate
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mov pc, lr
+#endif
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v6_dma_map_area)
+ add r1, r1, r0
+ teq r2, #DMA_FROM_DEVICE
+ beq v6_dma_inv_range
+#ifndef CONFIG_DMA_CACHE_RWFO
+ b v6_dma_clean_range
+#else
+ teq r2, #DMA_TO_DEVICE
+ beq v6_dma_clean_range
+ b v6_dma_flush_range
+#endif
+ENDPROC(v6_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v6_dma_unmap_area)
+#ifndef CONFIG_DMA_CACHE_RWFO
+ add r1, r1, r0
+ teq r2, #DMA_TO_DEVICE
+ bne v6_dma_inv_range
+#endif
+ mov pc, lr
+ENDPROC(v6_dma_unmap_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions v6
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v7.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v7.S
new file mode 100644
index 0000000..d2dc5e6
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-v7.S
@@ -0,0 +1,427 @@
+/*
+ * linux/arch/arm/mm/cache-v7.S
+ *
+ * Copyright (C) 2001 Deep Blue Solutions Ltd.
+ * Copyright (C) 2005 ARM Ltd.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This is the "shell" of the ARMv7 processor support.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/unwind.h>
+
+#include "proc-macros.S"
+
+/*
+ * v7_flush_icache_all()
+ *
+ * Flush the whole I-cache.
+ *
+ * Registers:
+ * r0 - set to 0
+ */
+ENTRY(v7_flush_icache_all)
+ mov r0, #0
+ ALT_SMP(mcr p15, 0, r0, c7, c1, 0) @ invalidate I-cache inner shareable
+ ALT_UP(mcr p15, 0, r0, c7, c5, 0) @ I+BTB cache invalidate
+ mov pc, lr
+ENDPROC(v7_flush_icache_all)
+
+
+/*
+ * v7_invalidate_dcache_all()
+ *
+ * invalidateh the whole D-cache.
+ *
+ * Corrupted registers: r0-r7, r9-r11 (r6 only in Thumb mode)
+ *
+ * - mm - mm_struct describing address space
+ *
+ * created by xuzhiguo to fix a bug on D cache when zx297510 power on reset
+ */
+
+ENTRY(v7_invalidate_dcache_all)
+ dmb @ ensure ordering with previous memory accesses
+ mrc p15, 1, r0, c0, c0, 1 @ read clidr
+ ands r3, r0, #0x7000000 @ extract loc from clidr
+ mov r3, r3, lsr #23 @ left align loc bit field
+ beq finished0 @ if loc is 0, then no need to clean
+ mov r10, #0 @ start clean at cache level 0
+loop01:
+ add r2, r10, r10, lsr #1 @ work out 3x current cache level
+ mov r1, r0, lsr r2 @ extract cache type bits from clidr
+ and r1, r1, #7 @ mask of the bits for current cache only
+ cmp r1, #2 @ see what cache we have at this level
+ blt skip0 @ skip if no cache, or just i-cache
+#ifdef CONFIG_PREEMPT
+ save_and_disable_irqs_notrace r9 @ make cssr&csidr read atomic
+#endif
+ mcr p15, 2, r10, c0, c0, 0 @ select current cache level in cssr
+ isb @ isb to sych the new cssr&csidr
+ mrc p15, 1, r1, c0, c0, 0 @ read the new csidr
+#ifdef CONFIG_PREEMPT
+ restore_irqs_notrace r9
+#endif
+ and r2, r1, #7 @ extract the length of the cache lines
+ add r2, r2, #4 @ add 4 (line length offset)
+ ldr r4, =0x3ff
+ ands r4, r4, r1, lsr #3 @ find maximum number on the way size
+ clz r5, r4 @ find bit position of way size increment
+ ldr r7, =0x7fff
+ ands r7, r7, r1, lsr #13 @ extract max number of the index size
+loop02:
+ mov r9, r4 @ create working copy of max way size
+loop03:
+ ARM( orr r11, r10, r9, lsl r5 ) @ factor way and cache number into r11
+ THUMB( lsl r6, r9, r5 )
+ THUMB( orr r11, r10, r6 ) @ factor way and cache number into r11
+ ARM( orr r11, r11, r7, lsl r2 ) @ factor index number into r11
+ THUMB( lsl r6, r7, r2 )
+ THUMB( orr r11, r11, r6 ) @ factor index number into r11
+ @mcr p15, 0, r11, c7, c14, 2 @ clean & invalidate by set/way
+ mcr p15, 0, r11, c7, c6, 2 @ invalidate by set/way on zx297510 only
+ subs r9, r9, #1 @ decrement the way
+ bge loop03
+ subs r7, r7, #1 @ decrement the index
+ bge loop02
+skip0:
+ add r10, r10, #2 @ increment cache number
+ cmp r3, r10
+ bgt loop01
+finished0:
+ mov r10, #0 @ swith back to cache level 0
+ mcr p15, 2, r10, c0, c0, 0 @ select current cache level in cssr
+ dsb
+ isb
+ mov pc, lr
+ENDPROC(v7_invalidate_dcache_all)
+
+/*
+ * v7_flush_dcache_all()
+ *
+ * Flush the whole D-cache.
+ *
+ * Corrupted registers: r0-r7, r9-r11 (r6 only in Thumb mode)
+ *
+ * - mm - mm_struct describing address space
+ */
+ENTRY(v7_flush_dcache_all)
+ dmb @ ensure ordering with previous memory accesses
+ mrc p15, 1, r0, c0, c0, 1 @ read clidr
+ ands r3, r0, #0x7000000 @ extract loc from clidr
+ mov r3, r3, lsr #23 @ left align loc bit field
+ beq finished @ if loc is 0, then no need to clean
+ mov r10, #0 @ start clean at cache level 0
+loop1:
+ add r2, r10, r10, lsr #1 @ work out 3x current cache level
+ mov r1, r0, lsr r2 @ extract cache type bits from clidr
+ and r1, r1, #7 @ mask of the bits for current cache only
+ cmp r1, #2 @ see what cache we have at this level
+ blt skip @ skip if no cache, or just i-cache
+#ifdef CONFIG_PREEMPT
+ save_and_disable_irqs_notrace r9 @ make cssr&csidr read atomic
+#endif
+ mcr p15, 2, r10, c0, c0, 0 @ select current cache level in cssr
+ isb @ isb to sych the new cssr&csidr
+ mrc p15, 1, r1, c0, c0, 0 @ read the new csidr
+#ifdef CONFIG_PREEMPT
+ restore_irqs_notrace r9
+#endif
+ and r2, r1, #7 @ extract the length of the cache lines
+ add r2, r2, #4 @ add 4 (line length offset)
+ ldr r4, =0x3ff
+ ands r4, r4, r1, lsr #3 @ find maximum number on the way size
+ clz r5, r4 @ find bit position of way size increment
+ ldr r7, =0x7fff
+ ands r7, r7, r1, lsr #13 @ extract max number of the index size
+loop2:
+ mov r9, r4 @ create working copy of max way size
+loop3:
+ ARM( orr r11, r10, r9, lsl r5 ) @ factor way and cache number into r11
+ THUMB( lsl r6, r9, r5 )
+ THUMB( orr r11, r10, r6 ) @ factor way and cache number into r11
+ ARM( orr r11, r11, r7, lsl r2 ) @ factor index number into r11
+ THUMB( lsl r6, r7, r2 )
+ THUMB( orr r11, r11, r6 ) @ factor index number into r11
+ mcr p15, 0, r11, c7, c14, 2 @ clean & invalidate by set/way
+ subs r9, r9, #1 @ decrement the way
+ bge loop3
+ subs r7, r7, #1 @ decrement the index
+ bge loop2
+skip:
+ add r10, r10, #2 @ increment cache number
+ cmp r3, r10
+ bgt loop1
+finished:
+ mov r10, #0 @ swith back to cache level 0
+ mcr p15, 2, r10, c0, c0, 0 @ select current cache level in cssr
+ dsb
+ isb
+ mov pc, lr
+ENDPROC(v7_flush_dcache_all)
+
+/*
+ * v7_flush_cache_all()
+ *
+ * Flush the entire cache system.
+ * The data cache flush is now achieved using atomic clean / invalidates
+ * working outwards from L1 cache. This is done using Set/Way based cache
+ * maintenance instructions.
+ * The instruction cache can still be invalidated back to the point of
+ * unification in a single instruction.
+ *
+ */
+ENTRY(v7_flush_kern_cache_all)
+ ARM( stmfd sp!, {r4-r5, r7, r9-r11, lr} )
+ THUMB( stmfd sp!, {r4-r7, r9-r11, lr} )
+ bl v7_flush_dcache_all
+ mov r0, #0
+ ALT_SMP(mcr p15, 0, r0, c7, c1, 0) @ invalidate I-cache inner shareable
+ ALT_UP(mcr p15, 0, r0, c7, c5, 0) @ I+BTB cache invalidate
+ ARM( ldmfd sp!, {r4-r5, r7, r9-r11, lr} )
+ THUMB( ldmfd sp!, {r4-r7, r9-r11, lr} )
+ mov pc, lr
+ENDPROC(v7_flush_kern_cache_all)
+
+/*
+ * v7_flush_cache_all()
+ *
+ * Flush all TLB entries in a particular address space
+ *
+ * - mm - mm_struct describing address space
+ */
+ENTRY(v7_flush_user_cache_all)
+ /*FALLTHROUGH*/
+
+/*
+ * v7_flush_cache_range(start, end, flags)
+ *
+ * Flush a range of TLB entries in the specified address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - flags - vm_area_struct flags describing address space
+ *
+ * It is assumed that:
+ * - we have a VIPT cache.
+ */
+ENTRY(v7_flush_user_cache_range)
+ mov pc, lr
+ENDPROC(v7_flush_user_cache_all)
+ENDPROC(v7_flush_user_cache_range)
+
+/*
+ * v7_coherent_kern_range(start,end)
+ *
+ * Ensure that the I and D caches are coherent within specified
+ * region. This is typically used when code has been written to
+ * a memory region, and will be executed.
+ *
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ *
+ * It is assumed that:
+ * - the Icache does not read data from the write buffer
+ */
+ENTRY(v7_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * v7_coherent_user_range(start,end)
+ *
+ * Ensure that the I and D caches are coherent within specified
+ * region. This is typically used when code has been written to
+ * a memory region, and will be executed.
+ *
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ *
+ * It is assumed that:
+ * - the Icache does not read data from the write buffer
+ */
+ENTRY(v7_coherent_user_range)
+ UNWIND(.fnstart )
+ dcache_line_size r2, r3
+ sub r3, r2, #1
+ bic r12, r0, r3
+#ifdef CONFIG_ARM_ERRATA_764369
+ ALT_SMP(W(dsb))
+ ALT_UP(W(nop))
+#endif
+1:
+ USER( mcr p15, 0, r12, c7, c11, 1 ) @ clean D line to the point of unification
+ add r12, r12, r2
+ cmp r12, r1
+ blo 1b
+ dsb
+ icache_line_size r2, r3
+ sub r3, r2, #1
+ bic r12, r0, r3
+2:
+ USER( mcr p15, 0, r12, c7, c5, 1 ) @ invalidate I line
+ add r12, r12, r2
+ cmp r12, r1
+ blo 2b
+3:
+ mov r0, #0
+ ALT_SMP(mcr p15, 0, r0, c7, c1, 6) @ invalidate BTB Inner Shareable
+ ALT_UP(mcr p15, 0, r0, c7, c5, 6) @ invalidate BTB
+ dsb
+ isb
+ mov pc, lr
+
+/*
+ * Fault handling for the cache operation above. If the virtual address in r0
+ * isn't mapped, just try the next page.
+ */
+9001:
+#ifdef CONFIG_ARM_ERRATA_775420
+ dsb
+#endif
+ mov r12, r12, lsr #12
+ mov r12, r12, lsl #12
+ add r12, r12, #4096
+ b 3b
+ UNWIND(.fnend )
+ENDPROC(v7_coherent_kern_range)
+ENDPROC(v7_coherent_user_range)
+
+/*
+ * v7_flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure that the data held in the page kaddr is written back
+ * to the page in question.
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(v7_flush_kern_dcache_area)
+ dcache_line_size r2, r3
+ add r1, r0, r1
+ sub r3, r2, #1
+ bic r0, r0, r3
+#ifdef CONFIG_ARM_ERRATA_764369
+ ALT_SMP(W(dsb))
+ ALT_UP(W(nop))
+#endif
+1:
+ mcr p15, 0, r0, c7, c14, 1 @ clean & invalidate D line / unified line
+ add r0, r0, r2
+ cmp r0, r1
+ blo 1b
+ dsb
+ mov pc, lr
+ENDPROC(v7_flush_kern_dcache_area)
+
+/*
+ * v7_dma_inv_range(start,end)
+ *
+ * Invalidate the data cache within the specified region; we will
+ * be performing a DMA operation in this region and we want to
+ * purge old data in the cache.
+ *
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+v7_dma_inv_range:
+ dcache_line_size r2, r3
+ sub r3, r2, #1
+ tst r0, r3
+ bic r0, r0, r3
+#ifdef CONFIG_ARM_ERRATA_764369
+ ALT_SMP(W(dsb))
+ ALT_UP(W(nop))
+#endif
+ mcrne p15, 0, r0, c7, c14, 1 @ clean & invalidate D / U line
+
+ tst r1, r3
+ bic r1, r1, r3
+ mcrne p15, 0, r1, c7, c14, 1 @ clean & invalidate D / U line
+1:
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D / U line
+ add r0, r0, r2
+ cmp r0, r1
+ blo 1b
+ dsb
+ mov pc, lr
+ENDPROC(v7_dma_inv_range)
+
+/*
+ * v7_dma_clean_range(start,end)
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+v7_dma_clean_range:
+ dcache_line_size r2, r3
+ sub r3, r2, #1
+ bic r0, r0, r3
+#ifdef CONFIG_ARM_ERRATA_764369
+ ALT_SMP(W(dsb))
+ ALT_UP(W(nop))
+#endif
+1:
+ mcr p15, 0, r0, c7, c10, 1 @ clean D / U line
+ add r0, r0, r2
+ cmp r0, r1
+ blo 1b
+ dsb
+ mov pc, lr
+ENDPROC(v7_dma_clean_range)
+
+/*
+ * v7_dma_flush_range(start,end)
+ * - start - virtual start address of region
+ * - end - virtual end address of region
+ */
+ENTRY(v7_dma_flush_range)
+ dcache_line_size r2, r3
+ sub r3, r2, #1
+ bic r0, r0, r3
+#ifdef CONFIG_ARM_ERRATA_764369
+ ALT_SMP(W(dsb))
+ ALT_UP(W(nop))
+#endif
+1:
+ mcr p15, 0, r0, c7, c14, 1 @ clean & invalidate D / U line
+ add r0, r0, r2
+ cmp r0, r1
+ blo 1b
+ dsb
+ mov pc, lr
+ENDPROC(v7_dma_flush_range)
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v7_dma_map_area)
+ add r1, r1, r0
+ teq r2, #DMA_FROM_DEVICE
+ beq v7_dma_inv_range
+ b v7_dma_clean_range
+ENDPROC(v7_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(v7_dma_unmap_area)
+ add r1, r1, r0
+ teq r2, #DMA_TO_DEVICE
+ bne v7_dma_inv_range
+ mov pc, lr
+ENDPROC(v7_dma_unmap_area)
+
+ __INITDATA
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions v7
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-xsc3l2.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-xsc3l2.c
new file mode 100644
index 0000000..6c3edeb
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/cache-xsc3l2.c
@@ -0,0 +1,220 @@
+/*
+ * arch/arm/mm/cache-xsc3l2.c - XScale3 L2 cache controller support
+ *
+ * Copyright (C) 2007 ARM Limited
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+#include <asm/cp15.h>
+#include <asm/cputype.h>
+#include <asm/cacheflush.h>
+
+#define CR_L2 (1 << 26)
+
+#define CACHE_LINE_SIZE 32
+#define CACHE_LINE_SHIFT 5
+#define CACHE_WAY_PER_SET 8
+
+#define CACHE_WAY_SIZE(l2ctype) (8192 << (((l2ctype) >> 8) & 0xf))
+#define CACHE_SET_SIZE(l2ctype) (CACHE_WAY_SIZE(l2ctype) >> CACHE_LINE_SHIFT)
+
+static inline int xsc3_l2_present(void)
+{
+ unsigned long l2ctype;
+
+ __asm__("mrc p15, 1, %0, c0, c0, 1" : "=r" (l2ctype));
+
+ return !!(l2ctype & 0xf8);
+}
+
+static inline void xsc3_l2_clean_mva(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c7, c11, 1" : : "r" (addr));
+}
+
+static inline void xsc3_l2_inv_mva(unsigned long addr)
+{
+ __asm__("mcr p15, 1, %0, c7, c7, 1" : : "r" (addr));
+}
+
+static inline void xsc3_l2_inv_all(void)
+{
+ unsigned long l2ctype, set_way;
+ int set, way;
+
+ __asm__("mrc p15, 1, %0, c0, c0, 1" : "=r" (l2ctype));
+
+ for (set = 0; set < CACHE_SET_SIZE(l2ctype); set++) {
+ for (way = 0; way < CACHE_WAY_PER_SET; way++) {
+ set_way = (way << 29) | (set << 5);
+ __asm__("mcr p15, 1, %0, c7, c11, 2" : : "r"(set_way));
+ }
+ }
+
+ dsb();
+}
+
+static inline void l2_unmap_va(unsigned long va)
+{
+#ifdef CONFIG_HIGHMEM
+ if (va != -1)
+ kunmap_atomic((void *)va);
+#endif
+}
+
+static inline unsigned long l2_map_va(unsigned long pa, unsigned long prev_va)
+{
+#ifdef CONFIG_HIGHMEM
+ unsigned long va = prev_va & PAGE_MASK;
+ unsigned long pa_offset = pa << (32 - PAGE_SHIFT);
+ if (unlikely(pa_offset < (prev_va << (32 - PAGE_SHIFT)))) {
+ /*
+ * Switching to a new page. Because cache ops are
+ * using virtual addresses only, we must put a mapping
+ * in place for it.
+ */
+ l2_unmap_va(prev_va);
+ va = (unsigned long)kmap_atomic_pfn(pa >> PAGE_SHIFT);
+ }
+ return va + (pa_offset >> (32 - PAGE_SHIFT));
+#else
+ return __phys_to_virt(pa);
+#endif
+}
+
+static void xsc3_l2_inv_range(unsigned long start, unsigned long end)
+{
+ unsigned long vaddr;
+
+ if (start == 0 && end == -1ul) {
+ xsc3_l2_inv_all();
+ return;
+ }
+
+ vaddr = -1; /* to force the first mapping */
+
+ /*
+ * Clean and invalidate partial first cache line.
+ */
+ if (start & (CACHE_LINE_SIZE - 1)) {
+ vaddr = l2_map_va(start & ~(CACHE_LINE_SIZE - 1), vaddr);
+ xsc3_l2_clean_mva(vaddr);
+ xsc3_l2_inv_mva(vaddr);
+ start = (start | (CACHE_LINE_SIZE - 1)) + 1;
+ }
+
+ /*
+ * Invalidate all full cache lines between 'start' and 'end'.
+ */
+ while (start < (end & ~(CACHE_LINE_SIZE - 1))) {
+ vaddr = l2_map_va(start, vaddr);
+ xsc3_l2_inv_mva(vaddr);
+ start += CACHE_LINE_SIZE;
+ }
+
+ /*
+ * Clean and invalidate partial last cache line.
+ */
+ if (start < end) {
+ vaddr = l2_map_va(start, vaddr);
+ xsc3_l2_clean_mva(vaddr);
+ xsc3_l2_inv_mva(vaddr);
+ }
+
+ l2_unmap_va(vaddr);
+
+ dsb();
+}
+
+static void xsc3_l2_clean_range(unsigned long start, unsigned long end)
+{
+ unsigned long vaddr;
+
+ vaddr = -1; /* to force the first mapping */
+
+ start &= ~(CACHE_LINE_SIZE - 1);
+ while (start < end) {
+ vaddr = l2_map_va(start, vaddr);
+ xsc3_l2_clean_mva(vaddr);
+ start += CACHE_LINE_SIZE;
+ }
+
+ l2_unmap_va(vaddr);
+
+ dsb();
+}
+
+/*
+ * optimize L2 flush all operation by set/way format
+ */
+static inline void xsc3_l2_flush_all(void)
+{
+ unsigned long l2ctype, set_way;
+ int set, way;
+
+ __asm__("mrc p15, 1, %0, c0, c0, 1" : "=r" (l2ctype));
+
+ for (set = 0; set < CACHE_SET_SIZE(l2ctype); set++) {
+ for (way = 0; way < CACHE_WAY_PER_SET; way++) {
+ set_way = (way << 29) | (set << 5);
+ __asm__("mcr p15, 1, %0, c7, c15, 2" : : "r"(set_way));
+ }
+ }
+
+ dsb();
+}
+
+static void xsc3_l2_flush_range(unsigned long start, unsigned long end)
+{
+ unsigned long vaddr;
+
+ if (start == 0 && end == -1ul) {
+ xsc3_l2_flush_all();
+ return;
+ }
+
+ vaddr = -1; /* to force the first mapping */
+
+ start &= ~(CACHE_LINE_SIZE - 1);
+ while (start < end) {
+ vaddr = l2_map_va(start, vaddr);
+ xsc3_l2_clean_mva(vaddr);
+ xsc3_l2_inv_mva(vaddr);
+ start += CACHE_LINE_SIZE;
+ }
+
+ l2_unmap_va(vaddr);
+
+ dsb();
+}
+
+static int __init xsc3_l2_init(void)
+{
+ if (!cpu_is_xsc3() || !xsc3_l2_present())
+ return 0;
+
+ if (get_cr() & CR_L2) {
+ pr_info("XScale3 L2 cache enabled.\n");
+ xsc3_l2_inv_all();
+
+ outer_cache.inv_range = xsc3_l2_inv_range;
+ outer_cache.clean_range = xsc3_l2_clean_range;
+ outer_cache.flush_range = xsc3_l2_flush_range;
+ }
+
+ return 0;
+}
+core_initcall(xsc3_l2_init);
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/context.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/context.c
new file mode 100644
index 0000000..806cc4f
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/context.c
@@ -0,0 +1,171 @@
+/*
+ * linux/arch/arm/mm/context.c
+ *
+ * Copyright (C) 2002-2003 Deep Blue Solutions Ltd, all rights reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/init.h>
+#include <linux/sched.h>
+#include <linux/mm.h>
+#include <linux/smp.h>
+#include <linux/percpu.h>
+
+#include <asm/mmu_context.h>
+#include <asm/tlbflush.h>
+
+static DEFINE_RAW_SPINLOCK(cpu_asid_lock);
+unsigned int cpu_last_asid = ASID_FIRST_VERSION;
+
+#ifdef CONFIG_ARM_LPAE
+void cpu_set_reserved_ttbr0(void)
+{
+ unsigned long ttbl = __pa(swapper_pg_dir);
+ unsigned long ttbh = 0;
+
+ /*
+ * Set TTBR0 to swapper_pg_dir which contains only global entries. The
+ * ASID is set to 0.
+ */
+ asm volatile(
+ " mcrr p15, 0, %0, %1, c2 @ set TTBR0\n"
+ :
+ : "r" (ttbl), "r" (ttbh));
+ isb();
+}
+#else
+void cpu_set_reserved_ttbr0(void)
+{
+ u32 ttb;
+ /* Copy TTBR1 into TTBR0 */
+ asm volatile(
+ " mrc p15, 0, %0, c2, c0, 1 @ read TTBR1\n"
+ " mcr p15, 0, %0, c2, c0, 0 @ set TTBR0\n"
+ : "=r" (ttb));
+ isb();
+}
+#endif
+
+/*
+ * We fork()ed a process, and we need a new context for the child
+ * to run in.
+ */
+void __init_new_context(struct task_struct *tsk, struct mm_struct *mm)
+{
+ mm->context.id = 0;
+ raw_spin_lock_init(&mm->context.id_lock);
+}
+
+static void flush_context(void)
+{
+ cpu_set_reserved_ttbr0();
+ local_flush_tlb_all();
+ if (icache_is_vivt_asid_tagged()) {
+ __flush_icache_all();
+ dsb();
+ }
+}
+
+#ifdef CONFIG_SMP
+
+static void set_mm_context(struct mm_struct *mm, unsigned int asid)
+{
+ unsigned long flags;
+
+ /*
+ * Locking needed for multi-threaded applications where the
+ * same mm->context.id could be set from different CPUs during
+ * the broadcast. This function is also called via IPI so the
+ * mm->context.id_lock has to be IRQ-safe.
+ */
+ raw_spin_lock_irqsave(&mm->context.id_lock, flags);
+ if (likely((mm->context.id ^ cpu_last_asid) >> ASID_BITS)) {
+ /*
+ * Old version of ASID found. Set the new one and
+ * reset mm_cpumask(mm).
+ */
+ mm->context.id = asid;
+ cpumask_clear(mm_cpumask(mm));
+ }
+ raw_spin_unlock_irqrestore(&mm->context.id_lock, flags);
+
+ /*
+ * Set the mm_cpumask(mm) bit for the current CPU.
+ */
+ cpumask_set_cpu(smp_processor_id(), mm_cpumask(mm));
+}
+
+/*
+ * Reset the ASID on the current CPU. This function call is broadcast
+ * from the CPU handling the ASID rollover and holding cpu_asid_lock.
+ */
+static void reset_context(void *info)
+{
+ unsigned int asid;
+ unsigned int cpu = smp_processor_id();
+ struct mm_struct *mm = current->active_mm;
+
+ smp_rmb();
+ asid = cpu_last_asid + cpu + 1;
+
+ flush_context();
+ set_mm_context(mm, asid);
+
+ /* set the new ASID */
+ cpu_switch_mm(mm->pgd, mm);
+}
+
+#else
+
+static inline void set_mm_context(struct mm_struct *mm, unsigned int asid)
+{
+ mm->context.id = asid;
+ cpumask_copy(mm_cpumask(mm), cpumask_of(smp_processor_id()));
+}
+
+#endif
+
+void __new_context(struct mm_struct *mm)
+{
+ unsigned int asid;
+
+ raw_spin_lock(&cpu_asid_lock);
+#ifdef CONFIG_SMP
+ /*
+ * Check the ASID again, in case the change was broadcast from
+ * another CPU before we acquired the lock.
+ */
+ if (unlikely(((mm->context.id ^ cpu_last_asid) >> ASID_BITS) == 0)) {
+ cpumask_set_cpu(smp_processor_id(), mm_cpumask(mm));
+ raw_spin_unlock(&cpu_asid_lock);
+ return;
+ }
+#endif
+ /*
+ * At this point, it is guaranteed that the current mm (with
+ * an old ASID) isn't active on any other CPU since the ASIDs
+ * are changed simultaneously via IPI.
+ */
+ asid = ++cpu_last_asid;
+ if (asid == 0)
+ asid = cpu_last_asid = ASID_FIRST_VERSION;
+
+ /*
+ * If we've used up all our ASIDs, we need
+ * to start a new version and flush the TLB.
+ */
+ if (unlikely((asid & ~ASID_MASK) == 0)) {
+ asid = cpu_last_asid + smp_processor_id() + 1;
+ flush_context();
+#ifdef CONFIG_SMP
+ smp_wmb();
+ smp_call_function(reset_context, NULL, 1);
+#endif
+ cpu_last_asid += NR_CPUS;
+ }
+
+ set_mm_context(mm, asid);
+ raw_spin_unlock(&cpu_asid_lock);
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-fa.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-fa.c
new file mode 100644
index 0000000..d130a5e
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-fa.c
@@ -0,0 +1,86 @@
+/*
+ * linux/arch/arm/lib/copypage-fa.S
+ *
+ * Copyright (C) 2005 Faraday Corp.
+ * Copyright (C) 2008-2009 Paulius Zaleckas <paulius.zaleckas@teltonika.lt>
+ *
+ * Based on copypage-v4wb.S:
+ * Copyright (C) 1995-1999 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+
+/*
+ * Faraday optimised copy_user_page
+ */
+static void __naked
+fa_copy_user_page(void *kto, const void *kfrom)
+{
+ asm("\
+ stmfd sp!, {r4, lr} @ 2\n\
+ mov r2, %0 @ 1\n\
+1: ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+ stmia r0, {r3, r4, ip, lr} @ 4\n\
+ mcr p15, 0, r0, c7, c14, 1 @ 1 clean and invalidate D line\n\
+ add r0, r0, #16 @ 1\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+ stmia r0, {r3, r4, ip, lr} @ 4\n\
+ mcr p15, 0, r0, c7, c14, 1 @ 1 clean and invalidate D line\n\
+ add r0, r0, #16 @ 1\n\
+ subs r2, r2, #1 @ 1\n\
+ bne 1b @ 1\n\
+ mcr p15, 0, r2, c7, c10, 4 @ 1 drain WB\n\
+ ldmfd sp!, {r4, pc} @ 3"
+ :
+ : "I" (PAGE_SIZE / 32));
+}
+
+void fa_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kto = kmap_atomic(to);
+ kfrom = kmap_atomic(from);
+ fa_copy_user_page(kto, kfrom);
+ kunmap_atomic(kfrom);
+ kunmap_atomic(kto);
+}
+
+/*
+ * Faraday optimised clear_user_page
+ *
+ * Same story as above.
+ */
+void fa_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile("\
+ mov r1, %2 @ 1\n\
+ mov r2, #0 @ 1\n\
+ mov r3, #0 @ 1\n\
+ mov ip, #0 @ 1\n\
+ mov lr, #0 @ 1\n\
+1: stmia %0, {r2, r3, ip, lr} @ 4\n\
+ mcr p15, 0, %0, c7, c14, 1 @ 1 clean and invalidate D line\n\
+ add %0, %0, #16 @ 1\n\
+ stmia %0, {r2, r3, ip, lr} @ 4\n\
+ mcr p15, 0, %0, c7, c14, 1 @ 1 clean and invalidate D line\n\
+ add %0, %0, #16 @ 1\n\
+ subs r1, r1, #1 @ 1\n\
+ bne 1b @ 1\n\
+ mcr p15, 0, r1, c7, c10, 4 @ 1 drain WB"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 32)
+ : "r1", "r2", "r3", "ip", "lr");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns fa_user_fns __initdata = {
+ .cpu_clear_user_highpage = fa_clear_user_highpage,
+ .cpu_copy_user_highpage = fa_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-feroceon.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-feroceon.c
new file mode 100644
index 0000000..49ee0c1
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-feroceon.c
@@ -0,0 +1,112 @@
+/*
+ * linux/arch/arm/mm/copypage-feroceon.S
+ *
+ * Copyright (C) 2008 Marvell Semiconductors
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This handles copy_user_highpage and clear_user_page on Feroceon
+ * more optimally than the generic implementations.
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+
+static void __naked
+feroceon_copy_user_page(void *kto, const void *kfrom)
+{
+ asm("\
+ stmfd sp!, {r4-r9, lr} \n\
+ mov ip, %2 \n\
+1: mov lr, r1 \n\
+ ldmia r1!, {r2 - r9} \n\
+ pld [lr, #32] \n\
+ pld [lr, #64] \n\
+ pld [lr, #96] \n\
+ pld [lr, #128] \n\
+ pld [lr, #160] \n\
+ pld [lr, #192] \n\
+ pld [lr, #224] \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ ldmia r1!, {r2 - r9} \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ stmia r0, {r2 - r9} \n\
+ subs ip, ip, #(32 * 8) \n\
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D line\n\
+ add r0, r0, #32 \n\
+ bne 1b \n\
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB\n\
+ ldmfd sp!, {r4-r9, pc}"
+ :
+ : "r" (kto), "r" (kfrom), "I" (PAGE_SIZE));
+}
+
+void feroceon_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kto = kmap_atomic(to);
+ kfrom = kmap_atomic(from);
+ flush_cache_page(vma, vaddr, page_to_pfn(from));
+ feroceon_copy_user_page(kto, kfrom);
+ kunmap_atomic(kfrom);
+ kunmap_atomic(kto);
+}
+
+void feroceon_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile ("\
+ mov r1, %2 \n\
+ mov r2, #0 \n\
+ mov r3, #0 \n\
+ mov r4, #0 \n\
+ mov r5, #0 \n\
+ mov r6, #0 \n\
+ mov r7, #0 \n\
+ mov ip, #0 \n\
+ mov lr, #0 \n\
+1: stmia %0, {r2-r7, ip, lr} \n\
+ subs r1, r1, #1 \n\
+ mcr p15, 0, %0, c7, c14, 1 @ clean and invalidate D line\n\
+ add %0, %0, #32 \n\
+ bne 1b \n\
+ mcr p15, 0, r1, c7, c10, 4 @ drain WB"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 32)
+ : "r1", "r2", "r3", "r4", "r5", "r6", "r7", "ip", "lr");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns feroceon_user_fns __initdata = {
+ .cpu_clear_user_highpage = feroceon_clear_user_highpage,
+ .cpu_copy_user_highpage = feroceon_copy_user_highpage,
+};
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v3.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v3.c
new file mode 100644
index 0000000..3935bdd
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v3.c
@@ -0,0 +1,81 @@
+/*
+ * linux/arch/arm/mm/copypage-v3.c
+ *
+ * Copyright (C) 1995-1999 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+
+/*
+ * ARMv3 optimised copy_user_highpage
+ *
+ * FIXME: do we need to handle cache stuff...
+ */
+static void __naked
+v3_copy_user_page(void *kto, const void *kfrom)
+{
+ asm("\n\
+ stmfd sp!, {r4, lr} @ 2\n\
+ mov r2, %2 @ 1\n\
+ ldmia %0!, {r3, r4, ip, lr} @ 4+1\n\
+1: stmia %1!, {r3, r4, ip, lr} @ 4\n\
+ ldmia %0!, {r3, r4, ip, lr} @ 4+1\n\
+ stmia %1!, {r3, r4, ip, lr} @ 4\n\
+ ldmia %0!, {r3, r4, ip, lr} @ 4+1\n\
+ stmia %1!, {r3, r4, ip, lr} @ 4\n\
+ ldmia %0!, {r3, r4, ip, lr} @ 4\n\
+ subs r2, r2, #1 @ 1\n\
+ stmia %1!, {r3, r4, ip, lr} @ 4\n\
+ ldmneia %0!, {r3, r4, ip, lr} @ 4\n\
+ bne 1b @ 1\n\
+ ldmfd sp!, {r4, pc} @ 3"
+ :
+ : "r" (kfrom), "r" (kto), "I" (PAGE_SIZE / 64));
+}
+
+void v3_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kto = kmap_atomic(to);
+ kfrom = kmap_atomic(from);
+ v3_copy_user_page(kto, kfrom);
+ kunmap_atomic(kfrom);
+ kunmap_atomic(kto);
+}
+
+/*
+ * ARMv3 optimised clear_user_page
+ *
+ * FIXME: do we need to handle cache stuff...
+ */
+void v3_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile("\n\
+ mov r1, %2 @ 1\n\
+ mov r2, #0 @ 1\n\
+ mov r3, #0 @ 1\n\
+ mov ip, #0 @ 1\n\
+ mov lr, #0 @ 1\n\
+1: stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ subs r1, r1, #1 @ 1\n\
+ bne 1b @ 1"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 64)
+ : "r1", "r2", "r3", "ip", "lr");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns v3_user_fns __initdata = {
+ .cpu_clear_user_highpage = v3_clear_user_highpage,
+ .cpu_copy_user_highpage = v3_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4mc.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4mc.c
new file mode 100644
index 0000000..1267e64
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4mc.c
@@ -0,0 +1,115 @@
+/*
+ * linux/arch/arm/lib/copypage-armv4mc.S
+ *
+ * Copyright (C) 1995-2005 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This handles the mini data cache, as found on SA11x0 and XScale
+ * processors. When we copy a user page page, we map it in such a way
+ * that accesses to this page will not touch the main data cache, but
+ * will be cached in the mini data cache. This prevents us thrashing
+ * the main data cache on page faults.
+ */
+#include <linux/init.h>
+#include <linux/mm.h>
+#include <linux/highmem.h>
+
+#include <asm/pgtable.h>
+#include <asm/tlbflush.h>
+#include <asm/cacheflush.h>
+
+#include "mm.h"
+
+#define minicache_pgprot __pgprot(L_PTE_PRESENT | L_PTE_YOUNG | \
+ L_PTE_MT_MINICACHE)
+
+static DEFINE_RAW_SPINLOCK(minicache_lock);
+
+/*
+ * ARMv4 mini-dcache optimised copy_user_highpage
+ *
+ * We flush the destination cache lines just before we write the data into the
+ * corresponding address. Since the Dcache is read-allocate, this removes the
+ * Dcache aliasing issue. The writes will be forwarded to the write buffer,
+ * and merged as appropriate.
+ *
+ * Note: We rely on all ARMv4 processors implementing the "invalidate D line"
+ * instruction. If your processor does not supply this, you have to write your
+ * own copy_user_highpage that does the right thing.
+ */
+static void __naked
+mc_copy_user_page(void *from, void *to)
+{
+ asm volatile(
+ "stmfd sp!, {r4, lr} @ 2\n\
+ mov r4, %2 @ 1\n\
+ ldmia %0!, {r2, r3, ip, lr} @ 4\n\
+1: mcr p15, 0, %1, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia %1!, {r2, r3, ip, lr} @ 4\n\
+ ldmia %0!, {r2, r3, ip, lr} @ 4+1\n\
+ stmia %1!, {r2, r3, ip, lr} @ 4\n\
+ ldmia %0!, {r2, r3, ip, lr} @ 4\n\
+ mcr p15, 0, %1, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia %1!, {r2, r3, ip, lr} @ 4\n\
+ ldmia %0!, {r2, r3, ip, lr} @ 4\n\
+ subs r4, r4, #1 @ 1\n\
+ stmia %1!, {r2, r3, ip, lr} @ 4\n\
+ ldmneia %0!, {r2, r3, ip, lr} @ 4\n\
+ bne 1b @ 1\n\
+ ldmfd sp!, {r4, pc} @ 3"
+ :
+ : "r" (from), "r" (to), "I" (PAGE_SIZE / 64));
+}
+
+void v4_mc_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto = kmap_atomic(to);
+
+ if (!test_and_set_bit(PG_dcache_clean, &from->flags))
+ __flush_dcache_page(page_mapping(from), from);
+
+ raw_spin_lock(&minicache_lock);
+
+ set_top_pte(COPYPAGE_MINICACHE, mk_pte(from, minicache_pgprot));
+
+ mc_copy_user_page((void *)COPYPAGE_MINICACHE, kto);
+
+ raw_spin_unlock(&minicache_lock);
+
+ kunmap_atomic(kto);
+}
+
+/*
+ * ARMv4 optimised clear_user_page
+ */
+void v4_mc_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile("\
+ mov r1, %2 @ 1\n\
+ mov r2, #0 @ 1\n\
+ mov r3, #0 @ 1\n\
+ mov ip, #0 @ 1\n\
+ mov lr, #0 @ 1\n\
+1: mcr p15, 0, %0, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ mcr p15, 0, %0, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ subs r1, r1, #1 @ 1\n\
+ bne 1b @ 1"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 64)
+ : "r1", "r2", "r3", "ip", "lr");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns v4_mc_user_fns __initdata = {
+ .cpu_clear_user_highpage = v4_mc_clear_user_highpage,
+ .cpu_copy_user_highpage = v4_mc_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4wb.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4wb.c
new file mode 100644
index 0000000..067d0fd
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4wb.c
@@ -0,0 +1,95 @@
+/*
+ * linux/arch/arm/mm/copypage-v4wb.c
+ *
+ * Copyright (C) 1995-1999 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+
+/*
+ * ARMv4 optimised copy_user_highpage
+ *
+ * We flush the destination cache lines just before we write the data into the
+ * corresponding address. Since the Dcache is read-allocate, this removes the
+ * Dcache aliasing issue. The writes will be forwarded to the write buffer,
+ * and merged as appropriate.
+ *
+ * Note: We rely on all ARMv4 processors implementing the "invalidate D line"
+ * instruction. If your processor does not supply this, you have to write your
+ * own copy_user_highpage that does the right thing.
+ */
+static void __naked
+v4wb_copy_user_page(void *kto, const void *kfrom)
+{
+ asm("\
+ stmfd sp!, {r4, lr} @ 2\n\
+ mov r2, %2 @ 1\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+1: mcr p15, 0, r0, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4+1\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+ mcr p15, 0, r0, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+ subs r2, r2, #1 @ 1\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmneia r1!, {r3, r4, ip, lr} @ 4\n\
+ bne 1b @ 1\n\
+ mcr p15, 0, r1, c7, c10, 4 @ 1 drain WB\n\
+ ldmfd sp!, {r4, pc} @ 3"
+ :
+ : "r" (kto), "r" (kfrom), "I" (PAGE_SIZE / 64));
+}
+
+void v4wb_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kto = kmap_atomic(to);
+ kfrom = kmap_atomic(from);
+ flush_cache_page(vma, vaddr, page_to_pfn(from));
+ v4wb_copy_user_page(kto, kfrom);
+ kunmap_atomic(kfrom);
+ kunmap_atomic(kto);
+}
+
+/*
+ * ARMv4 optimised clear_user_page
+ *
+ * Same story as above.
+ */
+void v4wb_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile("\
+ mov r1, %2 @ 1\n\
+ mov r2, #0 @ 1\n\
+ mov r3, #0 @ 1\n\
+ mov ip, #0 @ 1\n\
+ mov lr, #0 @ 1\n\
+1: mcr p15, 0, %0, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ mcr p15, 0, %0, c7, c6, 1 @ 1 invalidate D line\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ subs r1, r1, #1 @ 1\n\
+ bne 1b @ 1\n\
+ mcr p15, 0, r1, c7, c10, 4 @ 1 drain WB"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 64)
+ : "r1", "r2", "r3", "ip", "lr");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns v4wb_user_fns __initdata = {
+ .cpu_clear_user_highpage = v4wb_clear_user_highpage,
+ .cpu_copy_user_highpage = v4wb_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4wt.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4wt.c
new file mode 100644
index 0000000..b85c5da
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v4wt.c
@@ -0,0 +1,88 @@
+/*
+ * linux/arch/arm/mm/copypage-v4wt.S
+ *
+ * Copyright (C) 1995-1999 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This is for CPUs with a writethrough cache and 'flush ID cache' is
+ * the only supported cache operation.
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+
+/*
+ * ARMv4 optimised copy_user_highpage
+ *
+ * Since we have writethrough caches, we don't have to worry about
+ * dirty data in the cache. However, we do have to ensure that
+ * subsequent reads are up to date.
+ */
+static void __naked
+v4wt_copy_user_page(void *kto, const void *kfrom)
+{
+ asm("\
+ stmfd sp!, {r4, lr} @ 2\n\
+ mov r2, %2 @ 1\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+1: stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4+1\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmia r1!, {r3, r4, ip, lr} @ 4\n\
+ subs r2, r2, #1 @ 1\n\
+ stmia r0!, {r3, r4, ip, lr} @ 4\n\
+ ldmneia r1!, {r3, r4, ip, lr} @ 4\n\
+ bne 1b @ 1\n\
+ mcr p15, 0, r2, c7, c7, 0 @ flush ID cache\n\
+ ldmfd sp!, {r4, pc} @ 3"
+ :
+ : "r" (kto), "r" (kfrom), "I" (PAGE_SIZE / 64));
+}
+
+void v4wt_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kto = kmap_atomic(to);
+ kfrom = kmap_atomic(from);
+ v4wt_copy_user_page(kto, kfrom);
+ kunmap_atomic(kfrom);
+ kunmap_atomic(kto);
+}
+
+/*
+ * ARMv4 optimised clear_user_page
+ *
+ * Same story as above.
+ */
+void v4wt_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile("\
+ mov r1, %2 @ 1\n\
+ mov r2, #0 @ 1\n\
+ mov r3, #0 @ 1\n\
+ mov ip, #0 @ 1\n\
+ mov lr, #0 @ 1\n\
+1: stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ stmia %0!, {r2, r3, ip, lr} @ 4\n\
+ subs r1, r1, #1 @ 1\n\
+ bne 1b @ 1\n\
+ mcr p15, 0, r2, c7, c7, 0 @ flush ID cache"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 64)
+ : "r1", "r2", "r3", "ip", "lr");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns v4wt_user_fns __initdata = {
+ .cpu_clear_user_highpage = v4wt_clear_user_highpage,
+ .cpu_copy_user_highpage = v4wt_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v6.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v6.c
new file mode 100644
index 0000000..b9bcc9d
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-v6.c
@@ -0,0 +1,140 @@
+/*
+ * linux/arch/arm/mm/copypage-v6.c
+ *
+ * Copyright (C) 2002 Deep Blue Solutions Ltd, All Rights Reserved.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/init.h>
+#include <linux/spinlock.h>
+#include <linux/mm.h>
+#include <linux/highmem.h>
+
+#include <asm/pgtable.h>
+#include <asm/shmparam.h>
+#include <asm/tlbflush.h>
+#include <asm/cacheflush.h>
+#include <asm/cachetype.h>
+
+#include "mm.h"
+
+#if SHMLBA > 16384
+#error FIX ME
+#endif
+
+static DEFINE_RAW_SPINLOCK(v6_lock);
+
+/*
+ * Copy the user page. No aliasing to deal with so we can just
+ * attack the kernel's existing mapping of these pages.
+ */
+static void v6_copy_user_highpage_nonaliasing(struct page *to,
+ struct page *from, unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kfrom = kmap_atomic(from);
+ kto = kmap_atomic(to);
+ copy_page(kto, kfrom);
+ kunmap_atomic(kto);
+ kunmap_atomic(kfrom);
+}
+
+/*
+ * Clear the user page. No aliasing to deal with so we can just
+ * attack the kernel's existing mapping of this page.
+ */
+static void v6_clear_user_highpage_nonaliasing(struct page *page, unsigned long vaddr)
+{
+ void *kaddr = kmap_atomic(page);
+ clear_page(kaddr);
+ kunmap_atomic(kaddr);
+}
+
+/*
+ * Discard data in the kernel mapping for the new page.
+ * FIXME: needs this MCRR to be supported.
+ */
+static void discard_old_kernel_data(void *kto)
+{
+ __asm__("mcrr p15, 0, %1, %0, c6 @ 0xec401f06"
+ :
+ : "r" (kto),
+ "r" ((unsigned long)kto + PAGE_SIZE - L1_CACHE_BYTES)
+ : "cc");
+}
+
+/*
+ * Copy the page, taking account of the cache colour.
+ */
+static void v6_copy_user_highpage_aliasing(struct page *to,
+ struct page *from, unsigned long vaddr, struct vm_area_struct *vma)
+{
+ unsigned int offset = CACHE_COLOUR(vaddr);
+ unsigned long kfrom, kto;
+
+ if (!test_and_set_bit(PG_dcache_clean, &from->flags))
+ __flush_dcache_page(page_mapping(from), from);
+
+ /* FIXME: not highmem safe */
+ discard_old_kernel_data(page_address(to));
+
+ /*
+ * Now copy the page using the same cache colour as the
+ * pages ultimate destination.
+ */
+ raw_spin_lock(&v6_lock);
+
+ kfrom = COPYPAGE_V6_FROM + (offset << PAGE_SHIFT);
+ kto = COPYPAGE_V6_TO + (offset << PAGE_SHIFT);
+
+ set_top_pte(kfrom, mk_pte(from, PAGE_KERNEL));
+ set_top_pte(kto, mk_pte(to, PAGE_KERNEL));
+
+ copy_page((void *)kto, (void *)kfrom);
+
+ raw_spin_unlock(&v6_lock);
+}
+
+/*
+ * Clear the user page. We need to deal with the aliasing issues,
+ * so remap the kernel page into the same cache colour as the user
+ * page.
+ */
+static void v6_clear_user_highpage_aliasing(struct page *page, unsigned long vaddr)
+{
+ unsigned long to = COPYPAGE_V6_TO + (CACHE_COLOUR(vaddr) << PAGE_SHIFT);
+
+ /* FIXME: not highmem safe */
+ discard_old_kernel_data(page_address(page));
+
+ /*
+ * Now clear the page using the same cache colour as
+ * the pages ultimate destination.
+ */
+ raw_spin_lock(&v6_lock);
+
+ set_top_pte(to, mk_pte(page, PAGE_KERNEL));
+ clear_page((void *)to);
+
+ raw_spin_unlock(&v6_lock);
+}
+
+struct cpu_user_fns v6_user_fns __initdata = {
+ .cpu_clear_user_highpage = v6_clear_user_highpage_nonaliasing,
+ .cpu_copy_user_highpage = v6_copy_user_highpage_nonaliasing,
+};
+
+static int __init v6_userpage_init(void)
+{
+ if (cache_is_vipt_aliasing()) {
+ cpu_user.cpu_clear_user_highpage = v6_clear_user_highpage_aliasing;
+ cpu_user.cpu_copy_user_highpage = v6_copy_user_highpage_aliasing;
+ }
+
+ return 0;
+}
+
+core_initcall(v6_userpage_init);
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-xsc3.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-xsc3.c
new file mode 100644
index 0000000..03a2042
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-xsc3.c
@@ -0,0 +1,114 @@
+/*
+ * linux/arch/arm/mm/copypage-xsc3.S
+ *
+ * Copyright (C) 2004 Intel Corp.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * Adapted for 3rd gen XScale core, no more mini-dcache
+ * Author: Matt Gilbert (matthew.m.gilbert@intel.com)
+ */
+#include <linux/init.h>
+#include <linux/highmem.h>
+
+/*
+ * General note:
+ * We don't really want write-allocate cache behaviour for these functions
+ * since that will just eat through 8K of the cache.
+ */
+
+/*
+ * XSC3 optimised copy_user_highpage
+ * r0 = destination
+ * r1 = source
+ *
+ * The source page may have some clean entries in the cache already, but we
+ * can safely ignore them - break_cow() will flush them out of the cache
+ * if we eventually end up using our copied page.
+ *
+ */
+static void __naked
+xsc3_mc_copy_user_page(void *kto, const void *kfrom)
+{
+ asm("\
+ stmfd sp!, {r4, r5, lr} \n\
+ mov lr, %2 \n\
+ \n\
+ pld [r1, #0] \n\
+ pld [r1, #32] \n\
+1: pld [r1, #64] \n\
+ pld [r1, #96] \n\
+ \n\
+2: ldrd r2, [r1], #8 \n\
+ mov ip, r0 \n\
+ ldrd r4, [r1], #8 \n\
+ mcr p15, 0, ip, c7, c6, 1 @ invalidate\n\
+ strd r2, [r0], #8 \n\
+ ldrd r2, [r1], #8 \n\
+ strd r4, [r0], #8 \n\
+ ldrd r4, [r1], #8 \n\
+ strd r2, [r0], #8 \n\
+ strd r4, [r0], #8 \n\
+ ldrd r2, [r1], #8 \n\
+ mov ip, r0 \n\
+ ldrd r4, [r1], #8 \n\
+ mcr p15, 0, ip, c7, c6, 1 @ invalidate\n\
+ strd r2, [r0], #8 \n\
+ ldrd r2, [r1], #8 \n\
+ subs lr, lr, #1 \n\
+ strd r4, [r0], #8 \n\
+ ldrd r4, [r1], #8 \n\
+ strd r2, [r0], #8 \n\
+ strd r4, [r0], #8 \n\
+ bgt 1b \n\
+ beq 2b \n\
+ \n\
+ ldmfd sp!, {r4, r5, pc}"
+ :
+ : "r" (kto), "r" (kfrom), "I" (PAGE_SIZE / 64 - 1));
+}
+
+void xsc3_mc_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto, *kfrom;
+
+ kto = kmap_atomic(to);
+ kfrom = kmap_atomic(from);
+ flush_cache_page(vma, vaddr, page_to_pfn(from));
+ xsc3_mc_copy_user_page(kto, kfrom);
+ kunmap_atomic(kfrom);
+ kunmap_atomic(kto);
+}
+
+/*
+ * XScale optimised clear_user_page
+ * r0 = destination
+ * r1 = virtual user address of ultimate destination page
+ */
+void xsc3_mc_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile ("\
+ mov r1, %2 \n\
+ mov r2, #0 \n\
+ mov r3, #0 \n\
+1: mcr p15, 0, %0, c7, c6, 1 @ invalidate line\n\
+ strd r2, [%0], #8 \n\
+ strd r2, [%0], #8 \n\
+ strd r2, [%0], #8 \n\
+ strd r2, [%0], #8 \n\
+ subs r1, r1, #1 \n\
+ bne 1b"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 32)
+ : "r1", "r2", "r3");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns xsc3_mc_user_fns __initdata = {
+ .cpu_clear_user_highpage = xsc3_mc_clear_user_highpage,
+ .cpu_copy_user_highpage = xsc3_mc_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-xscale.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-xscale.c
new file mode 100644
index 0000000..0fb8502
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/copypage-xscale.c
@@ -0,0 +1,135 @@
+/*
+ * linux/arch/arm/lib/copypage-xscale.S
+ *
+ * Copyright (C) 1995-2005 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This handles the mini data cache, as found on SA11x0 and XScale
+ * processors. When we copy a user page page, we map it in such a way
+ * that accesses to this page will not touch the main data cache, but
+ * will be cached in the mini data cache. This prevents us thrashing
+ * the main data cache on page faults.
+ */
+#include <linux/init.h>
+#include <linux/mm.h>
+#include <linux/highmem.h>
+
+#include <asm/pgtable.h>
+#include <asm/tlbflush.h>
+#include <asm/cacheflush.h>
+
+#include "mm.h"
+
+#define minicache_pgprot __pgprot(L_PTE_PRESENT | L_PTE_YOUNG | \
+ L_PTE_MT_MINICACHE)
+
+static DEFINE_RAW_SPINLOCK(minicache_lock);
+
+/*
+ * XScale mini-dcache optimised copy_user_highpage
+ *
+ * We flush the destination cache lines just before we write the data into the
+ * corresponding address. Since the Dcache is read-allocate, this removes the
+ * Dcache aliasing issue. The writes will be forwarded to the write buffer,
+ * and merged as appropriate.
+ */
+static void __naked
+mc_copy_user_page(void *from, void *to)
+{
+ /*
+ * Strangely enough, best performance is achieved
+ * when prefetching destination as well. (NP)
+ */
+ asm volatile(
+ "stmfd sp!, {r4, r5, lr} \n\
+ mov lr, %2 \n\
+ pld [r0, #0] \n\
+ pld [r0, #32] \n\
+ pld [r1, #0] \n\
+ pld [r1, #32] \n\
+1: pld [r0, #64] \n\
+ pld [r0, #96] \n\
+ pld [r1, #64] \n\
+ pld [r1, #96] \n\
+2: ldrd r2, [r0], #8 \n\
+ ldrd r4, [r0], #8 \n\
+ mov ip, r1 \n\
+ strd r2, [r1], #8 \n\
+ ldrd r2, [r0], #8 \n\
+ strd r4, [r1], #8 \n\
+ ldrd r4, [r0], #8 \n\
+ strd r2, [r1], #8 \n\
+ strd r4, [r1], #8 \n\
+ mcr p15, 0, ip, c7, c10, 1 @ clean D line\n\
+ ldrd r2, [r0], #8 \n\
+ mcr p15, 0, ip, c7, c6, 1 @ invalidate D line\n\
+ ldrd r4, [r0], #8 \n\
+ mov ip, r1 \n\
+ strd r2, [r1], #8 \n\
+ ldrd r2, [r0], #8 \n\
+ strd r4, [r1], #8 \n\
+ ldrd r4, [r0], #8 \n\
+ strd r2, [r1], #8 \n\
+ strd r4, [r1], #8 \n\
+ mcr p15, 0, ip, c7, c10, 1 @ clean D line\n\
+ subs lr, lr, #1 \n\
+ mcr p15, 0, ip, c7, c6, 1 @ invalidate D line\n\
+ bgt 1b \n\
+ beq 2b \n\
+ ldmfd sp!, {r4, r5, pc} "
+ :
+ : "r" (from), "r" (to), "I" (PAGE_SIZE / 64 - 1));
+}
+
+void xscale_mc_copy_user_highpage(struct page *to, struct page *from,
+ unsigned long vaddr, struct vm_area_struct *vma)
+{
+ void *kto = kmap_atomic(to);
+
+ if (!test_and_set_bit(PG_dcache_clean, &from->flags))
+ __flush_dcache_page(page_mapping(from), from);
+
+ raw_spin_lock(&minicache_lock);
+
+ set_top_pte(COPYPAGE_MINICACHE, mk_pte(from, minicache_pgprot));
+
+ mc_copy_user_page((void *)COPYPAGE_MINICACHE, kto);
+
+ raw_spin_unlock(&minicache_lock);
+
+ kunmap_atomic(kto);
+}
+
+/*
+ * XScale optimised clear_user_page
+ */
+void
+xscale_mc_clear_user_highpage(struct page *page, unsigned long vaddr)
+{
+ void *ptr, *kaddr = kmap_atomic(page);
+ asm volatile(
+ "mov r1, %2 \n\
+ mov r2, #0 \n\
+ mov r3, #0 \n\
+1: mov ip, %0 \n\
+ strd r2, [%0], #8 \n\
+ strd r2, [%0], #8 \n\
+ strd r2, [%0], #8 \n\
+ strd r2, [%0], #8 \n\
+ mcr p15, 0, ip, c7, c10, 1 @ clean D line\n\
+ subs r1, r1, #1 \n\
+ mcr p15, 0, ip, c7, c6, 1 @ invalidate D line\n\
+ bne 1b"
+ : "=r" (ptr)
+ : "0" (kaddr), "I" (PAGE_SIZE / 32)
+ : "r1", "r2", "r3", "ip");
+ kunmap_atomic(kaddr);
+}
+
+struct cpu_user_fns xscale_mc_user_fns __initdata = {
+ .cpu_clear_user_highpage = xscale_mc_clear_user_highpage,
+ .cpu_copy_user_highpage = xscale_mc_copy_user_highpage,
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/dma-mapping.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/dma-mapping.c
new file mode 100644
index 0000000..61e08cf
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/dma-mapping.c
@@ -0,0 +1,760 @@
+/*
+ * linux/arch/arm/mm/dma-mapping.c
+ *
+ * Copyright (C) 2000-2004 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * DMA uncached mapping support.
+ */
+#include <linux/module.h>
+#include <linux/mm.h>
+#include <linux/gfp.h>
+#include <linux/errno.h>
+#include <linux/list.h>
+#include <linux/init.h>
+#include <linux/device.h>
+#include <linux/dma-mapping.h>
+#include <linux/highmem.h>
+#include <linux/slab.h>
+
+#include <asm/memory.h>
+#include <asm/highmem.h>
+#include <asm/cacheflush.h>
+#include <asm/tlbflush.h>
+#include <asm/sizes.h>
+#include <asm/mach/arch.h>
+
+#include "mm.h"
+
+static u64 get_coherent_dma_mask(struct device *dev)
+{
+ u64 mask = (u64)arm_dma_limit;
+
+ if (dev) {
+ mask = dev->coherent_dma_mask;
+
+ /*
+ * Sanity check the DMA mask - it must be non-zero, and
+ * must be able to be satisfied by a DMA allocation.
+ */
+ if (mask == 0) {
+ dev_warn(dev, "coherent DMA mask is unset\n");
+ return 0;
+ }
+
+ if ((~mask) & (u64)arm_dma_limit) {
+ dev_warn(dev, "coherent DMA mask %#llx is smaller "
+ "than system GFP_DMA mask %#llx\n",
+ mask, (u64)arm_dma_limit);
+ return 0;
+ }
+ }
+
+ return mask;
+}
+
+/*
+ * Allocate a DMA buffer for 'dev' of size 'size' using the
+ * specified gfp mask. Note that 'size' must be page aligned.
+ */
+static struct page *__dma_alloc_buffer(struct device *dev, size_t size, gfp_t gfp)
+{
+ unsigned long order = get_order(size);
+ struct page *page, *p, *e;
+ void *ptr;
+ u64 mask = get_coherent_dma_mask(dev);
+
+#ifdef CONFIG_DMA_API_DEBUG
+ u64 limit = (mask + 1) & ~mask;
+ if (limit && size >= limit) {
+ dev_warn(dev, "coherent allocation too big (requested %#x mask %#llx)\n",
+ size, mask);
+ return NULL;
+ }
+#endif
+
+ if (!mask)
+ return NULL;
+
+ if (mask < 0xffffffffULL)
+ gfp |= GFP_DMA;
+
+ page = alloc_pages(gfp, order);
+ if (!page)
+ return NULL;
+
+ /*
+ * Now split the huge page and free the excess pages
+ */
+ split_page(page, order);
+ for (p = page + (size >> PAGE_SHIFT), e = page + (1 << order); p < e; p++)
+ __free_page(p);
+
+ /*
+ * Ensure that the allocated pages are zeroed, and that any data
+ * lurking in the kernel direct-mapped region is invalidated.
+ */
+ ptr = page_address(page);
+ memset(ptr, 0, size);
+ dmac_flush_range(ptr, ptr + size);
+ outer_flush_range(__pa(ptr), __pa(ptr) + size);
+
+ return page;
+}
+
+/*
+ * Free a DMA buffer. 'size' must be page aligned.
+ */
+static void __dma_free_buffer(struct page *page, size_t size)
+{
+ struct page *e = page + (size >> PAGE_SHIFT);
+
+ while (page < e) {
+ __free_page(page);
+ page++;
+ }
+}
+
+#ifdef CONFIG_MMU
+
+#define CONSISTENT_OFFSET(x) (((unsigned long)(x) - consistent_base) >> PAGE_SHIFT)
+#define CONSISTENT_PTE_INDEX(x) (((unsigned long)(x) - consistent_base) >> PMD_SHIFT)
+
+/*
+ * These are the page tables (2MB each) covering uncached, DMA consistent allocations
+ */
+static pte_t **consistent_pte;
+
+#define DEFAULT_CONSISTENT_DMA_SIZE SZ_2M
+
+unsigned long consistent_base = CONSISTENT_END - DEFAULT_CONSISTENT_DMA_SIZE;
+
+void __init init_consistent_dma_size(unsigned long size)
+{
+ unsigned long base = CONSISTENT_END - ALIGN(size, SZ_2M);
+
+ BUG_ON(consistent_pte); /* Check we're called before DMA region init */
+ BUG_ON(base < VMALLOC_END);
+
+ /* Grow region to accommodate specified size */
+ if (base < consistent_base)
+ consistent_base = base;
+}
+
+#include "vmregion.h"
+
+static struct arm_vmregion_head consistent_head = {
+ .vm_lock = __SPIN_LOCK_UNLOCKED(&consistent_head.vm_lock),
+ .vm_list = LIST_HEAD_INIT(consistent_head.vm_list),
+ .vm_end = CONSISTENT_END,
+};
+
+#ifdef CONFIG_HUGETLB_PAGE
+#error ARM Coherent DMA allocator does not (yet) support huge TLB
+#endif
+
+/*
+ * Initialise the consistent memory allocation.
+ */
+static int __init consistent_init(void)
+{
+ int ret = 0;
+ pgd_t *pgd;
+ pud_t *pud;
+ pmd_t *pmd;
+ pte_t *pte;
+ int i = 0;
+ unsigned long base = consistent_base;
+ unsigned long num_ptes = (CONSISTENT_END - base) >> PMD_SHIFT;
+
+ consistent_pte = (pte_t **)kmalloc(num_ptes * sizeof(pte_t), GFP_KERNEL);
+ if (!consistent_pte) {
+ pr_err("%s: no memory\n", __func__);
+ return -ENOMEM;
+ }
+
+ pr_debug("DMA memory: 0x%08lx - 0x%08lx:\n", base, CONSISTENT_END);
+ consistent_head.vm_start = base;
+
+ do {
+ pgd = pgd_offset(&init_mm, base);
+
+ pud = pud_alloc(&init_mm, pgd, base);
+ if (!pud) {
+ printk(KERN_ERR "%s: no pud tables\n", __func__);
+ ret = -ENOMEM;
+ break;
+ }
+
+ pmd = pmd_alloc(&init_mm, pud, base);
+ if (!pmd) {
+ printk(KERN_ERR "%s: no pmd tables\n", __func__);
+ ret = -ENOMEM;
+ break;
+ }
+ WARN_ON(!pmd_none(*pmd));
+
+ pte = pte_alloc_kernel(pmd, base);
+ if (!pte) {
+ printk(KERN_ERR "%s: no pte tables\n", __func__);
+ ret = -ENOMEM;
+ break;
+ }
+
+ consistent_pte[i++] = pte;
+ base += PMD_SIZE;
+ } while (base < CONSISTENT_END);
+
+ return ret;
+}
+
+core_initcall(consistent_init);
+
+static void *
+__dma_alloc_remap(struct page *page, size_t size, gfp_t gfp, pgprot_t prot,
+ const void *caller)
+{
+ struct arm_vmregion *c;
+ size_t align;
+ int bit;
+
+ if (!consistent_pte) {
+ printk(KERN_ERR "%s: not initialised\n", __func__);
+ dump_stack();
+ return NULL;
+ }
+
+ /*
+ * Align the virtual region allocation - maximum alignment is
+ * a section size, minimum is a page size. This helps reduce
+ * fragmentation of the DMA space, and also prevents allocations
+ * smaller than a section from crossing a section boundary.
+ */
+ bit = fls(size - 1);
+ if (bit > SECTION_SHIFT)
+ bit = SECTION_SHIFT;
+ align = 1 << bit;
+
+ /*
+ * Allocate a virtual address in the consistent mapping region.
+ */
+ c = arm_vmregion_alloc(&consistent_head, align, size,
+ gfp & ~(__GFP_DMA | __GFP_HIGHMEM), caller);
+ if (c) {
+ pte_t *pte;
+ int idx = CONSISTENT_PTE_INDEX(c->vm_start);
+ u32 off = CONSISTENT_OFFSET(c->vm_start) & (PTRS_PER_PTE-1);
+
+ pte = consistent_pte[idx] + off;
+ c->vm_pages = page;
+
+ do {
+ BUG_ON(!pte_none(*pte));
+
+ set_pte_ext(pte, mk_pte(page, prot), 0);
+ page++;
+ pte++;
+ off++;
+ if (off >= PTRS_PER_PTE) {
+ off = 0;
+ pte = consistent_pte[++idx];
+ }
+ } while (size -= PAGE_SIZE);
+
+ dsb();
+
+ return (void *)c->vm_start;
+ }
+ return NULL;
+}
+
+static void __dma_free_remap(void *cpu_addr, size_t size)
+{
+ struct arm_vmregion *c;
+ unsigned long addr;
+ pte_t *ptep;
+ int idx;
+ u32 off;
+
+ c = arm_vmregion_find_remove(&consistent_head, (unsigned long)cpu_addr);
+ if (!c) {
+ printk(KERN_ERR "%s: trying to free invalid coherent area: %p\n",
+ __func__, cpu_addr);
+ dump_stack();
+ return;
+ }
+
+ if ((c->vm_end - c->vm_start) != size) {
+ printk(KERN_ERR "%s: freeing wrong coherent size (%ld != %d)\n",
+ __func__, c->vm_end - c->vm_start, size);
+ dump_stack();
+ size = c->vm_end - c->vm_start;
+ }
+
+ idx = CONSISTENT_PTE_INDEX(c->vm_start);
+ off = CONSISTENT_OFFSET(c->vm_start) & (PTRS_PER_PTE-1);
+ ptep = consistent_pte[idx] + off;
+ addr = c->vm_start;
+ do {
+ pte_t pte = ptep_get_and_clear(&init_mm, addr, ptep);
+
+ ptep++;
+ addr += PAGE_SIZE;
+ off++;
+ if (off >= PTRS_PER_PTE) {
+ off = 0;
+ ptep = consistent_pte[++idx];
+ }
+
+ if (pte_none(pte) || !pte_present(pte))
+ printk(KERN_CRIT "%s: bad page in kernel page table\n",
+ __func__);
+ } while (size -= PAGE_SIZE);
+
+ flush_tlb_kernel_range(c->vm_start, c->vm_end);
+
+ arm_vmregion_free(&consistent_head, c);
+}
+
+#else /* !CONFIG_MMU */
+
+#define __dma_alloc_remap(page, size, gfp, prot, c) page_address(page)
+#define __dma_free_remap(addr, size) do { } while (0)
+
+#endif /* CONFIG_MMU */
+
+static void *
+__dma_alloc(struct device *dev, size_t size, dma_addr_t *handle, gfp_t gfp,
+ pgprot_t prot, const void *caller)
+{
+ struct page *page;
+ void *addr;
+
+ /*
+ * Following is a work-around (a.k.a. hack) to prevent pages
+ * with __GFP_COMP being passed to split_page() which cannot
+ * handle them. The real problem is that this flag probably
+ * should be 0 on ARM as it is not supported on this
+ * platform; see CONFIG_HUGETLBFS.
+ */
+ gfp &= ~(__GFP_COMP);
+
+ *handle = ~0;
+ size = PAGE_ALIGN(size);
+
+ page = __dma_alloc_buffer(dev, size, gfp);
+ if (!page)
+ return NULL;
+
+ if (!arch_is_coherent())
+ addr = __dma_alloc_remap(page, size, gfp, prot, caller);
+ else
+ addr = page_address(page);
+
+ if (addr)
+ *handle = pfn_to_dma(dev, page_to_pfn(page));
+ else
+ __dma_free_buffer(page, size);
+
+ return addr;
+}
+
+/*
+ * Allocate DMA-coherent memory space and return both the kernel remapped
+ * virtual and bus address for that space.
+ */
+void *
+dma_alloc_coherent(struct device *dev, size_t size, dma_addr_t *handle, gfp_t gfp)
+{
+ void *memory;
+
+ if (dma_alloc_from_coherent(dev, size, handle, &memory))
+ return memory;
+
+ return __dma_alloc(dev, size, handle, gfp,
+ pgprot_dmacoherent(pgprot_kernel),
+ __builtin_return_address(0));
+}
+EXPORT_SYMBOL(dma_alloc_coherent);
+
+/*
+ * Allocate a writecombining region, in much the same way as
+ * dma_alloc_coherent above.
+ */
+void *
+dma_alloc_writecombine(struct device *dev, size_t size, dma_addr_t *handle, gfp_t gfp)
+{
+ return __dma_alloc(dev, size, handle, gfp,
+ pgprot_writecombine(pgprot_kernel),
+ __builtin_return_address(0));
+}
+EXPORT_SYMBOL(dma_alloc_writecombine);
+
+static int dma_mmap(struct device *dev, struct vm_area_struct *vma,
+ void *cpu_addr, dma_addr_t dma_addr, size_t size)
+{
+ int ret = -ENXIO;
+#ifdef CONFIG_MMU
+ unsigned long user_size, kern_size;
+ struct arm_vmregion *c;
+
+ user_size = (vma->vm_end - vma->vm_start) >> PAGE_SHIFT;
+
+ c = arm_vmregion_find(&consistent_head, (unsigned long)cpu_addr);
+ if (c) {
+ unsigned long off = vma->vm_pgoff;
+
+ kern_size = (c->vm_end - c->vm_start) >> PAGE_SHIFT;
+
+ if (off < kern_size &&
+ user_size <= (kern_size - off)) {
+ ret = remap_pfn_range(vma, vma->vm_start,
+ page_to_pfn(c->vm_pages) + off,
+ user_size << PAGE_SHIFT,
+ vma->vm_page_prot);
+ }
+ }
+#endif /* CONFIG_MMU */
+
+ return ret;
+}
+
+int dma_mmap_coherent(struct device *dev, struct vm_area_struct *vma,
+ void *cpu_addr, dma_addr_t dma_addr, size_t size)
+{
+ vma->vm_page_prot = pgprot_dmacoherent(vma->vm_page_prot);
+ return dma_mmap(dev, vma, cpu_addr, dma_addr, size);
+}
+EXPORT_SYMBOL(dma_mmap_coherent);
+
+int dma_mmap_writecombine(struct device *dev, struct vm_area_struct *vma,
+ void *cpu_addr, dma_addr_t dma_addr, size_t size)
+{
+ vma->vm_page_prot = pgprot_writecombine(vma->vm_page_prot);
+ return dma_mmap(dev, vma, cpu_addr, dma_addr, size);
+}
+EXPORT_SYMBOL(dma_mmap_writecombine);
+
+/*
+ * free a page as defined by the above mapping.
+ * Must not be called with IRQs disabled.
+ */
+void dma_free_coherent(struct device *dev, size_t size, void *cpu_addr, dma_addr_t handle)
+{
+ WARN_ON(irqs_disabled());
+
+ if (dma_release_from_coherent(dev, get_order(size), cpu_addr))
+ return;
+
+ size = PAGE_ALIGN(size);
+
+ if (!arch_is_coherent())
+ __dma_free_remap(cpu_addr, size);
+
+ __dma_free_buffer(pfn_to_page(dma_to_pfn(dev, handle)), size);
+}
+EXPORT_SYMBOL(dma_free_coherent);
+
+/*
+ * Make an area consistent for devices.
+ * Note: Drivers should NOT use this function directly, as it will break
+ * platforms with CONFIG_DMABOUNCE.
+ * Use the driver DMA support - see dma-mapping.h (dma_sync_*)
+ */
+void ___dma_single_cpu_to_dev(const void *kaddr, size_t size,
+ enum dma_data_direction dir)
+{
+ unsigned long paddr;
+
+ BUG_ON(!virt_addr_valid(kaddr) || !virt_addr_valid(kaddr + size - 1));
+
+ dmac_map_area(kaddr, size, dir);
+
+ paddr = __pa(kaddr);
+ if (dir == DMA_FROM_DEVICE) {
+ outer_inv_range(paddr, paddr + size);
+ } else {
+ outer_clean_range(paddr, paddr + size);
+ }
+ /* FIXME: non-speculating: flush on bidirectional mappings? */
+}
+EXPORT_SYMBOL(___dma_single_cpu_to_dev);
+
+void ___dma_single_dev_to_cpu(const void *kaddr, size_t size,
+ enum dma_data_direction dir)
+{
+ BUG_ON(!virt_addr_valid(kaddr) || !virt_addr_valid(kaddr + size - 1));
+
+ /* FIXME: non-speculating: not required */
+ /* don't bother invalidating if DMA to device */
+ if (dir != DMA_TO_DEVICE) {
+ unsigned long paddr = __pa(kaddr);
+ outer_inv_range(paddr, paddr + size);
+ }
+
+ dmac_unmap_area(kaddr, size, dir);
+}
+EXPORT_SYMBOL(___dma_single_dev_to_cpu);
+
+static void dma_cache_maint_page(struct page *page, unsigned long offset,
+ size_t size, enum dma_data_direction dir,
+ void (*op)(const void *, size_t, int))
+{
+ unsigned long pfn;
+ size_t left = size;
+
+ pfn = page_to_pfn(page) + offset / PAGE_SIZE;
+ offset %= PAGE_SIZE;
+
+ /*
+ * A single sg entry may refer to multiple physically contiguous
+ * pages. But we still need to process highmem pages individually.
+ * If highmem is not configured then the bulk of this loop gets
+ * optimized out.
+ */
+ do {
+ size_t len = left;
+ void *vaddr;
+
+ page = pfn_to_page(pfn);
+
+ if (PageHighMem(page)) {
+ if (len + offset > PAGE_SIZE)
+ len = PAGE_SIZE - offset;
+ vaddr = kmap_high_get(page);
+ if (vaddr) {
+ vaddr += offset;
+ op(vaddr, len, dir);
+ kunmap_high(page);
+ } else if (cache_is_vipt()) {
+ /* unmapped pages might still be cached */
+ vaddr = kmap_atomic(page);
+ op(vaddr + offset, len, dir);
+ kunmap_atomic(vaddr);
+ }
+ } else {
+ vaddr = page_address(page) + offset;
+ op(vaddr, len, dir);
+ }
+ offset = 0;
+ pfn++;
+ left -= len;
+ } while (left);
+}
+
+void ___dma_page_cpu_to_dev(struct page *page, unsigned long off,
+ size_t size, enum dma_data_direction dir)
+{
+ unsigned long paddr;
+
+ dma_cache_maint_page(page, off, size, dir, dmac_map_area);
+
+ paddr = page_to_phys(page) + off;
+ if (dir == DMA_FROM_DEVICE) {
+ outer_inv_range(paddr, paddr + size);
+ } else {
+ outer_clean_range(paddr, paddr + size);
+ }
+ /* FIXME: non-speculating: flush on bidirectional mappings? */
+}
+EXPORT_SYMBOL(___dma_page_cpu_to_dev);
+
+void ___dma_page_dev_to_cpu(struct page *page, unsigned long off,
+ size_t size, enum dma_data_direction dir)
+{
+ unsigned long paddr = page_to_phys(page) + off;
+
+ /* FIXME: non-speculating: not required */
+ /* don't bother invalidating if DMA to device */
+ if (dir != DMA_TO_DEVICE)
+ outer_inv_range(paddr, paddr + size);
+
+ dma_cache_maint_page(page, off, size, dir, dmac_unmap_area);
+
+ /*
+ * Mark the D-cache clean for this page to avoid extra flushing.
+ */
+ if (dir != DMA_TO_DEVICE && off == 0 && size >= PAGE_SIZE)
+ set_bit(PG_dcache_clean, &page->flags);
+}
+EXPORT_SYMBOL(___dma_page_dev_to_cpu);
+
+/**
+ * dma_map_sg - map a set of SG buffers for streaming mode DMA
+ * @dev: valid struct device pointer, or NULL for ISA and EISA-like devices
+ * @sg: list of buffers
+ * @nents: number of buffers to map
+ * @dir: DMA transfer direction
+ *
+ * Map a set of buffers described by scatterlist in streaming mode for DMA.
+ * This is the scatter-gather version of the dma_map_single interface.
+ * Here the scatter gather list elements are each tagged with the
+ * appropriate dma address and length. They are obtained via
+ * sg_dma_{address,length}.
+ *
+ * Device ownership issues as mentioned for dma_map_single are the same
+ * here.
+ */
+int dma_map_sg(struct device *dev, struct scatterlist *sg, int nents,
+ enum dma_data_direction dir)
+{
+ struct scatterlist *s;
+ int i, j;
+
+ BUG_ON(!valid_dma_direction(dir));
+
+ for_each_sg(sg, s, nents, i) {
+ s->dma_address = __dma_map_page(dev, sg_page(s), s->offset,
+ s->length, dir);
+ if (dma_mapping_error(dev, s->dma_address))
+ goto bad_mapping;
+ }
+ debug_dma_map_sg(dev, sg, nents, nents, dir);
+ return nents;
+
+ bad_mapping:
+ for_each_sg(sg, s, i, j)
+ __dma_unmap_page(dev, sg_dma_address(s), sg_dma_len(s), dir);
+ return 0;
+}
+EXPORT_SYMBOL(dma_map_sg);
+
+/**
+ * dma_unmap_sg - unmap a set of SG buffers mapped by dma_map_sg
+ * @dev: valid struct device pointer, or NULL for ISA and EISA-like devices
+ * @sg: list of buffers
+ * @nents: number of buffers to unmap (same as was passed to dma_map_sg)
+ * @dir: DMA transfer direction (same as was passed to dma_map_sg)
+ *
+ * Unmap a set of streaming mode DMA translations. Again, CPU access
+ * rules concerning calls here are the same as for dma_unmap_single().
+ */
+void dma_unmap_sg(struct device *dev, struct scatterlist *sg, int nents,
+ enum dma_data_direction dir)
+{
+ struct scatterlist *s;
+ int i;
+
+ debug_dma_unmap_sg(dev, sg, nents, dir);
+
+ for_each_sg(sg, s, nents, i)
+ __dma_unmap_page(dev, sg_dma_address(s), sg_dma_len(s), dir);
+}
+EXPORT_SYMBOL(dma_unmap_sg);
+
+/**
+ * dma_sync_sg_for_cpu
+ * @dev: valid struct device pointer, or NULL for ISA and EISA-like devices
+ * @sg: list of buffers
+ * @nents: number of buffers to map (returned from dma_map_sg)
+ * @dir: DMA transfer direction (same as was passed to dma_map_sg)
+ */
+void dma_sync_sg_for_cpu(struct device *dev, struct scatterlist *sg,
+ int nents, enum dma_data_direction dir)
+{
+ struct scatterlist *s;
+ int i;
+
+ for_each_sg(sg, s, nents, i) {
+ if (!dmabounce_sync_for_cpu(dev, sg_dma_address(s), 0,
+ sg_dma_len(s), dir))
+ continue;
+
+ __dma_page_dev_to_cpu(sg_page(s), s->offset,
+ s->length, dir);
+ }
+
+ debug_dma_sync_sg_for_cpu(dev, sg, nents, dir);
+}
+EXPORT_SYMBOL(dma_sync_sg_for_cpu);
+
+/**
+ * dma_sync_sg_for_device
+ * @dev: valid struct device pointer, or NULL for ISA and EISA-like devices
+ * @sg: list of buffers
+ * @nents: number of buffers to map (returned from dma_map_sg)
+ * @dir: DMA transfer direction (same as was passed to dma_map_sg)
+ */
+void dma_sync_sg_for_device(struct device *dev, struct scatterlist *sg,
+ int nents, enum dma_data_direction dir)
+{
+ struct scatterlist *s;
+ int i;
+
+ for_each_sg(sg, s, nents, i) {
+ if (!dmabounce_sync_for_device(dev, sg_dma_address(s), 0,
+ sg_dma_len(s), dir))
+ continue;
+
+ __dma_page_cpu_to_dev(sg_page(s), s->offset,
+ s->length, dir);
+ }
+
+ debug_dma_sync_sg_for_device(dev, sg, nents, dir);
+}
+EXPORT_SYMBOL(dma_sync_sg_for_device);
+
+void dma_cache_maint(const void *vir_addr, const void *phy_addr, size_t size, int direction)
+{
+ //BUG_ON(!virt_addr_valid(start) || !virt_addr_valid(start + size - 1));
+
+ switch (direction) {
+ case DMA_FROM_DEVICE: /* invalidate only */
+ outer_inv_range(phy_addr, phy_addr + size);
+ dmac_map_area(vir_addr, size, direction);
+ break;
+ case DMA_TO_DEVICE: /* writeback only */
+ dmac_map_area(vir_addr, size, direction);
+ outer_clean_range(phy_addr, phy_addr + size);
+ break;
+ case DMA_BIDIRECTIONAL: /* writeback and invalidate */
+ dmac_flush_range(vir_addr, vir_addr + size);
+ outer_flush_range(phy_addr, phy_addr + size);
+ break;
+ default:
+ BUG();
+ }
+}
+EXPORT_SYMBOL(dma_cache_maint);
+
+/*
+ * Return whether the given device DMA address mask can be supported
+ * properly. For example, if your device can only drive the low 24-bits
+ * during bus mastering, then you would pass 0x00ffffff as the mask
+ * to this function.
+ */
+int dma_supported(struct device *dev, u64 mask)
+{
+ if (mask < (u64)arm_dma_limit)
+ return 0;
+ return 1;
+}
+EXPORT_SYMBOL(dma_supported);
+
+int dma_set_mask(struct device *dev, u64 dma_mask)
+{
+ if (!dev->dma_mask || !dma_supported(dev, dma_mask))
+ return -EIO;
+
+#ifndef CONFIG_DMABOUNCE
+ *dev->dma_mask = dma_mask;
+#endif
+
+ return 0;
+}
+EXPORT_SYMBOL(dma_set_mask);
+
+#define PREALLOC_DMA_DEBUG_ENTRIES 4096
+
+static int __init dma_debug_do_init(void)
+{
+#ifdef CONFIG_MMU
+ arm_vmregion_create_proc("dma-mappings", &consistent_head);
+#endif
+ dma_debug_init(PREALLOC_DMA_DEBUG_ENTRIES);
+ return 0;
+}
+fs_initcall(dma_debug_do_init);
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/extable.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/extable.c
new file mode 100644
index 0000000..9d28562
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/extable.c
@@ -0,0 +1,16 @@
+/*
+ * linux/arch/arm/mm/extable.c
+ */
+#include <linux/module.h>
+#include <linux/uaccess.h>
+
+int fixup_exception(struct pt_regs *regs)
+{
+ const struct exception_table_entry *fixup;
+
+ fixup = search_exception_tables(instruction_pointer(regs));
+ if (fixup)
+ regs->ARM_pc = fixup->fixup;
+
+ return fixup != NULL;
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/fault-armv.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/fault-armv.c
new file mode 100644
index 0000000..7599e26
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/fault-armv.c
@@ -0,0 +1,270 @@
+/*
+ * linux/arch/arm/mm/fault-armv.c
+ *
+ * Copyright (C) 1995 Linus Torvalds
+ * Modifications for ARM processor (c) 1995-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/sched.h>
+#include <linux/kernel.h>
+#include <linux/mm.h>
+#include <linux/bitops.h>
+#include <linux/vmalloc.h>
+#include <linux/init.h>
+#include <linux/pagemap.h>
+#include <linux/gfp.h>
+
+#include <asm/bugs.h>
+#include <asm/cacheflush.h>
+#include <asm/cachetype.h>
+#include <asm/pgtable.h>
+#include <asm/tlbflush.h>
+
+#include "mm.h"
+
+static pteval_t shared_pte_mask = L_PTE_MT_BUFFERABLE;
+
+#if __LINUX_ARM_ARCH__ < 6
+/*
+ * We take the easy way out of this problem - we make the
+ * PTE uncacheable. However, we leave the write buffer on.
+ *
+ * Note that the pte lock held when calling update_mmu_cache must also
+ * guard the pte (somewhere else in the same mm) that we modify here.
+ * Therefore those configurations which might call adjust_pte (those
+ * without CONFIG_CPU_CACHE_VIPT) cannot support split page_table_lock.
+ */
+static int do_adjust_pte(struct vm_area_struct *vma, unsigned long address,
+ unsigned long pfn, pte_t *ptep)
+{
+ pte_t entry = *ptep;
+ int ret;
+
+ /*
+ * If this page is present, it's actually being shared.
+ */
+ ret = pte_present(entry);
+
+ /*
+ * If this page isn't present, or is already setup to
+ * fault (ie, is old), we can safely ignore any issues.
+ */
+ if (ret && (pte_val(entry) & L_PTE_MT_MASK) != shared_pte_mask) {
+ flush_cache_page(vma, address, pfn);
+ outer_flush_range((pfn << PAGE_SHIFT),
+ (pfn << PAGE_SHIFT) + PAGE_SIZE);
+ pte_val(entry) &= ~L_PTE_MT_MASK;
+ pte_val(entry) |= shared_pte_mask;
+ set_pte_at(vma->vm_mm, address, ptep, entry);
+ flush_tlb_page(vma, address);
+ }
+
+ return ret;
+}
+
+#if USE_SPLIT_PTLOCKS
+/*
+ * If we are using split PTE locks, then we need to take the page
+ * lock here. Otherwise we are using shared mm->page_table_lock
+ * which is already locked, thus cannot take it.
+ */
+static inline void do_pte_lock(spinlock_t *ptl)
+{
+ /*
+ * Use nested version here to indicate that we are already
+ * holding one similar spinlock.
+ */
+ spin_lock_nested(ptl, SINGLE_DEPTH_NESTING);
+}
+
+static inline void do_pte_unlock(spinlock_t *ptl)
+{
+ spin_unlock(ptl);
+}
+#else /* !USE_SPLIT_PTLOCKS */
+static inline void do_pte_lock(spinlock_t *ptl) {}
+static inline void do_pte_unlock(spinlock_t *ptl) {}
+#endif /* USE_SPLIT_PTLOCKS */
+
+static int adjust_pte(struct vm_area_struct *vma, unsigned long address,
+ unsigned long pfn)
+{
+ spinlock_t *ptl;
+ pgd_t *pgd;
+ pud_t *pud;
+ pmd_t *pmd;
+ pte_t *pte;
+ int ret;
+
+ pgd = pgd_offset(vma->vm_mm, address);
+ if (pgd_none_or_clear_bad(pgd))
+ return 0;
+
+ pud = pud_offset(pgd, address);
+ if (pud_none_or_clear_bad(pud))
+ return 0;
+
+ pmd = pmd_offset(pud, address);
+ if (pmd_none_or_clear_bad(pmd))
+ return 0;
+
+ /*
+ * This is called while another page table is mapped, so we
+ * must use the nested version. This also means we need to
+ * open-code the spin-locking.
+ */
+ ptl = pte_lockptr(vma->vm_mm, pmd);
+ pte = pte_offset_map(pmd, address);
+ do_pte_lock(ptl);
+
+ ret = do_adjust_pte(vma, address, pfn, pte);
+
+ do_pte_unlock(ptl);
+ pte_unmap(pte);
+
+ return ret;
+}
+
+static void
+make_coherent(struct address_space *mapping, struct vm_area_struct *vma,
+ unsigned long addr, pte_t *ptep, unsigned long pfn)
+{
+ struct mm_struct *mm = vma->vm_mm;
+ struct vm_area_struct *mpnt;
+ struct prio_tree_iter iter;
+ unsigned long offset;
+ pgoff_t pgoff;
+ int aliases = 0;
+
+ pgoff = vma->vm_pgoff + ((addr - vma->vm_start) >> PAGE_SHIFT);
+
+ /*
+ * If we have any shared mappings that are in the same mm
+ * space, then we need to handle them specially to maintain
+ * cache coherency.
+ */
+ flush_dcache_mmap_lock(mapping);
+ vma_prio_tree_foreach(mpnt, &iter, &mapping->i_mmap, pgoff, pgoff) {
+ /*
+ * If this VMA is not in our MM, we can ignore it.
+ * Note that we intentionally mask out the VMA
+ * that we are fixing up.
+ */
+ if (mpnt->vm_mm != mm || mpnt == vma)
+ continue;
+ if (!(mpnt->vm_flags & VM_MAYSHARE))
+ continue;
+ offset = (pgoff - mpnt->vm_pgoff) << PAGE_SHIFT;
+ aliases += adjust_pte(mpnt, mpnt->vm_start + offset, pfn);
+ }
+ flush_dcache_mmap_unlock(mapping);
+ if (aliases)
+ do_adjust_pte(vma, addr, pfn, ptep);
+}
+
+/*
+ * Take care of architecture specific things when placing a new PTE into
+ * a page table, or changing an existing PTE. Basically, there are two
+ * things that we need to take care of:
+ *
+ * 1. If PG_dcache_clean is not set for the page, we need to ensure
+ * that any cache entries for the kernels virtual memory
+ * range are written back to the page.
+ * 2. If we have multiple shared mappings of the same space in
+ * an object, we need to deal with the cache aliasing issues.
+ *
+ * Note that the pte lock will be held.
+ */
+void update_mmu_cache(struct vm_area_struct *vma, unsigned long addr,
+ pte_t *ptep)
+{
+ unsigned long pfn = pte_pfn(*ptep);
+ struct address_space *mapping;
+ struct page *page;
+
+ if (!pfn_valid(pfn))
+ return;
+
+ /*
+ * The zero page is never written to, so never has any dirty
+ * cache lines, and therefore never needs to be flushed.
+ */
+ page = pfn_to_page(pfn);
+ if (page == ZERO_PAGE(0))
+ return;
+
+ mapping = page_mapping(page);
+ if (!test_and_set_bit(PG_dcache_clean, &page->flags))
+ __flush_dcache_page(mapping, page);
+ if (mapping) {
+ if (cache_is_vivt())
+ make_coherent(mapping, vma, addr, ptep, pfn);
+ else if (vma->vm_flags & VM_EXEC)
+ __flush_icache_all();
+ }
+}
+#endif /* __LINUX_ARM_ARCH__ < 6 */
+
+/*
+ * Check whether the write buffer has physical address aliasing
+ * issues. If it has, we need to avoid them for the case where
+ * we have several shared mappings of the same object in user
+ * space.
+ */
+static int __init check_writebuffer(unsigned long *p1, unsigned long *p2)
+{
+ register unsigned long zero = 0, one = 1, val;
+
+ local_irq_disable();
+ mb();
+ *p1 = one;
+ mb();
+ *p2 = zero;
+ mb();
+ val = *p1;
+ mb();
+ local_irq_enable();
+ return val != zero;
+}
+
+void __init check_writebuffer_bugs(void)
+{
+ struct page *page;
+ const char *reason;
+ unsigned long v = 1;
+
+ printk(KERN_INFO "CPU: Testing write buffer coherency: ");
+
+ page = alloc_page(GFP_KERNEL);
+ if (page) {
+ unsigned long *p1, *p2;
+ pgprot_t prot = __pgprot_modify(PAGE_KERNEL,
+ L_PTE_MT_MASK, L_PTE_MT_BUFFERABLE);
+
+ p1 = vmap(&page, 1, VM_IOREMAP, prot);
+ p2 = vmap(&page, 1, VM_IOREMAP, prot);
+
+ if (p1 && p2) {
+ v = check_writebuffer(p1, p2);
+ reason = "enabling work-around";
+ } else {
+ reason = "unable to map memory\n";
+ }
+
+ vunmap(p1);
+ vunmap(p2);
+ put_page(page);
+ } else {
+ reason = "unable to grab page\n";
+ }
+
+ if (v) {
+ printk("failed, %s\n", reason);
+ shared_pte_mask = L_PTE_MT_UNCACHED;
+ } else {
+ printk("ok\n");
+ }
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/fault.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/fault.c
new file mode 100755
index 0000000..3f83356
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/fault.c
@@ -0,0 +1,305 @@
+
+#include <linux/module.h>
+#include <linux/signal.h>
+#include <linux/mm.h>
+#include <linux/hardirq.h>
+#include <linux/init.h>
+#include <linux/kprobes.h>
+#include <linux/uaccess.h>
+#include <linux/page-flags.h>
+#include <linux/sched.h>
+#include <linux/highmem.h>
+#include <linux/perf_event.h>
+#include <asm/exception.h>
+#include <asm/pgtable.h>
+#include <asm/system_misc.h>
+#include <asm/system_info.h>
+#include <asm/tlbflush.h>
+#include <asm/mach/map.h>
+#include <linux/slab.h>
+#include "fault.h"
+#ifdef CONFIG_MMU
+#ifdef CONFIG_KPROBES
+static inline int notify_page_fault(struct pt_regs*regs,unsigned int fsr){int
+ret=(0x821+7610-0x25db);if(!user_mode(regs)){preempt_disable();if(kprobe_running
+()&&kprobe_fault_handler(regs,fsr))ret=(0x1418+3031-0x1fee);preempt_enable();}
+return ret;}
+#else
+static inline int notify_page_fault(struct pt_regs*regs,unsigned int fsr){return
+(0xbd2+3187-0x1845);}
+#endif
+void show_pte(struct mm_struct*mm,unsigned long addr){pgd_t*pgd;if(!mm)mm=&
+init_mm;printk(KERN_ALERT"\x70\x67\x64\x20\x3d\x20\x25\x70" "\n",mm->pgd);pgd=
+pgd_offset(mm,addr);printk(KERN_ALERT
+"\x5b\x25\x30\x38\x6c\x78\x5d\x20\x2a\x70\x67\x64\x3d\x25\x30\x38\x6c\x6c\x78",
+addr,(long long)pgd_val(*pgd));do{pud_t*pud;pmd_t*pmd;pte_t*pte;if(pgd_none(*pgd
+))break;if(pgd_bad(*pgd)){printk("\x28\x62\x61\x64\x29");break;}pud=pud_offset(
+pgd,addr);if(PTRS_PER_PUD!=(0x1e30+502-0x2025))printk(
+"\x2c\x20\x2a\x70\x75\x64\x3d\x25\x30\x38\x6c\x6c\x78",(long long)pud_val(*pud))
+;if(pud_none(*pud))break;if(pud_bad(*pud)){printk("\x28\x62\x61\x64\x29");break;
+}pmd=pmd_offset(pud,addr);if(PTRS_PER_PMD!=(0x5c2+7093-0x2176))printk(
+"\x2c\x20\x2a\x70\x6d\x64\x3d\x25\x30\x38\x6c\x6c\x78",(long long)pmd_val(*pmd))
+;if(pmd_none(*pmd))break;if(pmd_bad(*pmd)){printk("\x28\x62\x61\x64\x29");break;
+}if(PageHighMem(pfn_to_page(pmd_val(*pmd)>>PAGE_SHIFT)))break;pte=pte_offset_map
+(pmd,addr);printk("\x2c\x20\x2a\x70\x74\x65\x3d\x25\x30\x38\x6c\x6c\x78",(long
+long)pte_val(*pte));
+#ifndef CONFIG_ARM_LPAE
+printk("\x2c\x20\x2a\x70\x70\x74\x65\x3d\x25\x30\x38\x6c\x6c\x78",(long long)
+pte_val(pte[PTE_HWTABLE_PTRS]));
+#endif
+pte_unmap(pte);}while((0x22f6+523-0x2501));printk("\n");}
+#else
+void show_pte(struct mm_struct*mm,unsigned long addr){}
+#endif
+static void __do_kernel_fault(struct mm_struct*mm,unsigned long addr,unsigned
+int fsr,struct pt_regs*regs){if(fixup_exception(regs))return;bust_spinlocks(
+(0x42d+6784-0x1eac));printk(KERN_ALERT
+"\x55\x6e\x61\x62\x6c\x65\x20\x74\x6f\x20\x68\x61\x6e\x64\x6c\x65\x20\x6b\x65\x72\x6e\x65\x6c\x20\x25\x73\x20\x61\x74\x20\x76\x69\x72\x74\x75\x61\x6c\x20\x61\x64\x64\x72\x65\x73\x73\x20\x25\x30\x38\x6c\x78" "\n"
+,(addr<PAGE_SIZE)?
+"\x4e\x55\x4c\x4c\x20\x70\x6f\x69\x6e\x74\x65\x72\x20\x64\x65\x72\x65\x66\x65\x72\x65\x6e\x63\x65"
+:"\x70\x61\x67\x69\x6e\x67\x20\x72\x65\x71\x75\x65\x73\x74",addr);show_pte(mm,
+addr);die("\x4f\x6f\x70\x73",regs,fsr);bust_spinlocks((0x950+629-0xbc5));do_exit
+(SIGKILL);}static void __do_user_fault(struct task_struct*tsk,unsigned long addr
+,unsigned int fsr,unsigned int sig,int code,struct pt_regs*regs){struct siginfo
+si;
+#ifdef CONFIG_DEBUG_USER
+if(((user_debug&UDBG_SEGV)&&(sig==SIGSEGV))||((user_debug&UDBG_BUS)&&(sig==
+SIGBUS))){printk(KERN_DEBUG
+"\x25\x73\x3a\x20\x75\x6e\x68\x61\x6e\x64\x6c\x65\x64\x20\x70\x61\x67\x65\x20\x66\x61\x75\x6c\x74\x20\x28\x25\x64\x29\x20\x61\x74\x20\x30\x78\x25\x30\x38\x6c\x78\x2c\x20\x63\x6f\x64\x65\x20\x30\x78\x25\x30\x33\x78" "\n"
+,tsk->comm,sig,addr,fsr);show_pte(tsk->mm,addr);show_regs(regs);}
+#endif
+tsk->thread.address=addr;tsk->thread.error_code=fsr;tsk->thread.trap_no=
+(0x1198+2168-0x1a02);si.si_signo=sig;si.si_errno=(0x735+2159-0xfa4);si.si_code=
+code;si.si_addr=(void __user*)addr;force_sig_info(sig,&si,tsk);}void do_bad_area
+(unsigned long addr,unsigned int fsr,struct pt_regs*regs){struct task_struct*tsk
+=current;struct mm_struct*mm=tsk->active_mm;if(user_mode(regs))__do_user_fault(
+tsk,addr,fsr,SIGSEGV,SEGV_MAPERR,regs);else __do_kernel_fault(mm,addr,fsr,regs);
+}
+#ifdef CONFIG_MMU
+#define VM_FAULT_BADMAP 65536
+#define VM_FAULT_BADACCESS 131072
+static inline bool access_error(unsigned int fsr,struct vm_area_struct*vma){
+unsigned int mask=VM_READ|VM_WRITE|VM_EXEC;if(fsr&FSR_WRITE)mask=VM_WRITE;if(fsr
+&FSR_LNX_PF)mask=VM_EXEC;return vma->vm_flags&mask?false:true;}static int
+__kprobes __do_page_fault(struct mm_struct*mm,unsigned long addr,unsigned int
+fsr,unsigned int flags,struct task_struct*tsk){struct vm_area_struct*vma;int
+fault;vma=find_vma(mm,addr);fault=VM_FAULT_BADMAP;if(unlikely(!vma))goto out;if(
+unlikely(vma->vm_start>addr))goto check_stack;good_area:if(access_error(fsr,vma)
+){fault=VM_FAULT_BADACCESS;goto out;}return handle_mm_fault(mm,vma,addr&
+PAGE_MASK,flags);check_stack:if(vma->vm_flags&VM_GROWSDOWN&&addr>=
+FIRST_USER_ADDRESS&&!expand_stack(vma,addr))goto good_area;out:return fault;}
+static int __kprobes do_page_fault(unsigned long addr,unsigned int fsr,struct
+pt_regs*regs){struct task_struct*tsk;struct mm_struct*mm;int fault,sig,code;int
+write=fsr&FSR_WRITE;unsigned int flags=FAULT_FLAG_ALLOW_RETRY|
+FAULT_FLAG_KILLABLE|(write?FAULT_FLAG_WRITE:(0x327+3606-0x113d));if(
+notify_page_fault(regs,fsr))return(0x44d+3467-0x11d8);tsk=current;mm=tsk->mm;if(
+interrupts_enabled(regs))local_irq_enable();if(!mm||pagefault_disabled())goto
+no_context;if(!down_read_trylock(&mm->mmap_sem)){if(!user_mode(regs)&&!
+search_exception_tables(regs->ARM_pc))goto no_context;retry:down_read(&mm->
+mmap_sem);}else{might_sleep();
+#ifdef CONFIG_DEBUG_VM
+if(!user_mode(regs)&&!search_exception_tables(regs->ARM_pc))goto no_context;
+#endif
+}fault=__do_page_fault(mm,addr,fsr,flags,tsk);if((fault&VM_FAULT_RETRY)&&
+fatal_signal_pending(current))return(0x464+2791-0xf4b);perf_sw_event(
+PERF_COUNT_SW_PAGE_FAULTS,(0x1a54+750-0x1d41),regs,addr);if(!(fault&
+VM_FAULT_ERROR)&&flags&FAULT_FLAG_ALLOW_RETRY){if(fault&VM_FAULT_MAJOR){tsk->
+maj_flt++;perf_sw_event(PERF_COUNT_SW_PAGE_FAULTS_MAJ,(0x104d+2685-0x1ac9),regs,
+addr);}else{tsk->min_flt++;perf_sw_event(PERF_COUNT_SW_PAGE_FAULTS_MIN,
+(0x1aa+120-0x221),regs,addr);}if(fault&VM_FAULT_RETRY){flags&=~
+FAULT_FLAG_ALLOW_RETRY;goto retry;}}up_read(&mm->mmap_sem);if(likely(!(fault&(
+VM_FAULT_ERROR|VM_FAULT_BADMAP|VM_FAULT_BADACCESS))))return(0x798+6836-0x224c);
+if(fault&VM_FAULT_OOM){pagefault_out_of_memory();return(0xc8d+3713-0x1b0e);}if(!
+user_mode(regs))goto no_context;if(fault&VM_FAULT_SIGBUS){sig=SIGBUS;code=
+BUS_ADRERR;}else{sig=SIGSEGV;code=fault==VM_FAULT_BADACCESS?SEGV_ACCERR:
+SEGV_MAPERR;}__do_user_fault(tsk,addr,fsr,sig,code,regs);return
+(0x354+7953-0x2265);no_context:__do_kernel_fault(mm,addr,fsr,regs);return
+(0x22fc+79-0x234b);}
+#else
+static int do_page_fault(unsigned long addr,unsigned int fsr,struct pt_regs*regs
+){return(0xd1d+2859-0x1848);}
+#endif
+#ifdef CONFIG_MMU
+static int __kprobes do_translation_fault(unsigned long addr,unsigned int fsr,
+struct pt_regs*regs){unsigned int index;pgd_t*pgd,*pgd_k;pud_t*pud,*pud_k;pmd_t*
+pmd,*pmd_k;if(addr<TASK_SIZE)return do_page_fault(addr,fsr,regs);if(
+interrupts_enabled(regs))local_irq_enable();if(user_mode(regs))goto bad_area;
+index=pgd_index(addr);pgd=cpu_get_pgd()+index;pgd_k=init_mm.pgd+index;if(
+pgd_none(*pgd_k))goto bad_area;if(!pgd_present(*pgd))set_pgd(pgd,*pgd_k);pud=
+pud_offset(pgd,addr);pud_k=pud_offset(pgd_k,addr);if(pud_none(*pud_k))goto
+bad_area;if(!pud_present(*pud))set_pud(pud,*pud_k);pmd=pmd_offset(pud,addr);
+pmd_k=pmd_offset(pud_k,addr);
+#ifdef CONFIG_ARM_LPAE
+index=(0x1c5+4393-0x12ee);
+#else
+index=(addr>>SECTION_SHIFT)&(0x286+7418-0x1f7f);
+#endif
+if(pmd_none(pmd_k[index]))goto bad_area;copy_pmd(pmd,pmd_k);return
+(0x105f+2739-0x1b12);bad_area:do_bad_area(addr,fsr,regs);return
+(0x12b7+2483-0x1c6a);}
+#else
+static int do_translation_fault(unsigned long addr,unsigned int fsr,struct
+pt_regs*regs){return(0x1446+4583-0x262d);}
+#endif
+static int do_sect_fault(unsigned long addr,unsigned int fsr,struct pt_regs*regs
+){if(interrupts_enabled(regs))local_irq_enable();do_bad_area(addr,fsr,regs);
+return(0x807+5063-0x1bce);}static int do_bad(unsigned long addr,unsigned int fsr
+,struct pt_regs*regs){return(0x5d+2345-0x985);}struct fsr_info{int(*fn)(unsigned
+ long addr,unsigned int fsr,struct pt_regs*regs);int sig;int code;const char*
+name;};
+#ifdef CONFIG_ARM_LPAE
+#include "fsr-3level.c"
+#else
+#include "fsr-2level.c"
+#endif
+void __init hook_fault_code(int nr,int(*fn)(unsigned long,unsigned int,struct
+pt_regs*),int sig,int code,const char*name){if(nr<(0x1c69+2519-0x2640)||nr>=
+ARRAY_SIZE(fsr_info))BUG();fsr_info[nr].fn=fn;fsr_info[nr].sig=sig;fsr_info[nr].
+code=code;fsr_info[nr].name=name;}
+#ifdef CONFIG_MODEM_CODE_IS_MAPPING
+static DECLARE_RWSEM(shrinker_rwsem);atomic_t _code_page_count=ATOMIC_INIT(
+(0xdf7+4574-0x1fd5));struct addr_info{struct list_head node;unsigned long vaddr;
+unsigned long kaddr;unsigned long page_index;};enum modem_access_technology{GSM=
+(0x3fb+8974-0x2709),UTRAN=(0xdb6+10-0xdbf),LTE=(0x4a4+1237-0x977),COM=
+(0x1163+2440-0x1ae8),NR_MODEM_ACCESS=(0x172a+824-0x1a5e)};struct list_head
+modem_page_list[NR_MODEM_ACCESS]={LIST_HEAD_INIT(modem_page_list[
+(0x200+3972-0x1184)]),LIST_HEAD_INIT(modem_page_list[(0x519+3610-0x1332)]),
+LIST_HEAD_INIT(modem_page_list[(0x1166+2931-0x1cd7)]),LIST_HEAD_INIT(
+modem_page_list[(0x127a+1583-0x18a6)]),};unsigned int page_used[(0x98c+41-0x98d)
+];struct completion page_completion[(0x10ac+3855-0x1f93)*(0x251+2654-0xc8f)];
+static void unmap_pte_range(pmd_t*pmd,unsigned long addr,unsigned long end){
+pte_t*pte;pte=pte_offset_kernel(pmd,addr);do{pte_t ptent=ptep_get_and_clear(&
+init_mm,addr,pte);WARN_ON(!pte_none(ptent)&&!pte_present(ptent));}while(pte++,
+addr+=PAGE_SIZE,addr!=end);}static void unmap_pmd_range(pud_t*pud,unsigned long
+addr,unsigned long end){pmd_t*pmd;unsigned long next;pmd=pmd_offset(pud,addr);do
+{next=pmd_addr_end(addr,end);if(pmd_none_or_clear_bad(pmd))continue;
+unmap_pte_range(pmd,addr,next);}while(pmd++,addr=next,addr!=end);}static void
+unmap_pud_range(pgd_t*pgd,unsigned long addr,unsigned long end){pud_t*pud;
+unsigned long next;pud=pud_offset(pgd,addr);do{next=pud_addr_end(addr,end);if(
+pud_none_or_clear_bad(pud))continue;unmap_pmd_range(pud,addr,next);}while(pud++,
+addr=next,addr!=end);}static void unmap_page_range(unsigned long addr,unsigned
+long end){pgd_t*pgd;unsigned long next;BUG_ON(addr>=end);pgd=pgd_offset_k(addr);
+do{next=pgd_addr_end(addr,end);if(pgd_none_or_clear_bad(pgd))continue;
+unmap_pud_range(pgd,addr,next);}while(pgd++,addr=next,addr!=end);}void
+shrink_modem_mem(unsigned int access_type){int i=(0x790+5554-0x1d42);unsigned
+long vaddr;struct addr_info*addr,*tmp_addr;struct list_head tmp_page_list;for(i=
+(0x632+3326-0x1330);i<NR_MODEM_ACCESS;i++){if(i==access_type)continue;down_write
+(&shrinker_rwsem);list_replace_init(&modem_page_list[i],&tmp_page_list);up_write
+(&shrinker_rwsem);list_for_each_entry_safe(addr,tmp_addr,&tmp_page_list,node){
+list_del_init(&addr->node);page_completion[addr->page_index].done=
+(0x21b+3760-0x10cb);page_used[addr->page_index/BITS_PER_LONG]&=~(
+(0x9a+3573-0xe8e)<<(addr->page_index%BITS_PER_LONG));vaddr=addr->vaddr&PAGE_MASK
+;if(vaddr<cpps_global_var.cpko_text_start||vaddr>cpps_global_var.modem_text_end)
+{panic(
+"\x61\x64\x64\x72\x5f\x69\x6e\x66\x6f\x3a\x20\x25\x30\x38\x78\x20\x69\x73\x20\x20\x64\x65\x73\x74\x72\x6f\x79"
+,addr);}flush_cache_vunmap(vaddr,vaddr+PAGE_SIZE);unmap_page_range(vaddr,vaddr+
+PAGE_SIZE);flush_tlb_kernel_range(vaddr,vaddr+PAGE_SIZE);
+#ifdef CONFIG_DEBUG_RODATA
+unsigned int flags;local_irq_save(flags);set_memory_rw(addr->kaddr,
+(0x48d+6813-0x1f29));local_irq_restore(flags);
+#endif
+free_page(addr->kaddr);kfree(addr);atomic_dec(&_code_page_count);};}}
+EXPORT_SYMBOL(shrink_modem_mem);phys_addr_t virt_is_mapping(unsigned long addr){
+pgd_t*pgd;pmd_t*pmd;pte_t*ptep,pte;unsigned long pfn;pgd=pgd_offset_k(addr);if(!
+pgd_none(*pgd)){pmd=pmd_offset(pgd,addr);if(!pmd_none(*pmd)){ptep=pte_offset_map
+(pmd,addr);pte=*ptep;if(pte_present(pte)){pfn=pte_pfn(pte);return __pfn_to_phys(
+pfn);}}}return(0xe71+3860-0x1d85);}static int sync_pgd(unsigned long addr,
+unsigned int fsr,struct pt_regs*regs){unsigned int index;pgd_t*pgd,*pgd_k;pud_t*
+pud,*pud_k;pmd_t*pmd,*pmd_k;index=pgd_index(addr);pgd=cpu_get_pgd()+index;pgd_k=
+init_mm.pgd+index;if(pgd_none(*pgd_k))goto bad_area;if(!pgd_present(*pgd))
+set_pgd(pgd,*pgd_k);pud=pud_offset(pgd,addr);pud_k=pud_offset(pgd_k,addr);if(
+pud_none(*pud_k))goto bad_area;if(!pud_present(*pud))set_pud(pud,*pud_k);pmd=
+pmd_offset(pud,addr);pmd_k=pmd_offset(pud_k,addr);
+#ifdef CONFIG_ARM_LPAE
+index=(0xf2a+201-0xff3);
+#else
+index=(addr>>SECTION_SHIFT)&(0x1648+2661-0x20ac);
+#endif
+if(pmd_none(pmd_k[index]))goto bad_area;copy_pmd(pmd,pmd_k);return
+(0x1100+3839-0x1fff);bad_area:do_bad_area(addr,fsr,regs);return
+(0x1f04+1244-0x23e0);}unsigned long*read_code_file(unsigned long page_index){
+unsigned long*code_buf;ssize_t result;code_buf=get_zeroed_page(GFP_ATOMIC);if(!
+code_buf)panic(
+"\x6d\x65\x6d\x65\x6f\x72\x79\x20\x6e\x6f\x74\x20\x65\x6e\x6f\x75\x67\x68\x21\x21"
+);atomic_inc(&_code_page_count);if(IS_ERR(cpps_global_var.fp_code)||
+cpps_global_var.fp_code==NULL){panic(
+"\x6f\x70\x65\x6e\x20\x66\x69\x6c\x65\x20\x65\x72\x72\x6f\x72" "\n");}
+mm_segment_t old_fs;old_fs=get_fs();set_fs(KERNEL_DS);loff_t pos;pos=page_index*
+PAGE_SIZE+cpps_global_var.modem_offset;result=vfs_read(cpps_global_var.fp_code,(
+char*)code_buf,PAGE_SIZE,&pos);if(result<(0x10ea+5558-0x26a0)){panic(
+"\x72\x65\x61\x64\x20\x63\x6f\x64\x65\x20\x66\x69\x6c\x65\x20\x65\x72\x72\x6f\x72" "\n"
+);}
+#ifdef CONFIG_DEBUG_RODATA
+unsigned int flags;local_irq_save(flags);set_memory_ro((unsigned long)code_buf,
+(0xa36+5305-0x1eee));local_irq_restore(flags);
+#endif
+set_fs(old_fs);return code_buf;}void read_code_mapping(unsigned long addr,
+unsigned int fsr,struct pt_regs*regs){unsigned long offset;unsigned long vaddr;
+const struct mem_type*mtype;unsigned long*vir_codebuf;unsigned long page_index;
+unsigned long page_shift;if(virt_is_mapping(addr&PAGE_MASK)!=(0x4a7+2584-0xebf))
+{sync_pgd(addr&PAGE_MASK,fsr,regs);return;}vaddr=addr&PAGE_MASK;offset=vaddr&(~
+cpps_global_var.cpko_text_start);page_index=offset>>PAGE_SHIFT;page_shift=
+page_index%BITS_PER_LONG;if((page_used[page_index/BITS_PER_LONG]>>page_shift)&
+(0x70+5278-0x150d)){wait_for_completion(&page_completion[page_index]);sync_pgd(
+vaddr,fsr,regs);return;}else page_used[page_index/BITS_PER_LONG]|=(
+(0x6ec+106-0x755)<<page_shift);local_irq_enable();vir_codebuf=read_code_file(
+page_index);struct addr_info*addr_info;addr_info=kzalloc(sizeof(struct addr_info
+),GFP_KERNEL);addr_info->kaddr=vir_codebuf;addr_info->vaddr=addr;addr_info->
+page_index=page_index;down_write(&shrinker_rwsem);if(vaddr<cpps_global_var.
+__utran_modem_text_start)list_add(&addr_info->node,&modem_page_list[GSM]);else
+if(vaddr<cpps_global_var.__lte_modem_text_start)list_add(&addr_info->node,&
+modem_page_list[UTRAN]);else if(vaddr<cpps_global_var.__comm_modem_text_start)
+list_add(&addr_info->node,&modem_page_list[LTE]);else list_add(&addr_info->node,
+&modem_page_list[COM]);up_write(&shrinker_rwsem);local_irq_disable();mtype=
+get_mem_type(MT_MEMORY);ioremap_page(vaddr,__pa(vir_codebuf),mtype);sync_pgd(
+vaddr,fsr,regs);flush_icache_range(vaddr,vaddr+PAGE_SIZE);if(waitqueue_active(&
+page_completion[page_index].wait))complete_all(&page_completion[page_index]);
+return;}
+#endif
+asmlinkage void __exception do_DataAbort(unsigned long addr,unsigned int fsr,
+struct pt_regs*regs){const struct fsr_info*inf=fsr_info+fsr_fs(fsr);struct
+siginfo info;
+#ifdef CONFIG_MODEM_CODE_IS_MAPPING
+if(addr!=(0x1227+4777-0x24d0)&&addr>=cpps_global_var.cpko_text_start&&addr<=
+cpps_global_var.modem_text_end){read_code_mapping(addr,fsr&~FSR_LNX_PF,regs);
+return;}
+#endif
+if(!inf->fn(addr,fsr&~FSR_LNX_PF,regs))return;printk(KERN_ALERT
+"\x55\x6e\x68\x61\x6e\x64\x6c\x65\x64\x20\x66\x61\x75\x6c\x74\x3a\x20\x25\x73\x20\x28\x30\x78\x25\x30\x33\x78\x29\x20\x61\x74\x20\x30\x78\x25\x30\x38\x6c\x78" "\n"
+,inf->name,fsr,addr);info.si_signo=inf->sig;info.si_errno=(0x84d+4540-0x1a09);
+info.si_code=inf->code;info.si_addr=(void __user*)addr;arm_notify_die("",regs,&
+info,fsr,(0x6a0+3136-0x12e0));}void __init hook_ifault_code(int nr,int(*fn)(
+unsigned long,unsigned int,struct pt_regs*),int sig,int code,const char*name){if
+(nr<(0x1372+2431-0x1cf1)||nr>=ARRAY_SIZE(ifsr_info))BUG();ifsr_info[nr].fn=fn;
+ifsr_info[nr].sig=sig;ifsr_info[nr].code=code;ifsr_info[nr].name=name;}
+asmlinkage void __exception do_PrefetchAbort(unsigned long addr,unsigned int
+ifsr,struct pt_regs*regs){const struct fsr_info*inf=ifsr_info+fsr_fs(ifsr);
+struct siginfo info;
+#ifdef CONFIG_MODEM_CODE_IS_MAPPING
+if(addr!=(0x191f+107-0x198a)&&addr>=cpps_global_var.cpko_text_start&&addr<=
+cpps_global_var.modem_text_end){read_code_mapping(addr,ifsr|FSR_LNX_PF,regs);
+return;}
+#endif
+if(!inf->fn(addr,ifsr|FSR_LNX_PF,regs))return;printk(KERN_ALERT
+"\x55\x6e\x68\x61\x6e\x64\x6c\x65\x64\x20\x70\x72\x65\x66\x65\x74\x63\x68\x20\x61\x62\x6f\x72\x74\x3a\x20\x25\x73\x20\x28\x30\x78\x25\x30\x33\x78\x29\x20\x61\x74\x20\x30\x78\x25\x30\x38\x6c\x78" "\n"
+,inf->name,ifsr,addr);info.si_signo=inf->sig;info.si_errno=(0x67c+1861-0xdc1);
+info.si_code=inf->code;info.si_addr=(void __user*)addr;arm_notify_die("",regs,&
+info,ifsr,(0xe2c+1528-0x1424));}
+#ifndef CONFIG_ARM_LPAE
+static int __init exceptions_init(void){if(cpu_architecture()>=CPU_ARCH_ARMv6){
+hook_fault_code((0xd16+306-0xe44),do_translation_fault,SIGSEGV,SEGV_MAPERR,
+"\x49\x2d\x63\x61\x63\x68\x65\x20\x6d\x61\x69\x6e\x74\x65\x6e\x61\x6e\x63\x65\x20\x66\x61\x75\x6c\x74"
+);}if(cpu_architecture()>=CPU_ARCH_ARMv7){hook_fault_code((0x1854+1865-0x1f9a),
+do_bad,SIGSEGV,SEGV_MAPERR,
+"\x73\x65\x63\x74\x69\x6f\x6e\x20\x61\x63\x63\x65\x73\x73\x20\x66\x6c\x61\x67\x20\x66\x61\x75\x6c\x74"
+);hook_fault_code((0xdcd+2406-0x172d),do_bad,SIGSEGV,SEGV_MAPERR,
+"\x73\x65\x63\x74\x69\x6f\x6e\x20\x61\x63\x63\x65\x73\x73\x20\x66\x6c\x61\x67\x20\x66\x61\x75\x6c\x74"
+);}
+#ifdef CONFIG_MODEM_CODE_IS_MAPPING
+int index=(0x13fb+4063-0x23da);for(index=(0x2059+1717-0x270e);index<
+(0x1b59+5-0x1b36)*(0x19e3+1660-0x203f);index++)init_completion(&page_completion[
+index]);
+#endif
+return(0x539+698-0x7f3);}arch_initcall(exceptions_init);
+#endif
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/fault.h b/ap/os/linux/linux-3.4.x/arch/arm/mm/fault.h
new file mode 100644
index 0000000..cf08bdf
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/fault.h
@@ -0,0 +1,28 @@
+#ifndef __ARCH_ARM_FAULT_H
+#define __ARCH_ARM_FAULT_H
+
+/*
+ * Fault status register encodings. We steal bit 31 for our own purposes.
+ */
+#define FSR_LNX_PF (1 << 31)
+#define FSR_WRITE (1 << 11)
+#define FSR_FS4 (1 << 10)
+#define FSR_FS3_0 (15)
+#define FSR_FS5_0 (0x3f)
+
+#ifdef CONFIG_ARM_LPAE
+static inline int fsr_fs(unsigned int fsr)
+{
+ return fsr & FSR_FS5_0;
+}
+#else
+static inline int fsr_fs(unsigned int fsr)
+{
+ return (fsr & FSR_FS3_0) | (fsr & FSR_FS4) >> 6;
+}
+#endif
+
+void do_bad_area(unsigned long addr, unsigned int fsr, struct pt_regs *regs);
+unsigned long search_exception_table(unsigned long addr);
+
+#endif /* __ARCH_ARM_FAULT_H */
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/flush.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/flush.c
new file mode 100644
index 0000000..8f0d285
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/flush.c
@@ -0,0 +1,372 @@
+/*
+ * linux/arch/arm/mm/flush.c
+ *
+ * Copyright (C) 1995-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/module.h>
+#include <linux/mm.h>
+#include <linux/pagemap.h>
+#include <linux/highmem.h>
+
+#include <asm/cacheflush.h>
+#include <asm/cachetype.h>
+#include <asm/highmem.h>
+#include <asm/smp_plat.h>
+#include <asm/tlbflush.h>
+
+#include "mm.h"
+
+#ifdef CONFIG_CPU_CACHE_VIPT
+
+static void flush_pfn_alias(unsigned long pfn, unsigned long vaddr)
+{
+ unsigned long to = FLUSH_ALIAS_START + (CACHE_COLOUR(vaddr) << PAGE_SHIFT);
+ const int zero = 0;
+
+ set_top_pte(to, pfn_pte(pfn, PAGE_KERNEL));
+
+ asm( "mcrr p15, 0, %1, %0, c14\n"
+ " mcr p15, 0, %2, c7, c10, 4"
+ :
+ : "r" (to), "r" (to + PAGE_SIZE - L1_CACHE_BYTES), "r" (zero)
+ : "cc");
+}
+
+static void flush_icache_alias(unsigned long pfn, unsigned long vaddr, unsigned long len)
+{
+ unsigned long va = FLUSH_ALIAS_START + (CACHE_COLOUR(vaddr) << PAGE_SHIFT);
+ unsigned long offset = vaddr & (PAGE_SIZE - 1);
+ unsigned long to;
+
+ set_top_pte(va, pfn_pte(pfn, PAGE_KERNEL));
+ to = va + offset;
+ flush_icache_range(to, to + len);
+}
+
+void flush_cache_mm(struct mm_struct *mm)
+{
+ if (cache_is_vivt()) {
+ vivt_flush_cache_mm(mm);
+ return;
+ }
+
+ if (cache_is_vipt_aliasing()) {
+ asm( "mcr p15, 0, %0, c7, c14, 0\n"
+ " mcr p15, 0, %0, c7, c10, 4"
+ :
+ : "r" (0)
+ : "cc");
+ }
+}
+
+void flush_cache_range(struct vm_area_struct *vma, unsigned long start, unsigned long end)
+{
+ if (cache_is_vivt()) {
+ vivt_flush_cache_range(vma, start, end);
+ return;
+ }
+
+ if (cache_is_vipt_aliasing()) {
+ asm( "mcr p15, 0, %0, c7, c14, 0\n"
+ " mcr p15, 0, %0, c7, c10, 4"
+ :
+ : "r" (0)
+ : "cc");
+ }
+
+ if (vma->vm_flags & VM_EXEC)
+ __flush_icache_all();
+}
+
+void flush_cache_page(struct vm_area_struct *vma, unsigned long user_addr, unsigned long pfn)
+{
+ if (cache_is_vivt()) {
+ vivt_flush_cache_page(vma, user_addr, pfn);
+ return;
+ }
+
+ if (cache_is_vipt_aliasing()) {
+ flush_pfn_alias(pfn, user_addr);
+ __flush_icache_all();
+ }
+
+ if (vma->vm_flags & VM_EXEC && icache_is_vivt_asid_tagged())
+ __flush_icache_all();
+}
+
+#else
+#define flush_pfn_alias(pfn,vaddr) do { } while (0)
+#define flush_icache_alias(pfn,vaddr,len) do { } while (0)
+#endif
+
+static void flush_ptrace_access_other(void *args)
+{
+ __flush_icache_all();
+}
+
+static
+void flush_ptrace_access(struct vm_area_struct *vma, struct page *page,
+ unsigned long uaddr, void *kaddr, unsigned long len)
+{
+ if (cache_is_vivt()) {
+ if (cpumask_test_cpu(smp_processor_id(), mm_cpumask(vma->vm_mm))) {
+ unsigned long addr = (unsigned long)kaddr;
+ __cpuc_coherent_kern_range(addr, addr + len);
+ }
+ return;
+ }
+
+ if (cache_is_vipt_aliasing()) {
+ flush_pfn_alias(page_to_pfn(page), uaddr);
+ __flush_icache_all();
+ return;
+ }
+
+ /* VIPT non-aliasing D-cache */
+ if (vma->vm_flags & VM_EXEC) {
+ unsigned long addr = (unsigned long)kaddr;
+ if (icache_is_vipt_aliasing())
+ flush_icache_alias(page_to_pfn(page), uaddr, len);
+ else
+ __cpuc_coherent_kern_range(addr, addr + len);
+ if (cache_ops_need_broadcast())
+ smp_call_function(flush_ptrace_access_other,
+ NULL, 1);
+ }
+}
+
+/*
+ * Copy user data from/to a page which is mapped into a different
+ * processes address space. Really, we want to allow our "user
+ * space" model to handle this.
+ *
+ * Note that this code needs to run on the current CPU.
+ */
+void copy_to_user_page(struct vm_area_struct *vma, struct page *page,
+ unsigned long uaddr, void *dst, const void *src,
+ unsigned long len)
+{
+#ifdef CONFIG_SMP
+ preempt_disable();
+#endif
+ memcpy(dst, src, len);
+ flush_ptrace_access(vma, page, uaddr, dst, len);
+#ifdef CONFIG_SMP
+ preempt_enable();
+#endif
+}
+
+void __flush_dcache_page(struct address_space *mapping, struct page *page)
+{
+ /*
+ * Writeback any data associated with the kernel mapping of this
+ * page. This ensures that data in the physical page is mutually
+ * coherent with the kernels mapping.
+ */
+ if (!PageHighMem(page)) {
+ __cpuc_flush_dcache_area(page_address(page), PAGE_SIZE);
+ } else {
+ void *addr = kmap_high_get(page);
+ if (addr) {
+ __cpuc_flush_dcache_area(addr, PAGE_SIZE);
+ kunmap_high(page);
+ } else if (cache_is_vipt()) {
+ /* unmapped pages might still be cached */
+ addr = kmap_atomic(page);
+ __cpuc_flush_dcache_area(addr, PAGE_SIZE);
+ kunmap_atomic(addr);
+ }
+ }
+
+ /*
+ * If this is a page cache page, and we have an aliasing VIPT cache,
+ * we only need to do one flush - which would be at the relevant
+ * userspace colour, which is congruent with page->index.
+ */
+ if (mapping && cache_is_vipt_aliasing())
+ flush_pfn_alias(page_to_pfn(page),
+ page->index << PAGE_CACHE_SHIFT);
+}
+
+static void __flush_dcache_aliases(struct address_space *mapping, struct page *page)
+{
+ struct mm_struct *mm = current->active_mm;
+ struct vm_area_struct *mpnt;
+ struct prio_tree_iter iter;
+ pgoff_t pgoff;
+
+ /*
+ * There are possible user space mappings of this page:
+ * - VIVT cache: we need to also write back and invalidate all user
+ * data in the current VM view associated with this page.
+ * - aliasing VIPT: we only need to find one mapping of this page.
+ */
+ pgoff = page->index << (PAGE_CACHE_SHIFT - PAGE_SHIFT);
+
+ flush_dcache_mmap_lock(mapping);
+ vma_prio_tree_foreach(mpnt, &iter, &mapping->i_mmap, pgoff, pgoff) {
+ unsigned long offset;
+
+ /*
+ * If this VMA is not in our MM, we can ignore it.
+ */
+ if (mpnt->vm_mm != mm)
+ continue;
+ if (!(mpnt->vm_flags & VM_MAYSHARE))
+ continue;
+ offset = (pgoff - mpnt->vm_pgoff) << PAGE_SHIFT;
+ flush_cache_page(mpnt, mpnt->vm_start + offset, page_to_pfn(page));
+ }
+ flush_dcache_mmap_unlock(mapping);
+}
+
+#if __LINUX_ARM_ARCH__ >= 6
+void __sync_icache_dcache(pte_t pteval)
+{
+ unsigned long pfn;
+ struct page *page;
+ struct address_space *mapping;
+
+ if (cache_is_vipt_nonaliasing() && !pte_exec(pteval))
+ /* only flush non-aliasing VIPT caches for exec mappings */
+ return;
+ pfn = pte_pfn(pteval);
+ if (!pfn_valid(pfn))
+ return;
+
+ page = pfn_to_page(pfn);
+ if (cache_is_vipt_aliasing())
+ mapping = page_mapping(page);
+ else
+ mapping = NULL;
+
+ if (!test_and_set_bit(PG_dcache_clean, &page->flags))
+ __flush_dcache_page(mapping, page);
+
+ if (pte_exec(pteval))
+ __flush_icache_all();
+}
+#endif
+
+/*
+ * Ensure cache coherency between kernel mapping and userspace mapping
+ * of this page.
+ *
+ * We have three cases to consider:
+ * - VIPT non-aliasing cache: fully coherent so nothing required.
+ * - VIVT: fully aliasing, so we need to handle every alias in our
+ * current VM view.
+ * - VIPT aliasing: need to handle one alias in our current VM view.
+ *
+ * If we need to handle aliasing:
+ * If the page only exists in the page cache and there are no user
+ * space mappings, we can be lazy and remember that we may have dirty
+ * kernel cache lines for later. Otherwise, we assume we have
+ * aliasing mappings.
+ *
+ * Note that we disable the lazy flush for SMP configurations where
+ * the cache maintenance operations are not automatically broadcasted.
+ */
+void flush_dcache_page(struct page *page)
+{
+ struct address_space *mapping;
+
+ /*
+ * The zero page is never written to, so never has any dirty
+ * cache lines, and therefore never needs to be flushed.
+ */
+ if (page == ZERO_PAGE(0))
+ return;
+
+ mapping = page_mapping(page);
+
+ if (!cache_ops_need_broadcast() &&
+ mapping && !mapping_mapped(mapping))
+ clear_bit(PG_dcache_clean, &page->flags);
+ else {
+ __flush_dcache_page(mapping, page);
+ if (mapping && cache_is_vivt())
+ __flush_dcache_aliases(mapping, page);
+ else if (mapping)
+ __flush_icache_all();
+ set_bit(PG_dcache_clean, &page->flags);
+ }
+}
+EXPORT_SYMBOL(flush_dcache_page);
+
+/*
+ * Ensure cache coherency for the kernel mapping of this page. We can
+ * assume that the page is pinned via kmap.
+ *
+ * If the page only exists in the page cache and there are no user
+ * space mappings, this is a no-op since the page was already marked
+ * dirty at creation. Otherwise, we need to flush the dirty kernel
+ * cache lines directly.
+ */
+void flush_kernel_dcache_page(struct page *page)
+{
+ if (cache_is_vivt() || cache_is_vipt_aliasing()) {
+ struct address_space *mapping;
+
+ mapping = page_mapping(page);
+
+ if (!mapping || mapping_mapped(mapping)) {
+ void *addr;
+
+ addr = page_address(page);
+ /*
+ * kmap_atomic() doesn't set the page virtual
+ * address for highmem pages, and
+ * kunmap_atomic() takes care of cache
+ * flushing already.
+ */
+ if (!IS_ENABLED(CONFIG_HIGHMEM) || addr)
+ __cpuc_flush_dcache_area(addr, PAGE_SIZE);
+ }
+ }
+}
+EXPORT_SYMBOL(flush_kernel_dcache_page);
+
+/*
+ * Flush an anonymous page so that users of get_user_pages()
+ * can safely access the data. The expected sequence is:
+ *
+ * get_user_pages()
+ * -> flush_anon_page
+ * memcpy() to/from page
+ * if written to page, flush_dcache_page()
+ */
+void __flush_anon_page(struct vm_area_struct *vma, struct page *page, unsigned long vmaddr)
+{
+ unsigned long pfn;
+
+ /* VIPT non-aliasing caches need do nothing */
+ if (cache_is_vipt_nonaliasing())
+ return;
+
+ /*
+ * Write back and invalidate userspace mapping.
+ */
+ pfn = page_to_pfn(page);
+ if (cache_is_vivt()) {
+ flush_cache_page(vma, vmaddr, pfn);
+ } else {
+ /*
+ * For aliasing VIPT, we can flush an alias of the
+ * userspace address only.
+ */
+ flush_pfn_alias(pfn, vmaddr);
+ __flush_icache_all();
+ }
+
+ /*
+ * Invalidate kernel mapping. No data should be contained
+ * in this mapping of the page. FIXME: this is overkill
+ * since we actually ask for a write-back and invalidate.
+ */
+ __cpuc_flush_dcache_area(page_address(page), PAGE_SIZE);
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/fsr-2level.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/fsr-2level.c
new file mode 100644
index 0000000..18ca74c
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/fsr-2level.c
@@ -0,0 +1,78 @@
+static struct fsr_info fsr_info[] = {
+ /*
+ * The following are the standard ARMv3 and ARMv4 aborts. ARMv5
+ * defines these to be "precise" aborts.
+ */
+ { do_bad, SIGSEGV, 0, "vector exception" },
+ { do_bad, SIGBUS, BUS_ADRALN, "alignment exception" },
+ { do_bad, SIGKILL, 0, "terminal exception" },
+ { do_bad, SIGBUS, BUS_ADRALN, "alignment exception" },
+ { do_bad, SIGBUS, 0, "external abort on linefetch" },
+ { do_translation_fault, SIGSEGV, SEGV_MAPERR, "section translation fault" },
+ { do_bad, SIGBUS, 0, "external abort on linefetch" },
+ { do_page_fault, SIGSEGV, SEGV_MAPERR, "page translation fault" },
+ { do_bad, SIGBUS, 0, "external abort on non-linefetch" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "section domain fault" },
+ { do_bad, SIGBUS, 0, "external abort on non-linefetch" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "page domain fault" },
+ { do_bad, SIGBUS, 0, "external abort on translation" },
+ { do_sect_fault, SIGSEGV, SEGV_ACCERR, "section permission fault" },
+ { do_bad, SIGBUS, 0, "external abort on translation" },
+ { do_page_fault, SIGSEGV, SEGV_ACCERR, "page permission fault" },
+ /*
+ * The following are "imprecise" aborts, which are signalled by bit
+ * 10 of the FSR, and may not be recoverable. These are only
+ * supported if the CPU abort handler supports bit 10.
+ */
+ { do_bad, SIGBUS, 0, "unknown 16" },
+ { do_bad, SIGBUS, 0, "unknown 17" },
+ { do_bad, SIGBUS, 0, "unknown 18" },
+ { do_bad, SIGBUS, 0, "unknown 19" },
+ { do_bad, SIGBUS, 0, "lock abort" }, /* xscale */
+ { do_bad, SIGBUS, 0, "unknown 21" },
+ { do_bad, SIGBUS, BUS_OBJERR, "imprecise external abort" }, /* xscale */
+ { do_bad, SIGBUS, 0, "unknown 23" },
+ { do_bad, SIGBUS, 0, "dcache parity error" }, /* xscale */
+ { do_bad, SIGBUS, 0, "unknown 25" },
+ { do_bad, SIGBUS, 0, "unknown 26" },
+ { do_bad, SIGBUS, 0, "unknown 27" },
+ { do_bad, SIGBUS, 0, "unknown 28" },
+ { do_bad, SIGBUS, 0, "unknown 29" },
+ { do_bad, SIGBUS, 0, "unknown 30" },
+ { do_bad, SIGBUS, 0, "unknown 31" },
+};
+
+static struct fsr_info ifsr_info[] = {
+ { do_bad, SIGBUS, 0, "unknown 0" },
+ { do_bad, SIGBUS, 0, "unknown 1" },
+ { do_bad, SIGBUS, 0, "debug event" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "section access flag fault" },
+ { do_bad, SIGBUS, 0, "unknown 4" },
+ { do_translation_fault, SIGSEGV, SEGV_MAPERR, "section translation fault" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "page access flag fault" },
+ { do_page_fault, SIGSEGV, SEGV_MAPERR, "page translation fault" },
+ { do_bad, SIGBUS, 0, "external abort on non-linefetch" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "section domain fault" },
+ { do_bad, SIGBUS, 0, "unknown 10" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "page domain fault" },
+ { do_bad, SIGBUS, 0, "external abort on translation" },
+ { do_sect_fault, SIGSEGV, SEGV_ACCERR, "section permission fault" },
+ { do_bad, SIGBUS, 0, "external abort on translation" },
+ { do_page_fault, SIGSEGV, SEGV_ACCERR, "page permission fault" },
+ { do_bad, SIGBUS, 0, "unknown 16" },
+ { do_bad, SIGBUS, 0, "unknown 17" },
+ { do_bad, SIGBUS, 0, "unknown 18" },
+ { do_bad, SIGBUS, 0, "unknown 19" },
+ { do_bad, SIGBUS, 0, "unknown 20" },
+ { do_bad, SIGBUS, 0, "unknown 21" },
+ { do_bad, SIGBUS, 0, "unknown 22" },
+ { do_bad, SIGBUS, 0, "unknown 23" },
+ { do_bad, SIGBUS, 0, "unknown 24" },
+ { do_bad, SIGBUS, 0, "unknown 25" },
+ { do_bad, SIGBUS, 0, "unknown 26" },
+ { do_bad, SIGBUS, 0, "unknown 27" },
+ { do_bad, SIGBUS, 0, "unknown 28" },
+ { do_bad, SIGBUS, 0, "unknown 29" },
+ { do_bad, SIGBUS, 0, "unknown 30" },
+ { do_bad, SIGBUS, 0, "unknown 31" },
+};
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/fsr-3level.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/fsr-3level.c
new file mode 100644
index 0000000..05a4e94
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/fsr-3level.c
@@ -0,0 +1,68 @@
+static struct fsr_info fsr_info[] = {
+ { do_bad, SIGBUS, 0, "unknown 0" },
+ { do_bad, SIGBUS, 0, "unknown 1" },
+ { do_bad, SIGBUS, 0, "unknown 2" },
+ { do_bad, SIGBUS, 0, "unknown 3" },
+ { do_bad, SIGBUS, 0, "reserved translation fault" },
+ { do_translation_fault, SIGSEGV, SEGV_MAPERR, "level 1 translation fault" },
+ { do_translation_fault, SIGSEGV, SEGV_MAPERR, "level 2 translation fault" },
+ { do_page_fault, SIGSEGV, SEGV_MAPERR, "level 3 translation fault" },
+ { do_bad, SIGBUS, 0, "reserved access flag fault" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "level 1 access flag fault" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "level 2 access flag fault" },
+ { do_page_fault, SIGSEGV, SEGV_ACCERR, "level 3 access flag fault" },
+ { do_bad, SIGBUS, 0, "reserved permission fault" },
+ { do_bad, SIGSEGV, SEGV_ACCERR, "level 1 permission fault" },
+ { do_sect_fault, SIGSEGV, SEGV_ACCERR, "level 2 permission fault" },
+ { do_page_fault, SIGSEGV, SEGV_ACCERR, "level 3 permission fault" },
+ { do_bad, SIGBUS, 0, "synchronous external abort" },
+ { do_bad, SIGBUS, 0, "asynchronous external abort" },
+ { do_bad, SIGBUS, 0, "unknown 18" },
+ { do_bad, SIGBUS, 0, "unknown 19" },
+ { do_bad, SIGBUS, 0, "synchronous abort (translation table walk)" },
+ { do_bad, SIGBUS, 0, "synchronous abort (translation table walk)" },
+ { do_bad, SIGBUS, 0, "synchronous abort (translation table walk)" },
+ { do_bad, SIGBUS, 0, "synchronous abort (translation table walk)" },
+ { do_bad, SIGBUS, 0, "synchronous parity error" },
+ { do_bad, SIGBUS, 0, "asynchronous parity error" },
+ { do_bad, SIGBUS, 0, "unknown 26" },
+ { do_bad, SIGBUS, 0, "unknown 27" },
+ { do_bad, SIGBUS, 0, "synchronous parity error (translation table walk" },
+ { do_bad, SIGBUS, 0, "synchronous parity error (translation table walk" },
+ { do_bad, SIGBUS, 0, "synchronous parity error (translation table walk" },
+ { do_bad, SIGBUS, 0, "synchronous parity error (translation table walk" },
+ { do_bad, SIGBUS, 0, "unknown 32" },
+ { do_bad, SIGBUS, BUS_ADRALN, "alignment fault" },
+ { do_bad, SIGBUS, 0, "debug event" },
+ { do_bad, SIGBUS, 0, "unknown 35" },
+ { do_bad, SIGBUS, 0, "unknown 36" },
+ { do_bad, SIGBUS, 0, "unknown 37" },
+ { do_bad, SIGBUS, 0, "unknown 38" },
+ { do_bad, SIGBUS, 0, "unknown 39" },
+ { do_bad, SIGBUS, 0, "unknown 40" },
+ { do_bad, SIGBUS, 0, "unknown 41" },
+ { do_bad, SIGBUS, 0, "unknown 42" },
+ { do_bad, SIGBUS, 0, "unknown 43" },
+ { do_bad, SIGBUS, 0, "unknown 44" },
+ { do_bad, SIGBUS, 0, "unknown 45" },
+ { do_bad, SIGBUS, 0, "unknown 46" },
+ { do_bad, SIGBUS, 0, "unknown 47" },
+ { do_bad, SIGBUS, 0, "unknown 48" },
+ { do_bad, SIGBUS, 0, "unknown 49" },
+ { do_bad, SIGBUS, 0, "unknown 50" },
+ { do_bad, SIGBUS, 0, "unknown 51" },
+ { do_bad, SIGBUS, 0, "implementation fault (lockdown abort)" },
+ { do_bad, SIGBUS, 0, "unknown 53" },
+ { do_bad, SIGBUS, 0, "unknown 54" },
+ { do_bad, SIGBUS, 0, "unknown 55" },
+ { do_bad, SIGBUS, 0, "unknown 56" },
+ { do_bad, SIGBUS, 0, "unknown 57" },
+ { do_bad, SIGBUS, 0, "implementation fault (coprocessor abort)" },
+ { do_bad, SIGBUS, 0, "unknown 59" },
+ { do_bad, SIGBUS, 0, "unknown 60" },
+ { do_bad, SIGBUS, 0, "unknown 61" },
+ { do_bad, SIGBUS, 0, "unknown 62" },
+ { do_bad, SIGBUS, 0, "unknown 63" },
+};
+
+#define ifsr_info fsr_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/highmem.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/highmem.c
new file mode 100644
index 0000000..21b9e1b
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/highmem.c
@@ -0,0 +1,137 @@
+/*
+ * arch/arm/mm/highmem.c -- ARM highmem support
+ *
+ * Author: Nicolas Pitre
+ * Created: september 8, 2008
+ * Copyright: Marvell Semiconductors Inc.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+
+#include <linux/module.h>
+#include <linux/highmem.h>
+#include <linux/interrupt.h>
+#include <asm/fixmap.h>
+#include <asm/cacheflush.h>
+#include <asm/tlbflush.h>
+#include "mm.h"
+
+void *kmap(struct page *page)
+{
+ might_sleep();
+ if (!PageHighMem(page))
+ return page_address(page);
+ return kmap_high(page);
+}
+EXPORT_SYMBOL(kmap);
+
+void kunmap(struct page *page)
+{
+ BUG_ON(in_interrupt());
+ if (!PageHighMem(page))
+ return;
+ kunmap_high(page);
+}
+EXPORT_SYMBOL(kunmap);
+
+void *kmap_atomic(struct page *page)
+{
+ unsigned int idx;
+ unsigned long vaddr;
+ void *kmap;
+ int type;
+
+ pagefault_disable();
+ if (!PageHighMem(page))
+ return page_address(page);
+
+#ifdef CONFIG_DEBUG_HIGHMEM
+ /*
+ * There is no cache coherency issue when non VIVT, so force the
+ * dedicated kmap usage for better debugging purposes in that case.
+ */
+ if (!cache_is_vivt())
+ kmap = NULL;
+ else
+#endif
+ kmap = kmap_high_get(page);
+ if (kmap)
+ return kmap;
+
+ type = kmap_atomic_idx_push();
+
+ idx = type + KM_TYPE_NR * smp_processor_id();
+ vaddr = __fix_to_virt(FIX_KMAP_BEGIN + idx);
+#ifdef CONFIG_DEBUG_HIGHMEM
+ /*
+ * With debugging enabled, kunmap_atomic forces that entry to 0.
+ * Make sure it was indeed properly unmapped.
+ */
+ BUG_ON(!pte_none(get_top_pte(vaddr)));
+#endif
+ /*
+ * When debugging is off, kunmap_atomic leaves the previous mapping
+ * in place, so the contained TLB flush ensures the TLB is updated
+ * with the new mapping.
+ */
+ set_top_pte(vaddr, mk_pte(page, kmap_prot));
+
+ return (void *)vaddr;
+}
+EXPORT_SYMBOL(kmap_atomic);
+
+void __kunmap_atomic(void *kvaddr)
+{
+ unsigned long vaddr = (unsigned long) kvaddr & PAGE_MASK;
+ int idx, type;
+
+ if (kvaddr >= (void *)FIXADDR_START) {
+ type = kmap_atomic_idx();
+ idx = type + KM_TYPE_NR * smp_processor_id();
+
+ if (cache_is_vivt())
+ __cpuc_flush_dcache_area((void *)vaddr, PAGE_SIZE);
+#ifdef CONFIG_DEBUG_HIGHMEM
+ BUG_ON(vaddr != __fix_to_virt(FIX_KMAP_BEGIN + idx));
+ set_top_pte(vaddr, __pte(0));
+#else
+ (void) idx; /* to kill a warning */
+#endif
+ kmap_atomic_idx_pop();
+ } else if (vaddr >= PKMAP_ADDR(0) && vaddr < PKMAP_ADDR(LAST_PKMAP)) {
+ /* this address was obtained through kmap_high_get() */
+ kunmap_high(pte_page(pkmap_page_table[PKMAP_NR(vaddr)]));
+ }
+ pagefault_enable();
+}
+EXPORT_SYMBOL(__kunmap_atomic);
+
+void *kmap_atomic_pfn(unsigned long pfn)
+{
+ unsigned long vaddr;
+ int idx, type;
+
+ pagefault_disable();
+
+ type = kmap_atomic_idx_push();
+ idx = type + KM_TYPE_NR * smp_processor_id();
+ vaddr = __fix_to_virt(FIX_KMAP_BEGIN + idx);
+#ifdef CONFIG_DEBUG_HIGHMEM
+ BUG_ON(!pte_none(get_top_pte(vaddr)));
+#endif
+ set_top_pte(vaddr, pfn_pte(pfn, kmap_prot));
+
+ return (void *)vaddr;
+}
+
+struct page *kmap_atomic_to_page(const void *ptr)
+{
+ unsigned long vaddr = (unsigned long)ptr;
+
+ if (vaddr < FIXADDR_START)
+ return virt_to_page(ptr);
+
+ return pte_page(get_top_pte(vaddr));
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/idmap.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/idmap.c
new file mode 100644
index 0000000..ef8f2df
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/idmap.c
@@ -0,0 +1,121 @@
+#include <linux/kernel.h>
+
+#include <asm/cputype.h>
+#include <asm/idmap.h>
+#include <asm/pgalloc.h>
+#include <asm/pgtable.h>
+#include <asm/sections.h>
+#include <asm/system_info.h>
+
+pgd_t *idmap_pgd;
+
+#ifdef CONFIG_ARM_LPAE
+static void idmap_add_pmd(pud_t *pud, unsigned long addr, unsigned long end,
+ unsigned long prot)
+{
+ pmd_t *pmd;
+ unsigned long next;
+
+ if (pud_none_or_clear_bad(pud) || (pud_val(*pud) & L_PGD_SWAPPER)) {
+ pmd = pmd_alloc_one(&init_mm, addr);
+ if (!pmd) {
+ pr_warning("Failed to allocate identity pmd.\n");
+ return;
+ }
+ /*
+ * Copy the original PMD to ensure that the PMD entries for
+ * the kernel image are preserved.
+ */
+ if (!pud_none(*pud))
+ memcpy(pmd, pmd_offset(pud, 0),
+ PTRS_PER_PMD * sizeof(pmd_t));
+ pud_populate(&init_mm, pud, pmd);
+ pmd += pmd_index(addr);
+ } else
+ pmd = pmd_offset(pud, addr);
+
+ do {
+ next = pmd_addr_end(addr, end);
+ *pmd = __pmd((addr & PMD_MASK) | prot);
+ flush_pmd_entry(pmd);
+ } while (pmd++, addr = next, addr != end);
+}
+#else /* !CONFIG_ARM_LPAE */
+static void idmap_add_pmd(pud_t *pud, unsigned long addr, unsigned long end,
+ unsigned long prot)
+{
+ pmd_t *pmd = pmd_offset(pud, addr);
+
+ addr = (addr & PMD_MASK) | prot;
+ pmd[0] = __pmd(addr);
+ addr += SECTION_SIZE;
+ pmd[1] = __pmd(addr);
+ flush_pmd_entry(pmd);
+}
+#endif /* CONFIG_ARM_LPAE */
+
+static void idmap_add_pud(pgd_t *pgd, unsigned long addr, unsigned long end,
+ unsigned long prot)
+{
+ pud_t *pud = pud_offset(pgd, addr);
+ unsigned long next;
+
+ do {
+ next = pud_addr_end(addr, end);
+ idmap_add_pmd(pud, addr, next, prot);
+ } while (pud++, addr = next, addr != end);
+}
+
+static void identity_mapping_add(pgd_t *pgd, unsigned long addr, unsigned long end)
+{
+ unsigned long prot, next;
+
+ prot = PMD_TYPE_SECT | PMD_SECT_AP_WRITE | PMD_SECT_AF;
+ if (cpu_architecture() <= CPU_ARCH_ARMv5TEJ && !cpu_is_xscale())
+ prot |= PMD_BIT4;
+
+ pgd += pgd_index(addr);
+ do {
+ next = pgd_addr_end(addr, end);
+ idmap_add_pud(pgd, addr, next, prot);
+ } while (pgd++, addr = next, addr != end);
+}
+
+extern char __idmap_text_start[], __idmap_text_end[];
+
+static int __init init_static_idmap(void)
+{
+ phys_addr_t idmap_start, idmap_end;
+
+ idmap_pgd = pgd_alloc(&init_mm);
+ if (!idmap_pgd)
+ return -ENOMEM;
+
+ /* Add an identity mapping for the physical address of the section. */
+ idmap_start = virt_to_phys((void *)__idmap_text_start);
+ idmap_end = virt_to_phys((void *)__idmap_text_end);
+
+ pr_info("Setting up static identity map for 0x%llx - 0x%llx\n",
+ (long long)idmap_start, (long long)idmap_end);
+ identity_mapping_add(idmap_pgd, idmap_start, idmap_end);
+
+ return 0;
+}
+early_initcall(init_static_idmap);
+
+/*
+ * In order to soft-boot, we need to switch to a 1:1 mapping for the
+ * cpu_reset functions. This will then ensure that we have predictable
+ * results when turning off the mmu.
+ */
+void setup_mm_for_reboot(void)
+{
+ /* Clean and invalidate L1. */
+ flush_cache_all();
+
+ /* Switch to the identity mapping. */
+ cpu_switch_mm(idmap_pgd, &init_mm);
+
+ /* Flush the TLB. */
+ local_flush_tlb_all();
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/init.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/init.c
new file mode 100644
index 0000000..9f537d6
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/init.c
@@ -0,0 +1,762 @@
+/*
+ * linux/arch/arm/mm/init.c
+ *
+ * Copyright (C) 1995-2005 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/kernel.h>
+#include <linux/errno.h>
+#include <linux/swap.h>
+#include <linux/init.h>
+#include <linux/bootmem.h>
+#include <linux/mman.h>
+#include <linux/export.h>
+#include <linux/nodemask.h>
+#include <linux/initrd.h>
+#include <linux/of_fdt.h>
+#include <linux/highmem.h>
+#include <linux/gfp.h>
+#include <linux/memblock.h>
+
+#include <asm/mach-types.h>
+#include <asm/memblock.h>
+#include <asm/prom.h>
+#include <asm/sections.h>
+#include <asm/setup.h>
+#include <asm/sizes.h>
+#include <asm/tlb.h>
+#include <asm/fixmap.h>
+
+#include <asm/mach/arch.h>
+#include <asm/mach/map.h>
+
+#include "mm.h"
+
+static unsigned long phys_initrd_start __initdata = 0;
+static unsigned long phys_initrd_size __initdata = 0;
+
+static int __init early_initrd(char *p)
+{
+ unsigned long start, size;
+ char *endp;
+
+ start = memparse(p, &endp);
+ if (*endp == ',') {
+ size = memparse(endp + 1, NULL);
+
+ phys_initrd_start = start;
+ phys_initrd_size = size;
+ }
+ return 0;
+}
+early_param("initrd", early_initrd);
+
+static int __init parse_tag_initrd(const struct tag *tag)
+{
+ printk(KERN_WARNING "ATAG_INITRD is deprecated; "
+ "please update your bootloader.\n");
+ phys_initrd_start = __virt_to_phys(tag->u.initrd.start);
+ phys_initrd_size = tag->u.initrd.size;
+ return 0;
+}
+
+__tagtable(ATAG_INITRD, parse_tag_initrd);
+
+static int __init parse_tag_initrd2(const struct tag *tag)
+{
+ phys_initrd_start = tag->u.initrd.start;
+ phys_initrd_size = tag->u.initrd.size;
+ return 0;
+}
+
+__tagtable(ATAG_INITRD2, parse_tag_initrd2);
+
+#ifdef CONFIG_OF_FLATTREE
+void __init early_init_dt_setup_initrd_arch(unsigned long start, unsigned long end)
+{
+ phys_initrd_start = start;
+ phys_initrd_size = end - start;
+}
+#endif /* CONFIG_OF_FLATTREE */
+
+/*
+ * This keeps memory configuration data used by a couple memory
+ * initialization functions, as well as show_mem() for the skipping
+ * of holes in the memory map. It is populated by arm_add_memory().
+ */
+struct meminfo meminfo;
+
+void show_mem2(unsigned int filter)
+{
+ int free = 0, total = 0, reserved = 0;
+ int shared = 0, cached = 0, slab = 0, i;
+ struct meminfo * mi = &meminfo;
+
+ printk("Mem-info:\n");
+ show_free_areas(filter);
+
+ if (filter & SHOW_MEM_FILTER_PAGE_COUNT)
+ return;
+
+ for_each_bank (i, mi) {
+ struct membank *bank = &mi->bank[i];
+ unsigned int pfn1, pfn2;
+ struct page *page, *end;
+
+ pfn1 = bank_pfn_start(bank);
+ pfn2 = bank_pfn_end(bank);
+
+ page = pfn_to_page(pfn1);
+ end = pfn_to_page(pfn2 - 1) + 1;
+
+ do {
+ total++;
+ if (PageReserved(page))
+ reserved++;
+ else if (PageSwapCache(page))
+ cached++;
+ else if (PageSlab(page))
+ slab++;
+ else if (!page_count(page))
+ free++;
+ else
+ shared += page_count(page) - 1;
+ page++;
+ } while (page < end);
+ }
+
+ printk("%d pages of RAM\n", total);
+ printk("%d free pages\n", free);
+ printk("%d reserved pages\n", reserved);
+ printk("%d slab pages\n", slab);
+ printk("%d pages shared\n", shared);
+ printk("%d pages swap cached\n", cached);
+}
+
+static void __init find_limits(unsigned long *min, unsigned long *max_low,
+ unsigned long *max_high)
+{
+ struct meminfo *mi = &meminfo;
+ int i;
+
+ /* This assumes the meminfo array is properly sorted */
+ *min = bank_pfn_start(&mi->bank[0]);
+ for_each_bank (i, mi)
+ if (mi->bank[i].highmem)
+ break;
+ *max_low = bank_pfn_end(&mi->bank[i - 1]);
+ *max_high = bank_pfn_end(&mi->bank[mi->nr_banks - 1]);
+}
+
+static void __init arm_bootmem_init(unsigned long start_pfn,
+ unsigned long end_pfn)
+{
+ struct memblock_region *reg;
+ unsigned int boot_pages;
+ phys_addr_t bitmap;
+ pg_data_t *pgdat;
+
+ /*
+ * Allocate the bootmem bitmap page. This must be in a region
+ * of memory which has already been mapped.
+ */
+ boot_pages = bootmem_bootmap_pages(end_pfn - start_pfn);
+ bitmap = memblock_alloc_base(boot_pages << PAGE_SHIFT, L1_CACHE_BYTES,
+ __pfn_to_phys(end_pfn));
+
+ /*
+ * Initialise the bootmem allocator, handing the
+ * memory banks over to bootmem.
+ */
+ node_set_online(0);
+ pgdat = NODE_DATA(0);
+ init_bootmem_node(pgdat, __phys_to_pfn(bitmap), start_pfn, end_pfn);
+
+ /* Free the lowmem regions from memblock into bootmem. */
+ for_each_memblock(memory, reg) {
+ unsigned long start = memblock_region_memory_base_pfn(reg);
+ unsigned long end = memblock_region_memory_end_pfn(reg);
+
+ if (end >= end_pfn)
+ end = end_pfn;
+ if (start >= end)
+ break;
+
+ free_bootmem(__pfn_to_phys(start), (end - start) << PAGE_SHIFT);
+ }
+
+ /* Reserve the lowmem memblock reserved regions in bootmem. */
+ for_each_memblock(reserved, reg) {
+ unsigned long start = memblock_region_reserved_base_pfn(reg);
+ unsigned long end = memblock_region_reserved_end_pfn(reg);
+
+ if (end >= end_pfn)
+ end = end_pfn;
+ if (start >= end)
+ break;
+
+ reserve_bootmem(__pfn_to_phys(start),
+ (end - start) << PAGE_SHIFT, BOOTMEM_DEFAULT);
+ }
+}
+
+#ifdef CONFIG_ZONE_DMA
+
+unsigned long arm_dma_zone_size __read_mostly;
+EXPORT_SYMBOL(arm_dma_zone_size);
+
+/*
+ * The DMA mask corresponding to the maximum bus address allocatable
+ * using GFP_DMA. The default here places no restriction on DMA
+ * allocations. This must be the smallest DMA mask in the system,
+ * so a successful GFP_DMA allocation will always satisfy this.
+ */
+u32 arm_dma_limit;
+
+static void __init arm_adjust_dma_zone(unsigned long *size, unsigned long *hole,
+ unsigned long dma_size)
+{
+ if (size[0] <= dma_size)
+ return;
+
+ size[ZONE_NORMAL] = size[0] - dma_size;
+ size[ZONE_DMA] = dma_size;
+ hole[ZONE_NORMAL] = hole[0];
+ hole[ZONE_DMA] = 0;
+}
+#endif
+
+static void __init arm_bootmem_free(unsigned long min, unsigned long max_low,
+ unsigned long max_high)
+{
+ unsigned long zone_size[MAX_NR_ZONES], zhole_size[MAX_NR_ZONES];
+ struct memblock_region *reg;
+
+ /*
+ * initialise the zones.
+ */
+ memset(zone_size, 0, sizeof(zone_size));
+
+ /*
+ * The memory size has already been determined. If we need
+ * to do anything fancy with the allocation of this memory
+ * to the zones, now is the time to do it.
+ */
+ zone_size[0] = max_low - min;
+#ifdef CONFIG_HIGHMEM
+ zone_size[ZONE_HIGHMEM] = max_high - max_low;
+#endif
+
+ /*
+ * Calculate the size of the holes.
+ * holes = node_size - sum(bank_sizes)
+ */
+ memcpy(zhole_size, zone_size, sizeof(zhole_size));
+ for_each_memblock(memory, reg) {
+ unsigned long start = memblock_region_memory_base_pfn(reg);
+ unsigned long end = memblock_region_memory_end_pfn(reg);
+
+ if (start < max_low) {
+ unsigned long low_end = min(end, max_low);
+ zhole_size[0] -= low_end - start;
+ }
+#ifdef CONFIG_HIGHMEM
+ if (end > max_low) {
+ unsigned long high_start = max(start, max_low);
+ zhole_size[ZONE_HIGHMEM] -= end - high_start;
+ }
+#endif
+ }
+
+#ifdef CONFIG_ZONE_DMA
+ /*
+ * Adjust the sizes according to any special requirements for
+ * this machine type.
+ */
+ if (arm_dma_zone_size) {
+ arm_adjust_dma_zone(zone_size, zhole_size,
+ arm_dma_zone_size >> PAGE_SHIFT);
+ arm_dma_limit = PHYS_OFFSET + arm_dma_zone_size - 1;
+ } else
+ arm_dma_limit = 0xffffffff;
+#endif
+
+ free_area_init_node(0, zone_size, min, zhole_size);
+}
+
+#ifdef CONFIG_HAVE_ARCH_PFN_VALID
+int pfn_valid(unsigned long pfn)
+{
+ return memblock_is_memory(__pfn_to_phys(pfn));
+}
+EXPORT_SYMBOL(pfn_valid);
+#endif
+
+#ifndef CONFIG_SPARSEMEM
+static void __init arm_memory_present(void)
+{
+}
+#else
+static void __init arm_memory_present(void)
+{
+ struct memblock_region *reg;
+
+ for_each_memblock(memory, reg)
+ memory_present(0, memblock_region_memory_base_pfn(reg),
+ memblock_region_memory_end_pfn(reg));
+}
+#endif
+
+static bool arm_memblock_steal_permitted = true;
+
+phys_addr_t __init arm_memblock_steal(phys_addr_t size, phys_addr_t align)
+{
+ phys_addr_t phys;
+
+ BUG_ON(!arm_memblock_steal_permitted);
+
+ phys = memblock_alloc(size, align);
+ memblock_free(phys, size);
+ memblock_remove(phys, size);
+
+ return phys;
+}
+
+void __init arm_memblock_init(struct meminfo *mi, struct machine_desc *mdesc)
+{
+ int i;
+
+ for (i = 0; i < mi->nr_banks; i++)
+ memblock_add(mi->bank[i].start, mi->bank[i].size);
+
+ /* Register the kernel text, kernel data and initrd with memblock. */
+#ifdef CONFIG_XIP_KERNEL
+ memblock_reserve(__pa(_sdata), _end - _sdata);
+#else
+ memblock_reserve(__pa(_stext), _end - _stext);
+#endif
+#ifdef CONFIG_BLK_DEV_INITRD
+ if (phys_initrd_size &&
+ !memblock_is_region_memory(phys_initrd_start, phys_initrd_size)) {
+ pr_err("INITRD: 0x%08lx+0x%08lx is not a memory region - disabling initrd\n",
+ phys_initrd_start, phys_initrd_size);
+ phys_initrd_start = phys_initrd_size = 0;
+ }
+ if (phys_initrd_size &&
+ memblock_is_region_reserved(phys_initrd_start, phys_initrd_size)) {
+ pr_err("INITRD: 0x%08lx+0x%08lx overlaps in-use memory region - disabling initrd\n",
+ phys_initrd_start, phys_initrd_size);
+ phys_initrd_start = phys_initrd_size = 0;
+ }
+ if (phys_initrd_size) {
+ memblock_reserve(phys_initrd_start, phys_initrd_size);
+
+ /* Now convert initrd to virtual addresses */
+ initrd_start = __phys_to_virt(phys_initrd_start);
+ initrd_end = initrd_start + phys_initrd_size;
+ }
+#endif
+
+ arm_mm_memblock_reserve();
+ arm_dt_memblock_reserve();
+
+ /* reserve any platform specific memblock areas */
+ if (mdesc->reserve)
+ mdesc->reserve();
+
+ arm_memblock_steal_permitted = false;
+ memblock_allow_resize();
+ memblock_dump_all();
+}
+
+void __init bootmem_init(void)
+{
+ unsigned long min, max_low, max_high;
+
+ max_low = max_high = 0;
+
+ find_limits(&min, &max_low, &max_high);
+
+ arm_bootmem_init(min, max_low);
+
+ /*
+ * Sparsemem tries to allocate bootmem in memory_present(),
+ * so must be done after the fixed reservations
+ */
+ arm_memory_present();
+
+ /*
+ * sparse_init() needs the bootmem allocator up and running.
+ */
+ sparse_init();
+
+ /*
+ * Now free the memory - free_area_init_node needs
+ * the sparse mem_map arrays initialized by sparse_init()
+ * for memmap_init_zone(), otherwise all PFNs are invalid.
+ */
+ arm_bootmem_free(min, max_low, max_high);
+
+ /*
+ * This doesn't seem to be used by the Linux memory manager any
+ * more, but is used by ll_rw_block. If we can get rid of it, we
+ * also get rid of some of the stuff above as well.
+ *
+ * Note: max_low_pfn and max_pfn reflect the number of _pages_ in
+ * the system, not the maximum PFN.
+ */
+ max_low_pfn = max_low - PHYS_PFN_OFFSET;
+ max_pfn = max_high - PHYS_PFN_OFFSET;
+}
+
+static inline int free_area(unsigned long pfn, unsigned long end, char *s)
+{
+ unsigned int pages = 0, size = (end - pfn) << (PAGE_SHIFT - 10);
+
+ for (; pfn < end; pfn++) {
+ struct page *page = pfn_to_page(pfn);
+ ClearPageReserved(page);
+ init_page_count(page);
+ __free_page(page);
+ pages++;
+ }
+
+ if (size && s)
+ printk(KERN_INFO "Freeing %s memory: %dK\n", s, size);
+
+ return pages;
+}
+
+/*
+ * Poison init memory with an undefined instruction (ARM) or a branch to an
+ * undefined instruction (Thumb).
+ */
+static inline void poison_init_mem(void *s, size_t count)
+{
+ u32 *p = (u32 *)s;
+ for (; count != 0; count -= 4)
+ *p++ = 0xe7fddef0;
+}
+
+static inline void
+free_memmap(unsigned long start_pfn, unsigned long end_pfn)
+{
+ struct page *start_pg, *end_pg;
+ unsigned long pg, pgend;
+
+ /*
+ * Convert start_pfn/end_pfn to a struct page pointer.
+ */
+ start_pg = pfn_to_page(start_pfn - 1) + 1;
+ end_pg = pfn_to_page(end_pfn - 1) + 1;
+
+ /*
+ * Convert to physical addresses, and
+ * round start upwards and end downwards.
+ */
+ pg = (unsigned long)PAGE_ALIGN(__pa(start_pg));
+ pgend = (unsigned long)__pa(end_pg) & PAGE_MASK;
+
+ /*
+ * If there are free pages between these,
+ * free the section of the memmap array.
+ */
+ if (pg < pgend)
+ free_bootmem(pg, pgend - pg);
+}
+
+/*
+ * The mem_map array can get very big. Free the unused area of the memory map.
+ */
+static void __init free_unused_memmap(struct meminfo *mi)
+{
+ unsigned long bank_start, prev_bank_end = 0;
+ unsigned int i;
+
+ /*
+ * This relies on each bank being in address order.
+ * The banks are sorted previously in bootmem_init().
+ */
+ for_each_bank(i, mi) {
+ struct membank *bank = &mi->bank[i];
+
+ bank_start = bank_pfn_start(bank);
+
+#ifdef CONFIG_SPARSEMEM
+ /*
+ * Take care not to free memmap entries that don't exist
+ * due to SPARSEMEM sections which aren't present.
+ */
+ bank_start = min(bank_start,
+ ALIGN(prev_bank_end, PAGES_PER_SECTION));
+#else
+ /*
+ * Align down here since the VM subsystem insists that the
+ * memmap entries are valid from the bank start aligned to
+ * MAX_ORDER_NR_PAGES.
+ */
+ bank_start = round_down(bank_start, MAX_ORDER_NR_PAGES);
+#endif
+ /*
+ * If we had a previous bank, and there is a space
+ * between the current bank and the previous, free it.
+ */
+ if (prev_bank_end && prev_bank_end < bank_start)
+ free_memmap(prev_bank_end, bank_start);
+
+ /*
+ * Align up here since the VM subsystem insists that the
+ * memmap entries are valid from the bank end aligned to
+ * MAX_ORDER_NR_PAGES.
+ */
+ prev_bank_end = ALIGN(bank_pfn_end(bank), MAX_ORDER_NR_PAGES);
+ }
+
+#ifdef CONFIG_SPARSEMEM
+ if (!IS_ALIGNED(prev_bank_end, PAGES_PER_SECTION))
+ free_memmap(prev_bank_end,
+ ALIGN(prev_bank_end, PAGES_PER_SECTION));
+#endif
+}
+
+static void __init free_highpages(void)
+{
+#ifdef CONFIG_HIGHMEM
+ unsigned long max_low = max_low_pfn + PHYS_PFN_OFFSET;
+ struct memblock_region *mem, *res;
+
+ /* set highmem page free */
+ for_each_memblock(memory, mem) {
+ unsigned long start = memblock_region_memory_base_pfn(mem);
+ unsigned long end = memblock_region_memory_end_pfn(mem);
+
+ /* Ignore complete lowmem entries */
+ if (end <= max_low)
+ continue;
+
+ /* Truncate partial highmem entries */
+ if (start < max_low)
+ start = max_low;
+
+ /* Find and exclude any reserved regions */
+ for_each_memblock(reserved, res) {
+ unsigned long res_start, res_end;
+
+ res_start = memblock_region_reserved_base_pfn(res);
+ res_end = memblock_region_reserved_end_pfn(res);
+
+ if (res_end < start)
+ continue;
+ if (res_start < start)
+ res_start = start;
+ if (res_start > end)
+ res_start = end;
+ if (res_end > end)
+ res_end = end;
+ if (res_start != start)
+ totalhigh_pages += free_area(start, res_start,
+ NULL);
+ start = res_end;
+ if (start == end)
+ break;
+ }
+
+ /* And now free anything which remains */
+ if (start < end)
+ totalhigh_pages += free_area(start, end, NULL);
+ }
+ totalram_pages += totalhigh_pages;
+#endif
+}
+
+/*
+ * mem_init() marks the free areas in the mem_map and tells us how much
+ * memory is free. This is done after various parts of the system have
+ * claimed their memory after the kernel image.
+ */
+void __init mem_init(void)
+{
+ unsigned long reserved_pages, free_pages;
+ struct memblock_region *reg;
+ int i;
+#ifdef CONFIG_HAVE_TCM
+ /* These pointers are filled in on TCM detection */
+ extern u32 dtcm_end;
+ extern u32 itcm_end;
+#endif
+
+ max_mapnr = pfn_to_page(max_pfn + PHYS_PFN_OFFSET) - mem_map;
+
+ /* this will put all unused low memory onto the freelists */
+ free_unused_memmap(&meminfo);
+
+ totalram_pages += free_all_bootmem();
+
+#ifdef CONFIG_SA1111
+ /* now that our DMA memory is actually so designated, we can free it */
+ totalram_pages += free_area(PHYS_PFN_OFFSET,
+ __phys_to_pfn(__pa(swapper_pg_dir)), NULL);
+#endif
+
+ free_highpages();
+
+ reserved_pages = free_pages = 0;
+
+ for_each_bank(i, &meminfo) {
+ struct membank *bank = &meminfo.bank[i];
+ unsigned int pfn1, pfn2;
+ struct page *page, *end;
+
+ pfn1 = bank_pfn_start(bank);
+ pfn2 = bank_pfn_end(bank);
+
+ page = pfn_to_page(pfn1);
+ end = pfn_to_page(pfn2 - 1) + 1;
+
+ do {
+ if (PageReserved(page))
+ reserved_pages++;
+ else if (!page_count(page))
+ free_pages++;
+ page++;
+ } while (page < end);
+ }
+
+ /*
+ * Since our memory may not be contiguous, calculate the
+ * real number of pages we have in this system
+ */
+ printk(KERN_INFO "Memory:");
+ num_physpages = 0;
+ for_each_memblock(memory, reg) {
+ unsigned long pages = memblock_region_memory_end_pfn(reg) -
+ memblock_region_memory_base_pfn(reg);
+ num_physpages += pages;
+ printk(" %ldMB", pages >> (20 - PAGE_SHIFT));
+ }
+ printk(" = %luMB total\n", num_physpages >> (20 - PAGE_SHIFT));
+
+ printk(KERN_NOTICE "Memory: %luk/%luk available, %luk reserved, %luK highmem\n",
+ nr_free_pages() << (PAGE_SHIFT-10),
+ free_pages << (PAGE_SHIFT-10),
+ reserved_pages << (PAGE_SHIFT-10),
+ totalhigh_pages << (PAGE_SHIFT-10));
+
+#define MLK(b, t) b, t, ((t) - (b)) >> 10
+#define MLM(b, t) b, t, ((t) - (b)) >> 20
+#define MLK_ROUNDUP(b, t) b, t, DIV_ROUND_UP(((t) - (b)), SZ_1K)
+
+ printk(KERN_NOTICE "Virtual kernel memory layout:\n"
+ " vector : 0x%08lx - 0x%08lx (%4ld kB)\n"
+#ifdef CONFIG_HAVE_TCM
+ " DTCM : 0x%08lx - 0x%08lx (%4ld kB)\n"
+ " ITCM : 0x%08lx - 0x%08lx (%4ld kB)\n"
+#endif
+ " fixmap : 0x%08lx - 0x%08lx (%4ld kB)\n"
+ " vmalloc : 0x%08lx - 0x%08lx (%4ld MB)\n"
+ " lowmem : 0x%08lx - 0x%08lx (%4ld MB)\n"
+#ifdef CONFIG_HIGHMEM
+ " pkmap : 0x%08lx - 0x%08lx (%4ld MB)\n"
+#endif
+#ifdef CONFIG_MODULES
+ " modules : 0x%08lx - 0x%08lx (%4ld MB)\n"
+#endif
+ " .text : 0x%p" " - 0x%p" " (%4d kB)\n"
+ " .init : 0x%p" " - 0x%p" " (%4d kB)\n"
+ " .data : 0x%p" " - 0x%p" " (%4d kB)\n"
+ " .bss : 0x%p" " - 0x%p" " (%4d kB)\n",
+
+ MLK(UL(CONFIG_VECTORS_BASE), UL(CONFIG_VECTORS_BASE) +
+ (PAGE_SIZE)),
+#ifdef CONFIG_HAVE_TCM
+ MLK(DTCM_OFFSET, (unsigned long) dtcm_end),
+ MLK(ITCM_OFFSET, (unsigned long) itcm_end),
+#endif
+ MLK(FIXADDR_START, FIXADDR_TOP),
+ MLM(VMALLOC_START, VMALLOC_END),
+ MLM(PAGE_OFFSET, (unsigned long)high_memory),
+#ifdef CONFIG_HIGHMEM
+ MLM(PKMAP_BASE, (PKMAP_BASE) + (LAST_PKMAP) *
+ (PAGE_SIZE)),
+#endif
+#ifdef CONFIG_MODULES
+ MLM(MODULES_VADDR, MODULES_END),
+#endif
+
+ MLK_ROUNDUP(_text, _etext),
+ MLK_ROUNDUP(__init_begin, __init_end),
+ MLK_ROUNDUP(_sdata, _edata),
+ MLK_ROUNDUP(__bss_start, __bss_stop));
+
+#undef MLK
+#undef MLM
+#undef MLK_ROUNDUP
+
+ /*
+ * Check boundaries twice: Some fundamental inconsistencies can
+ * be detected at build time already.
+ */
+#ifdef CONFIG_MMU
+ BUILD_BUG_ON(TASK_SIZE > MODULES_VADDR);
+ BUG_ON(TASK_SIZE > MODULES_VADDR);
+#endif
+
+#ifdef CONFIG_HIGHMEM
+ BUILD_BUG_ON(PKMAP_BASE + LAST_PKMAP * PAGE_SIZE > PAGE_OFFSET);
+ BUG_ON(PKMAP_BASE + LAST_PKMAP * PAGE_SIZE > PAGE_OFFSET);
+#endif
+
+ if (PAGE_SIZE >= 16384 && num_physpages <= 128) {
+ extern int sysctl_overcommit_memory;
+ /*
+ * On a machine this small we won't get
+ * anywhere without overcommit, so turn
+ * it on by default.
+ */
+ sysctl_overcommit_memory = OVERCOMMIT_ALWAYS;
+ }
+}
+
+void free_initmem(void)
+{
+#ifdef CONFIG_HAVE_TCM
+ extern char __tcm_start, __tcm_end;
+
+ poison_init_mem(&__tcm_start, &__tcm_end - &__tcm_start);
+ totalram_pages += free_area(__phys_to_pfn(__pa(&__tcm_start)),
+ __phys_to_pfn(__pa(&__tcm_end)),
+ "TCM link");
+#endif
+
+ poison_init_mem(__init_begin, __init_end - __init_begin);
+ if (!machine_is_integrator() && !machine_is_cintegrator())
+ totalram_pages += free_area(__phys_to_pfn(__pa(__init_begin)),
+ __phys_to_pfn(__pa(__init_end)),
+ "init");
+}
+
+#ifdef CONFIG_BLK_DEV_INITRD
+
+static int keep_initrd;
+
+void free_initrd_mem(unsigned long start, unsigned long end)
+{
+ if (!keep_initrd) {
+ poison_init_mem((void *)start, PAGE_ALIGN(end) - start);
+ totalram_pages += free_area(__phys_to_pfn(__pa(start)),
+ __phys_to_pfn(__pa(end)),
+ "initrd");
+ }
+}
+
+static int __init keepinitrd_setup(char *__unused)
+{
+ keep_initrd = 1;
+ return 1;
+}
+
+__setup("keepinitrd", keepinitrd_setup);
+#endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/iomap.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/iomap.c
new file mode 100644
index 0000000..4614208
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/iomap.c
@@ -0,0 +1,42 @@
+/*
+ * linux/arch/arm/mm/iomap.c
+ *
+ * Map IO port and PCI memory spaces so that {read,write}[bwl] can
+ * be used to access this memory.
+ */
+#include <linux/module.h>
+#include <linux/pci.h>
+#include <linux/ioport.h>
+#include <linux/io.h>
+
+unsigned long vga_base;
+EXPORT_SYMBOL(vga_base);
+
+#ifdef __io
+void __iomem *ioport_map(unsigned long port, unsigned int nr)
+{
+ return __io(port);
+}
+EXPORT_SYMBOL(ioport_map);
+
+void ioport_unmap(void __iomem *addr)
+{
+}
+EXPORT_SYMBOL(ioport_unmap);
+#endif
+
+#ifdef CONFIG_PCI
+unsigned long pcibios_min_io = 0x1000;
+EXPORT_SYMBOL(pcibios_min_io);
+
+unsigned long pcibios_min_mem = 0x01000000;
+EXPORT_SYMBOL(pcibios_min_mem);
+
+void pci_iounmap(struct pci_dev *dev, void __iomem *addr)
+{
+ if ((unsigned long)addr >= VMALLOC_START &&
+ (unsigned long)addr < VMALLOC_END)
+ iounmap(addr);
+}
+EXPORT_SYMBOL(pci_iounmap);
+#endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/ioremap.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/ioremap.c
new file mode 100644
index 0000000..c17bb40
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/ioremap.c
@@ -0,0 +1,386 @@
+/*
+ * linux/arch/arm/mm/ioremap.c
+ *
+ * Re-map IO memory to kernel address space so that we can access it.
+ *
+ * (C) Copyright 1995 1996 Linus Torvalds
+ *
+ * Hacked for ARM by Phil Blundell <philb@gnu.org>
+ * Hacked to allow all architectures to build, and various cleanups
+ * by Russell King
+ *
+ * This allows a driver to remap an arbitrary region of bus memory into
+ * virtual space. One should *only* use readl, writel, memcpy_toio and
+ * so on with such remapped areas.
+ *
+ * Because the ARM only has a 32-bit address space we can't address the
+ * whole of the (physical) PCI space at once. PCI huge-mode addressing
+ * allows us to circumvent this restriction by splitting PCI space into
+ * two 2GB chunks and mapping only one at a time into processor memory.
+ * We use MMU protection domains to trap any attempt to access the bank
+ * that is not currently mapped. (This isn't fully implemented yet.)
+ */
+#include <linux/module.h>
+#include <linux/errno.h>
+#include <linux/mm.h>
+#include <linux/vmalloc.h>
+#include <linux/io.h>
+
+#include <asm/cp15.h>
+#include <asm/cputype.h>
+#include <asm/cacheflush.h>
+#include <asm/mmu_context.h>
+#include <asm/pgalloc.h>
+#include <asm/tlbflush.h>
+#include <asm/sizes.h>
+#include <asm/system_info.h>
+
+#include <asm/mach/map.h>
+#include "mm.h"
+
+int ioremap_page(unsigned long virt, unsigned long phys,
+ const struct mem_type *mtype)
+{
+ return ioremap_page_range(virt, virt + PAGE_SIZE, phys,
+ __pgprot(mtype->prot_pte));
+}
+EXPORT_SYMBOL(ioremap_page);
+
+void __check_kvm_seq(struct mm_struct *mm)
+{
+ unsigned int seq;
+
+ do {
+ seq = init_mm.context.kvm_seq;
+ memcpy(pgd_offset(mm, VMALLOC_START),
+ pgd_offset_k(VMALLOC_START),
+ sizeof(pgd_t) * (pgd_index(VMALLOC_END) -
+ pgd_index(VMALLOC_START)));
+ mm->context.kvm_seq = seq;
+ } while (seq != init_mm.context.kvm_seq);
+}
+
+#if !defined(CONFIG_SMP) && !defined(CONFIG_ARM_LPAE)
+/*
+ * Section support is unsafe on SMP - If you iounmap and ioremap a region,
+ * the other CPUs will not see this change until their next context switch.
+ * Meanwhile, (eg) if an interrupt comes in on one of those other CPUs
+ * which requires the new ioremap'd region to be referenced, the CPU will
+ * reference the _old_ region.
+ *
+ * Note that get_vm_area_caller() allocates a guard 4K page, so we need to
+ * mask the size back to 1MB aligned or we will overflow in the loop below.
+ */
+static void unmap_area_sections(unsigned long virt, unsigned long size)
+{
+ unsigned long addr = virt, end = virt + (size & ~(SZ_1M - 1));
+ pgd_t *pgd;
+ pud_t *pud;
+ pmd_t *pmdp;
+
+ flush_cache_vunmap(addr, end);
+ pgd = pgd_offset_k(addr);
+ pud = pud_offset(pgd, addr);
+ pmdp = pmd_offset(pud, addr);
+ do {
+ pmd_t pmd = *pmdp;
+
+ if (!pmd_none(pmd)) {
+ /*
+ * Clear the PMD from the page table, and
+ * increment the kvm sequence so others
+ * notice this change.
+ *
+ * Note: this is still racy on SMP machines.
+ */
+ pmd_clear(pmdp);
+ init_mm.context.kvm_seq++;
+
+ /*
+ * Free the page table, if there was one.
+ */
+ if ((pmd_val(pmd) & PMD_TYPE_MASK) == PMD_TYPE_TABLE)
+ pte_free_kernel(&init_mm, pmd_page_vaddr(pmd));
+ }
+
+ addr += PMD_SIZE;
+ pmdp += 2;
+ } while (addr < end);
+
+ /*
+ * Ensure that the active_mm is up to date - we want to
+ * catch any use-after-iounmap cases.
+ */
+ if (current->active_mm->context.kvm_seq != init_mm.context.kvm_seq)
+ __check_kvm_seq(current->active_mm);
+
+ flush_tlb_kernel_range(virt, end);
+}
+
+static int
+remap_area_sections(unsigned long virt, unsigned long pfn,
+ size_t size, const struct mem_type *type)
+{
+ unsigned long addr = virt, end = virt + size;
+ pgd_t *pgd;
+ pud_t *pud;
+ pmd_t *pmd;
+
+ /*
+ * Remove and free any PTE-based mapping, and
+ * sync the current kernel mapping.
+ */
+ unmap_area_sections(virt, size);
+
+ pgd = pgd_offset_k(addr);
+ pud = pud_offset(pgd, addr);
+ pmd = pmd_offset(pud, addr);
+ do {
+ pmd[0] = __pmd(__pfn_to_phys(pfn) | type->prot_sect);
+ pfn += SZ_1M >> PAGE_SHIFT;
+ pmd[1] = __pmd(__pfn_to_phys(pfn) | type->prot_sect);
+ pfn += SZ_1M >> PAGE_SHIFT;
+ flush_pmd_entry(pmd);
+
+ addr += PMD_SIZE;
+ pmd += 2;
+ } while (addr < end);
+
+ return 0;
+}
+
+static int
+remap_area_supersections(unsigned long virt, unsigned long pfn,
+ size_t size, const struct mem_type *type)
+{
+ unsigned long addr = virt, end = virt + size;
+ pgd_t *pgd;
+ pud_t *pud;
+ pmd_t *pmd;
+
+ /*
+ * Remove and free any PTE-based mapping, and
+ * sync the current kernel mapping.
+ */
+ unmap_area_sections(virt, size);
+
+ pgd = pgd_offset_k(virt);
+ pud = pud_offset(pgd, addr);
+ pmd = pmd_offset(pud, addr);
+ do {
+ unsigned long super_pmd_val, i;
+
+ super_pmd_val = __pfn_to_phys(pfn) | type->prot_sect |
+ PMD_SECT_SUPER;
+ super_pmd_val |= ((pfn >> (32 - PAGE_SHIFT)) & 0xf) << 20;
+
+ for (i = 0; i < 8; i++) {
+ pmd[0] = __pmd(super_pmd_val);
+ pmd[1] = __pmd(super_pmd_val);
+ flush_pmd_entry(pmd);
+
+ addr += PMD_SIZE;
+ pmd += 2;
+ }
+
+ pfn += SUPERSECTION_SIZE >> PAGE_SHIFT;
+ } while (addr < end);
+
+ return 0;
+}
+#endif
+
+void __iomem * __arm_ioremap_pfn_caller(unsigned long pfn,
+ unsigned long offset, size_t size, unsigned int mtype, void *caller)
+{
+ const struct mem_type *type;
+ int err;
+ unsigned long addr;
+ struct vm_struct * area;
+
+#ifndef CONFIG_ARM_LPAE
+ /*
+ * High mappings must be supersection aligned
+ */
+ if (pfn >= 0x100000 && (__pfn_to_phys(pfn) & ~SUPERSECTION_MASK))
+ return NULL;
+#endif
+
+ type = get_mem_type(mtype);
+ if (!type)
+ return NULL;
+
+ /*
+ * Page align the mapping size, taking account of any offset.
+ */
+ size = PAGE_ALIGN(offset + size);
+
+ /*
+ * Try to reuse one of the static mapping whenever possible.
+ */
+ read_lock(&vmlist_lock);
+ for (area = vmlist; area; area = area->next) {
+ if (!size || (sizeof(phys_addr_t) == 4 && pfn >= 0x100000))
+ break;
+ if (!(area->flags & VM_ARM_STATIC_MAPPING))
+ continue;
+ if ((area->flags & VM_ARM_MTYPE_MASK) != VM_ARM_MTYPE(mtype))
+ continue;
+ if (__phys_to_pfn(area->phys_addr) > pfn ||
+ __pfn_to_phys(pfn) + size-1 > area->phys_addr + area->size-1)
+ continue;
+ /* we can drop the lock here as we know *area is static */
+ read_unlock(&vmlist_lock);
+ addr = (unsigned long)area->addr;
+ addr += __pfn_to_phys(pfn) - area->phys_addr;
+ return (void __iomem *) (offset + addr);
+ }
+ read_unlock(&vmlist_lock);
+
+ /*
+ * Don't allow RAM to be mapped - this causes problems with ARMv6+
+ */
+ if (WARN_ON(pfn_valid(pfn)))
+ return NULL;
+
+ area = get_vm_area_caller(size, VM_IOREMAP, caller);
+ if (!area)
+ return NULL;
+ addr = (unsigned long)area->addr;
+
+#if !defined(CONFIG_SMP) && !defined(CONFIG_ARM_LPAE)
+ if (DOMAIN_IO == 0 &&
+ (((cpu_architecture() >= CPU_ARCH_ARMv6) && (get_cr() & CR_XP)) ||
+ cpu_is_xsc3()) && pfn >= 0x100000 &&
+ !((__pfn_to_phys(pfn) | size | addr) & ~SUPERSECTION_MASK)) {
+ area->flags |= VM_ARM_SECTION_MAPPING;
+ err = remap_area_supersections(addr, pfn, size, type);
+ } else if (!((__pfn_to_phys(pfn) | size | addr) & ~PMD_MASK)) {
+ area->flags |= VM_ARM_SECTION_MAPPING;
+ err = remap_area_sections(addr, pfn, size, type);
+ } else
+#endif
+ err = ioremap_page_range(addr, addr + size, __pfn_to_phys(pfn),
+ __pgprot(type->prot_pte));
+
+ if (err) {
+ vunmap((void *)addr);
+ return NULL;
+ }
+
+ flush_cache_vmap(addr, addr + size);
+ return (void __iomem *) (offset + addr);
+}
+
+void __iomem *__arm_ioremap_caller(unsigned long phys_addr, size_t size,
+ unsigned int mtype, void *caller)
+{
+ unsigned long last_addr;
+ unsigned long offset = phys_addr & ~PAGE_MASK;
+ unsigned long pfn = __phys_to_pfn(phys_addr);
+
+ /*
+ * Don't allow wraparound or zero size
+ */
+ last_addr = phys_addr + size - 1;
+ if (!size || last_addr < phys_addr)
+ return NULL;
+
+ return __arm_ioremap_pfn_caller(pfn, offset, size, mtype,
+ caller);
+}
+
+/*
+ * Remap an arbitrary physical address space into the kernel virtual
+ * address space. Needed when the kernel wants to access high addresses
+ * directly.
+ *
+ * NOTE! We need to allow non-page-aligned mappings too: we will obviously
+ * have to convert them into an offset in a page-aligned mapping, but the
+ * caller shouldn't need to know that small detail.
+ */
+void __iomem *
+__arm_ioremap_pfn(unsigned long pfn, unsigned long offset, size_t size,
+ unsigned int mtype)
+{
+ return __arm_ioremap_pfn_caller(pfn, offset, size, mtype,
+ __builtin_return_address(0));
+}
+EXPORT_SYMBOL(__arm_ioremap_pfn);
+
+void __iomem * (*arch_ioremap_caller)(unsigned long, size_t,
+ unsigned int, void *) =
+ __arm_ioremap_caller;
+
+void __iomem *
+__arm_ioremap(unsigned long phys_addr, size_t size, unsigned int mtype)
+{
+ return arch_ioremap_caller(phys_addr, size, mtype,
+ __builtin_return_address(0));
+}
+EXPORT_SYMBOL(__arm_ioremap);
+
+/*
+ * Remap an arbitrary physical address space into the kernel virtual
+ * address space as memory. Needed when the kernel wants to execute
+ * code in external memory. This is needed for reprogramming source
+ * clocks that would affect normal memory for example. Please see
+ * CONFIG_GENERIC_ALLOCATOR for allocating external memory.
+ */
+void __iomem *
+__arm_ioremap_exec(unsigned long phys_addr, size_t size, bool cached)
+{
+ unsigned int mtype;
+
+ if (cached)
+ mtype = MT_MEMORY;
+ else
+ mtype = MT_MEMORY_NONCACHED;
+
+ return __arm_ioremap_caller(phys_addr, size, mtype,
+ __builtin_return_address(0));
+}
+
+void __iounmap(volatile void __iomem *io_addr)
+{
+ void *addr = (void *)(PAGE_MASK & (unsigned long)io_addr);
+ struct vm_struct *vm;
+
+ read_lock(&vmlist_lock);
+ for (vm = vmlist; vm; vm = vm->next) {
+ if (vm->addr > addr)
+ break;
+ if (!(vm->flags & VM_IOREMAP))
+ continue;
+ /* If this is a static mapping we must leave it alone */
+ if ((vm->flags & VM_ARM_STATIC_MAPPING) &&
+ (vm->addr <= addr) && (vm->addr + vm->size > addr)) {
+ read_unlock(&vmlist_lock);
+ return;
+ }
+#if !defined(CONFIG_SMP) && !defined(CONFIG_ARM_LPAE)
+ /*
+ * If this is a section based mapping we need to handle it
+ * specially as the VM subsystem does not know how to handle
+ * such a beast.
+ */
+ if ((vm->addr == addr) &&
+ (vm->flags & VM_ARM_SECTION_MAPPING)) {
+ unmap_area_sections((unsigned long)vm->addr, vm->size);
+ break;
+ }
+#endif
+ }
+ read_unlock(&vmlist_lock);
+
+ vunmap(addr);
+}
+
+void (*arch_iounmap)(volatile void __iomem *) = __iounmap;
+
+void __arm_iounmap(volatile void __iomem *io_addr)
+{
+ arch_iounmap(io_addr);
+}
+EXPORT_SYMBOL(__arm_iounmap);
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/mm.h b/ap/os/linux/linux-3.4.x/arch/arm/mm/mm.h
new file mode 100644
index 0000000..d3f25c9
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/mm.h
@@ -0,0 +1,74 @@
+#ifdef CONFIG_MMU
+
+/* the upper-most page table pointer */
+extern pmd_t *top_pmd;
+
+/*
+ * 0xffff8000 to 0xffffffff is reserved for any ARM architecture
+ * specific hacks for copying pages efficiently, while 0xffff4000
+ * is reserved for VIPT aliasing flushing by generic code.
+ *
+ * Note that we don't allow VIPT aliasing caches with SMP.
+ */
+#define COPYPAGE_MINICACHE 0xffff8000
+#define COPYPAGE_V6_FROM 0xffff8000
+#define COPYPAGE_V6_TO 0xffffc000
+/* PFN alias flushing, for VIPT caches */
+#define FLUSH_ALIAS_START 0xffff4000
+
+static inline void set_top_pte(unsigned long va, pte_t pte)
+{
+ pte_t *ptep = pte_offset_kernel(top_pmd, va);
+ set_pte_ext(ptep, pte, 0);
+ local_flush_tlb_kernel_page(va);
+}
+
+static inline pte_t get_top_pte(unsigned long va)
+{
+ pte_t *ptep = pte_offset_kernel(top_pmd, va);
+ return *ptep;
+}
+
+static inline pmd_t *pmd_off_k(unsigned long virt)
+{
+ return pmd_offset(pud_offset(pgd_offset_k(virt), virt), virt);
+}
+
+struct mem_type {
+ pteval_t prot_pte;
+ pmdval_t prot_l1;
+ pmdval_t prot_sect;
+ unsigned int domain;
+};
+
+const struct mem_type *get_mem_type(unsigned int type);
+
+extern void __flush_dcache_page(struct address_space *mapping, struct page *page);
+
+/*
+ * ARM specific vm_struct->flags bits.
+ */
+
+/* (super)section-mapped I/O regions used by ioremap()/iounmap() */
+#define VM_ARM_SECTION_MAPPING 0x80000000
+
+/* permanent static mappings from iotable_init() */
+#define VM_ARM_STATIC_MAPPING 0x40000000
+
+/* empty mapping */
+#define VM_ARM_EMPTY_MAPPING 0x20000000
+
+/* mapping type (attributes) for permanent static mappings */
+#define VM_ARM_MTYPE(mt) ((mt) << 20)
+#define VM_ARM_MTYPE_MASK (0x1f << 20)
+
+#endif
+
+#ifdef CONFIG_ZONE_DMA
+extern u32 arm_dma_limit;
+#else
+#define arm_dma_limit ((u32)~0)
+#endif
+
+void __init bootmem_init(void);
+void arm_mm_memblock_reserve(void);
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/mmap.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/mmap.c
new file mode 100644
index 0000000..ce8cb19
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/mmap.c
@@ -0,0 +1,322 @@
+/*
+ * linux/arch/arm/mm/mmap.c
+ */
+#include <linux/fs.h>
+#include <linux/mm.h>
+#include <linux/mman.h>
+#include <linux/shm.h>
+#include <linux/sched.h>
+#include <linux/io.h>
+#include <linux/personality.h>
+#include <linux/random.h>
+#include <asm/cachetype.h>
+
+static inline unsigned long COLOUR_ALIGN_DOWN(unsigned long addr,
+ unsigned long pgoff)
+{
+ unsigned long base = addr & ~(SHMLBA-1);
+ unsigned long off = (pgoff << PAGE_SHIFT) & (SHMLBA-1);
+
+ if (base + off <= addr)
+ return base + off;
+
+ return base - off;
+}
+
+#define COLOUR_ALIGN(addr,pgoff) \
+ ((((addr)+SHMLBA-1)&~(SHMLBA-1)) + \
+ (((pgoff)<<PAGE_SHIFT) & (SHMLBA-1)))
+
+/* gap between mmap and stack */
+#define MIN_GAP (128*1024*1024UL)
+#define MAX_GAP ((TASK_SIZE)/6*5)
+
+static int mmap_is_legacy(void)
+{
+ if (current->personality & ADDR_COMPAT_LAYOUT)
+ return 1;
+
+ if (rlimit(RLIMIT_STACK) == RLIM_INFINITY)
+ return 1;
+
+ return sysctl_legacy_va_layout;
+}
+
+static unsigned long mmap_base(unsigned long rnd)
+{
+ unsigned long gap = rlimit(RLIMIT_STACK);
+
+ if (gap < MIN_GAP)
+ gap = MIN_GAP;
+ else if (gap > MAX_GAP)
+ gap = MAX_GAP;
+
+ return PAGE_ALIGN(TASK_SIZE - gap - rnd);
+}
+
+/*
+ * We need to ensure that shared mappings are correctly aligned to
+ * avoid aliasing issues with VIPT caches. We need to ensure that
+ * a specific page of an object is always mapped at a multiple of
+ * SHMLBA bytes.
+ *
+ * We unconditionally provide this function for all cases, however
+ * in the VIVT case, we optimise out the alignment rules.
+ */
+unsigned long
+arch_get_unmapped_area(struct file *filp, unsigned long addr,
+ unsigned long len, unsigned long pgoff, unsigned long flags)
+{
+ struct mm_struct *mm = current->mm;
+ struct vm_area_struct *vma;
+ unsigned long start_addr;
+ int do_align = 0;
+ int aliasing = cache_is_vipt_aliasing();
+
+ /*
+ * We only need to do colour alignment if either the I or D
+ * caches alias.
+ */
+ if (aliasing)
+ do_align = filp || (flags & MAP_SHARED);
+
+ /*
+ * We enforce the MAP_FIXED case.
+ */
+ if (flags & MAP_FIXED) {
+ if (aliasing && flags & MAP_SHARED &&
+ (addr - (pgoff << PAGE_SHIFT)) & (SHMLBA - 1))
+ return -EINVAL;
+ return addr;
+ }
+
+ if (len > TASK_SIZE)
+ return -ENOMEM;
+
+ if (addr) {
+ if (do_align)
+ addr = COLOUR_ALIGN(addr, pgoff);
+ else
+ addr = PAGE_ALIGN(addr);
+
+ vma = find_vma(mm, addr);
+ if (TASK_SIZE - len >= addr &&
+ (!vma || addr + len <= vma->vm_start))
+ return addr;
+ }
+ if (len > mm->cached_hole_size) {
+ start_addr = addr = mm->free_area_cache;
+ } else {
+ start_addr = addr = mm->mmap_base;
+ mm->cached_hole_size = 0;
+ }
+
+full_search:
+ if (do_align)
+ addr = COLOUR_ALIGN(addr, pgoff);
+ else
+ addr = PAGE_ALIGN(addr);
+
+ for (vma = find_vma(mm, addr); ; vma = vma->vm_next) {
+ /* At this point: (!vma || addr < vma->vm_end). */
+ if (TASK_SIZE - len < addr) {
+ /*
+ * Start a new search - just in case we missed
+ * some holes.
+ */
+ if (start_addr != TASK_UNMAPPED_BASE) {
+ start_addr = addr = TASK_UNMAPPED_BASE;
+ mm->cached_hole_size = 0;
+ goto full_search;
+ }
+ return -ENOMEM;
+ }
+ if (!vma || addr + len <= vma->vm_start) {
+ /*
+ * Remember the place where we stopped the search:
+ */
+ mm->free_area_cache = addr + len;
+ return addr;
+ }
+ if (addr + mm->cached_hole_size < vma->vm_start)
+ mm->cached_hole_size = vma->vm_start - addr;
+ addr = vma->vm_end;
+ if (do_align)
+ addr = COLOUR_ALIGN(addr, pgoff);
+ }
+}
+
+unsigned long
+arch_get_unmapped_area_topdown(struct file *filp, const unsigned long addr0,
+ const unsigned long len, const unsigned long pgoff,
+ const unsigned long flags)
+{
+ struct vm_area_struct *vma;
+ struct mm_struct *mm = current->mm;
+ unsigned long addr = addr0;
+ int do_align = 0;
+ int aliasing = cache_is_vipt_aliasing();
+
+ /*
+ * We only need to do colour alignment if either the I or D
+ * caches alias.
+ */
+ if (aliasing)
+ do_align = filp || (flags & MAP_SHARED);
+
+ /* requested length too big for entire address space */
+ if (len > TASK_SIZE)
+ return -ENOMEM;
+
+ if (flags & MAP_FIXED) {
+ if (aliasing && flags & MAP_SHARED &&
+ (addr - (pgoff << PAGE_SHIFT)) & (SHMLBA - 1))
+ return -EINVAL;
+ return addr;
+ }
+
+ /* requesting a specific address */
+ if (addr) {
+ if (do_align)
+ addr = COLOUR_ALIGN(addr, pgoff);
+ else
+ addr = PAGE_ALIGN(addr);
+ vma = find_vma(mm, addr);
+ if (TASK_SIZE - len >= addr &&
+ (!vma || addr + len <= vma->vm_start))
+ return addr;
+ }
+
+ /* check if free_area_cache is useful for us */
+ if (len <= mm->cached_hole_size) {
+ mm->cached_hole_size = 0;
+ mm->free_area_cache = mm->mmap_base;
+ }
+
+ /* either no address requested or can't fit in requested address hole */
+ addr = mm->free_area_cache;
+ if (do_align) {
+ unsigned long base = COLOUR_ALIGN_DOWN(addr - len, pgoff);
+ addr = base + len;
+ }
+
+ /* make sure it can fit in the remaining address space */
+ if (addr > len) {
+ vma = find_vma(mm, addr-len);
+ if (!vma || addr <= vma->vm_start)
+ /* remember the address as a hint for next time */
+ return (mm->free_area_cache = addr-len);
+ }
+
+ if (mm->mmap_base < len)
+ goto bottomup;
+
+ addr = mm->mmap_base - len;
+ if (do_align)
+ addr = COLOUR_ALIGN_DOWN(addr, pgoff);
+
+ do {
+ /*
+ * Lookup failure means no vma is above this address,
+ * else if new region fits below vma->vm_start,
+ * return with success:
+ */
+ vma = find_vma(mm, addr);
+ if (!vma || addr+len <= vma->vm_start)
+ /* remember the address as a hint for next time */
+ return (mm->free_area_cache = addr);
+
+ /* remember the largest hole we saw so far */
+ if (addr + mm->cached_hole_size < vma->vm_start)
+ mm->cached_hole_size = vma->vm_start - addr;
+
+ /* try just below the current vma->vm_start */
+ addr = vma->vm_start - len;
+ if (do_align)
+ addr = COLOUR_ALIGN_DOWN(addr, pgoff);
+ } while (len < vma->vm_start);
+
+bottomup:
+ /*
+ * A failed mmap() very likely causes application failure,
+ * so fall back to the bottom-up function here. This scenario
+ * can happen with large stack limits and large mmap()
+ * allocations.
+ */
+ mm->cached_hole_size = ~0UL;
+ mm->free_area_cache = TASK_UNMAPPED_BASE;
+ addr = arch_get_unmapped_area(filp, addr0, len, pgoff, flags);
+ /*
+ * Restore the topdown base:
+ */
+ mm->free_area_cache = mm->mmap_base;
+ mm->cached_hole_size = ~0UL;
+
+ return addr;
+}
+
+void arch_pick_mmap_layout(struct mm_struct *mm)
+{
+ unsigned long random_factor = 0UL;
+
+ /* 8 bits of randomness in 20 address space bits */
+ if ((current->flags & PF_RANDOMIZE) &&
+ !(current->personality & ADDR_NO_RANDOMIZE))
+ random_factor = (get_random_int() % (1 << 8)) << PAGE_SHIFT;
+
+ if (mmap_is_legacy()) {
+ mm->mmap_base = TASK_UNMAPPED_BASE + random_factor;
+ mm->get_unmapped_area = arch_get_unmapped_area;
+ mm->unmap_area = arch_unmap_area;
+ } else {
+ mm->mmap_base = mmap_base(random_factor);
+ mm->get_unmapped_area = arch_get_unmapped_area_topdown;
+ mm->unmap_area = arch_unmap_area_topdown;
+ }
+}
+
+/*
+ * You really shouldn't be using read() or write() on /dev/mem. This
+ * might go away in the future.
+ */
+int valid_phys_addr_range(unsigned long addr, size_t size)
+{
+ if (addr < PHYS_OFFSET)
+ return 0;
+ if (addr + size > __pa(high_memory - 1) + 1)
+ return 0;
+
+ return 1;
+}
+
+/*
+ * We don't use supersection mappings for mmap() on /dev/mem, which
+ * means that we can't map the memory area above the 4G barrier into
+ * userspace.
+ */
+int valid_mmap_phys_addr_range(unsigned long pfn, size_t size)
+{
+ return !(pfn + (size >> PAGE_SHIFT) > 0x00100000);
+}
+
+#ifdef CONFIG_STRICT_DEVMEM
+
+#include <linux/ioport.h>
+
+/*
+ * devmem_is_allowed() checks to see if /dev/mem access to a certain
+ * address is valid. The argument is a physical page number.
+ * We mimic x86 here by disallowing access to system RAM as well as
+ * device-exclusive MMIO regions. This effectively disable read()/write()
+ * on /dev/mem.
+ */
+int devmem_is_allowed(unsigned long pfn)
+{
+ if (iomem_is_exclusive(pfn << PAGE_SHIFT))
+ return 0;
+ if (!page_is_ram(pfn))
+ return 1;
+ return 0;
+}
+
+#endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/mmu.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/mmu.c
new file mode 100644
index 0000000..8c89ab8
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/mmu.c
@@ -0,0 +1,1280 @@
+/*
+ * linux/arch/arm/mm/mmu.c
+ *
+ * Copyright (C) 1995-2005 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/errno.h>
+#include <linux/init.h>
+#include <linux/mman.h>
+#include <linux/nodemask.h>
+#include <linux/memblock.h>
+#include <linux/fs.h>
+#include <linux/vmalloc.h>
+
+#include <asm/cp15.h>
+#include <asm/cputype.h>
+#include <asm/sections.h>
+#include <asm/cachetype.h>
+#include <asm/setup.h>
+#include <asm/sizes.h>
+#include <asm/smp_plat.h>
+#include <asm/tlb.h>
+#include <asm/highmem.h>
+#include <asm/system_info.h>
+#include <asm/traps.h>
+
+#include <asm/mach/arch.h>
+#include <asm/mach/map.h>
+
+#include "mm.h"
+
+/*
+ * empty_zero_page is a special page that is used for
+ * zero-initialized data and COW.
+ */
+struct page *empty_zero_page;
+EXPORT_SYMBOL(empty_zero_page);
+
+/*
+ * The pmd table for the upper-most set of pages.
+ */
+pmd_t *top_pmd;
+
+#define CPOLICY_UNCACHED 0
+#define CPOLICY_BUFFERED 1
+#define CPOLICY_WRITETHROUGH 2
+#define CPOLICY_WRITEBACK 3
+#define CPOLICY_WRITEALLOC 4
+
+static unsigned int cachepolicy __initdata = CPOLICY_WRITEBACK;
+static unsigned int ecc_mask __initdata = 0;
+pgprot_t pgprot_user;
+pgprot_t pgprot_kernel;
+
+EXPORT_SYMBOL(pgprot_user);
+EXPORT_SYMBOL(pgprot_kernel);
+
+struct cachepolicy {
+ const char policy[16];
+ unsigned int cr_mask;
+ pmdval_t pmd;
+ pteval_t pte;
+};
+
+static struct cachepolicy cache_policies[] __initdata = {
+ {
+ .policy = "uncached",
+ .cr_mask = CR_W|CR_C,
+ .pmd = PMD_SECT_UNCACHED,
+ .pte = L_PTE_MT_UNCACHED,
+ }, {
+ .policy = "buffered",
+ .cr_mask = CR_C,
+ .pmd = PMD_SECT_BUFFERED,
+ .pte = L_PTE_MT_BUFFERABLE,
+ }, {
+ .policy = "writethrough",
+ .cr_mask = 0,
+ .pmd = PMD_SECT_WT,
+ .pte = L_PTE_MT_WRITETHROUGH,
+ }, {
+ .policy = "writeback",
+ .cr_mask = 0,
+ .pmd = PMD_SECT_WB,
+ .pte = L_PTE_MT_WRITEBACK,
+ }, {
+ .policy = "writealloc",
+ .cr_mask = 0,
+ .pmd = PMD_SECT_WBWA,
+ .pte = L_PTE_MT_WRITEALLOC,
+ }
+};
+
+/*
+ * These are useful for identifying cache coherency
+ * problems by allowing the cache or the cache and
+ * writebuffer to be turned off. (Note: the write
+ * buffer should not be on and the cache off).
+ */
+static int __init early_cachepolicy(char *p)
+{
+ int i;
+
+ for (i = 0; i < ARRAY_SIZE(cache_policies); i++) {
+ int len = strlen(cache_policies[i].policy);
+
+ if (memcmp(p, cache_policies[i].policy, len) == 0) {
+ cachepolicy = i;
+ cr_alignment &= ~cache_policies[i].cr_mask;
+ cr_no_alignment &= ~cache_policies[i].cr_mask;
+ break;
+ }
+ }
+ if (i == ARRAY_SIZE(cache_policies))
+ printk(KERN_ERR "ERROR: unknown or unsupported cache policy\n");
+ /*
+ * This restriction is partly to do with the way we boot; it is
+ * unpredictable to have memory mapped using two different sets of
+ * memory attributes (shared, type, and cache attribs). We can not
+ * change these attributes once the initial assembly has setup the
+ * page tables.
+ */
+ if (cpu_architecture() >= CPU_ARCH_ARMv6) {
+ printk(KERN_WARNING "Only cachepolicy=writeback supported on ARMv6 and later\n");
+ cachepolicy = CPOLICY_WRITEBACK;
+ }
+ flush_cache_all();
+ set_cr(cr_alignment);
+ return 0;
+}
+early_param("cachepolicy", early_cachepolicy);
+
+static int __init early_nocache(char *__unused)
+{
+ char *p = "buffered";
+ printk(KERN_WARNING "nocache is deprecated; use cachepolicy=%s\n", p);
+ early_cachepolicy(p);
+ return 0;
+}
+early_param("nocache", early_nocache);
+
+static int __init early_nowrite(char *__unused)
+{
+ char *p = "uncached";
+ printk(KERN_WARNING "nowb is deprecated; use cachepolicy=%s\n", p);
+ early_cachepolicy(p);
+ return 0;
+}
+early_param("nowb", early_nowrite);
+
+#ifndef CONFIG_ARM_LPAE
+static int __init early_ecc(char *p)
+{
+ if (memcmp(p, "on", 2) == 0)
+ ecc_mask = PMD_PROTECTION;
+ else if (memcmp(p, "off", 3) == 0)
+ ecc_mask = 0;
+ return 0;
+}
+early_param("ecc", early_ecc);
+#endif
+
+static int __init noalign_setup(char *__unused)
+{
+ cr_alignment &= ~CR_A;
+ cr_no_alignment &= ~CR_A;
+ set_cr(cr_alignment);
+ return 1;
+}
+__setup("noalign", noalign_setup);
+
+#ifndef CONFIG_SMP
+void adjust_cr(unsigned long mask, unsigned long set)
+{
+ unsigned long flags;
+
+ mask &= ~CR_A;
+
+ set &= mask;
+
+ local_irq_save(flags);
+
+ cr_no_alignment = (cr_no_alignment & ~mask) | set;
+ cr_alignment = (cr_alignment & ~mask) | set;
+
+ set_cr((get_cr() & ~mask) | set);
+
+ local_irq_restore(flags);
+}
+#endif
+
+#define PROT_PTE_DEVICE L_PTE_PRESENT|L_PTE_YOUNG|L_PTE_DIRTY|L_PTE_XN
+#define PROT_SECT_DEVICE PMD_TYPE_SECT|PMD_SECT_AP_WRITE
+
+static struct mem_type mem_types[] = {
+ [MT_DEVICE] = { /* Strongly ordered / ARMv6 shared device */
+ .prot_pte = PROT_PTE_DEVICE | L_PTE_MT_DEV_SHARED |
+ L_PTE_SHARED,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PROT_SECT_DEVICE | PMD_SECT_S,
+ .domain = DOMAIN_IO,
+ },
+ [MT_DEVICE_NONSHARED] = { /* ARMv6 non-shared device */
+ .prot_pte = PROT_PTE_DEVICE | L_PTE_MT_DEV_NONSHARED,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PROT_SECT_DEVICE,
+ .domain = DOMAIN_IO,
+ },
+ [MT_DEVICE_CACHED] = { /* ioremap_cached */
+ .prot_pte = PROT_PTE_DEVICE | L_PTE_MT_DEV_CACHED,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PROT_SECT_DEVICE | PMD_SECT_WB,
+ .domain = DOMAIN_IO,
+ },
+ [MT_DEVICE_WC] = { /* ioremap_wc */
+ .prot_pte = PROT_PTE_DEVICE | L_PTE_MT_DEV_WC,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PROT_SECT_DEVICE,
+ .domain = DOMAIN_IO,
+ },
+ [MT_UNCACHED] = {
+ .prot_pte = PROT_PTE_DEVICE,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_XN,
+ .domain = DOMAIN_IO,
+ },
+ [MT_CACHECLEAN] = {
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_XN,
+ .domain = DOMAIN_KERNEL,
+ },
+#ifndef CONFIG_ARM_LPAE
+ [MT_MINICLEAN] = {
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_XN | PMD_SECT_MINICACHE,
+ .domain = DOMAIN_KERNEL,
+ },
+#endif
+ [MT_LOW_VECTORS] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY |
+ L_PTE_RDONLY,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .domain = DOMAIN_USER,
+ },
+ [MT_HIGH_VECTORS] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY |
+ L_PTE_USER | L_PTE_RDONLY,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .domain = DOMAIN_USER,
+ },
+ [MT_MEMORY] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_AP_WRITE,
+ .domain = DOMAIN_KERNEL,
+ },
+ [MT_ROM] = {
+ .prot_sect = PMD_TYPE_SECT,
+ .domain = DOMAIN_KERNEL,
+ },
+ [MT_MEMORY_NONCACHED] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY |
+ L_PTE_MT_BUFFERABLE,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_AP_WRITE,
+ .domain = DOMAIN_KERNEL,
+ },
+ [MT_MEMORY_DTCM] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY |
+ L_PTE_XN,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_XN,
+ .domain = DOMAIN_KERNEL,
+ },
+ [MT_MEMORY_ITCM] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .domain = DOMAIN_KERNEL,
+ },
+ [MT_MEMORY_SO] = {
+ .prot_pte = L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY |
+ L_PTE_MT_UNCACHED,
+ .prot_l1 = PMD_TYPE_TABLE,
+ .prot_sect = PMD_TYPE_SECT | PMD_SECT_AP_WRITE | PMD_SECT_S |
+ PMD_SECT_UNCACHED | PMD_SECT_XN,
+ .domain = DOMAIN_KERNEL,
+ },
+};
+
+const struct mem_type *get_mem_type(unsigned int type)
+{
+ return type < ARRAY_SIZE(mem_types) ? &mem_types[type] : NULL;
+}
+EXPORT_SYMBOL(get_mem_type);
+
+/*
+ * Adjust the PMD section entries according to the CPU in use.
+ */
+static void __init build_mem_type_table(void)
+{
+ struct cachepolicy *cp;
+ unsigned int cr = get_cr();
+ pteval_t user_pgprot, kern_pgprot, vecs_pgprot;
+ int cpu_arch = cpu_architecture();
+ int i;
+
+ if (cpu_arch < CPU_ARCH_ARMv6) {
+#if defined(CONFIG_CPU_DCACHE_DISABLE)
+ if (cachepolicy > CPOLICY_BUFFERED)
+ cachepolicy = CPOLICY_BUFFERED;
+#elif defined(CONFIG_CPU_DCACHE_WRITETHROUGH)
+ if (cachepolicy > CPOLICY_WRITETHROUGH)
+ cachepolicy = CPOLICY_WRITETHROUGH;
+#endif
+ }
+ if (cpu_arch < CPU_ARCH_ARMv5) {
+ if (cachepolicy >= CPOLICY_WRITEALLOC)
+ cachepolicy = CPOLICY_WRITEBACK;
+ ecc_mask = 0;
+ }
+ if (is_smp())
+ cachepolicy = CPOLICY_WRITEALLOC;
+
+ /*
+ * Strip out features not present on earlier architectures.
+ * Pre-ARMv5 CPUs don't have TEX bits. Pre-ARMv6 CPUs or those
+ * without extended page tables don't have the 'Shared' bit.
+ */
+ if (cpu_arch < CPU_ARCH_ARMv5)
+ for (i = 0; i < ARRAY_SIZE(mem_types); i++)
+ mem_types[i].prot_sect &= ~PMD_SECT_TEX(7);
+ if ((cpu_arch < CPU_ARCH_ARMv6 || !(cr & CR_XP)) && !cpu_is_xsc3())
+ for (i = 0; i < ARRAY_SIZE(mem_types); i++)
+ mem_types[i].prot_sect &= ~PMD_SECT_S;
+
+ /*
+ * ARMv5 and lower, bit 4 must be set for page tables (was: cache
+ * "update-able on write" bit on ARM610). However, Xscale and
+ * Xscale3 require this bit to be cleared.
+ */
+ if (cpu_is_xscale() || cpu_is_xsc3()) {
+ for (i = 0; i < ARRAY_SIZE(mem_types); i++) {
+ mem_types[i].prot_sect &= ~PMD_BIT4;
+ mem_types[i].prot_l1 &= ~PMD_BIT4;
+ }
+ } else if (cpu_arch < CPU_ARCH_ARMv6) {
+ for (i = 0; i < ARRAY_SIZE(mem_types); i++) {
+ if (mem_types[i].prot_l1)
+ mem_types[i].prot_l1 |= PMD_BIT4;
+ if (mem_types[i].prot_sect)
+ mem_types[i].prot_sect |= PMD_BIT4;
+ }
+ }
+
+ /*
+ * Mark the device areas according to the CPU/architecture.
+ */
+ if (cpu_is_xsc3() || (cpu_arch >= CPU_ARCH_ARMv6 && (cr & CR_XP))) {
+ if (!cpu_is_xsc3()) {
+ /*
+ * Mark device regions on ARMv6+ as execute-never
+ * to prevent speculative instruction fetches.
+ */
+ mem_types[MT_DEVICE].prot_sect |= PMD_SECT_XN;
+ mem_types[MT_DEVICE_NONSHARED].prot_sect |= PMD_SECT_XN;
+ mem_types[MT_DEVICE_CACHED].prot_sect |= PMD_SECT_XN;
+ mem_types[MT_DEVICE_WC].prot_sect |= PMD_SECT_XN;
+ }
+ if (cpu_arch >= CPU_ARCH_ARMv7 && (cr & CR_TRE)) {
+ /*
+ * For ARMv7 with TEX remapping,
+ * - shared device is SXCB=1100
+ * - nonshared device is SXCB=0100
+ * - write combine device mem is SXCB=0001
+ * (Uncached Normal memory)
+ */
+ mem_types[MT_DEVICE].prot_sect |= PMD_SECT_TEX(1);
+ mem_types[MT_DEVICE_NONSHARED].prot_sect |= PMD_SECT_TEX(1);
+ mem_types[MT_DEVICE_WC].prot_sect |= PMD_SECT_BUFFERABLE;
+ } else if (cpu_is_xsc3()) {
+ /*
+ * For Xscale3,
+ * - shared device is TEXCB=00101
+ * - nonshared device is TEXCB=01000
+ * - write combine device mem is TEXCB=00100
+ * (Inner/Outer Uncacheable in xsc3 parlance)
+ */
+ mem_types[MT_DEVICE].prot_sect |= PMD_SECT_TEX(1) | PMD_SECT_BUFFERED;
+ mem_types[MT_DEVICE_NONSHARED].prot_sect |= PMD_SECT_TEX(2);
+ mem_types[MT_DEVICE_WC].prot_sect |= PMD_SECT_TEX(1);
+ } else {
+ /*
+ * For ARMv6 and ARMv7 without TEX remapping,
+ * - shared device is TEXCB=00001
+ * - nonshared device is TEXCB=01000
+ * - write combine device mem is TEXCB=00100
+ * (Uncached Normal in ARMv6 parlance).
+ */
+ mem_types[MT_DEVICE].prot_sect |= PMD_SECT_BUFFERED;
+ mem_types[MT_DEVICE_NONSHARED].prot_sect |= PMD_SECT_TEX(2);
+ mem_types[MT_DEVICE_WC].prot_sect |= PMD_SECT_TEX(1);
+ }
+ } else {
+ /*
+ * On others, write combining is "Uncached/Buffered"
+ */
+ mem_types[MT_DEVICE_WC].prot_sect |= PMD_SECT_BUFFERABLE;
+ }
+
+ /*
+ * Now deal with the memory-type mappings
+ */
+ cp = &cache_policies[cachepolicy];
+ vecs_pgprot = kern_pgprot = user_pgprot = cp->pte;
+
+ /*
+ * Only use write-through for non-SMP systems
+ */
+ if (!is_smp() && cpu_arch >= CPU_ARCH_ARMv5 && cachepolicy > CPOLICY_WRITETHROUGH)
+ vecs_pgprot = cache_policies[CPOLICY_WRITETHROUGH].pte;
+
+ /*
+ * Enable CPU-specific coherency if supported.
+ * (Only available on XSC3 at the moment.)
+ */
+ if (arch_is_coherent() && cpu_is_xsc3()) {
+ mem_types[MT_MEMORY].prot_sect |= PMD_SECT_S;
+ mem_types[MT_MEMORY].prot_pte |= L_PTE_SHARED;
+ mem_types[MT_MEMORY_NONCACHED].prot_sect |= PMD_SECT_S;
+ mem_types[MT_MEMORY_NONCACHED].prot_pte |= L_PTE_SHARED;
+ }
+ /*
+ * ARMv6 and above have extended page tables.
+ */
+ if (cpu_arch >= CPU_ARCH_ARMv6 && (cr & CR_XP)) {
+#ifndef CONFIG_ARM_LPAE
+ /*
+ * Mark cache clean areas and XIP ROM read only
+ * from SVC mode and no access from userspace.
+ */
+ mem_types[MT_ROM].prot_sect |= PMD_SECT_APX|PMD_SECT_AP_WRITE;
+ mem_types[MT_MINICLEAN].prot_sect |= PMD_SECT_APX|PMD_SECT_AP_WRITE;
+ mem_types[MT_CACHECLEAN].prot_sect |= PMD_SECT_APX|PMD_SECT_AP_WRITE;
+#endif
+
+ if (is_smp()) {
+ /*
+ * Mark memory with the "shared" attribute
+ * for SMP systems
+ */
+ user_pgprot |= L_PTE_SHARED;
+ kern_pgprot |= L_PTE_SHARED;
+ vecs_pgprot |= L_PTE_SHARED;
+ mem_types[MT_DEVICE_WC].prot_sect |= PMD_SECT_S;
+ mem_types[MT_DEVICE_WC].prot_pte |= L_PTE_SHARED;
+ mem_types[MT_DEVICE_CACHED].prot_sect |= PMD_SECT_S;
+ mem_types[MT_DEVICE_CACHED].prot_pte |= L_PTE_SHARED;
+ mem_types[MT_MEMORY].prot_sect |= PMD_SECT_S;
+ mem_types[MT_MEMORY].prot_pte |= L_PTE_SHARED;
+ mem_types[MT_MEMORY_NONCACHED].prot_sect |= PMD_SECT_S;
+ mem_types[MT_MEMORY_NONCACHED].prot_pte |= L_PTE_SHARED;
+ }
+ }
+
+ /*
+ * Non-cacheable Normal - intended for memory areas that must
+ * not cause dirty cache line writebacks when used
+ */
+ if (cpu_arch >= CPU_ARCH_ARMv6) {
+ if (cpu_arch >= CPU_ARCH_ARMv7 && (cr & CR_TRE)) {
+ /* Non-cacheable Normal is XCB = 001 */
+ mem_types[MT_MEMORY_NONCACHED].prot_sect |=
+ PMD_SECT_BUFFERED;
+ } else {
+ /* For both ARMv6 and non-TEX-remapping ARMv7 */
+ mem_types[MT_MEMORY_NONCACHED].prot_sect |=
+ PMD_SECT_TEX(1);
+ }
+ } else {
+ mem_types[MT_MEMORY_NONCACHED].prot_sect |= PMD_SECT_BUFFERABLE;
+ }
+
+#ifdef CONFIG_ARM_LPAE
+ /*
+ * Do not generate access flag faults for the kernel mappings.
+ */
+ for (i = 0; i < ARRAY_SIZE(mem_types); i++) {
+ mem_types[i].prot_pte |= PTE_EXT_AF;
+ if (mem_types[i].prot_sect)
+ mem_types[i].prot_sect |= PMD_SECT_AF;
+ }
+ kern_pgprot |= PTE_EXT_AF;
+ vecs_pgprot |= PTE_EXT_AF;
+#endif
+
+ for (i = 0; i < 16; i++) {
+ pteval_t v = pgprot_val(protection_map[i]);
+ protection_map[i] = __pgprot(v | user_pgprot);
+ }
+
+ mem_types[MT_LOW_VECTORS].prot_pte |= vecs_pgprot;
+ mem_types[MT_HIGH_VECTORS].prot_pte |= vecs_pgprot;
+
+ pgprot_user = __pgprot(L_PTE_PRESENT | L_PTE_YOUNG | user_pgprot);
+ pgprot_kernel = __pgprot(L_PTE_PRESENT | L_PTE_YOUNG |
+ L_PTE_DIRTY | kern_pgprot);
+
+ mem_types[MT_LOW_VECTORS].prot_l1 |= ecc_mask;
+ mem_types[MT_HIGH_VECTORS].prot_l1 |= ecc_mask;
+ mem_types[MT_MEMORY].prot_sect |= ecc_mask | cp->pmd;
+ mem_types[MT_MEMORY].prot_pte |= kern_pgprot;
+ mem_types[MT_MEMORY_NONCACHED].prot_sect |= ecc_mask;
+ mem_types[MT_ROM].prot_sect |= cp->pmd;
+
+ switch (cp->pmd) {
+ case PMD_SECT_WT:
+ mem_types[MT_CACHECLEAN].prot_sect |= PMD_SECT_WT;
+ break;
+ case PMD_SECT_WB:
+ case PMD_SECT_WBWA:
+ mem_types[MT_CACHECLEAN].prot_sect |= PMD_SECT_WB;
+ break;
+ }
+ printk("Memory policy: ECC %sabled, Data cache %s\n",
+ ecc_mask ? "en" : "dis", cp->policy);
+
+ for (i = 0; i < ARRAY_SIZE(mem_types); i++) {
+ struct mem_type *t = &mem_types[i];
+ if (t->prot_l1)
+ t->prot_l1 |= PMD_DOMAIN(t->domain);
+ if (t->prot_sect)
+ t->prot_sect |= PMD_DOMAIN(t->domain);
+ }
+}
+
+#ifdef CONFIG_ARM_DMA_MEM_BUFFERABLE
+pgprot_t phys_mem_access_prot(struct file *file, unsigned long pfn,
+ unsigned long size, pgprot_t vma_prot)
+{
+ if (!pfn_valid(pfn))
+ return pgprot_noncached(vma_prot);
+ else if (file->f_flags & O_SYNC)
+ return pgprot_writecombine(vma_prot);
+ return vma_prot;
+}
+EXPORT_SYMBOL(phys_mem_access_prot);
+#endif
+
+#define vectors_base() (vectors_high() ? 0xffff0000 : 0)
+
+static void __init *early_alloc_aligned(unsigned long sz, unsigned long align)
+{
+ void *ptr = __va(memblock_alloc(sz, align));
+ memset(ptr, 0, sz);
+ return ptr;
+}
+
+static void __init *early_alloc(unsigned long sz)
+{
+ return early_alloc_aligned(sz, sz);
+}
+
+static pte_t * __init early_pte_alloc(pmd_t *pmd)
+{
+ if (pmd_none(*pmd) || pmd_bad(*pmd))
+ return early_alloc(PTE_HWTABLE_OFF + PTE_HWTABLE_SIZE);
+ return pmd_page_vaddr(*pmd);
+}
+
+static void __init early_pte_install(pmd_t *pmd, pte_t *pte, unsigned long prot)
+{
+ __pmd_populate(pmd, __pa(pte), prot);
+ BUG_ON(pmd_bad(*pmd));
+}
+
+static pte_t * __init early_pte_alloc_and_install(pmd_t *pmd,
+ unsigned long addr, unsigned long prot)
+{
+ if (pmd_none(*pmd)) {
+ pte_t *pte = early_pte_alloc(pmd);
+ early_pte_install(pmd, pte, prot);
+ }
+ BUG_ON(pmd_bad(*pmd));
+ return pte_offset_kernel(pmd, addr);
+}
+
+static void __init alloc_init_pte(pmd_t *pmd, unsigned long addr,
+ unsigned long end, unsigned long pfn,
+ const struct mem_type *type)
+{
+ pte_t *start_pte = early_pte_alloc(pmd);
+ pte_t *pte = start_pte + pte_index(addr);
+
+ /* If replacing a section mapping, the whole section must be replaced */
+#ifndef CONFIG_DEBUG_RODATA
+ BUG_ON(pmd_bad(*pmd) && ((addr | end) & ~PMD_MASK));
+#endif
+
+ do {
+ set_pte_ext(pte, pfn_pte(pfn, __pgprot(type->prot_pte)), 0);
+ pfn++;
+ } while (pte++, addr += PAGE_SIZE, addr != end);
+ early_pte_install(pmd, start_pte, type->prot_l1);
+}
+
+static void __init alloc_init_section(pud_t *pud, unsigned long addr,
+ unsigned long end, phys_addr_t phys,
+ const struct mem_type *type,
+ bool force_pages)
+{
+ pmd_t *pmd = pmd_offset(pud, addr);
+
+ /*
+ * Try a section mapping - end, addr and phys must all be aligned
+ * to a section boundary. Note that PMDs refer to the individual
+ * L1 entries, whereas PGDs refer to a group of L1 entries making
+ * up one logical pointer to an L2 table.
+ */
+ if (((addr | end | phys) & ~SECTION_MASK) == 0 && !force_pages) {
+ pmd_t *p = pmd;
+
+#ifndef CONFIG_ARM_LPAE
+ if (addr & SECTION_SIZE)
+ pmd++;
+#endif
+
+ do {
+ *pmd = __pmd(phys | type->prot_sect);
+ phys += SECTION_SIZE;
+ } while (pmd++, addr += SECTION_SIZE, addr != end);
+
+ flush_pmd_entry(p);
+ } else {
+ /*
+ * No need to loop; pte's aren't interested in the
+ * individual L1 entries.
+ */
+ alloc_init_pte(pmd, addr, end, __phys_to_pfn(phys), type);
+ }
+}
+
+static void __init alloc_init_pud(pgd_t *pgd, unsigned long addr,
+ unsigned long end, unsigned long phys, const struct mem_type *type,
+ bool force_pages)
+{
+ pud_t *pud = pud_offset(pgd, addr);
+ unsigned long next;
+
+ do {
+ next = pud_addr_end(addr, end);
+ alloc_init_section(pud, addr, next, phys, type, force_pages);
+ phys += next - addr;
+ } while (pud++, addr = next, addr != end);
+}
+
+#ifndef CONFIG_ARM_LPAE
+static void __init create_36bit_mapping(struct map_desc *md,
+ const struct mem_type *type)
+{
+ unsigned long addr, length, end;
+ phys_addr_t phys;
+ pgd_t *pgd;
+
+ addr = md->virtual;
+ phys = __pfn_to_phys(md->pfn);
+ length = PAGE_ALIGN(md->length);
+
+ if (!(cpu_architecture() >= CPU_ARCH_ARMv6 || cpu_is_xsc3())) {
+ printk(KERN_ERR "MM: CPU does not support supersection "
+ "mapping for 0x%08llx at 0x%08lx\n",
+ (long long)__pfn_to_phys((u64)md->pfn), addr);
+ return;
+ }
+
+ /* N.B. ARMv6 supersections are only defined to work with domain 0.
+ * Since domain assignments can in fact be arbitrary, the
+ * 'domain == 0' check below is required to insure that ARMv6
+ * supersections are only allocated for domain 0 regardless
+ * of the actual domain assignments in use.
+ */
+ if (type->domain) {
+ printk(KERN_ERR "MM: invalid domain in supersection "
+ "mapping for 0x%08llx at 0x%08lx\n",
+ (long long)__pfn_to_phys((u64)md->pfn), addr);
+ return;
+ }
+
+ if ((addr | length | __pfn_to_phys(md->pfn)) & ~SUPERSECTION_MASK) {
+ printk(KERN_ERR "MM: cannot create mapping for 0x%08llx"
+ " at 0x%08lx invalid alignment\n",
+ (long long)__pfn_to_phys((u64)md->pfn), addr);
+ return;
+ }
+
+ /*
+ * Shift bits [35:32] of address into bits [23:20] of PMD
+ * (See ARMv6 spec).
+ */
+ phys |= (((md->pfn >> (32 - PAGE_SHIFT)) & 0xF) << 20);
+
+ pgd = pgd_offset_k(addr);
+ end = addr + length;
+ do {
+ pud_t *pud = pud_offset(pgd, addr);
+ pmd_t *pmd = pmd_offset(pud, addr);
+ int i;
+
+ for (i = 0; i < 16; i++)
+ *pmd++ = __pmd(phys | type->prot_sect | PMD_SECT_SUPER);
+
+ addr += SUPERSECTION_SIZE;
+ phys += SUPERSECTION_SIZE;
+ pgd += SUPERSECTION_SIZE >> PGDIR_SHIFT;
+ } while (addr != end);
+}
+#endif /* !CONFIG_ARM_LPAE */
+
+/*
+ * Create the page directory entries and any necessary
+ * page tables for the mapping specified by `md'. We
+ * are able to cope here with varying sizes and address
+ * offsets, and we take full advantage of sections and
+ * supersections.
+ */
+static void __init create_mapping(struct map_desc *md, bool force_pages)
+{
+ unsigned long addr, length, end;
+ phys_addr_t phys;
+ const struct mem_type *type;
+ pgd_t *pgd;
+
+ if (md->virtual != vectors_base() && md->virtual < TASK_SIZE) {
+ printk(KERN_WARNING "BUG: not creating mapping for 0x%08llx"
+ " at 0x%08lx in user region\n",
+ (long long)__pfn_to_phys((u64)md->pfn), md->virtual);
+ return;
+ }
+
+ if ((md->type == MT_DEVICE || md->type == MT_ROM) &&
+ md->virtual >= PAGE_OFFSET &&
+ (md->virtual < VMALLOC_START || md->virtual >= VMALLOC_END)) {
+ printk(KERN_WARNING "BUG: mapping for 0x%08llx"
+ " at 0x%08lx out of vmalloc space\n",
+ (long long)__pfn_to_phys((u64)md->pfn), md->virtual);
+ }
+
+ type = &mem_types[md->type];
+
+#ifndef CONFIG_ARM_LPAE
+ /*
+ * Catch 36-bit addresses
+ */
+ if (md->pfn >= 0x100000) {
+ create_36bit_mapping(md, type);
+ return;
+ }
+#endif
+
+ addr = md->virtual & PAGE_MASK;
+ phys = __pfn_to_phys(md->pfn);
+ length = PAGE_ALIGN(md->length + (md->virtual & ~PAGE_MASK));
+
+ if (type->prot_l1 == 0 && ((addr | phys | length) & ~SECTION_MASK)) {
+ printk(KERN_WARNING "BUG: map for 0x%08llx at 0x%08lx can not "
+ "be mapped using pages, ignoring.\n",
+ (long long)__pfn_to_phys(md->pfn), addr);
+ return;
+ }
+
+ if ((addr & ~SECTION_MASK) && length > (2 * PGDIR_SIZE))
+ {
+ unsigned long addr_tmp;
+ phys_addr_t phys_tmp;
+
+ addr_tmp = (addr & SECTION_MASK) + PGDIR_SIZE;
+ phys_tmp = phys + (addr_tmp - addr);
+
+ pgd = pgd_offset_k(addr_tmp);
+ end = addr + length;
+ do {
+ unsigned long next = pgd_addr_end(addr_tmp, end);
+
+ alloc_init_pud(pgd, addr_tmp, next, phys_tmp, type, force_pages);
+
+ phys_tmp += next - addr_tmp;
+ addr_tmp = next;
+ } while (pgd++, addr_tmp != end);
+
+ pgd = pgd_offset_k(addr);
+ end = (addr & SECTION_MASK) + PGDIR_SIZE;
+ do {
+ unsigned long next = pgd_addr_end(addr, end);
+
+ alloc_init_pud(pgd, addr, next, phys, type, force_pages);
+
+ phys += next - addr;
+ addr = next;
+ } while (pgd++, addr != end);
+ }
+ else
+ {
+ pgd = pgd_offset_k(addr);
+ end = addr + length;
+ do {
+ unsigned long next = pgd_addr_end(addr, end);
+
+ alloc_init_pud(pgd, addr, next, phys, type, force_pages);
+
+ phys += next - addr;
+ addr = next;
+ } while (pgd++, addr != end);
+ }
+}
+
+/*
+ * Create the architecture specific mappings
+ */
+void __init iotable_init(struct map_desc *io_desc, int nr)
+{
+ struct map_desc *md;
+ struct vm_struct *vm;
+
+ if (!nr)
+ return;
+
+ vm = early_alloc_aligned(sizeof(*vm) * nr, __alignof__(*vm));
+
+ for (md = io_desc; nr; md++, nr--) {
+ create_mapping(md, false);
+ vm->addr = (void *)(md->virtual & PAGE_MASK);
+ vm->size = PAGE_ALIGN(md->length + (md->virtual & ~PAGE_MASK));
+ vm->phys_addr = __pfn_to_phys(md->pfn);
+ vm->flags = VM_IOREMAP | VM_ARM_STATIC_MAPPING;
+ vm->flags |= VM_ARM_MTYPE(md->type);
+ vm->caller = iotable_init;
+ vm_area_add_early(vm++);
+ }
+}
+
+#ifndef CONFIG_ARM_LPAE
+
+/*
+ * The Linux PMD is made of two consecutive section entries covering 2MB
+ * (see definition in include/asm/pgtable-2level.h). However a call to
+ * create_mapping() may optimize static mappings by using individual
+ * 1MB section mappings. This leaves the actual PMD potentially half
+ * initialized if the top or bottom section entry isn't used, leaving it
+ * open to problems if a subsequent ioremap() or vmalloc() tries to use
+ * the virtual space left free by that unused section entry.
+ *
+ * Let's avoid the issue by inserting dummy vm entries covering the unused
+ * PMD halves once the static mappings are in place.
+ */
+
+static void __init pmd_empty_section_gap(unsigned long addr)
+{
+ struct vm_struct *vm;
+
+ vm = early_alloc_aligned(sizeof(*vm), __alignof__(*vm));
+ vm->addr = (void *)addr;
+ vm->size = SECTION_SIZE;
+ vm->flags = VM_IOREMAP | VM_ARM_EMPTY_MAPPING;
+ vm->caller = pmd_empty_section_gap;
+ vm_area_add_early(vm);
+}
+
+static void __init fill_pmd_gaps(void)
+{
+ struct vm_struct *vm;
+ unsigned long addr, next = 0;
+ pmd_t *pmd;
+
+ /* we're still single threaded hence no lock needed here */
+ for (vm = vmlist; vm; vm = vm->next) {
+ if (!(vm->flags & (VM_ARM_STATIC_MAPPING | VM_ARM_EMPTY_MAPPING)))
+ continue;
+ addr = (unsigned long)vm->addr;
+ if (addr < next)
+ continue;
+
+ /*
+ * Check if this vm starts on an odd section boundary.
+ * If so and the first section entry for this PMD is free
+ * then we block the corresponding virtual address.
+ */
+ if ((addr & ~PMD_MASK) == SECTION_SIZE) {
+ pmd = pmd_off_k(addr);
+ if (pmd_none(*pmd))
+ pmd_empty_section_gap(addr & PMD_MASK);
+ }
+
+ /*
+ * Then check if this vm ends on an odd section boundary.
+ * If so and the second section entry for this PMD is empty
+ * then we block the corresponding virtual address.
+ */
+ addr += vm->size;
+ if ((addr & ~PMD_MASK) == SECTION_SIZE) {
+ pmd = pmd_off_k(addr) + 1;
+ if (pmd_none(*pmd))
+ pmd_empty_section_gap(addr);
+ }
+
+ /* no need to look at any vm entry until we hit the next PMD */
+ next = (addr + PMD_SIZE - 1) & PMD_MASK;
+ }
+}
+
+#else
+#define fill_pmd_gaps() do { } while (0)
+#endif
+
+static void * __initdata vmalloc_min =
+ (void *)(VMALLOC_END - (240 << 20) - VMALLOC_OFFSET);
+
+/*
+ * vmalloc=size forces the vmalloc area to be exactly 'size'
+ * bytes. This can be used to increase (or decrease) the vmalloc
+ * area - the default is 240m.
+ */
+static int __init early_vmalloc(char *arg)
+{
+ unsigned long vmalloc_reserve = memparse(arg, NULL);
+
+ if (vmalloc_reserve < SZ_16M) {
+ vmalloc_reserve = SZ_16M;
+ printk(KERN_WARNING
+ "vmalloc area too small, limiting to %luMB\n",
+ vmalloc_reserve >> 20);
+ }
+
+ if (vmalloc_reserve > VMALLOC_END - (PAGE_OFFSET + SZ_32M)) {
+ vmalloc_reserve = VMALLOC_END - (PAGE_OFFSET + SZ_32M);
+ printk(KERN_WARNING
+ "vmalloc area is too big, limiting to %luMB\n",
+ vmalloc_reserve >> 20);
+ }
+
+ vmalloc_min = (void *)(VMALLOC_END - vmalloc_reserve);
+ return 0;
+}
+early_param("vmalloc", early_vmalloc);
+
+static phys_addr_t lowmem_limit __initdata = 0;
+
+void __init sanity_check_meminfo(void)
+{
+ int i, j, highmem = 0;
+
+ for (i = 0, j = 0; i < meminfo.nr_banks; i++) {
+ struct membank *bank = &meminfo.bank[j];
+ *bank = meminfo.bank[i];
+
+ if (bank->start > ULONG_MAX)
+ highmem = 1;
+
+#ifdef CONFIG_HIGHMEM
+ if (__va(bank->start) >= vmalloc_min ||
+ __va(bank->start) < (void *)PAGE_OFFSET)
+ highmem = 1;
+
+ bank->highmem = highmem;
+
+ /*
+ * Split those memory banks which are partially overlapping
+ * the vmalloc area greatly simplifying things later.
+ */
+ if (!highmem && __va(bank->start) < vmalloc_min &&
+ bank->size > vmalloc_min - __va(bank->start)) {
+ if (meminfo.nr_banks >= NR_BANKS) {
+ printk(KERN_CRIT "NR_BANKS too low, "
+ "ignoring high memory\n");
+ } else {
+ memmove(bank + 1, bank,
+ (meminfo.nr_banks - i) * sizeof(*bank));
+ meminfo.nr_banks++;
+ i++;
+ bank[1].size -= vmalloc_min - __va(bank->start);
+ bank[1].start = __pa(vmalloc_min - 1) + 1;
+ bank[1].highmem = highmem = 1;
+ j++;
+ }
+ bank->size = vmalloc_min - __va(bank->start);
+ }
+#else
+ bank->highmem = highmem;
+
+ /*
+ * Highmem banks not allowed with !CONFIG_HIGHMEM.
+ */
+ if (highmem) {
+ printk(KERN_NOTICE "Ignoring RAM at %.8llx-%.8llx "
+ "(!CONFIG_HIGHMEM).\n",
+ (unsigned long long)bank->start,
+ (unsigned long long)bank->start + bank->size - 1);
+ continue;
+ }
+
+ /*
+ * Check whether this memory bank would entirely overlap
+ * the vmalloc area.
+ */
+ if (__va(bank->start) >= vmalloc_min ||
+ __va(bank->start) < (void *)PAGE_OFFSET) {
+ printk(KERN_NOTICE "Ignoring RAM at %.8llx-%.8llx "
+ "(vmalloc region overlap).\n",
+ (unsigned long long)bank->start,
+ (unsigned long long)bank->start + bank->size - 1);
+ continue;
+ }
+
+ /*
+ * Check whether this memory bank would partially overlap
+ * the vmalloc area.
+ */
+ if (__va(bank->start + bank->size) > vmalloc_min ||
+ __va(bank->start + bank->size) < __va(bank->start)) {
+ unsigned long newsize = vmalloc_min - __va(bank->start);
+ printk(KERN_NOTICE "Truncating RAM at %.8llx-%.8llx "
+ "to -%.8llx (vmalloc region overlap).\n",
+ (unsigned long long)bank->start,
+ (unsigned long long)bank->start + bank->size - 1,
+ (unsigned long long)bank->start + newsize - 1);
+ bank->size = newsize;
+ }
+#endif
+ if (!bank->highmem && bank->start + bank->size > lowmem_limit)
+ lowmem_limit = bank->start + bank->size;
+
+ j++;
+ }
+#ifdef CONFIG_HIGHMEM
+ if (highmem) {
+ const char *reason = NULL;
+
+ if (cache_is_vipt_aliasing()) {
+ /*
+ * Interactions between kmap and other mappings
+ * make highmem support with aliasing VIPT caches
+ * rather difficult.
+ */
+ reason = "with VIPT aliasing cache";
+ }
+ if (reason) {
+ printk(KERN_CRIT "HIGHMEM is not supported %s, ignoring high memory\n",
+ reason);
+ while (j > 0 && meminfo.bank[j - 1].highmem)
+ j--;
+ }
+ }
+#endif
+ meminfo.nr_banks = j;
+ high_memory = __va(lowmem_limit - 1) + 1;
+ memblock_set_current_limit(lowmem_limit);
+}
+
+static inline void prepare_page_table(void)
+{
+ unsigned long addr;
+ phys_addr_t end;
+
+ /*
+ * Clear out all the mappings below the kernel image.
+ */
+ for (addr = 0; addr < MODULES_VADDR; addr += PMD_SIZE)
+ pmd_clear(pmd_off_k(addr));
+
+#ifdef CONFIG_XIP_KERNEL
+ /* The XIP kernel is mapped in the module area -- skip over it */
+ addr = ((unsigned long)_etext + PMD_SIZE - 1) & PMD_MASK;
+#endif
+ for ( ; addr < PAGE_OFFSET; addr += PMD_SIZE)
+ pmd_clear(pmd_off_k(addr));
+
+ /*
+ * Find the end of the first block of lowmem.
+ */
+ end = memblock.memory.regions[0].base + memblock.memory.regions[0].size;
+ if (end >= lowmem_limit)
+ end = lowmem_limit;
+
+ /*
+ * Clear out all the kernel space mappings, except for the first
+ * memory bank, up to the vmalloc region.
+ */
+ for (addr = __phys_to_virt(end);
+ addr < VMALLOC_START; addr += PMD_SIZE)
+ pmd_clear(pmd_off_k(addr));
+}
+
+#ifdef CONFIG_ARM_LPAE
+/* the first page is reserved for pgd */
+#define SWAPPER_PG_DIR_SIZE (PAGE_SIZE + \
+ PTRS_PER_PGD * PTRS_PER_PMD * sizeof(pmd_t))
+#else
+#define SWAPPER_PG_DIR_SIZE (PTRS_PER_PGD * sizeof(pgd_t))
+#endif
+
+/*
+ * Reserve the special regions of memory
+ */
+void __init arm_mm_memblock_reserve(void)
+{
+ /*
+ * Reserve the page tables. These are already in use,
+ * and can only be in node 0.
+ */
+ memblock_reserve(__pa(swapper_pg_dir), SWAPPER_PG_DIR_SIZE);
+
+#ifdef CONFIG_SA1111
+ /*
+ * Because of the SA1111 DMA bug, we want to preserve our
+ * precious DMA-able memory...
+ */
+ memblock_reserve(PHYS_OFFSET, __pa(swapper_pg_dir) - PHYS_OFFSET);
+#endif
+}
+
+/*
+ * Set up the device mappings. Since we clear out the page tables for all
+ * mappings above VMALLOC_START, we will remove any debug device mappings.
+ * This means you have to be careful how you debug this function, or any
+ * called function. This means you can't use any function or debugging
+ * method which may touch any device, otherwise the kernel _will_ crash.
+ */
+static void __init devicemaps_init(struct machine_desc *mdesc)
+{
+ struct map_desc map;
+ unsigned long addr;
+ void *vectors;
+
+ /*
+ * Allocate the vector page early.
+ */
+ vectors = early_alloc(PAGE_SIZE);
+
+ early_trap_init(vectors);
+
+ for (addr = VMALLOC_START; addr; addr += PMD_SIZE)
+ pmd_clear(pmd_off_k(addr));
+
+ /*
+ * Map the kernel if it is XIP.
+ * It is always first in the modulearea.
+ */
+#ifdef CONFIG_XIP_KERNEL
+ map.pfn = __phys_to_pfn(CONFIG_XIP_PHYS_ADDR & SECTION_MASK);
+ map.virtual = MODULES_VADDR;
+ map.length = ((unsigned long)_etext - map.virtual + ~SECTION_MASK) & SECTION_MASK;
+ map.type = MT_ROM;
+ create_mapping(&map);
+#endif
+
+ /*
+ * Map the cache flushing regions.
+ */
+#ifdef FLUSH_BASE
+ map.pfn = __phys_to_pfn(FLUSH_BASE_PHYS);
+ map.virtual = FLUSH_BASE;
+ map.length = SZ_1M;
+ map.type = MT_CACHECLEAN;
+ create_mapping(&map);
+#endif
+#ifdef FLUSH_BASE_MINICACHE
+ map.pfn = __phys_to_pfn(FLUSH_BASE_PHYS + SZ_1M);
+ map.virtual = FLUSH_BASE_MINICACHE;
+ map.length = SZ_1M;
+ map.type = MT_MINICLEAN;
+ create_mapping(&map);
+#endif
+
+ /*
+ * Create a mapping for the machine vectors at the high-vectors
+ * location (0xffff0000). If we aren't using high-vectors, also
+ * create a mapping at the low-vectors virtual address.
+ */
+ map.pfn = __phys_to_pfn(virt_to_phys(vectors));
+ map.virtual = 0xffff0000;
+ map.length = PAGE_SIZE;
+ map.type = MT_HIGH_VECTORS;
+ create_mapping(&map, false);
+
+ if (!vectors_high()) {
+ map.virtual = 0;
+ map.type = MT_LOW_VECTORS;
+ create_mapping(&map, false);
+ }
+
+ /*
+ * Ask the machine support to map in the statically mapped devices.
+ */
+ if (mdesc->map_io)
+ mdesc->map_io();
+ fill_pmd_gaps();
+
+ /*
+ * Finally flush the caches and tlb to ensure that we're in a
+ * consistent state wrt the writebuffer. This also ensures that
+ * any write-allocated cache lines in the vector page are written
+ * back. After this point, we can start to touch devices again.
+ */
+ local_flush_tlb_all();
+ flush_cache_all();
+}
+
+static void __init kmap_init(void)
+{
+#ifdef CONFIG_HIGHMEM
+ pkmap_page_table = early_pte_alloc_and_install(pmd_off_k(PKMAP_BASE),
+ PKMAP_BASE, _PAGE_KERNEL_TABLE);
+#endif
+}
+
+static void __init map_lowmem(void)
+{
+ struct memblock_region *reg;
+ phys_addr_t start;
+ phys_addr_t end;
+ struct map_desc map;
+
+ /* Map all the lowmem memory banks. */
+ for_each_memblock(memory, reg) {
+ start = reg->base;
+ end = start + reg->size;
+
+ if (end > lowmem_limit)
+ end = lowmem_limit;
+ if (start >= end)
+ break;
+
+ map.pfn = __phys_to_pfn(start);
+ map.virtual = __phys_to_virt(start);
+ map.length = end - start;
+ map.type = MT_MEMORY;
+
+ create_mapping(&map, false);
+ }
+
+#ifdef CONFIG_DEBUG_RODATA
+ //start = __pa(_stext) & PMD_MASK;
+ //end = ALIGN(__pa(__end_rodata), PMD_SIZE);
+
+ map.pfn = __phys_to_pfn(start);
+ map.virtual = __phys_to_virt(start);
+ map.length = end - start;
+ map.type = MT_MEMORY;
+
+ create_mapping(&map, true);
+#endif
+}
+
+/*
+ * paging_init() sets up the page tables, initialises the zone memory
+ * maps, and sets up the zero page, bad page and bad page tables.
+ */
+void __init paging_init(struct machine_desc *mdesc)
+{
+ void *zero_page;
+
+ memblock_set_current_limit(PHYS_OFFSET + (((lowmem_limit - PHYS_OFFSET) >> PMD_SHIFT) << PMD_SHIFT));
+
+ build_mem_type_table();
+ prepare_page_table();
+ map_lowmem();
+ devicemaps_init(mdesc);
+ kmap_init();
+
+ top_pmd = pmd_off_k(0xffff0000);
+
+ /* allocate the zero page. */
+ zero_page = early_alloc(PAGE_SIZE);
+
+ bootmem_init();
+
+ empty_zero_page = virt_to_page(zero_page);
+ __flush_dcache_page(NULL, empty_zero_page);
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/nommu.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/nommu.c
new file mode 100644
index 0000000..eb5293a
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/nommu.c
@@ -0,0 +1,110 @@
+/*
+ * linux/arch/arm/mm/nommu.c
+ *
+ * ARM uCLinux supporting functions.
+ */
+#include <linux/module.h>
+#include <linux/mm.h>
+#include <linux/pagemap.h>
+#include <linux/io.h>
+#include <linux/memblock.h>
+
+#include <asm/cacheflush.h>
+#include <asm/sections.h>
+#include <asm/page.h>
+#include <asm/setup.h>
+#include <asm/traps.h>
+#include <asm/mach/arch.h>
+
+#include "mm.h"
+
+void __init arm_mm_memblock_reserve(void)
+{
+ /*
+ * Register the exception vector page.
+ * some architectures which the DRAM is the exception vector to trap,
+ * alloc_page breaks with error, although it is not NULL, but "0."
+ */
+ memblock_reserve(CONFIG_VECTORS_BASE, PAGE_SIZE);
+}
+
+void __init sanity_check_meminfo(void)
+{
+ phys_addr_t end = bank_phys_end(&meminfo.bank[meminfo.nr_banks - 1]);
+ high_memory = __va(end - 1) + 1;
+}
+
+/*
+ * paging_init() sets up the page tables, initialises the zone memory
+ * maps, and sets up the zero page, bad page and bad page tables.
+ */
+void __init paging_init(struct machine_desc *mdesc)
+{
+ early_trap_init((void *)CONFIG_VECTORS_BASE);
+ bootmem_init();
+}
+
+/*
+ * We don't need to do anything here for nommu machines.
+ */
+void setup_mm_for_reboot(void)
+{
+}
+
+void flush_dcache_page(struct page *page)
+{
+ __cpuc_flush_dcache_area(page_address(page), PAGE_SIZE);
+}
+EXPORT_SYMBOL(flush_dcache_page);
+
+void flush_kernel_dcache_page(struct page *page)
+{
+ __cpuc_flush_dcache_area(page_address(page), PAGE_SIZE);
+}
+EXPORT_SYMBOL(flush_kernel_dcache_page);
+
+void copy_to_user_page(struct vm_area_struct *vma, struct page *page,
+ unsigned long uaddr, void *dst, const void *src,
+ unsigned long len)
+{
+ memcpy(dst, src, len);
+ if (vma->vm_flags & VM_EXEC)
+ __cpuc_coherent_user_range(uaddr, uaddr + len);
+}
+
+void __iomem *__arm_ioremap_pfn(unsigned long pfn, unsigned long offset,
+ size_t size, unsigned int mtype)
+{
+ if (pfn >= (0x100000000ULL >> PAGE_SHIFT))
+ return NULL;
+ return (void __iomem *) (offset + (pfn << PAGE_SHIFT));
+}
+EXPORT_SYMBOL(__arm_ioremap_pfn);
+
+void __iomem *__arm_ioremap_pfn_caller(unsigned long pfn, unsigned long offset,
+ size_t size, unsigned int mtype, void *caller)
+{
+ return __arm_ioremap_pfn(pfn, offset, size, mtype);
+}
+
+void __iomem *__arm_ioremap(unsigned long phys_addr, size_t size,
+ unsigned int mtype)
+{
+ return (void __iomem *)phys_addr;
+}
+EXPORT_SYMBOL(__arm_ioremap);
+
+void __iomem * (*arch_ioremap_caller)(unsigned long, size_t, unsigned int, void *);
+
+void __iomem *__arm_ioremap_caller(unsigned long phys_addr, size_t size,
+ unsigned int mtype, void *caller)
+{
+ return __arm_ioremap(phys_addr, size, mtype);
+}
+
+void (*arch_iounmap)(volatile void __iomem *);
+
+void __arm_iounmap(volatile void __iomem *addr)
+{
+}
+EXPORT_SYMBOL(__arm_iounmap);
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-legacy.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-legacy.S
new file mode 100644
index 0000000..8bbff02
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-legacy.S
@@ -0,0 +1,21 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+
+/*
+ * Function: legacy_pabort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = address of aborted instruction
+ * : r5 = psr for parent context
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current prefetch abort.
+ */
+
+ .align 5
+ENTRY(legacy_pabort)
+ mov r0, r4
+ mov r1, #5
+ b do_PrefetchAbort
+ENDPROC(legacy_pabort)
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-v6.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-v6.S
new file mode 100644
index 0000000..9627646
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-v6.S
@@ -0,0 +1,21 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+
+/*
+ * Function: v6_pabort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = address of aborted instruction
+ * : r5 = psr for parent context
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current prefetch abort.
+ */
+
+ .align 5
+ENTRY(v6_pabort)
+ mov r0, r4
+ mrc p15, 0, r1, c5, c0, 1 @ get IFSR
+ b do_PrefetchAbort
+ENDPROC(v6_pabort)
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-v7.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-v7.S
new file mode 100644
index 0000000..875761f
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/pabort-v7.S
@@ -0,0 +1,21 @@
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+
+/*
+ * Function: v7_pabort
+ *
+ * Params : r2 = pt_regs
+ * : r4 = address of aborted instruction
+ * : r5 = psr for parent context
+ *
+ * Returns : r4 - r11, r13 preserved
+ *
+ * Purpose : obtain information about current prefetch abort.
+ */
+
+ .align 5
+ENTRY(v7_pabort)
+ mrc p15, 0, r0, c6, c0, 2 @ get IFAR
+ mrc p15, 0, r1, c5, c0, 1 @ get IFSR
+ b do_PrefetchAbort
+ENDPROC(v7_pabort)
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/pgd.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/pgd.c
new file mode 100644
index 0000000..0acb089
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/pgd.c
@@ -0,0 +1,159 @@
+/*
+ * linux/arch/arm/mm/pgd.c
+ *
+ * Copyright (C) 1998-2005 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/mm.h>
+#include <linux/gfp.h>
+#include <linux/highmem.h>
+#include <linux/slab.h>
+
+#include <asm/cp15.h>
+#include <asm/pgalloc.h>
+#include <asm/page.h>
+#include <asm/tlbflush.h>
+
+#include "mm.h"
+
+#ifdef CONFIG_ARM_LPAE
+#define __pgd_alloc() kmalloc(PTRS_PER_PGD * sizeof(pgd_t), GFP_KERNEL)
+#define __pgd_free(pgd) kfree(pgd)
+#else
+#define __pgd_alloc() (pgd_t *)__get_free_pages(GFP_KERNEL, 2)
+#define __pgd_free(pgd) free_pages((unsigned long)pgd, 2)
+#endif
+
+/*
+ * need to get a 16k page for level 1
+ */
+pgd_t *pgd_alloc(struct mm_struct *mm)
+{
+ pgd_t *new_pgd, *init_pgd;
+ pud_t *new_pud, *init_pud;
+ pmd_t *new_pmd, *init_pmd;
+ pte_t *new_pte, *init_pte;
+
+ new_pgd = __pgd_alloc();
+ if (!new_pgd)
+ goto no_pgd;
+
+ memset(new_pgd, 0, USER_PTRS_PER_PGD * sizeof(pgd_t));
+
+ /*
+ * Copy over the kernel and IO PGD entries
+ */
+ init_pgd = pgd_offset_k(0);
+ memcpy(new_pgd + USER_PTRS_PER_PGD, init_pgd + USER_PTRS_PER_PGD,
+ (PTRS_PER_PGD - USER_PTRS_PER_PGD) * sizeof(pgd_t));
+
+ clean_dcache_area(new_pgd, PTRS_PER_PGD * sizeof(pgd_t));
+
+#ifdef CONFIG_ARM_LPAE
+ /*
+ * Allocate PMD table for modules and pkmap mappings.
+ */
+ new_pud = pud_alloc(mm, new_pgd + pgd_index(MODULES_VADDR),
+ MODULES_VADDR);
+ if (!new_pud)
+ goto no_pud;
+
+ new_pmd = pmd_alloc(mm, new_pud, 0);
+ if (!new_pmd)
+ goto no_pmd;
+#endif
+
+ if (!vectors_high()) {
+ /*
+ * On ARM, first page must always be allocated since it
+ * contains the machine vectors. The vectors are always high
+ * with LPAE.
+ */
+ new_pud = pud_alloc(mm, new_pgd, 0);
+ if (!new_pud)
+ goto no_pud;
+
+ new_pmd = pmd_alloc(mm, new_pud, 0);
+ if (!new_pmd)
+ goto no_pmd;
+
+ new_pte = pte_alloc_map(mm, NULL, new_pmd, 0);
+ if (!new_pte)
+ goto no_pte;
+
+ init_pud = pud_offset(init_pgd, 0);
+ init_pmd = pmd_offset(init_pud, 0);
+ init_pte = pte_offset_map(init_pmd, 0);
+ set_pte_ext(new_pte, *init_pte, 0);
+ pte_unmap(init_pte);
+ pte_unmap(new_pte);
+ }
+
+ return new_pgd;
+
+no_pte:
+ pmd_free(mm, new_pmd);
+no_pmd:
+ pud_free(mm, new_pud);
+no_pud:
+ __pgd_free(new_pgd);
+no_pgd:
+ return NULL;
+}
+
+void pgd_free(struct mm_struct *mm, pgd_t *pgd_base)
+{
+ pgd_t *pgd;
+ pud_t *pud;
+ pmd_t *pmd;
+ pgtable_t pte;
+
+ if (!pgd_base)
+ return;
+
+ pgd = pgd_base + pgd_index(0);
+ if (pgd_none_or_clear_bad(pgd))
+ goto no_pgd;
+
+ pud = pud_offset(pgd, 0);
+ if (pud_none_or_clear_bad(pud))
+ goto no_pud;
+
+ pmd = pmd_offset(pud, 0);
+ if (pmd_none_or_clear_bad(pmd))
+ goto no_pmd;
+
+ pte = pmd_pgtable(*pmd);
+ pmd_clear(pmd);
+ pte_free(mm, pte);
+no_pmd:
+ pud_clear(pud);
+ pmd_free(mm, pmd);
+no_pud:
+ pgd_clear(pgd);
+ pud_free(mm, pud);
+no_pgd:
+#ifdef CONFIG_ARM_LPAE
+ /*
+ * Free modules/pkmap or identity pmd tables.
+ */
+ for (pgd = pgd_base; pgd < pgd_base + PTRS_PER_PGD; pgd++) {
+ if (pgd_none_or_clear_bad(pgd))
+ continue;
+ if (pgd_val(*pgd) & L_PGD_SWAPPER)
+ continue;
+ pud = pud_offset(pgd, 0);
+ if (pud_none_or_clear_bad(pud))
+ continue;
+ pmd = pmd_offset(pud, 0);
+ pud_clear(pud);
+ pmd_free(mm, pmd);
+ pgd_clear(pgd);
+ pud_free(mm, pud);
+ }
+#endif
+ __pgd_free(pgd_base);
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1020.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1020.S
new file mode 100644
index 0000000..2349513
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1020.S
@@ -0,0 +1,529 @@
+/*
+ * linux/arch/arm/mm/proc-arm1020.S: MMU functions for ARM1020
+ *
+ * Copyright (C) 2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the arm1020.
+ *
+ * CONFIG_CPU_ARM1020_CPU_IDLE -> nohlt
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be invalidated
+ * using the single invalidate entry instructions. Anything larger
+ * than this, and we go for the whole cache.
+ *
+ * This value should be chosen such that we choose the cheapest
+ * alternative.
+ */
+#define MAX_AREA_SIZE 32768
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 16
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ */
+#define CACHE_DLIMIT 32768
+
+ .text
+/*
+ * cpu_arm1020_proc_init()
+ */
+ENTRY(cpu_arm1020_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm1020_proc_fin()
+ */
+ENTRY(cpu_arm1020_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm1020_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm1020_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm1020_reset)
+ .popsection
+
+/*
+ * cpu_arm1020_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm1020_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+ .align 5
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm1020_flush_icache_all)
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+#endif
+ mov pc, lr
+ENDPROC(arm1020_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(arm1020_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm1020_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 16 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 15 to 0
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags for this space
+ */
+ENTRY(arm1020_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, ip, c7, c10, 4
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1020_coherent_kern_range)
+ /* FALLTRHOUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1020_coherent_user_range)
+ mov ip, #0
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcr p15, 0, ip, c7, c10, 4
+1:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#endif
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm1020_flush_kern_dcache_area)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1020_dma_inv_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, ip, c7, c10, 4
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, ip, c7, c10, 4
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1020_dma_clean_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1020_dma_flush_range)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcr p15, 0, ip, c7, c10, 4
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1020_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm1020_dma_clean_range
+ bcs arm1020_dma_inv_range
+ b arm1020_dma_flush_range
+ENDPROC(arm1020_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1020_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm1020_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm1020
+
+ .align 5
+ENTRY(cpu_arm1020_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mov ip, #0
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm1020_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm1020_switch_mm)
+#ifdef CONFIG_MMU
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r3, c7, c10, 4
+ mov r1, #0xF @ 16 segments
+1: mov r3, #0x3F @ 64 entries
+2: mov ip, r3, LSL #26 @ shift up entry
+ orr ip, ip, r1, LSL #5 @ shift in/up index
+ mcr p15, 0, ip, c7, c14, 2 @ Clean & Inval DCache entry
+ mov ip, #0
+ mcr p15, 0, ip, c7, c10, 4
+ subs r3, r3, #1
+ cmp r3, #0
+ bge 2b @ entries 3F to 0
+ subs r1, r1, #1
+ cmp r1, #0
+ bge 1b @ segments 15 to 0
+
+#endif
+ mov r1, #0
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r1, c7, c5, 0 @ invalidate I cache
+#endif
+ mcr p15, 0, r1, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, r1, c8, c7, 0 @ invalidate I & D TLBs
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+/*
+ * cpu_arm1020_set_pte(ptep, pte)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm1020_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 4
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __arm1020_setup, #function
+__arm1020_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+
+ adr r5, arm1020_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x4000 @ .R.. .... .... ....
+#endif
+ mov pc, lr
+ .size __arm1020_setup, . - __arm1020_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 1001 ..11 0101
+ */
+ .type arm1020_crval, #object
+arm1020_crval:
+ crval clear=0x0000593f, mmuset=0x00003935, ucset=0x00001930
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm1020, dabort=v4t_early_abort, pabort=legacy_pabort
+
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5t"
+ string cpu_elf_name, "v5"
+
+ .type cpu_arm1020_name, #object
+cpu_arm1020_name:
+ .ascii "ARM1020"
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ .ascii "i"
+#endif
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ .ascii "d"
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ .ascii "(wt)"
+#else
+ .ascii "(wb)"
+#endif
+#endif
+#ifndef CONFIG_CPU_BPREDICT_DISABLE
+ .ascii "B"
+#endif
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ .ascii "RR"
+#endif
+ .ascii "\0"
+ .size cpu_arm1020_name, . - cpu_arm1020_name
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm1020_proc_info,#object
+__arm1020_proc_info:
+ .long 0x4104a200 @ ARM 1020T (Architecture v5T)
+ .long 0xff0ffff0
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm1020_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB
+ .long cpu_arm1020_name
+ .long arm1020_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long arm1020_cache_fns
+ .size __arm1020_proc_info, . - __arm1020_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1020e.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1020e.S
new file mode 100644
index 0000000..c244b06
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1020e.S
@@ -0,0 +1,489 @@
+/*
+ * linux/arch/arm/mm/proc-arm1020e.S: MMU functions for ARM1020
+ *
+ * Copyright (C) 2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the arm1020e.
+ *
+ * CONFIG_CPU_ARM1020_CPU_IDLE -> nohlt
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be invalidated
+ * using the single invalidate entry instructions. Anything larger
+ * than this, and we go for the whole cache.
+ *
+ * This value should be chosen such that we choose the cheapest
+ * alternative.
+ */
+#define MAX_AREA_SIZE 32768
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 16
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ */
+#define CACHE_DLIMIT 32768
+
+ .text
+/*
+ * cpu_arm1020e_proc_init()
+ */
+ENTRY(cpu_arm1020e_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm1020e_proc_fin()
+ */
+ENTRY(cpu_arm1020e_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm1020e_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm1020e_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm1020e_reset)
+ .popsection
+
+/*
+ * cpu_arm1020e_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm1020e_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+ .align 5
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm1020e_flush_icache_all)
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+#endif
+ mov pc, lr
+ENDPROC(arm1020e_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(arm1020e_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm1020e_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 16 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 15 to 0
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags for this space
+ */
+ENTRY(arm1020e_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1020e_coherent_kern_range)
+ /* FALLTHROUGH */
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1020e_coherent_user_range)
+ mov ip, #0
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm1020e_flush_kern_dcache_area)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1020e_dma_inv_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1020e_dma_clean_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1020e_dma_flush_range)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1020e_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm1020e_dma_clean_range
+ bcs arm1020e_dma_inv_range
+ b arm1020e_dma_flush_range
+ENDPROC(arm1020e_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1020e_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm1020e_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm1020e
+
+ .align 5
+ENTRY(cpu_arm1020e_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mov ip, #0
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm1020e_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm1020e_switch_mm)
+#ifdef CONFIG_MMU
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r3, c7, c10, 4
+ mov r1, #0xF @ 16 segments
+1: mov r3, #0x3F @ 64 entries
+2: mov ip, r3, LSL #26 @ shift up entry
+ orr ip, ip, r1, LSL #5 @ shift in/up index
+ mcr p15, 0, ip, c7, c14, 2 @ Clean & Inval DCache entry
+ mov ip, #0
+ subs r3, r3, #1
+ cmp r3, #0
+ bge 2b @ entries 3F to 0
+ subs r1, r1, #1
+ cmp r1, #0
+ bge 1b @ segments 15 to 0
+
+#endif
+ mov r1, #0
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r1, c7, c5, 0 @ invalidate I cache
+#endif
+ mcr p15, 0, r1, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, r1, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm1020e_set_pte(ptep, pte)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm1020e_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __arm1020e_setup, #function
+__arm1020e_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+ adr r5, arm1020e_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x4000 @ .R.. .... .... ....
+#endif
+ mov pc, lr
+ .size __arm1020e_setup, . - __arm1020e_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 1001 ..11 0101
+ */
+ .type arm1020e_crval, #object
+arm1020e_crval:
+ crval clear=0x00007f3f, mmuset=0x00003935, ucset=0x00001930
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm1020e, dabort=v4t_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5"
+ string cpu_arm1020e_name, "ARM1020E"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm1020e_proc_info,#object
+__arm1020e_proc_info:
+ .long 0x4105a200 @ ARM 1020TE (Architecture v5TE)
+ .long 0xff0ffff0
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm1020e_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB | HWCAP_EDSP
+ .long cpu_arm1020e_name
+ .long arm1020e_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long arm1020e_cache_fns
+ .size __arm1020e_proc_info, . - __arm1020e_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1022.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1022.S
new file mode 100644
index 0000000..38fe22e
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1022.S
@@ -0,0 +1,472 @@
+/*
+ * linux/arch/arm/mm/proc-arm1022.S: MMU functions for ARM1022E
+ *
+ * Copyright (C) 2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the ARM1022E.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be invalidated
+ * using the single invalidate entry instructions. Anything larger
+ * than this, and we go for the whole cache.
+ *
+ * This value should be chosen such that we choose the cheapest
+ * alternative.
+ */
+#define MAX_AREA_SIZE 32768
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 16
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ */
+#define CACHE_DLIMIT 32768
+
+ .text
+/*
+ * cpu_arm1022_proc_init()
+ */
+ENTRY(cpu_arm1022_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm1022_proc_fin()
+ */
+ENTRY(cpu_arm1022_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm1022_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm1022_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm1022_reset)
+ .popsection
+
+/*
+ * cpu_arm1022_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm1022_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+ .align 5
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm1022_flush_icache_all)
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+#endif
+ mov pc, lr
+ENDPROC(arm1022_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(arm1022_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm1022_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 16 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 15 to 0
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags for this space
+ */
+ENTRY(arm1022_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1022_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1022_coherent_user_range)
+ mov ip, #0
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm1022_flush_kern_dcache_area)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1022_dma_inv_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1022_dma_clean_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1022_dma_flush_range)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1022_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm1022_dma_clean_range
+ bcs arm1022_dma_inv_range
+ b arm1022_dma_flush_range
+ENDPROC(arm1022_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1022_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm1022_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm1022
+
+ .align 5
+ENTRY(cpu_arm1022_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mov ip, #0
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm1022_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm1022_switch_mm)
+#ifdef CONFIG_MMU
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 16 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 15 to 0
+#endif
+ mov r1, #0
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r1, c7, c5, 0 @ invalidate I cache
+#endif
+ mcr p15, 0, r1, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, r1, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm1022_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm1022_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __arm1022_setup, #function
+__arm1022_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+ adr r5, arm1022_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x4000 @ .R..............
+#endif
+ mov pc, lr
+ .size __arm1022_setup, . - __arm1022_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 1001 ..11 0101
+ *
+ */
+ .type arm1022_crval, #object
+arm1022_crval:
+ crval clear=0x00007f3f, mmuset=0x00003935, ucset=0x00001930
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm1022, dabort=v4t_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5"
+ string cpu_arm1022_name, "ARM1022"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm1022_proc_info,#object
+__arm1022_proc_info:
+ .long 0x4105a220 @ ARM 1022E (v5TE)
+ .long 0xff0ffff0
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm1022_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB | HWCAP_EDSP
+ .long cpu_arm1022_name
+ .long arm1022_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long arm1022_cache_fns
+ .size __arm1022_proc_info, . - __arm1022_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1026.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1026.S
new file mode 100644
index 0000000..3eb9c3c
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm1026.S
@@ -0,0 +1,467 @@
+/*
+ * linux/arch/arm/mm/proc-arm1026.S: MMU functions for ARM1026EJ-S
+ *
+ * Copyright (C) 2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the ARM1026EJ-S.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be invalidated
+ * using the single invalidate entry instructions. Anything larger
+ * than this, and we go for the whole cache.
+ *
+ * This value should be chosen such that we choose the cheapest
+ * alternative.
+ */
+#define MAX_AREA_SIZE 32768
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 16
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ */
+#define CACHE_DLIMIT 32768
+
+ .text
+/*
+ * cpu_arm1026_proc_init()
+ */
+ENTRY(cpu_arm1026_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm1026_proc_fin()
+ */
+ENTRY(cpu_arm1026_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm1026_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm1026_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm1026_reset)
+ .popsection
+
+/*
+ * cpu_arm1026_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm1026_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+ .align 5
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm1026_flush_icache_all)
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+#endif
+ mov pc, lr
+ENDPROC(arm1026_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(arm1026_flush_user_cache_all)
+ /* FALLTHROUGH */
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm1026_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+1: mrc p15, 0, r15, c7, c14, 3 @ test, clean, invalidate
+ bne 1b
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags for this space
+ */
+ENTRY(arm1026_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ tst r2, #VM_EXEC
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+#endif
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1026_coherent_kern_range)
+ /* FALLTHROUGH */
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1026_coherent_user_range)
+ mov ip, #0
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm1026_flush_kern_dcache_area)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1026_dma_inv_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm1026_dma_clean_range:
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm1026_dma_flush_range)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1026_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm1026_dma_clean_range
+ bcs arm1026_dma_inv_range
+ b arm1026_dma_flush_range
+ENDPROC(arm1026_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm1026_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm1026_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm1026
+
+ .align 5
+ENTRY(cpu_arm1026_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mov ip, #0
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm1026_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm1026_switch_mm)
+#ifdef CONFIG_MMU
+ mov r1, #0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+1: mrc p15, 0, r15, c7, c14, 3 @ test, clean, invalidate
+ bne 1b
+#endif
+#ifndef CONFIG_CPU_ICACHE_DISABLE
+ mcr p15, 0, r1, c7, c5, 0 @ invalidate I cache
+#endif
+ mcr p15, 0, r1, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, r1, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm1026_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm1026_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+#ifndef CONFIG_CPU_DCACHE_DISABLE
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+
+ __CPUINIT
+
+ .type __arm1026_setup, #function
+__arm1026_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+ mcr p15, 0, r4, c2, c0 @ load page table pointer
+#endif
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r0, #4 @ explicitly disable writeback
+ mcr p15, 7, r0, c15, c0, 0
+#endif
+ adr r5, arm1026_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x4000 @ .R.. .... .... ....
+#endif
+ mov pc, lr
+ .size __arm1026_setup, . - __arm1026_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 1001 ..11 0101
+ *
+ */
+ .type arm1026_crval, #object
+arm1026_crval:
+ crval clear=0x00007f3f, mmuset=0x00003935, ucset=0x00001934
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm1026, dabort=v5t_early_abort, pabort=legacy_pabort
+
+ .section .rodata
+
+ string cpu_arch_name, "armv5tej"
+ string cpu_elf_name, "v5"
+ .align
+ string cpu_arm1026_name, "ARM1026EJ-S"
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm1026_proc_info,#object
+__arm1026_proc_info:
+ .long 0x4106a260 @ ARM 1026EJ-S (v5TEJ)
+ .long 0xff0ffff0
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm1026_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP|HWCAP_JAVA
+ .long cpu_arm1026_name
+ .long arm1026_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long arm1026_cache_fns
+ .size __arm1026_proc_info, . - __arm1026_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm6_7.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm6_7.S
new file mode 100644
index 0000000..4fbeb5b
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm6_7.S
@@ -0,0 +1,327 @@
+/*
+ * linux/arch/arm/mm/proc-arm6,7.S
+ *
+ * Copyright (C) 1997-2000 Russell King
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the ARM610 & ARM710.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+ENTRY(cpu_arm6_dcache_clean_area)
+ENTRY(cpu_arm7_dcache_clean_area)
+ mov pc, lr
+
+/*
+ * Function: arm6_7_data_abort ()
+ *
+ * Params : r2 = pt_regs
+ * : r4 = aborted context pc
+ * : r5 = aborted context psr
+ *
+ * Purpose : obtain information about current aborted instruction
+ *
+ * Returns : r4-r5, r10-r11, r13 preserved
+ */
+
+ENTRY(cpu_arm7_data_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ ldr r8, [r4] @ read arm instruction
+ tst r8, #1 << 20 @ L = 0 -> write?
+ orreq r1, r1, #1 << 11 @ yes.
+ and r7, r8, #15 << 24
+ add pc, pc, r7, lsr #22 @ Now branch to the relevant processing routine
+ nop
+
+/* 0 */ b .data_unknown
+/* 1 */ b do_DataAbort @ swp
+/* 2 */ b .data_unknown
+/* 3 */ b .data_unknown
+/* 4 */ b .data_arm_lateldrpostconst @ ldr rd, [rn], #m
+/* 5 */ b .data_arm_lateldrpreconst @ ldr rd, [rn, #m]
+/* 6 */ b .data_arm_lateldrpostreg @ ldr rd, [rn], rm
+/* 7 */ b .data_arm_lateldrprereg @ ldr rd, [rn, rm]
+/* 8 */ b .data_arm_ldmstm @ ldm*a rn, <rlist>
+/* 9 */ b .data_arm_ldmstm @ ldm*b rn, <rlist>
+/* a */ b .data_unknown
+/* b */ b .data_unknown
+/* c */ b do_DataAbort @ ldc rd, [rn], #m @ Same as ldr rd, [rn], #m
+/* d */ b do_DataAbort @ ldc rd, [rn, #m]
+/* e */ b .data_unknown
+/* f */
+.data_unknown: @ Part of jumptable
+ mov r0, r4
+ mov r1, r8
+ b baddataabort
+
+ENTRY(cpu_arm6_data_abort)
+ mrc p15, 0, r1, c5, c0, 0 @ get FSR
+ mrc p15, 0, r0, c6, c0, 0 @ get FAR
+ ldr r8, [r4] @ read arm instruction
+ tst r8, #1 << 20 @ L = 0 -> write?
+ orreq r1, r1, #1 << 11 @ yes.
+ and r7, r8, #14 << 24
+ teq r7, #8 << 24 @ was it ldm/stm
+ bne do_DataAbort
+
+.data_arm_ldmstm:
+ tst r8, #1 << 21 @ check writeback bit
+ beq do_DataAbort @ no writeback -> no fixup
+ mov r7, #0x11
+ orr r7, r7, #0x1100
+ and r6, r8, r7
+ and r9, r8, r7, lsl #1
+ add r6, r6, r9, lsr #1
+ and r9, r8, r7, lsl #2
+ add r6, r6, r9, lsr #2
+ and r9, r8, r7, lsl #3
+ add r6, r6, r9, lsr #3
+ add r6, r6, r6, lsr #8
+ add r6, r6, r6, lsr #4
+ and r6, r6, #15 @ r6 = no. of registers to transfer.
+ and r9, r8, #15 << 16 @ Extract 'n' from instruction
+ ldr r7, [r2, r9, lsr #14] @ Get register 'Rn'
+ tst r8, #1 << 23 @ Check U bit
+ subne r7, r7, r6, lsl #2 @ Undo increment
+ addeq r7, r7, r6, lsl #2 @ Undo decrement
+ str r7, [r2, r9, lsr #14] @ Put register 'Rn'
+ b do_DataAbort
+
+.data_arm_apply_r6_and_rn:
+ and r9, r8, #15 << 16 @ Extract 'n' from instruction
+ ldr r7, [r2, r9, lsr #14] @ Get register 'Rn'
+ tst r8, #1 << 23 @ Check U bit
+ subne r7, r7, r6 @ Undo incrmenet
+ addeq r7, r7, r6 @ Undo decrement
+ str r7, [r2, r9, lsr #14] @ Put register 'Rn'
+ b do_DataAbort
+
+.data_arm_lateldrpreconst:
+ tst r8, #1 << 21 @ check writeback bit
+ beq do_DataAbort @ no writeback -> no fixup
+.data_arm_lateldrpostconst:
+ movs r6, r8, lsl #20 @ Get offset
+ beq do_DataAbort @ zero -> no fixup
+ and r9, r8, #15 << 16 @ Extract 'n' from instruction
+ ldr r7, [r2, r9, lsr #14] @ Get register 'Rn'
+ tst r8, #1 << 23 @ Check U bit
+ subne r7, r7, r6, lsr #20 @ Undo increment
+ addeq r7, r7, r6, lsr #20 @ Undo decrement
+ str r7, [r2, r9, lsr #14] @ Put register 'Rn'
+ b do_DataAbort
+
+.data_arm_lateldrprereg:
+ tst r8, #1 << 21 @ check writeback bit
+ beq do_DataAbort @ no writeback -> no fixup
+.data_arm_lateldrpostreg:
+ and r7, r8, #15 @ Extract 'm' from instruction
+ ldr r6, [r2, r7, lsl #2] @ Get register 'Rm'
+ mov r9, r8, lsr #7 @ get shift count
+ ands r9, r9, #31
+ and r7, r8, #0x70 @ get shift type
+ orreq r7, r7, #8 @ shift count = 0
+ add pc, pc, r7
+ nop
+
+ mov r6, r6, lsl r9 @ 0: LSL #!0
+ b .data_arm_apply_r6_and_rn
+ b .data_arm_apply_r6_and_rn @ 1: LSL #0
+ nop
+ b .data_unknown @ 2: MUL?
+ nop
+ b .data_unknown @ 3: MUL?
+ nop
+ mov r6, r6, lsr r9 @ 4: LSR #!0
+ b .data_arm_apply_r6_and_rn
+ mov r6, r6, lsr #32 @ 5: LSR #32
+ b .data_arm_apply_r6_and_rn
+ b .data_unknown @ 6: MUL?
+ nop
+ b .data_unknown @ 7: MUL?
+ nop
+ mov r6, r6, asr r9 @ 8: ASR #!0
+ b .data_arm_apply_r6_and_rn
+ mov r6, r6, asr #32 @ 9: ASR #32
+ b .data_arm_apply_r6_and_rn
+ b .data_unknown @ A: MUL?
+ nop
+ b .data_unknown @ B: MUL?
+ nop
+ mov r6, r6, ror r9 @ C: ROR #!0
+ b .data_arm_apply_r6_and_rn
+ mov r6, r6, rrx @ D: RRX
+ b .data_arm_apply_r6_and_rn
+ b .data_unknown @ E: MUL?
+ nop
+ b .data_unknown @ F: MUL?
+
+/*
+ * Function: arm6_7_proc_init (void)
+ * : arm6_7_proc_fin (void)
+ *
+ * Notes : This processor does not require these
+ */
+ENTRY(cpu_arm6_proc_init)
+ENTRY(cpu_arm7_proc_init)
+ mov pc, lr
+
+ENTRY(cpu_arm6_proc_fin)
+ENTRY(cpu_arm7_proc_fin)
+ mov r0, #0x31 @ ....S..DP...M
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+ENTRY(cpu_arm6_do_idle)
+ENTRY(cpu_arm7_do_idle)
+ mov pc, lr
+
+/*
+ * Function: arm6_7_switch_mm(unsigned long pgd_phys)
+ * Params : pgd_phys Physical address of page table
+ * Purpose : Perform a task switch, saving the old processes state, and restoring
+ * the new.
+ */
+ENTRY(cpu_arm6_switch_mm)
+ENTRY(cpu_arm7_switch_mm)
+#ifdef CONFIG_MMU
+ mov r1, #0
+ mcr p15, 0, r1, c7, c0, 0 @ flush cache
+ mcr p15, 0, r0, c2, c0, 0 @ update page table ptr
+ mcr p15, 0, r1, c5, c0, 0 @ flush TLBs
+#endif
+ mov pc, lr
+
+/*
+ * Function: arm6_7_set_pte_ext(pte_t *ptep, pte_t pte, unsigned int ext)
+ * Params : r0 = Address to set
+ * : r1 = value to set
+ * Purpose : Set a PTE and flush it out of any WB cache
+ */
+ .align 5
+ENTRY(cpu_arm6_set_pte_ext)
+ENTRY(cpu_arm7_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext wc_disable=0
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+/*
+ * Function: _arm6_7_reset
+ * Params : r0 = address to jump to
+ * Notes : This sets up everything for a reset
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm6_reset)
+ENTRY(cpu_arm7_reset)
+ mov r1, #0
+ mcr p15, 0, r1, c7, c0, 0 @ flush cache
+#ifdef CONFIG_MMU
+ mcr p15, 0, r1, c5, c0, 0 @ flush TLB
+#endif
+ mov r1, #0x30
+ mcr p15, 0, r1, c1, c0, 0 @ turn off MMU etc
+ mov pc, r0
+ENDPROC(cpu_arm6_reset)
+ENDPROC(cpu_arm7_reset)
+ .popsection
+
+ __CPUINIT
+
+ .type __arm6_setup, #function
+__arm6_setup: mov r0, #0
+ mcr p15, 0, r0, c7, c0 @ flush caches on v3
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c5, c0 @ flush TLBs on v3
+ mov r0, #0x3d @ . ..RS BLDP WCAM
+ orr r0, r0, #0x100 @ . ..01 0011 1101
+#else
+ mov r0, #0x3c @ . ..RS BLDP WCA.
+#endif
+ mov pc, lr
+ .size __arm6_setup, . - __arm6_setup
+
+ .type __arm7_setup, #function
+__arm7_setup: mov r0, #0
+ mcr p15, 0, r0, c7, c0 @ flush caches on v3
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c5, c0 @ flush TLBs on v3
+ mcr p15, 0, r0, c3, c0 @ load domain access register
+ mov r0, #0x7d @ . ..RS BLDP WCAM
+ orr r0, r0, #0x100 @ . ..01 0111 1101
+#else
+ mov r0, #0x7c @ . ..RS BLDP WCA.
+#endif
+ mov pc, lr
+ .size __arm7_setup, . - __arm7_setup
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm6, dabort=cpu_arm6_data_abort, pabort=legacy_pabort
+ define_processor_functions arm7, dabort=cpu_arm7_data_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv3"
+ string cpu_elf_name, "v3"
+ string cpu_arm6_name, "ARM6"
+ string cpu_arm610_name, "ARM610"
+ string cpu_arm7_name, "ARM7"
+ string cpu_arm710_name, "ARM710"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro arm67_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req, \
+ cpu_mm_mmu_flags:req, cpu_flush:req, cpu_proc_funcs:req
+ .type __\name\()_proc_info, #object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long \cpu_mm_mmu_flags
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b \cpu_flush
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_26BIT
+ .long \cpu_name
+ .long \cpu_proc_funcs
+ .long v3_tlb_fns
+ .long v3_user_fns
+ .long v3_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ arm67_proc_info arm6, 0x41560600, 0xfffffff0, cpu_arm6_name, \
+ 0x00000c1e, __arm6_setup, arm6_processor_functions
+ arm67_proc_info arm610, 0x41560610, 0xfffffff0, cpu_arm610_name, \
+ 0x00000c1e, __arm6_setup, arm6_processor_functions
+ arm67_proc_info arm7, 0x41007000, 0xffffff00, cpu_arm7_name, \
+ 0x00000c1e, __arm7_setup, arm7_processor_functions
+ arm67_proc_info arm710, 0x41007100, 0xfff8ff00, cpu_arm710_name, \
+ PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ, \
+ __arm7_setup, arm7_processor_functions
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm720.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm720.S
new file mode 100644
index 0000000..0ac908c
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm720.S
@@ -0,0 +1,221 @@
+/*
+ * linux/arch/arm/mm/proc-arm720.S: MMU functions for ARM720
+ *
+ * Copyright (C) 2000 Steve Hill (sjhill@cotw.com)
+ * Rob Scott (rscott@mtrob.fdns.net)
+ * Copyright (C) 2000 ARM Limited, Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2004.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the ARM720T. The ARM720T has a writethrough IDC
+ * cache, so we don't need to clean it.
+ *
+ * Changelog:
+ * 05-09-2000 SJH Created by moving 720 specific functions
+ * out of 'proc-arm6,7.S' per RMK discussion
+ * 07-25-2000 SJH Added idle function.
+ * 08-25-2000 DBS Updated for integration of ARM Ltd version.
+ * 04-20-2004 HSC modified for non-paged memory management mode.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+/*
+ * Function: arm720_proc_init (void)
+ * : arm720_proc_fin (void)
+ *
+ * Notes : This processor does not require these
+ */
+ENTRY(cpu_arm720_dcache_clean_area)
+ENTRY(cpu_arm720_proc_init)
+ mov pc, lr
+
+ENTRY(cpu_arm720_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * Function: arm720_proc_do_idle(void)
+ * Params : r0 = unused
+ * Purpose : put the processor in proper idle mode
+ */
+ENTRY(cpu_arm720_do_idle)
+ mov pc, lr
+
+/*
+ * Function: arm720_switch_mm(unsigned long pgd_phys)
+ * Params : pgd_phys Physical address of page table
+ * Purpose : Perform a task switch, saving the old process' state and restoring
+ * the new.
+ */
+ENTRY(cpu_arm720_switch_mm)
+#ifdef CONFIG_MMU
+ mov r1, #0
+ mcr p15, 0, r1, c7, c7, 0 @ invalidate cache
+ mcr p15, 0, r0, c2, c0, 0 @ update page table ptr
+ mcr p15, 0, r1, c8, c7, 0 @ flush TLB (v4)
+#endif
+ mov pc, lr
+
+/*
+ * Function: arm720_set_pte_ext(pte_t *ptep, pte_t pte, unsigned int ext)
+ * Params : r0 = Address to set
+ * : r1 = value to set
+ * Purpose : Set a PTE and flush it out of any WB cache
+ */
+ .align 5
+ENTRY(cpu_arm720_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext wc_disable=0
+#endif
+ mov pc, lr
+
+/*
+ * Function: arm720_reset
+ * Params : r0 = address to jump to
+ * Notes : This sets up everything for a reset
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm720_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate cache
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ flush TLB (v4)
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ get ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x2100 @ ..v....s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm720_reset)
+ .popsection
+
+ __CPUINIT
+
+ .type __arm710_setup, #function
+__arm710_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7, 0 @ invalidate caches
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7, 0 @ flush TLB (v4)
+#endif
+ mrc p15, 0, r0, c1, c0 @ get control register
+ ldr r5, arm710_cr1_clear
+ bic r0, r0, r5
+ ldr r5, arm710_cr1_set
+ orr r0, r0, r5
+ mov pc, lr @ __ret (head.S)
+ .size __arm710_setup, . - __arm710_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .... 0001 ..11 1101
+ *
+ */
+ .type arm710_cr1_clear, #object
+ .type arm710_cr1_set, #object
+arm710_cr1_clear:
+ .word 0x0f3f
+arm710_cr1_set:
+ .word 0x013d
+
+ .type __arm720_setup, #function
+__arm720_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7, 0 @ invalidate caches
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7, 0 @ flush TLB (v4)
+#endif
+ adr r5, arm720_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr @ __ret (head.S)
+ .size __arm720_setup, . - __arm720_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * ..1. 1001 ..11 1101
+ *
+ */
+ .type arm720_crval, #object
+arm720_crval:
+ crval clear=0x00002f3f, mmuset=0x0000213d, ucset=0x00000130
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm720, dabort=v4t_late_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm710_name, "ARM710T"
+ string cpu_arm720_name, "ARM720T"
+
+ .align
+
+/*
+ * See <asm/procinfo.h> for a definition of this structure.
+ */
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro arm720_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req, cpu_flush:req
+ .type __\name\()_proc_info,#object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b \cpu_flush @ cpu_flush
+ .long cpu_arch_name @ arch_name
+ .long cpu_elf_name @ elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB @ elf_hwcap
+ .long \cpu_name
+ .long arm720_processor_functions
+ .long v4_tlb_fns
+ .long v4wt_user_fns
+ .long v4_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ arm720_proc_info arm710, 0x41807100, 0xffffff00, cpu_arm710_name, __arm710_setup
+ arm720_proc_info arm720, 0x41807200, 0xffffff00, cpu_arm720_name, __arm720_setup
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm740.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm740.S
new file mode 100644
index 0000000..dc5de5d
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm740.S
@@ -0,0 +1,149 @@
+/*
+ * linux/arch/arm/mm/arm740.S: utility functions for ARM740
+ *
+ * Copyright (C) 2004-2006 Hyok S. Choi (hyok.choi@samsung.com)
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+ .text
+/*
+ * cpu_arm740_proc_init()
+ * cpu_arm740_do_idle()
+ * cpu_arm740_dcache_clean_area()
+ * cpu_arm740_switch_mm()
+ *
+ * These are not required.
+ */
+ENTRY(cpu_arm740_proc_init)
+ENTRY(cpu_arm740_do_idle)
+ENTRY(cpu_arm740_dcache_clean_area)
+ENTRY(cpu_arm740_switch_mm)
+ mov pc, lr
+
+/*
+ * cpu_arm740_proc_fin()
+ */
+ENTRY(cpu_arm740_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0
+ bic r0, r0, #0x3f000000 @ bank/f/lock/s
+ bic r0, r0, #0x0000000c @ w-buffer/cache
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm740_reset(loc)
+ * Params : r0 = address to jump to
+ * Notes : This sets up everything for a reset
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm740_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c0, 0 @ invalidate cache
+ mrc p15, 0, ip, c1, c0, 0 @ get ctrl register
+ bic ip, ip, #0x0000000c @ ............wc..
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm740_reset)
+ .popsection
+
+ __CPUINIT
+
+ .type __arm740_setup, #function
+__arm740_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c0, 0 @ invalidate caches
+
+ mcr p15, 0, r0, c6, c3 @ disable area 3~7
+ mcr p15, 0, r0, c6, c4
+ mcr p15, 0, r0, c6, c5
+ mcr p15, 0, r0, c6, c6
+ mcr p15, 0, r0, c6, c7
+
+ mov r0, #0x0000003F @ base = 0, size = 4GB
+ mcr p15, 0, r0, c6, c0 @ set area 0, default
+
+ ldr r0, =(CONFIG_DRAM_BASE & 0xFFFFF000) @ base[31:12] of RAM
+ ldr r1, =(CONFIG_DRAM_SIZE >> 12) @ size of RAM (must be >= 4KB)
+ mov r2, #10 @ 11 is the minimum (4KB)
+1: add r2, r2, #1 @ area size *= 2
+ mov r1, r1, lsr #1
+ bne 1b @ count not zero r-shift
+ orr r0, r0, r2, lsl #1 @ the area register value
+ orr r0, r0, #1 @ set enable bit
+ mcr p15, 0, r0, c6, c1 @ set area 1, RAM
+
+ ldr r0, =(CONFIG_FLASH_MEM_BASE & 0xFFFFF000) @ base[31:12] of FLASH
+ ldr r1, =(CONFIG_FLASH_SIZE >> 12) @ size of FLASH (must be >= 4KB)
+ mov r2, #10 @ 11 is the minimum (4KB)
+1: add r2, r2, #1 @ area size *= 2
+ mov r1, r1, lsr #1
+ bne 1b @ count not zero r-shift
+ orr r0, r0, r2, lsl #1 @ the area register value
+ orr r0, r0, #1 @ set enable bit
+ mcr p15, 0, r0, c6, c2 @ set area 2, ROM/FLASH
+
+ mov r0, #0x06
+ mcr p15, 0, r0, c2, c0 @ Region 1&2 cacheable
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r0, #0x00 @ disable whole write buffer
+#else
+ mov r0, #0x02 @ Region 1 write bufferred
+#endif
+ mcr p15, 0, r0, c3, c0
+
+ mov r0, #0x10000
+ sub r0, r0, #1 @ r0 = 0xffff
+ mcr p15, 0, r0, c5, c0 @ all read/write access
+
+ mrc p15, 0, r0, c1, c0 @ get control register
+ bic r0, r0, #0x3F000000 @ set to standard caching mode
+ @ need some benchmark
+ orr r0, r0, #0x0000000d @ MPU/Cache/WB
+
+ mov pc, lr
+
+ .size __arm740_setup, . - __arm740_setup
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm740, dabort=v4t_late_abort, pabort=legacy_pabort, nommu=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4"
+ string cpu_elf_name, "v4"
+ string cpu_arm740_name, "ARM740T"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+ .type __arm740_proc_info,#object
+__arm740_proc_info:
+ .long 0x41807400
+ .long 0xfffffff0
+ .long 0
+ b __arm740_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_26BIT
+ .long cpu_arm740_name
+ .long arm740_processor_functions
+ .long 0
+ .long 0
+ .long v3_cache_fns @ cache model
+ .size __arm740_proc_info, . - __arm740_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm7tdmi.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm7tdmi.S
new file mode 100644
index 0000000..6ddea3e
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm7tdmi.S
@@ -0,0 +1,116 @@
+/*
+ * linux/arch/arm/mm/proc-arm7tdmi.S: utility functions for ARM7TDMI
+ *
+ * Copyright (C) 2003-2006 Hyok S. Choi <hyok.choi@samsung.com>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+ .text
+/*
+ * cpu_arm7tdmi_proc_init()
+ * cpu_arm7tdmi_do_idle()
+ * cpu_arm7tdmi_dcache_clean_area()
+ * cpu_arm7tdmi_switch_mm()
+ *
+ * These are not required.
+ */
+ENTRY(cpu_arm7tdmi_proc_init)
+ENTRY(cpu_arm7tdmi_do_idle)
+ENTRY(cpu_arm7tdmi_dcache_clean_area)
+ENTRY(cpu_arm7tdmi_switch_mm)
+ mov pc, lr
+
+/*
+ * cpu_arm7tdmi_proc_fin()
+ */
+ENTRY(cpu_arm7tdmi_proc_fin)
+ mov pc, lr
+
+/*
+ * Function: cpu_arm7tdmi_reset(loc)
+ * Params : loc(r0) address to jump to
+ * Purpose : Sets up everything for a reset and jump to the location for soft reset.
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm7tdmi_reset)
+ mov pc, r0
+ENDPROC(cpu_arm7tdmi_reset)
+ .popsection
+
+ __CPUINIT
+
+ .type __arm7tdmi_setup, #function
+__arm7tdmi_setup:
+ mov pc, lr
+ .size __arm7tdmi_setup, . - __arm7tdmi_setup
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm7tdmi, dabort=v4t_late_abort, pabort=legacy_pabort, nommu=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm7tdmi_name, "ARM7TDMI"
+ string cpu_triscenda7_name, "Triscend-A7x"
+ string cpu_at91_name, "Atmel-AT91M40xxx"
+ string cpu_s3c3410_name, "Samsung-S3C3410"
+ string cpu_s3c44b0x_name, "Samsung-S3C44B0x"
+ string cpu_s3c4510b_name, "Samsung-S3C4510B"
+ string cpu_s3c4530_name, "Samsung-S3C4530"
+ string cpu_netarm_name, "NETARM"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro arm7tdmi_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req, \
+ extra_hwcaps=0
+ .type __\name\()_proc_info, #object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long 0
+ .long 0
+ b __arm7tdmi_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_26BIT | ( \extra_hwcaps )
+ .long \cpu_name
+ .long arm7tdmi_processor_functions
+ .long 0
+ .long 0
+ .long v4_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ arm7tdmi_proc_info arm7tdmi, 0x41007700, 0xfff8ff00, \
+ cpu_arm7tdmi_name
+ arm7tdmi_proc_info triscenda7, 0x0001d2ff, 0x0001ffff, \
+ cpu_triscenda7_name, extra_hwcaps=HWCAP_THUMB
+ arm7tdmi_proc_info at91, 0x14000040, 0xfff000e0, \
+ cpu_at91_name, extra_hwcaps=HWCAP_THUMB
+ arm7tdmi_proc_info s3c4510b, 0x36365000, 0xfffff000, \
+ cpu_s3c4510b_name, extra_hwcaps=HWCAP_THUMB
+ arm7tdmi_proc_info s3c4530, 0x4c000000, 0xfff000e0, \
+ cpu_s3c4530_name, extra_hwcaps=HWCAP_THUMB
+ arm7tdmi_proc_info s3c3410, 0x34100000, 0xffff0000, \
+ cpu_s3c3410_name, extra_hwcaps=HWCAP_THUMB
+ arm7tdmi_proc_info s3c44b0x, 0x44b00000, 0xffff0000, \
+ cpu_s3c44b0x_name, extra_hwcaps=HWCAP_THUMB
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm920.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm920.S
new file mode 100644
index 0000000..aeeb126
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm920.S
@@ -0,0 +1,478 @@
+/*
+ * linux/arch/arm/mm/proc-arm920.S: MMU functions for ARM920
+ *
+ * Copyright (C) 1999,2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the arm920.
+ *
+ * CONFIG_CPU_ARM920_CPU_IDLE -> nohlt
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 8
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ */
+#define CACHE_DLIMIT 65536
+
+
+ .text
+/*
+ * cpu_arm920_proc_init()
+ */
+ENTRY(cpu_arm920_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm920_proc_fin()
+ */
+ENTRY(cpu_arm920_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm920_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm920_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm920_reset)
+ .popsection
+
+/*
+ * cpu_arm920_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm920_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm920_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(arm920_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(arm920_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm920_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 8 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 7 to 0
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags for address space
+ */
+ENTRY(arm920_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm920_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm920_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm920_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm920_dma_inv_range:
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm920_dma_clean_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm920_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm920_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm920_dma_clean_range
+ bcs arm920_dma_inv_range
+ b arm920_dma_flush_range
+ENDPROC(arm920_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm920_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm920_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm920
+#endif
+
+
+ENTRY(cpu_arm920_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm920_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm920_switch_mm)
+#ifdef CONFIG_MMU
+ mov ip, #0
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+@ && 'Clean & Invalidate whole DCache'
+@ && Re-written to use Index Ops.
+@ && Uses registers r1, r3 and ip
+
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 8 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean & invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 7 to 0
+#endif
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm920_set_pte(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm920_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+ mov pc, lr
+
+/* Suspend/resume support: taken from arch/arm/plat-s3c24xx/sleep.S */
+.globl cpu_arm920_suspend_size
+.equ cpu_arm920_suspend_size, 4 * 3
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_arm920_do_suspend)
+ stmfd sp!, {r4 - r6, lr}
+ mrc p15, 0, r4, c13, c0, 0 @ PID
+ mrc p15, 0, r5, c3, c0, 0 @ Domain ID
+ mrc p15, 0, r6, c1, c0, 0 @ Control register
+ stmia r0, {r4 - r6}
+ ldmfd sp!, {r4 - r6, pc}
+ENDPROC(cpu_arm920_do_suspend)
+
+ENTRY(cpu_arm920_do_resume)
+ mov ip, #0
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I+D TLBs
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I+D caches
+ ldmia r0, {r4 - r6}
+ mcr p15, 0, r4, c13, c0, 0 @ PID
+ mcr p15, 0, r5, c3, c0, 0 @ Domain ID
+ mcr p15, 0, r1, c2, c0, 0 @ TTB address
+ mov r0, r6 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_arm920_do_resume)
+#endif
+
+ __CPUINIT
+
+ .type __arm920_setup, #function
+__arm920_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+ adr r5, arm920_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+ .size __arm920_setup, . - __arm920_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * ..11 0001 ..11 0101
+ *
+ */
+ .type arm920_crval, #object
+arm920_crval:
+ crval clear=0x00003f3f, mmuset=0x00003135, ucset=0x00001130
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm920, dabort=v4t_early_abort, pabort=legacy_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm920_name, "ARM920T"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm920_proc_info,#object
+__arm920_proc_info:
+ .long 0x41009200
+ .long 0xff00fff0
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm920_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB
+ .long cpu_arm920_name
+ .long arm920_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ .long arm920_cache_fns
+#else
+ .long v4wt_cache_fns
+#endif
+ .size __arm920_proc_info, . - __arm920_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm922.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm922.S
new file mode 100644
index 0000000..4ec0e07
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm922.S
@@ -0,0 +1,456 @@
+/*
+ * linux/arch/arm/mm/proc-arm922.S: MMU functions for ARM922
+ *
+ * Copyright (C) 1999,2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * Copyright (C) 2001 Altera Corporation
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the arm922.
+ *
+ * CONFIG_CPU_ARM922_CPU_IDLE -> nohlt
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 4
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 64
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions. (I think this should
+ * be 32768).
+ */
+#define CACHE_DLIMIT 8192
+
+
+ .text
+/*
+ * cpu_arm922_proc_init()
+ */
+ENTRY(cpu_arm922_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm922_proc_fin()
+ */
+ENTRY(cpu_arm922_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm922_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm922_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm922_reset)
+ .popsection
+
+/*
+ * cpu_arm922_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm922_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm922_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(arm922_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular
+ * address space.
+ */
+ENTRY(arm922_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm922_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 8 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 7 to 0
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the
+ * specified address range.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ */
+ENTRY(arm922_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm922_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm922_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm922_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm922_dma_inv_range:
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm922_dma_clean_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm922_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm922_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm922_dma_clean_range
+ bcs arm922_dma_inv_range
+ b arm922_dma_flush_range
+ENDPROC(arm922_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm922_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm922_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm922
+#endif
+
+
+ENTRY(cpu_arm922_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm922_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm922_switch_mm)
+#ifdef CONFIG_MMU
+ mov ip, #0
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+@ && 'Clean & Invalidate whole DCache'
+@ && Re-written to use Index Ops.
+@ && Uses registers r1, r3 and ip
+
+ mov r1, #(CACHE_DSEGMENTS - 1) << 5 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean & invalidate D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 5
+ bcs 1b @ segments 7 to 0
+#endif
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm922_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm922_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __arm922_setup, #function
+__arm922_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+ adr r5, arm922_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+ .size __arm922_setup, . - __arm922_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * ..11 0001 ..11 0101
+ *
+ */
+ .type arm922_crval, #object
+arm922_crval:
+ crval clear=0x00003f3f, mmuset=0x00003135, ucset=0x00001130
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm922, dabort=v4t_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm922_name, "ARM922T"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm922_proc_info,#object
+__arm922_proc_info:
+ .long 0x41009220
+ .long 0xff00fff0
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm922_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB
+ .long cpu_arm922_name
+ .long arm922_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ .long arm922_cache_fns
+#else
+ .long v4wt_cache_fns
+#endif
+ .size __arm922_proc_info, . - __arm922_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm925.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm925.S
new file mode 100644
index 0000000..9dccd9a
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm925.S
@@ -0,0 +1,523 @@
+/*
+ * linux/arch/arm/mm/arm925.S: MMU functions for ARM925
+ *
+ * Copyright (C) 1999,2000 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * Copyright (C) 2002 RidgeRun, Inc.
+ * Copyright (C) 2002-2003 MontaVista Software, Inc.
+ *
+ * Update for Linux-2.6 and cache flush improvements
+ * Copyright (C) 2004 Nokia Corporation by Tony Lindgren <tony@atomide.com>
+ *
+ * hacked for non-paged-MM by Hyok S. Choi, 2004.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the arm925.
+ *
+ * CONFIG_CPU_ARM925_CPU_IDLE -> nohlt
+ *
+ * Some additional notes based on deciphering the TI TRM on OMAP-5910:
+ *
+ * NOTE1: The TI925T Configuration Register bit "D-cache clean and flush
+ * entry mode" must be 0 to flush the entries in both segments
+ * at once. This is the default value. See TRM 2-20 and 2-24 for
+ * more information.
+ *
+ * NOTE2: Default is the "D-cache clean and flush entry mode". It looks
+ * like the "Transparent mode" must be on for partial cache flushes
+ * to work in this mode. This mode only works with 16-bit external
+ * memory. See TRM 2-24 for more information.
+ *
+ * NOTE3: Write-back cache flushing seems to be flakey with devices using
+ * direct memory access, such as USB OHCI. The workaround is to use
+ * write-through cache with CONFIG_CPU_DCACHE_WRITETHROUGH (this is
+ * the default for OMAP-1510).
+ */
+
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * The size of one data cache line.
+ */
+#define CACHE_DLINESIZE 16
+
+/*
+ * The number of data cache segments.
+ */
+#define CACHE_DSEGMENTS 2
+
+/*
+ * The number of lines in a cache segment.
+ */
+#define CACHE_DENTRIES 256
+
+/*
+ * This is the size at which it becomes more efficient to
+ * clean the whole cache, rather than using the individual
+ * cache line maintenance instructions.
+ */
+#define CACHE_DLIMIT 8192
+
+ .text
+/*
+ * cpu_arm925_proc_init()
+ */
+ENTRY(cpu_arm925_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm925_proc_fin()
+ */
+ENTRY(cpu_arm925_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm925_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm925_reset)
+ /* Send software reset to MPU and DSP */
+ mov ip, #0xff000000
+ orr ip, ip, #0x00fe0000
+ orr ip, ip, #0x0000ce00
+ mov r4, #1
+ strh r4, [ip, #0x10]
+ENDPROC(cpu_arm925_reset)
+ .popsection
+
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+
+/*
+ * cpu_arm925_do_idle()
+ *
+ * Called with IRQs disabled
+ */
+ .align 10
+ENTRY(cpu_arm925_do_idle)
+ mov r0, #0
+ mrc p15, 0, r1, c1, c0, 0 @ Read control register
+ mcr p15, 0, r0, c7, c10, 4 @ Drain write buffer
+ bic r2, r1, #1 << 12
+ mcr p15, 0, r2, c1, c0, 0 @ Disable I cache
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mcr p15, 0, r1, c1, c0, 0 @ Restore ICache enable
+ mov pc, lr
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm925_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(arm925_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular
+ * address space.
+ */
+ENTRY(arm925_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm925_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+ /* Flush entries in both segments at once, see NOTE1 above */
+ mov r3, #(CACHE_DENTRIES - 1) << 4 @ 256 entries in segment
+2: mcr p15, 0, r3, c7, c14, 2 @ clean+invalidate D index
+ subs r3, r3, #1 << 4
+ bcs 2b @ entries 255 to 0
+#endif
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the
+ * specified address range.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ */
+ENTRY(arm925_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bgt __flush_whole_cache
+1: tst r2, #VM_EXEC
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+#else
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+#endif
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm925_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm925_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm925_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm925_dma_inv_range:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ tst r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+#endif
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm925_dma_clean_range:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm925_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+#else
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm925_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm925_dma_clean_range
+ bcs arm925_dma_inv_range
+ b arm925_dma_flush_range
+ENDPROC(arm925_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm925_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm925_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm925
+
+ENTRY(cpu_arm925_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm925_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm925_switch_mm)
+#ifdef CONFIG_MMU
+ mov ip, #0
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+ /* Flush entries in bothe segments at once, see NOTE1 above */
+ mov r3, #(CACHE_DENTRIES - 1) << 4 @ 256 entries in segment
+2: mcr p15, 0, r3, c7, c14, 2 @ clean & invalidate D index
+ subs r3, r3, #1 << 4
+ bcs 2b @ entries 255 to 0
+#endif
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm925_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm925_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif /* CONFIG_MMU */
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __arm925_setup, #function
+__arm925_setup:
+ mov r0, #0
+#if defined(CONFIG_CPU_ICACHE_STREAMING_DISABLE)
+ orr r0,r0,#1 << 7
+#endif
+
+ /* Transparent on, D-cache clean & flush mode. See NOTE2 above */
+ orr r0,r0,#1 << 1 @ transparent mode on
+ mcr p15, 0, r0, c15, c1, 0 @ write TI config register
+
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r0, #4 @ disable write-back on caches explicitly
+ mcr p15, 7, r0, c15, c0, 0
+#endif
+
+ adr r5, arm925_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x4000 @ .1.. .... .... ....
+#endif
+ mov pc, lr
+ .size __arm925_setup, . - __arm925_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 0001 ..11 1101
+ *
+ */
+ .type arm925_crval, #object
+arm925_crval:
+ crval clear=0x00007f3f, mmuset=0x0000313d, ucset=0x00001130
+
+ __INITDATA
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm925, dabort=v4t_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm925_name, "ARM925T"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro arm925_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req, cache
+ .type __\name\()_proc_info,#object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm925_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB
+ .long cpu_arm925_name
+ .long arm925_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long arm925_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ arm925_proc_info arm925, 0x54029250, 0xfffffff0, cpu_arm925_name
+ arm925_proc_info arm915, 0x54029150, 0xfffffff0, cpu_arm925_name
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm926.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm926.S
new file mode 100644
index 0000000..ee29dc4
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm926.S
@@ -0,0 +1,500 @@
+/*
+ * linux/arch/arm/mm/proc-arm926.S: MMU functions for ARM926EJ-S
+ *
+ * Copyright (C) 1999-2001 ARM Limited
+ * Copyright (C) 2000 Deep Blue Solutions Ltd.
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the arm926.
+ *
+ * CONFIG_CPU_ARM926_CPU_IDLE -> nohlt
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be invalidated
+ * using the single invalidate entry instructions. Anything larger
+ * than this, and we go for the whole cache.
+ *
+ * This value should be chosen such that we choose the cheapest
+ * alternative.
+ */
+#define CACHE_DLIMIT 16384
+
+/*
+ * the cache line size of the I and D cache
+ */
+#define CACHE_DLINESIZE 32
+
+ .text
+/*
+ * cpu_arm926_proc_init()
+ */
+ENTRY(cpu_arm926_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_arm926_proc_fin()
+ */
+ENTRY(cpu_arm926_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm926_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm926_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm926_reset)
+ .popsection
+
+/*
+ * cpu_arm926_do_idle()
+ *
+ * Called with IRQs disabled
+ */
+ .align 10
+ENTRY(cpu_arm926_do_idle)
+ mov r0, #0
+ mrc p15, 0, r1, c1, c0, 0 @ Read control register
+ mcr p15, 0, r0, c7, c10, 4 @ Drain write buffer
+ bic r2, r1, #1 << 12
+ mrs r3, cpsr @ Disable FIQs while Icache
+ orr ip, r3, #PSR_F_BIT @ is disabled
+ msr cpsr_c, ip
+ mcr p15, 0, r2, c1, c0, 0 @ Disable I cache
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mcr p15, 0, r1, c1, c0, 0 @ Restore ICache enable
+ msr cpsr_c, r3 @ Restore FIQ state
+ mov pc, lr
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm926_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(arm926_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular
+ * address space.
+ */
+ENTRY(arm926_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm926_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+1: mrc p15, 0, r15, c7, c14, 3 @ test,clean,invalidate
+ bne 1b
+#endif
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the
+ * specified address range.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ */
+ENTRY(arm926_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bgt __flush_whole_cache
+1: tst r2, #VM_EXEC
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+#else
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+#endif
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm926_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm926_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm926_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm926_dma_inv_range:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ tst r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+#endif
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+arm926_dma_clean_range:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm926_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+#else
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm926_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm926_dma_clean_range
+ bcs arm926_dma_inv_range
+ b arm926_dma_flush_range
+ENDPROC(arm926_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm926_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm926_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm926
+
+ENTRY(cpu_arm926_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_arm926_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_arm926_switch_mm)
+#ifdef CONFIG_MMU
+ mov ip, #0
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+@ && 'Clean & Invalidate whole DCache'
+1: mrc p15, 0, r15, c7, c14, 3 @ test,clean,invalidate
+ bne 1b
+#endif
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm926_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_arm926_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+ mov pc, lr
+
+/* Suspend/resume support: taken from arch/arm/plat-s3c24xx/sleep.S */
+.globl cpu_arm926_suspend_size
+.equ cpu_arm926_suspend_size, 4 * 3
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_arm926_do_suspend)
+ stmfd sp!, {r4 - r6, lr}
+ mrc p15, 0, r4, c13, c0, 0 @ PID
+ mrc p15, 0, r5, c3, c0, 0 @ Domain ID
+ mrc p15, 0, r6, c1, c0, 0 @ Control register
+ stmia r0, {r4 - r6}
+ ldmfd sp!, {r4 - r6, pc}
+ENDPROC(cpu_arm926_do_suspend)
+
+ENTRY(cpu_arm926_do_resume)
+ mov ip, #0
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I+D TLBs
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I+D caches
+ ldmia r0, {r4 - r6}
+ mcr p15, 0, r4, c13, c0, 0 @ PID
+ mcr p15, 0, r5, c3, c0, 0 @ Domain ID
+ mcr p15, 0, r1, c2, c0, 0 @ TTB address
+ mov r0, r6 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_arm926_do_resume)
+#endif
+
+ __CPUINIT
+
+ .type __arm926_setup, #function
+__arm926_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+
+
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r0, #4 @ disable write-back on caches explicitly
+ mcr p15, 7, r0, c15, c0, 0
+#endif
+
+ adr r5, arm926_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x4000 @ .1.. .... .... ....
+#endif
+ mov pc, lr
+ .size __arm926_setup, . - __arm926_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 0001 ..11 0101
+ *
+ */
+ .type arm926_crval, #object
+arm926_crval:
+ crval clear=0x00007f3f, mmuset=0x00003135, ucset=0x00001134
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm926, dabort=v5tj_early_abort, pabort=legacy_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5tej"
+ string cpu_elf_name, "v5"
+ string cpu_arm926_name, "ARM926EJ-S"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm926_proc_info,#object
+__arm926_proc_info:
+ .long 0x41069260 @ ARM926EJ-S (v5TEJ)
+ .long 0xff0ffff0
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __arm926_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP|HWCAP_JAVA
+ .long cpu_arm926_name
+ .long arm926_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long arm926_cache_fns
+ .size __arm926_proc_info, . - __arm926_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm940.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm940.S
new file mode 100644
index 0000000..9fdc0a1
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm940.S
@@ -0,0 +1,373 @@
+/*
+ * linux/arch/arm/mm/arm940.S: utility functions for ARM940T
+ *
+ * Copyright (C) 2004-2006 Hyok S. Choi (hyok.choi@samsung.com)
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/* ARM940T has a 4KB DCache comprising 256 lines of 4 words */
+#define CACHE_DLINESIZE 16
+#define CACHE_DSEGMENTS 4
+#define CACHE_DENTRIES 64
+
+ .text
+/*
+ * cpu_arm940_proc_init()
+ * cpu_arm940_switch_mm()
+ *
+ * These are not required.
+ */
+ENTRY(cpu_arm940_proc_init)
+ENTRY(cpu_arm940_switch_mm)
+ mov pc, lr
+
+/*
+ * cpu_arm940_proc_fin()
+ */
+ENTRY(cpu_arm940_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x00001000 @ i-cache
+ bic r0, r0, #0x00000004 @ d-cache
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm940_reset(loc)
+ * Params : r0 = address to jump to
+ * Notes : This sets up everything for a reset
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm940_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c5, 0 @ flush I cache
+ mcr p15, 0, ip, c7, c6, 0 @ flush D cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x00000005 @ .............c.p
+ bic ip, ip, #0x00001000 @ i-cache
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm940_reset)
+ .popsection
+
+/*
+ * cpu_arm940_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm940_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm940_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(arm940_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ */
+ENTRY(arm940_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm940_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ /* FALLTHROUGH */
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * There is no efficient way to flush a range of cache entries
+ * in the specified address range. Thus, flushes all.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ */
+ENTRY(arm940_flush_user_cache_range)
+ mov ip, #0
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ flush D cache
+#else
+ mov r1, #(CACHE_DSEGMENTS - 1) << 4 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean/flush D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 4
+ bcs 1b @ segments 3 to 0
+#endif
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm940_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm940_coherent_user_range)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(arm940_flush_kern_dcache_area)
+ mov ip, #0
+ mov r1, #(CACHE_DSEGMENTS - 1) << 4 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean/flush D index
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 4
+ bcs 1b @ segments 7 to 0
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * There is no efficient way to invalidate a specifid virtual
+ * address range. Thus, invalidates all.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+arm940_dma_inv_range:
+ mov ip, #0
+ mov r1, #(CACHE_DSEGMENTS - 1) << 4 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c6, 2 @ flush D entry
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 4
+ bcs 1b @ segments 7 to 0
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * There is no efficient way to clean a specifid virtual
+ * address range. Thus, cleans all.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+arm940_dma_clean_range:
+ENTRY(cpu_arm940_dcache_clean_area)
+ mov ip, #0
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r1, #(CACHE_DSEGMENTS - 1) << 4 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2: mcr p15, 0, r3, c7, c10, 2 @ clean D entry
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 4
+ bcs 1b @ segments 7 to 0
+#endif
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * There is no efficient way to clean and invalidate a specifid
+ * virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm940_dma_flush_range)
+ mov ip, #0
+ mov r1, #(CACHE_DSEGMENTS - 1) << 4 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 26 @ 64 entries
+2:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r3, c7, c14, 2 @ clean/flush D entry
+#else
+ mcr p15, 0, r3, c7, c6, 2 @ invalidate D entry
+#endif
+ subs r3, r3, #1 << 26
+ bcs 2b @ entries 63 to 0
+ subs r1, r1, #1 << 4
+ bcs 1b @ segments 7 to 0
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm940_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm940_dma_clean_range
+ bcs arm940_dma_inv_range
+ b arm940_dma_flush_range
+ENDPROC(arm940_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm940_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm940_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm940
+
+ __CPUINIT
+
+ .type __arm940_setup, #function
+__arm940_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c6, 0 @ invalidate D cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+
+ mcr p15, 0, r0, c6, c3, 0 @ disable data area 3~7
+ mcr p15, 0, r0, c6, c4, 0
+ mcr p15, 0, r0, c6, c5, 0
+ mcr p15, 0, r0, c6, c6, 0
+ mcr p15, 0, r0, c6, c7, 0
+
+ mcr p15, 0, r0, c6, c3, 1 @ disable instruction area 3~7
+ mcr p15, 0, r0, c6, c4, 1
+ mcr p15, 0, r0, c6, c5, 1
+ mcr p15, 0, r0, c6, c6, 1
+ mcr p15, 0, r0, c6, c7, 1
+
+ mov r0, #0x0000003F @ base = 0, size = 4GB
+ mcr p15, 0, r0, c6, c0, 0 @ set area 0, default
+ mcr p15, 0, r0, c6, c0, 1
+
+ ldr r0, =(CONFIG_DRAM_BASE & 0xFFFFF000) @ base[31:12] of RAM
+ ldr r1, =(CONFIG_DRAM_SIZE >> 12) @ size of RAM (must be >= 4KB)
+ mov r2, #10 @ 11 is the minimum (4KB)
+1: add r2, r2, #1 @ area size *= 2
+ mov r1, r1, lsr #1
+ bne 1b @ count not zero r-shift
+ orr r0, r0, r2, lsl #1 @ the area register value
+ orr r0, r0, #1 @ set enable bit
+ mcr p15, 0, r0, c6, c1, 0 @ set area 1, RAM
+ mcr p15, 0, r0, c6, c1, 1
+
+ ldr r0, =(CONFIG_FLASH_MEM_BASE & 0xFFFFF000) @ base[31:12] of FLASH
+ ldr r1, =(CONFIG_FLASH_SIZE >> 12) @ size of FLASH (must be >= 4KB)
+ mov r2, #10 @ 11 is the minimum (4KB)
+1: add r2, r2, #1 @ area size *= 2
+ mov r1, r1, lsr #1
+ bne 1b @ count not zero r-shift
+ orr r0, r0, r2, lsl #1 @ the area register value
+ orr r0, r0, #1 @ set enable bit
+ mcr p15, 0, r0, c6, c2, 0 @ set area 2, ROM/FLASH
+ mcr p15, 0, r0, c6, c2, 1
+
+ mov r0, #0x06
+ mcr p15, 0, r0, c2, c0, 0 @ Region 1&2 cacheable
+ mcr p15, 0, r0, c2, c0, 1
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r0, #0x00 @ disable whole write buffer
+#else
+ mov r0, #0x02 @ Region 1 write bufferred
+#endif
+ mcr p15, 0, r0, c3, c0, 0
+
+ mov r0, #0x10000
+ sub r0, r0, #1 @ r0 = 0xffff
+ mcr p15, 0, r0, c5, c0, 0 @ all read/write access
+ mcr p15, 0, r0, c5, c0, 1
+
+ mrc p15, 0, r0, c1, c0 @ get control register
+ orr r0, r0, #0x00001000 @ I-cache
+ orr r0, r0, #0x00000005 @ MPU/D-cache
+
+ mov pc, lr
+
+ .size __arm940_setup, . - __arm940_setup
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm940, dabort=nommu_early_abort, pabort=legacy_pabort, nommu=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm940_name, "ARM940T"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __arm940_proc_info,#object
+__arm940_proc_info:
+ .long 0x41009400
+ .long 0xff00fff0
+ .long 0
+ b __arm940_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB
+ .long cpu_arm940_name
+ .long arm940_processor_functions
+ .long 0
+ .long 0
+ .long arm940_cache_fns
+ .size __arm940_proc_info, . - __arm940_proc_info
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm946.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm946.S
new file mode 100644
index 0000000..f684cfe
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm946.S
@@ -0,0 +1,427 @@
+/*
+ * linux/arch/arm/mm/arm946.S: utility functions for ARM946E-S
+ *
+ * Copyright (C) 2004-2006 Hyok S. Choi (hyok.choi@samsung.com)
+ *
+ * (Many of cache codes are from proc-arm926.S)
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * ARM946E-S is synthesizable to have 0KB to 1MB sized D-Cache,
+ * comprising 256 lines of 32 bytes (8 words).
+ */
+#define CACHE_DSIZE (CONFIG_CPU_DCACHE_SIZE) /* typically 8KB. */
+#define CACHE_DLINESIZE 32 /* fixed */
+#define CACHE_DSEGMENTS 4 /* fixed */
+#define CACHE_DENTRIES (CACHE_DSIZE / CACHE_DSEGMENTS / CACHE_DLINESIZE)
+#define CACHE_DLIMIT (CACHE_DSIZE * 4) /* benchmark needed */
+
+ .text
+/*
+ * cpu_arm946_proc_init()
+ * cpu_arm946_switch_mm()
+ *
+ * These are not required.
+ */
+ENTRY(cpu_arm946_proc_init)
+ENTRY(cpu_arm946_switch_mm)
+ mov pc, lr
+
+/*
+ * cpu_arm946_proc_fin()
+ */
+ENTRY(cpu_arm946_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x00001000 @ i-cache
+ bic r0, r0, #0x00000004 @ d-cache
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_arm946_reset(loc)
+ * Params : r0 = address to jump to
+ * Notes : This sets up everything for a reset
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm946_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c5, 0 @ flush I cache
+ mcr p15, 0, ip, c7, c6, 0 @ flush D cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x00000005 @ .............c.p
+ bic ip, ip, #0x00001000 @ i-cache
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_arm946_reset)
+ .popsection
+
+/*
+ * cpu_arm946_do_idle()
+ */
+ .align 5
+ENTRY(cpu_arm946_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(arm946_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(arm946_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ */
+ENTRY(arm946_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(arm946_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ flush D cache
+#else
+ mov r1, #(CACHE_DSEGMENTS - 1) << 29 @ 4 segments
+1: orr r3, r1, #(CACHE_DENTRIES - 1) << 4 @ n entries
+2: mcr p15, 0, r3, c7, c14, 2 @ clean/flush D index
+ subs r3, r3, #1 << 4
+ bcs 2b @ entries n to 0
+ subs r1, r1, #1 << 29
+ bcs 1b @ segments 3 to 0
+#endif
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ flush I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the
+ * specified address range.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ * (same as arm926)
+ */
+ENTRY(arm946_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bhs __flush_whole_cache
+
+1: tst r2, #VM_EXEC
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+#else
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+#endif
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(arm946_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ * (same as arm926)
+ */
+ENTRY(arm946_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ * (same as arm926)
+ */
+ENTRY(arm946_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ * (same as arm926)
+ */
+arm946_dma_inv_range:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ tst r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+#endif
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as arm926)
+ */
+arm946_dma_clean_range:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as arm926)
+ */
+ENTRY(arm946_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+#else
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+#endif
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm946_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq arm946_dma_clean_range
+ bcs arm946_dma_inv_range
+ b arm946_dma_flush_range
+ENDPROC(arm946_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(arm946_dma_unmap_area)
+ mov pc, lr
+ENDPROC(arm946_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions arm946
+
+ENTRY(cpu_arm946_dcache_clean_area)
+#ifndef CONFIG_CPU_DCACHE_WRITETHROUGH
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __arm946_setup, #function
+__arm946_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c6, 0 @ invalidate D cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+
+ mcr p15, 0, r0, c6, c3, 0 @ disable memory region 3~7
+ mcr p15, 0, r0, c6, c4, 0
+ mcr p15, 0, r0, c6, c5, 0
+ mcr p15, 0, r0, c6, c6, 0
+ mcr p15, 0, r0, c6, c7, 0
+
+ mov r0, #0x0000003F @ base = 0, size = 4GB
+ mcr p15, 0, r0, c6, c0, 0 @ set region 0, default
+
+ ldr r0, =(CONFIG_DRAM_BASE & 0xFFFFF000) @ base[31:12] of RAM
+ ldr r1, =(CONFIG_DRAM_SIZE >> 12) @ size of RAM (must be >= 4KB)
+ mov r2, #10 @ 11 is the minimum (4KB)
+1: add r2, r2, #1 @ area size *= 2
+ mov r1, r1, lsr #1
+ bne 1b @ count not zero r-shift
+ orr r0, r0, r2, lsl #1 @ the region register value
+ orr r0, r0, #1 @ set enable bit
+ mcr p15, 0, r0, c6, c1, 0 @ set region 1, RAM
+
+ ldr r0, =(CONFIG_FLASH_MEM_BASE & 0xFFFFF000) @ base[31:12] of FLASH
+ ldr r1, =(CONFIG_FLASH_SIZE >> 12) @ size of FLASH (must be >= 4KB)
+ mov r2, #10 @ 11 is the minimum (4KB)
+1: add r2, r2, #1 @ area size *= 2
+ mov r1, r1, lsr #1
+ bne 1b @ count not zero r-shift
+ orr r0, r0, r2, lsl #1 @ the region register value
+ orr r0, r0, #1 @ set enable bit
+ mcr p15, 0, r0, c6, c2, 0 @ set region 2, ROM/FLASH
+
+ mov r0, #0x06
+ mcr p15, 0, r0, c2, c0, 0 @ region 1,2 d-cacheable
+ mcr p15, 0, r0, c2, c0, 1 @ region 1,2 i-cacheable
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mov r0, #0x00 @ disable whole write buffer
+#else
+ mov r0, #0x02 @ region 1 write bufferred
+#endif
+ mcr p15, 0, r0, c3, c0, 0
+
+/*
+ * Access Permission Settings for future permission control by PU.
+ *
+ * priv. user
+ * region 0 (whole) rw -- : b0001
+ * region 1 (RAM) rw rw : b0011
+ * region 2 (FLASH) rw r- : b0010
+ * region 3~7 (none) -- -- : b0000
+ */
+ mov r0, #0x00000031
+ orr r0, r0, #0x00000200
+ mcr p15, 0, r0, c5, c0, 2 @ set data access permission
+ mcr p15, 0, r0, c5, c0, 3 @ set inst. access permission
+
+ mrc p15, 0, r0, c1, c0 @ get control register
+ orr r0, r0, #0x00001000 @ I-cache
+ orr r0, r0, #0x00000005 @ MPU/D-cache
+#ifdef CONFIG_CPU_CACHE_ROUND_ROBIN
+ orr r0, r0, #0x00004000 @ .1.. .... .... ....
+#endif
+ mov pc, lr
+
+ .size __arm946_setup, . - __arm946_setup
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm946, dabort=nommu_early_abort, pabort=legacy_pabort, nommu=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5t"
+ string cpu_arm946_name, "ARM946E-S"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+ .type __arm946_proc_info,#object
+__arm946_proc_info:
+ .long 0x41009460
+ .long 0xff00fff0
+ .long 0
+ .long 0
+ b __arm946_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB
+ .long cpu_arm946_name
+ .long arm946_processor_functions
+ .long 0
+ .long 0
+ .long arm946_cache_fns
+ .size __arm946_proc_info, . - __arm946_proc_info
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm9tdmi.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm9tdmi.S
new file mode 100644
index 0000000..8881391
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-arm9tdmi.S
@@ -0,0 +1,97 @@
+/*
+ * linux/arch/arm/mm/proc-arm9tdmi.S: utility functions for ARM9TDMI
+ *
+ * Copyright (C) 2003-2006 Hyok S. Choi <hyok.choi@samsung.com>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+ .text
+/*
+ * cpu_arm9tdmi_proc_init()
+ * cpu_arm9tdmi_do_idle()
+ * cpu_arm9tdmi_dcache_clean_area()
+ * cpu_arm9tdmi_switch_mm()
+ *
+ * These are not required.
+ */
+ENTRY(cpu_arm9tdmi_proc_init)
+ENTRY(cpu_arm9tdmi_do_idle)
+ENTRY(cpu_arm9tdmi_dcache_clean_area)
+ENTRY(cpu_arm9tdmi_switch_mm)
+ mov pc, lr
+
+/*
+ * cpu_arm9tdmi_proc_fin()
+ */
+ENTRY(cpu_arm9tdmi_proc_fin)
+ mov pc, lr
+
+/*
+ * Function: cpu_arm9tdmi_reset(loc)
+ * Params : loc(r0) address to jump to
+ * Purpose : Sets up everything for a reset and jump to the location for soft reset.
+ */
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_arm9tdmi_reset)
+ mov pc, r0
+ENDPROC(cpu_arm9tdmi_reset)
+ .popsection
+
+ __CPUINIT
+
+ .type __arm9tdmi_setup, #function
+__arm9tdmi_setup:
+ mov pc, lr
+ .size __arm9tdmi_setup, . - __arm9tdmi_setup
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions arm9tdmi, dabort=nommu_early_abort, pabort=legacy_pabort, nommu=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4t"
+ string cpu_elf_name, "v4"
+ string cpu_arm9tdmi_name, "ARM9TDMI"
+ string cpu_p2001_name, "P2001"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro arm9tdmi_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req
+ .type __\name\()_proc_info, #object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long 0
+ .long 0
+ b __arm9tdmi_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_THUMB | HWCAP_26BIT
+ .long \cpu_name
+ .long arm9tdmi_processor_functions
+ .long 0
+ .long 0
+ .long v4_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ arm9tdmi_proc_info arm9tdmi, 0x41009900, 0xfff8ff00, cpu_arm9tdmi_name
+ arm9tdmi_proc_info p2001, 0x41029000, 0xffffffff, cpu_p2001_name
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-fa526.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-fa526.S
new file mode 100644
index 0000000..d217e97
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-fa526.S
@@ -0,0 +1,221 @@
+/*
+ * linux/arch/arm/mm/proc-fa526.S: MMU functions for FA526
+ *
+ * Written by : Luke Lee
+ * Copyright (C) 2005 Faraday Corp.
+ * Copyright (C) 2008-2009 Paulius Zaleckas <paulius.zaleckas@teltonika.lt>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the fa526.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+#define CACHE_DLINESIZE 16
+
+ .text
+/*
+ * cpu_fa526_proc_init()
+ */
+ENTRY(cpu_fa526_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_fa526_proc_fin()
+ */
+ENTRY(cpu_fa526_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ nop
+ nop
+ mov pc, lr
+
+/*
+ * cpu_fa526_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 4
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_fa526_reset)
+/* TODO: Use CP8 if possible... */
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ bic ip, ip, #0x0800 @ BTB off
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ nop
+ nop
+ mov pc, r0
+ENDPROC(cpu_fa526_reset)
+ .popsection
+
+/*
+ * cpu_fa526_do_idle()
+ */
+ .align 4
+ENTRY(cpu_fa526_do_idle)
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+
+ENTRY(cpu_fa526_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_fa526_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 4
+ENTRY(cpu_fa526_switch_mm)
+#ifdef CONFIG_MMU
+ mov ip, #0
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ mcr p15, 0, ip, c7, c6, 0 @ invalidate D cache
+#else
+ mcr p15, 0, ip, c7, c14, 0 @ clean and invalidate whole D cache
+#endif
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c5, 6 @ invalidate BTB since mm changed
+ mcr p15, 0, ip, c7, c10, 4 @ data write barrier
+ mcr p15, 0, ip, c7, c5, 4 @ prefetch flush
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate UTLB
+#endif
+ mov pc, lr
+
+/*
+ * cpu_fa526_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 4
+ENTRY(cpu_fa526_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __fa526_setup, #function
+__fa526_setup:
+ /* On return of this routine, r0 must carry correct flags for CFG register */
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+ mcr p15, 0, r0, c7, c5, 5 @ invalidate IScratchpad RAM
+
+ mov r0, #1
+ mcr p15, 0, r0, c1, c1, 0 @ turn-on ECR
+
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 6 @ invalidate BTB All
+ mcr p15, 0, r0, c7, c10, 4 @ data write barrier
+ mcr p15, 0, r0, c7, c5, 4 @ prefetch flush
+
+ mov r0, #0x1f @ Domains 0, 1 = manager, 2 = client
+ mcr p15, 0, r0, c3, c0 @ load domain access register
+
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ ldr r5, fa526_cr1_clear
+ bic r0, r0, r5
+ ldr r5, fa526_cr1_set
+ orr r0, r0, r5
+ mov pc, lr
+ .size __fa526_setup, . - __fa526_setup
+
+ /*
+ * .RVI ZFRS BLDP WCAM
+ * ..11 1001 .111 1101
+ *
+ */
+ .type fa526_cr1_clear, #object
+ .type fa526_cr1_set, #object
+fa526_cr1_clear:
+ .word 0x3f3f
+fa526_cr1_set:
+ .word 0x397D
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions fa526, dabort=v4_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4"
+ string cpu_elf_name, "v4"
+ string cpu_fa526_name, "FA526"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __fa526_proc_info,#object
+__fa526_proc_info:
+ .long 0x66015261
+ .long 0xff01fff1
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __fa526_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF
+ .long cpu_fa526_name
+ .long fa526_processor_functions
+ .long fa_tlb_fns
+ .long fa_user_fns
+ .long fa_cache_fns
+ .size __fa526_proc_info, . - __fa526_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-feroceon.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-feroceon.S
new file mode 100644
index 0000000..ba3c500
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-feroceon.S
@@ -0,0 +1,597 @@
+/*
+ * linux/arch/arm/mm/proc-feroceon.S: MMU functions for Feroceon
+ *
+ * Heavily based on proc-arm926.S
+ * Maintainer: Assaf Hoffman <hoffman@marvell.com>
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be invalidated
+ * using the single invalidate entry instructions. Anything larger
+ * than this, and we go for the whole cache.
+ *
+ * This value should be chosen such that we choose the cheapest
+ * alternative.
+ */
+#define CACHE_DLIMIT 16384
+
+/*
+ * the cache line size of the I and D cache
+ */
+#define CACHE_DLINESIZE 32
+
+ .bss
+ .align 3
+__cache_params_loc:
+ .space 8
+
+ .text
+__cache_params:
+ .word __cache_params_loc
+
+/*
+ * cpu_feroceon_proc_init()
+ */
+ENTRY(cpu_feroceon_proc_init)
+ mrc p15, 0, r0, c0, c0, 1 @ read cache type register
+ ldr r1, __cache_params
+ mov r2, #(16 << 5)
+ tst r0, #(1 << 16) @ get way
+ mov r0, r0, lsr #18 @ get cache size order
+ movne r3, #((4 - 1) << 30) @ 4-way
+ and r0, r0, #0xf
+ moveq r3, #0 @ 1-way
+ mov r2, r2, lsl r0 @ actual cache size
+ movne r2, r2, lsr #2 @ turned into # of sets
+ sub r2, r2, #(1 << 5)
+ stmia r1, {r2, r3}
+ mov pc, lr
+
+/*
+ * cpu_feroceon_proc_fin()
+ */
+ENTRY(cpu_feroceon_proc_fin)
+#if defined(CONFIG_CACHE_FEROCEON_L2) && \
+ !defined(CONFIG_CACHE_FEROCEON_L2_WRITETHROUGH)
+ mov r0, #0
+ mcr p15, 1, r0, c15, c9, 0 @ clean L2
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_feroceon_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_feroceon_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_feroceon_reset)
+ .popsection
+
+/*
+ * cpu_feroceon_do_idle()
+ *
+ * Called with IRQs disabled
+ */
+ .align 5
+ENTRY(cpu_feroceon_do_idle)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ Drain write buffer
+ mcr p15, 0, r0, c7, c0, 4 @ Wait for interrupt
+ mov pc, lr
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(feroceon_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(feroceon_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular
+ * address space.
+ */
+ .align 5
+ENTRY(feroceon_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(feroceon_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+
+__flush_whole_cache:
+ ldr r1, __cache_params
+ ldmia r1, {r1, r3}
+1: orr ip, r1, r3
+2: mcr p15, 0, ip, c7, c14, 2 @ clean + invalidate D set/way
+ subs ip, ip, #(1 << 30) @ next way
+ bcs 2b
+ subs r1, r1, #(1 << 5) @ next set
+ bcs 1b
+
+ tst r2, #VM_EXEC
+ mov ip, #0
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the
+ * specified address range.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ */
+ .align 5
+ENTRY(feroceon_flush_user_cache_range)
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bgt __flush_whole_cache
+1: tst r2, #VM_EXEC
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mov ip, #0
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ .align 5
+ENTRY(feroceon_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(feroceon_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ .align 5
+ENTRY(feroceon_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+ .align 5
+ENTRY(feroceon_range_flush_kern_dcache_area)
+ mrs r2, cpsr
+ add r1, r0, #PAGE_SZ - CACHE_DLINESIZE @ top addr is inclusive
+ orr r3, r2, #PSR_I_BIT
+ msr cpsr_c, r3 @ disable interrupts
+ mcr p15, 5, r0, c15, c15, 0 @ D clean/inv range start
+ mcr p15, 5, r1, c15, c15, 1 @ D clean/inv range top
+ msr cpsr_c, r2 @ restore interrupts
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+ .align 5
+feroceon_dma_inv_range:
+ tst r0, #CACHE_DLINESIZE - 1
+ bic r0, r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+ .align 5
+feroceon_range_dma_inv_range:
+ mrs r2, cpsr
+ tst r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+ cmp r1, r0
+ subne r1, r1, #1 @ top address is inclusive
+ orr r3, r2, #PSR_I_BIT
+ msr cpsr_c, r3 @ disable interrupts
+ mcr p15, 5, r0, c15, c14, 0 @ D inv range start
+ mcr p15, 5, r1, c15, c14, 1 @ D inv range top
+ msr cpsr_c, r2 @ restore interrupts
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+ .align 5
+feroceon_dma_clean_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+ .align 5
+feroceon_range_dma_clean_range:
+ mrs r2, cpsr
+ cmp r1, r0
+ subne r1, r1, #1 @ top address is inclusive
+ orr r3, r2, #PSR_I_BIT
+ msr cpsr_c, r3 @ disable interrupts
+ mcr p15, 5, r0, c15, c13, 0 @ D clean range start
+ mcr p15, 5, r1, c15, c13, 1 @ D clean range top
+ msr cpsr_c, r2 @ restore interrupts
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ .align 5
+ENTRY(feroceon_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+ .align 5
+ENTRY(feroceon_range_dma_flush_range)
+ mrs r2, cpsr
+ cmp r1, r0
+ subne r1, r1, #1 @ top address is inclusive
+ orr r3, r2, #PSR_I_BIT
+ msr cpsr_c, r3 @ disable interrupts
+ mcr p15, 5, r0, c15, c15, 0 @ D clean/inv range start
+ mcr p15, 5, r1, c15, c15, 1 @ D clean/inv range top
+ msr cpsr_c, r2 @ restore interrupts
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(feroceon_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq feroceon_dma_clean_range
+ bcs feroceon_dma_inv_range
+ b feroceon_dma_flush_range
+ENDPROC(feroceon_dma_map_area)
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(feroceon_range_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq feroceon_range_dma_clean_range
+ bcs feroceon_range_dma_inv_range
+ b feroceon_range_dma_flush_range
+ENDPROC(feroceon_range_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(feroceon_dma_unmap_area)
+ mov pc, lr
+ENDPROC(feroceon_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions feroceon
+
+.macro range_alias basename
+ .globl feroceon_range_\basename
+ .type feroceon_range_\basename , %function
+ .equ feroceon_range_\basename , feroceon_\basename
+.endm
+
+/*
+ * Most of the cache functions are unchanged for this case.
+ * Export suitable alias symbols for the unchanged functions:
+ */
+ range_alias flush_icache_all
+ range_alias flush_user_cache_all
+ range_alias flush_kern_cache_all
+ range_alias flush_user_cache_range
+ range_alias coherent_kern_range
+ range_alias coherent_user_range
+ range_alias dma_unmap_area
+
+ define_cache_functions feroceon_range
+
+ .align 5
+ENTRY(cpu_feroceon_dcache_clean_area)
+#if defined(CONFIG_CACHE_FEROCEON_L2) && \
+ !defined(CONFIG_CACHE_FEROCEON_L2_WRITETHROUGH)
+ mov r2, r0
+ mov r3, r1
+#endif
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+#if defined(CONFIG_CACHE_FEROCEON_L2) && \
+ !defined(CONFIG_CACHE_FEROCEON_L2_WRITETHROUGH)
+1: mcr p15, 1, r2, c15, c9, 1 @ clean L2 entry
+ add r2, r2, #CACHE_DLINESIZE
+ subs r3, r3, #CACHE_DLINESIZE
+ bhi 1b
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_feroceon_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_feroceon_switch_mm)
+#ifdef CONFIG_MMU
+ /*
+ * Note: we wish to call __flush_whole_cache but we need to preserve
+ * lr to do so. The only way without touching main memory is to
+ * use r2 which is normally used to test the VM_EXEC flag, and
+ * compensate locally for the skipped ops if it is not set.
+ */
+ mov r2, lr @ abuse r2 to preserve lr
+ bl __flush_whole_cache
+ @ if r2 contains the VM_EXEC bit then the next 2 ops are done already
+ tst r2, #VM_EXEC
+ mcreq p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcreq p15, 0, ip, c7, c10, 4 @ drain WB
+
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ mov pc, r2
+#else
+ mov pc, lr
+#endif
+
+/*
+ * cpu_feroceon_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_feroceon_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext wc_disable=0
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+#if defined(CONFIG_CACHE_FEROCEON_L2) && \
+ !defined(CONFIG_CACHE_FEROCEON_L2_WRITETHROUGH)
+ mcr p15, 1, r0, c15, c9, 1 @ clean L2 entry
+#endif
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __feroceon_setup, #function
+__feroceon_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+
+ adr r5, feroceon_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+ .size __feroceon_setup, . - __feroceon_setup
+
+ /*
+ * B
+ * R P
+ * .RVI UFRS BLDP WCAM
+ * .011 .001 ..11 0101
+ *
+ */
+ .type feroceon_crval, #object
+feroceon_crval:
+ crval clear=0x0000773f, mmuset=0x00003135, ucset=0x00001134
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions feroceon, dabort=v5t_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5"
+ string cpu_feroceon_name, "Feroceon"
+ string cpu_88fr531_name, "Feroceon 88FR531-vd"
+ string cpu_88fr571_name, "Feroceon 88FR571-vd"
+ string cpu_88fr131_name, "Feroceon 88FR131"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro feroceon_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req, cache:req
+ .type __\name\()_proc_info,#object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __feroceon_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP
+ .long \cpu_name
+ .long feroceon_processor_functions
+ .long v4wbi_tlb_fns
+ .long feroceon_user_fns
+ .long \cache
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+#ifdef CONFIG_CPU_FEROCEON_OLD_ID
+ feroceon_proc_info feroceon_old_id, 0x41009260, 0xff00fff0, \
+ cpu_name=cpu_feroceon_name, cache=feroceon_cache_fns
+#endif
+
+ feroceon_proc_info 88fr531, 0x56055310, 0xfffffff0, cpu_88fr531_name, \
+ cache=feroceon_cache_fns
+ feroceon_proc_info 88fr571, 0x56155710, 0xfffffff0, cpu_88fr571_name, \
+ cache=feroceon_range_cache_fns
+ feroceon_proc_info 88fr131, 0x56251310, 0xfffffff0, cpu_88fr131_name, \
+ cache=feroceon_range_cache_fns
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-macros.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-macros.S
new file mode 100644
index 0000000..2d8ff3a
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-macros.S
@@ -0,0 +1,325 @@
+/*
+ * We need constants.h for:
+ * VMA_VM_MM
+ * VMA_VM_FLAGS
+ * VM_EXEC
+ */
+#include <asm/asm-offsets.h>
+#include <asm/thread_info.h>
+
+/*
+ * vma_vm_mm - get mm pointer from vma pointer (vma->vm_mm)
+ */
+ .macro vma_vm_mm, rd, rn
+ ldr \rd, [\rn, #VMA_VM_MM]
+ .endm
+
+/*
+ * vma_vm_flags - get vma->vm_flags
+ */
+ .macro vma_vm_flags, rd, rn
+ ldr \rd, [\rn, #VMA_VM_FLAGS]
+ .endm
+
+ .macro tsk_mm, rd, rn
+ ldr \rd, [\rn, #TI_TASK]
+ ldr \rd, [\rd, #TSK_ACTIVE_MM]
+ .endm
+
+/*
+ * act_mm - get current->active_mm
+ */
+ .macro act_mm, rd
+ bic \rd, sp, #8128
+ bic \rd, \rd, #63
+ ldr \rd, [\rd, #TI_TASK]
+ ldr \rd, [\rd, #TSK_ACTIVE_MM]
+ .endm
+
+/*
+ * mmid - get context id from mm pointer (mm->context.id)
+ */
+ .macro mmid, rd, rn
+ ldr \rd, [\rn, #MM_CONTEXT_ID]
+ .endm
+
+/*
+ * mask_asid - mask the ASID from the context ID
+ */
+ .macro asid, rd, rn
+ and \rd, \rn, #255
+ .endm
+
+ .macro crval, clear, mmuset, ucset
+#ifdef CONFIG_MMU
+ .word \clear
+ .word \mmuset
+#else
+ .word \clear
+ .word \ucset
+#endif
+ .endm
+
+/*
+ * dcache_line_size - get the minimum D-cache line size from the CTR register
+ * on ARMv7.
+ */
+ .macro dcache_line_size, reg, tmp
+ mrc p15, 0, \tmp, c0, c0, 1 @ read ctr
+ lsr \tmp, \tmp, #16
+ and \tmp, \tmp, #0xf @ cache line size encoding
+ mov \reg, #4 @ bytes per word
+ mov \reg, \reg, lsl \tmp @ actual cache line size
+ .endm
+
+/*
+ * icache_line_size - get the minimum I-cache line size from the CTR register
+ * on ARMv7.
+ */
+ .macro icache_line_size, reg, tmp
+ mrc p15, 0, \tmp, c0, c0, 1 @ read ctr
+ and \tmp, \tmp, #0xf @ cache line size encoding
+ mov \reg, #4 @ bytes per word
+ mov \reg, \reg, lsl \tmp @ actual cache line size
+ .endm
+
+/*
+ * Sanity check the PTE configuration for the code below - which makes
+ * certain assumptions about how these bits are laid out.
+ */
+#ifdef CONFIG_MMU
+#if L_PTE_SHARED != PTE_EXT_SHARED
+#error PTE shared bit mismatch
+#endif
+#if !defined (CONFIG_ARM_LPAE) && \
+ (L_PTE_XN+L_PTE_USER+L_PTE_RDONLY+L_PTE_DIRTY+L_PTE_YOUNG+\
+ L_PTE_FILE+L_PTE_PRESENT) > L_PTE_SHARED
+#error Invalid Linux PTE bit settings
+#endif
+#endif /* CONFIG_MMU */
+
+/*
+ * The ARMv6 and ARMv7 set_pte_ext translation function.
+ *
+ * Permission translation:
+ * YUWD APX AP1 AP0 SVC User
+ * 0xxx 0 0 0 no acc no acc
+ * 100x 1 0 1 r/o no acc
+ * 10x0 1 0 1 r/o no acc
+ * 1011 0 0 1 r/w no acc
+ * 110x 0 1 0 r/w r/o
+ * 11x0 0 1 0 r/w r/o
+ * 1111 0 1 1 r/w r/w
+ *
+ * If !CONFIG_CPU_USE_DOMAINS, the following permissions are changed:
+ * 110x 1 1 1 r/o r/o
+ * 11x0 1 1 1 r/o r/o
+ */
+ .macro armv6_mt_table pfx
+\pfx\()_mt_table:
+ .long 0x00 @ L_PTE_MT_UNCACHED
+ .long PTE_EXT_TEX(1) @ L_PTE_MT_BUFFERABLE
+ .long PTE_CACHEABLE @ L_PTE_MT_WRITETHROUGH
+ .long PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_WRITEBACK
+ .long PTE_BUFFERABLE @ L_PTE_MT_DEV_SHARED
+ .long 0x00 @ unused
+ .long 0x00 @ L_PTE_MT_MINICACHE (not present)
+ .long PTE_EXT_TEX(1) | PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_WRITEALLOC
+ .long 0x00 @ unused
+ .long PTE_EXT_TEX(1) @ L_PTE_MT_DEV_WC
+ .long 0x00 @ unused
+ .long PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_DEV_CACHED
+ .long PTE_EXT_TEX(2) @ L_PTE_MT_DEV_NONSHARED
+ .long 0x00 @ unused
+ .long 0x00 @ unused
+ .long 0x00 @ unused
+ .endm
+
+ .macro armv6_set_pte_ext pfx
+ str r1, [r0], #2048 @ linux version
+
+ bic r3, r1, #0x000003fc
+ bic r3, r3, #PTE_TYPE_MASK
+ orr r3, r3, r2
+ orr r3, r3, #PTE_EXT_AP0 | 2
+
+ adr ip, \pfx\()_mt_table
+ and r2, r1, #L_PTE_MT_MASK
+ ldr r2, [ip, r2]
+
+ eor r1, r1, #L_PTE_DIRTY
+ tst r1, #L_PTE_DIRTY|L_PTE_RDONLY
+ orrne r3, r3, #PTE_EXT_APX
+
+ tst r1, #L_PTE_USER
+ orrne r3, r3, #PTE_EXT_AP1
+#ifdef CONFIG_CPU_USE_DOMAINS
+ @ allow kernel read/write access to read-only user pages
+ tstne r3, #PTE_EXT_APX
+ bicne r3, r3, #PTE_EXT_APX | PTE_EXT_AP0
+#endif
+
+ tst r1, #L_PTE_XN
+ orrne r3, r3, #PTE_EXT_XN
+
+ orr r3, r3, r2
+
+ tst r1, #L_PTE_YOUNG
+ tstne r1, #L_PTE_PRESENT
+ moveq r3, #0
+
+ str r3, [r0]
+ mcr p15, 0, r0, c7, c10, 1 @ flush_pte
+ .endm
+
+
+/*
+ * The ARMv3, ARMv4 and ARMv5 set_pte_ext translation function,
+ * covering most CPUs except Xscale and Xscale 3.
+ *
+ * Permission translation:
+ * YUWD AP SVC User
+ * 0xxx 0x00 no acc no acc
+ * 100x 0x00 r/o no acc
+ * 10x0 0x00 r/o no acc
+ * 1011 0x55 r/w no acc
+ * 110x 0xaa r/w r/o
+ * 11x0 0xaa r/w r/o
+ * 1111 0xff r/w r/w
+ */
+ .macro armv3_set_pte_ext wc_disable=1
+ str r1, [r0], #2048 @ linux version
+
+ eor r3, r1, #L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY
+
+ bic r2, r1, #PTE_SMALL_AP_MASK @ keep C, B bits
+ bic r2, r2, #PTE_TYPE_MASK
+ orr r2, r2, #PTE_TYPE_SMALL
+
+ tst r3, #L_PTE_USER @ user?
+ orrne r2, r2, #PTE_SMALL_AP_URO_SRW
+
+ tst r3, #L_PTE_RDONLY | L_PTE_DIRTY @ write and dirty?
+ orreq r2, r2, #PTE_SMALL_AP_UNO_SRW
+
+ tst r3, #L_PTE_PRESENT | L_PTE_YOUNG @ present and young?
+ movne r2, #0
+
+ .if \wc_disable
+#ifdef CONFIG_CPU_DCACHE_WRITETHROUGH
+ tst r2, #PTE_CACHEABLE
+ bicne r2, r2, #PTE_BUFFERABLE
+#endif
+ .endif
+ str r2, [r0] @ hardware version
+ .endm
+
+
+/*
+ * Xscale set_pte_ext translation, split into two halves to cope
+ * with work-arounds. r3 must be preserved by code between these
+ * two macros.
+ *
+ * Permission translation:
+ * YUWD AP SVC User
+ * 0xxx 00 no acc no acc
+ * 100x 00 r/o no acc
+ * 10x0 00 r/o no acc
+ * 1011 01 r/w no acc
+ * 110x 10 r/w r/o
+ * 11x0 10 r/w r/o
+ * 1111 11 r/w r/w
+ */
+ .macro xscale_set_pte_ext_prologue
+ str r1, [r0] @ linux version
+
+ eor r3, r1, #L_PTE_PRESENT | L_PTE_YOUNG | L_PTE_DIRTY
+
+ bic r2, r1, #PTE_SMALL_AP_MASK @ keep C, B bits
+ orr r2, r2, #PTE_TYPE_EXT @ extended page
+
+ tst r3, #L_PTE_USER @ user?
+ orrne r2, r2, #PTE_EXT_AP_URO_SRW @ yes -> user r/o, system r/w
+
+ tst r3, #L_PTE_RDONLY | L_PTE_DIRTY @ write and dirty?
+ orreq r2, r2, #PTE_EXT_AP_UNO_SRW @ yes -> user n/a, system r/w
+ @ combined with user -> user r/w
+ .endm
+
+ .macro xscale_set_pte_ext_epilogue
+ tst r3, #L_PTE_PRESENT | L_PTE_YOUNG @ present and young?
+ movne r2, #0 @ no -> fault
+
+ str r2, [r0, #2048]! @ hardware version
+ mov ip, #0
+ mcr p15, 0, r0, c7, c10, 1 @ clean L1 D line
+ mcr p15, 0, ip, c7, c10, 4 @ data write barrier
+ .endm
+
+.macro define_processor_functions name:req, dabort:req, pabort:req, nommu=0, suspend=0
+ .type \name\()_processor_functions, #object
+ .align 2
+ENTRY(\name\()_processor_functions)
+ .word \dabort
+ .word \pabort
+ .word cpu_\name\()_proc_init
+ .word cpu_\name\()_proc_fin
+ .word cpu_\name\()_reset
+ .word cpu_\name\()_do_idle
+ .word cpu_\name\()_dcache_clean_area
+ .word cpu_\name\()_switch_mm
+
+ .if \nommu
+ .word 0
+ .else
+ .word cpu_\name\()_set_pte_ext
+ .endif
+
+ .if \suspend
+ .word cpu_\name\()_suspend_size
+#ifdef CONFIG_PM_SLEEP
+ .word cpu_\name\()_do_suspend
+ .word cpu_\name\()_do_resume
+#else
+ .word 0
+ .word 0
+#endif
+ .else
+ .word 0
+ .word 0
+ .word 0
+ .endif
+
+ .size \name\()_processor_functions, . - \name\()_processor_functions
+.endm
+
+.macro define_cache_functions name:req
+ .align 2
+ .type \name\()_cache_fns, #object
+ENTRY(\name\()_cache_fns)
+ .long \name\()_flush_icache_all
+ .long \name\()_flush_kern_cache_all
+ .long \name\()_flush_user_cache_all
+ .long \name\()_flush_user_cache_range
+ .long \name\()_coherent_kern_range
+ .long \name\()_coherent_user_range
+ .long \name\()_flush_kern_dcache_area
+ .long \name\()_dma_map_area
+ .long \name\()_dma_unmap_area
+ .long \name\()_dma_flush_range
+ .size \name\()_cache_fns, . - \name\()_cache_fns
+.endm
+
+.macro define_tlb_functions name:req, flags_up:req, flags_smp
+ .type \name\()_tlb_fns, #object
+ENTRY(\name\()_tlb_fns)
+ .long \name\()_flush_user_tlb_range
+ .long \name\()_flush_kern_tlb_range
+ .ifnb \flags_smp
+ ALT_SMP(.long \flags_smp )
+ ALT_UP(.long \flags_up )
+ .else
+ .long \flags_up
+ .endif
+ .size \name\()_tlb_fns, . - \name\()_tlb_fns
+.endm
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-mohawk.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-mohawk.S
new file mode 100644
index 0000000..cdfedc5
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-mohawk.S
@@ -0,0 +1,418 @@
+/*
+ * linux/arch/arm/mm/proc-mohawk.S: MMU functions for Marvell PJ1 core
+ *
+ * PJ1 (codename Mohawk) is a hybrid of the xscale3 and Marvell's own core.
+ *
+ * Heavily based on proc-arm926.S and proc-xsc3.S
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License as published by
+ * the Free Software Foundation; either version 2 of the License, or
+ * (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be flushed. If the
+ * area is larger than this, then we flush the whole cache.
+ */
+#define CACHE_DLIMIT 32768
+
+/*
+ * The cache line size of the L1 D cache.
+ */
+#define CACHE_DLINESIZE 32
+
+/*
+ * cpu_mohawk_proc_init()
+ */
+ENTRY(cpu_mohawk_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_mohawk_proc_fin()
+ */
+ENTRY(cpu_mohawk_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1800 @ ...iz...........
+ bic r0, r0, #0x0006 @ .............ca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_mohawk_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ *
+ * (same as arm926)
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_mohawk_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x0007 @ .............cam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_mohawk_reset)
+ .popsection
+
+/*
+ * cpu_mohawk_do_idle()
+ *
+ * Called with IRQs disabled
+ */
+ .align 5
+ENTRY(cpu_mohawk_do_idle)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mcr p15, 0, r0, c7, c0, 4 @ wait for interrupt
+ mov pc, lr
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(mohawk_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(mohawk_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Clean and invalidate all cache entries in a particular
+ * address space.
+ */
+ENTRY(mohawk_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(mohawk_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+ mcr p15, 0, ip, c7, c14, 0 @ clean & invalidate all D cache
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcrne p15, 0, ip, c7, c10, 0 @ drain write buffer
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, flags)
+ *
+ * Clean and invalidate a range of cache entries in the
+ * specified address range.
+ *
+ * - start - start address (inclusive)
+ * - end - end address (exclusive)
+ * - flags - vm_flags describing address space
+ *
+ * (same as arm926)
+ */
+ENTRY(mohawk_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #CACHE_DLIMIT
+ bgt __flush_whole_cache
+1: tst r2, #VM_EXEC
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ mcr p15, 0, r0, c7, c14, 1 @ clean and invalidate D entry
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(mohawk_coherent_kern_range)
+ /* FALLTHROUGH */
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start, end. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as arm926)
+ */
+ENTRY(mohawk_coherent_user_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ invalidate I entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(mohawk_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+mohawk_dma_inv_range:
+ tst r0, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHE_DLINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * (same as v4wb)
+ */
+mohawk_dma_clean_range:
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(mohawk_dma_flush_range)
+ bic r0, r0, #CACHE_DLINESIZE - 1
+1:
+ mcr p15, 0, r0, c7, c14, 1 @ clean+invalidate D entry
+ add r0, r0, #CACHE_DLINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(mohawk_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq mohawk_dma_clean_range
+ bcs mohawk_dma_inv_range
+ b mohawk_dma_flush_range
+ENDPROC(mohawk_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(mohawk_dma_unmap_area)
+ mov pc, lr
+ENDPROC(mohawk_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions mohawk
+
+ENTRY(cpu_mohawk_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHE_DLINESIZE
+ subs r1, r1, #CACHE_DLINESIZE
+ bhi 1b
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+/*
+ * cpu_mohawk_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_mohawk_switch_mm)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c14, 0 @ clean & invalidate all D cache
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+ orr r0, r0, #0x18 @ cache the page table in L2
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ mov pc, lr
+
+/*
+ * cpu_mohawk_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_mohawk_set_pte_ext)
+ armv3_set_pte_ext
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __mohawk_setup, #function
+__mohawk_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs
+ orr r4, r4, #0x18 @ cache the page table in L2
+ mcr p15, 0, r4, c2, c0, 0 @ load page table pointer
+
+ mov r0, #0 @ don't allow CP access
+ mcr p15, 0, r0, c15, c1, 0 @ write CP access register
+
+ adr r5, mohawk_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+
+ .size __mohawk_setup, . - __mohawk_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * .011 1001 ..00 0101
+ *
+ */
+ .type mohawk_crval, #object
+mohawk_crval:
+ crval clear=0x00007f3f, mmuset=0x00003905, ucset=0x00001134
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions mohawk, dabort=v5t_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5"
+ string cpu_mohawk_name, "Marvell 88SV331x"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __88sv331x_proc_info,#object
+__88sv331x_proc_info:
+ .long 0x56158000 @ Marvell 88SV331x (MOHAWK)
+ .long 0xfffff000
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_BIT4 | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __mohawk_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP
+ .long cpu_mohawk_name
+ .long mohawk_processor_functions
+ .long v4wbi_tlb_fns
+ .long v4wb_user_fns
+ .long mohawk_cache_fns
+ .size __88sv331x_proc_info, . - __88sv331x_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-sa110.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-sa110.S
new file mode 100644
index 0000000..775d70f
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-sa110.S
@@ -0,0 +1,227 @@
+/*
+ * linux/arch/arm/mm/proc-sa110.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * MMU functions for SA110
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the StrongARM-110.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <mach/hardware.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+#include <asm/ptrace.h>
+
+#include "proc-macros.S"
+
+/*
+ * the cache line size of the I and D cache
+ */
+#define DCACHELINESIZE 32
+
+ .text
+
+/*
+ * cpu_sa110_proc_init()
+ */
+ENTRY(cpu_sa110_proc_init)
+ mov r0, #0
+ mcr p15, 0, r0, c15, c1, 2 @ Enable clock switching
+ mov pc, lr
+
+/*
+ * cpu_sa110_proc_fin()
+ */
+ENTRY(cpu_sa110_proc_fin)
+ mov r0, #0
+ mcr p15, 0, r0, c15, c2, 2 @ Disable clock switching
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_sa110_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_sa110_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_sa110_reset)
+ .popsection
+
+/*
+ * cpu_sa110_do_idle(type)
+ *
+ * Cause the processor to idle
+ *
+ * type: call type:
+ * 0 = slow idle
+ * 1 = fast idle
+ * 2 = switch to slow processor clock
+ * 3 = switch to fast processor clock
+ */
+ .align 5
+
+ENTRY(cpu_sa110_do_idle)
+ mcr p15, 0, ip, c15, c2, 2 @ disable clock switching
+ ldr r1, =UNCACHEABLE_ADDR @ load from uncacheable loc
+ ldr r1, [r1, #0] @ force switch to MCLK
+ mov r0, r0 @ safety
+ mov r0, r0 @ safety
+ mov r0, r0 @ safety
+ mcr p15, 0, r0, c15, c8, 2 @ Wait for interrupt, cache aligned
+ mov r0, r0 @ safety
+ mov r0, r0 @ safety
+ mov r0, r0 @ safety
+ mcr p15, 0, r0, c15, c1, 2 @ enable clock switching
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+/*
+ * cpu_sa110_dcache_clean_area(addr,sz)
+ *
+ * Clean the specified entry of any caches such that the MMU
+ * translation fetches will obtain correct data.
+ *
+ * addr: cache-unaligned virtual address
+ */
+ .align 5
+ENTRY(cpu_sa110_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #DCACHELINESIZE
+ subs r1, r1, #DCACHELINESIZE
+ bhi 1b
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_sa110_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_sa110_switch_mm)
+#ifdef CONFIG_MMU
+ str lr, [sp, #-4]!
+ bl v4wb_flush_kern_cache_all @ clears IP
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ ldr pc, [sp], #4
+#else
+ mov pc, lr
+#endif
+
+/*
+ * cpu_sa110_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_sa110_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext wc_disable=0
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+ mov pc, lr
+
+ __CPUINIT
+
+ .type __sa110_setup, #function
+__sa110_setup:
+ mov r10, #0
+ mcr p15, 0, r10, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r10, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r10, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+
+ adr r5, sa110_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+ .size __sa110_setup, . - __sa110_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * ..01 0001 ..11 1101
+ *
+ */
+ .type sa110_crval, #object
+sa110_crval:
+ crval clear=0x00003f3f, mmuset=0x0000113d, ucset=0x00001130
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions sa110, dabort=v4_early_abort, pabort=legacy_pabort
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4"
+ string cpu_elf_name, "v4"
+ string cpu_sa110_name, "StrongARM-110"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ .type __sa110_proc_info,#object
+__sa110_proc_info:
+ .long 0x4401a100
+ .long 0xfffffff0
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __sa110_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_26BIT | HWCAP_FAST_MULT
+ .long cpu_sa110_name
+ .long sa110_processor_functions
+ .long v4wb_tlb_fns
+ .long v4wb_user_fns
+ .long v4wb_cache_fns
+ .size __sa110_proc_info, . - __sa110_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-sa1100.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-sa1100.S
new file mode 100644
index 0000000..d92dfd0
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-sa1100.S
@@ -0,0 +1,275 @@
+/*
+ * linux/arch/arm/mm/proc-sa1100.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ * hacked for non-paged-MM by Hyok S. Choi, 2003.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * MMU functions for SA110
+ *
+ * These are the low level assembler for performing cache and TLB
+ * functions on the StrongARM-1100 and StrongARM-1110.
+ *
+ * Note that SA1100 and SA1110 share everything but their name and CPU ID.
+ *
+ * 12-jun-2000, Erik Mouw (J.A.K.Mouw@its.tudelft.nl):
+ * Flush the read buffer at context switches
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <mach/hardware.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+
+#include "proc-macros.S"
+
+/*
+ * the cache line size of the I and D cache
+ */
+#define DCACHELINESIZE 32
+
+ .section .text
+
+/*
+ * cpu_sa1100_proc_init()
+ */
+ENTRY(cpu_sa1100_proc_init)
+ mov r0, #0
+ mcr p15, 0, r0, c15, c1, 2 @ Enable clock switching
+ mcr p15, 0, r0, c9, c0, 5 @ Allow read-buffer operations from userland
+ mov pc, lr
+
+/*
+ * cpu_sa1100_proc_fin()
+ *
+ * Prepare the CPU for reset:
+ * - Disable interrupts
+ * - Clean and turn off caches.
+ */
+ENTRY(cpu_sa1100_proc_fin)
+ mcr p15, 0, ip, c15, c2, 2 @ Disable clock switching
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x000e @ ............wca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_sa1100_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_sa1100_reset)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches
+ mcr p15, 0, ip, c7, c10, 4 @ drain WB
+#ifdef CONFIG_MMU
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+#endif
+ mrc p15, 0, ip, c1, c0, 0 @ ctrl register
+ bic ip, ip, #0x000f @ ............wcam
+ bic ip, ip, #0x1100 @ ...i...s........
+ mcr p15, 0, ip, c1, c0, 0 @ ctrl register
+ mov pc, r0
+ENDPROC(cpu_sa1100_reset)
+ .popsection
+
+/*
+ * cpu_sa1100_do_idle(type)
+ *
+ * Cause the processor to idle
+ *
+ * type: call type:
+ * 0 = slow idle
+ * 1 = fast idle
+ * 2 = switch to slow processor clock
+ * 3 = switch to fast processor clock
+ */
+ .align 5
+ENTRY(cpu_sa1100_do_idle)
+ mov r0, r0 @ 4 nop padding
+ mov r0, r0
+ mov r0, r0
+ mov r0, r0 @ 4 nop padding
+ mov r0, r0
+ mov r0, r0
+ mov r0, #0
+ ldr r1, =UNCACHEABLE_ADDR @ ptr to uncacheable address
+ @ --- aligned to a cache line
+ mcr p15, 0, r0, c15, c2, 2 @ disable clock switching
+ ldr r1, [r1, #0] @ force switch to MCLK
+ mcr p15, 0, r0, c15, c8, 2 @ wait for interrupt
+ mov r0, r0 @ safety
+ mcr p15, 0, r0, c15, c1, 2 @ enable clock switching
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+/*
+ * cpu_sa1100_dcache_clean_area(addr,sz)
+ *
+ * Clean the specified entry of any caches such that the MMU
+ * translation fetches will obtain correct data.
+ *
+ * addr: cache-unaligned virtual address
+ */
+ .align 5
+ENTRY(cpu_sa1100_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #DCACHELINESIZE
+ subs r1, r1, #DCACHELINESIZE
+ bhi 1b
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_sa1100_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_sa1100_switch_mm)
+#ifdef CONFIG_MMU
+ str lr, [sp, #-4]!
+ bl v4wb_flush_kern_cache_all @ clears IP
+ mcr p15, 0, ip, c9, c0, 0 @ invalidate RB
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ ldr pc, [sp], #4
+#else
+ mov pc, lr
+#endif
+
+/*
+ * cpu_sa1100_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+ .align 5
+ENTRY(cpu_sa1100_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv3_set_pte_ext wc_disable=0
+ mov r0, r0
+ mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c10, 4 @ drain WB
+#endif
+ mov pc, lr
+
+.globl cpu_sa1100_suspend_size
+.equ cpu_sa1100_suspend_size, 4 * 3
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_sa1100_do_suspend)
+ stmfd sp!, {r4 - r6, lr}
+ mrc p15, 0, r4, c3, c0, 0 @ domain ID
+ mrc p15, 0, r5, c13, c0, 0 @ PID
+ mrc p15, 0, r6, c1, c0, 0 @ control reg
+ stmia r0, {r4 - r6} @ store cp regs
+ ldmfd sp!, {r4 - r6, pc}
+ENDPROC(cpu_sa1100_do_suspend)
+
+ENTRY(cpu_sa1100_do_resume)
+ ldmia r0, {r4 - r6} @ load cp regs
+ mov ip, #0
+ mcr p15, 0, ip, c8, c7, 0 @ flush I+D TLBs
+ mcr p15, 0, ip, c7, c7, 0 @ flush I&D cache
+ mcr p15, 0, ip, c9, c0, 0 @ invalidate RB
+ mcr p15, 0, ip, c9, c0, 5 @ allow user space to use RB
+
+ mcr p15, 0, r4, c3, c0, 0 @ domain ID
+ mcr p15, 0, r1, c2, c0, 0 @ translation table base addr
+ mcr p15, 0, r5, c13, c0, 0 @ PID
+ mov r0, r6 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_sa1100_do_resume)
+#endif
+
+ __CPUINIT
+
+ .type __sa1100_setup, #function
+__sa1100_setup:
+ mov r0, #0
+ mcr p15, 0, r0, c7, c7 @ invalidate I,D caches on v4
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer on v4
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7 @ invalidate I,D TLBs on v4
+#endif
+ adr r5, sa1100_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0 @ get control register v4
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+ .size __sa1100_setup, . - __sa1100_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * ..11 0001 ..11 1101
+ *
+ */
+ .type sa1100_crval, #object
+sa1100_crval:
+ crval clear=0x00003f3f, mmuset=0x0000313d, ucset=0x00001130
+
+ __INITDATA
+
+/*
+ * SA1100 and SA1110 share the same function calls
+ */
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions sa1100, dabort=v4_early_abort, pabort=legacy_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv4"
+ string cpu_elf_name, "v4"
+ string cpu_sa1100_name, "StrongARM-1100"
+ string cpu_sa1110_name, "StrongARM-1110"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro sa1100_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req
+ .type __\name\()_proc_info,#object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __sa1100_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_26BIT | HWCAP_FAST_MULT
+ .long \cpu_name
+ .long sa1100_processor_functions
+ .long v4wb_tlb_fns
+ .long v4_mc_user_fns
+ .long v4wb_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ sa1100_proc_info sa1100, 0x4401a110, 0xfffffff0, cpu_sa1100_name
+ sa1100_proc_info sa1110, 0x6901b110, 0xfffffff0, cpu_sa1110_name
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-syms.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-syms.c
new file mode 100644
index 0000000..3e6210b
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-syms.c
@@ -0,0 +1,51 @@
+/*
+ * linux/arch/arm/mm/proc-syms.c
+ *
+ * Copyright (C) 2000-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+#include <linux/module.h>
+#include <linux/mm.h>
+
+#include <asm/cacheflush.h>
+#include <asm/proc-fns.h>
+#include <asm/tlbflush.h>
+#include <asm/page.h>
+
+#ifndef MULTI_CPU
+EXPORT_SYMBOL(cpu_dcache_clean_area);
+EXPORT_SYMBOL(cpu_set_pte_ext);
+#else
+EXPORT_SYMBOL(processor);
+#endif
+
+#ifndef MULTI_CACHE
+EXPORT_SYMBOL(__cpuc_flush_kern_all);
+EXPORT_SYMBOL(__cpuc_flush_user_all);
+EXPORT_SYMBOL(__cpuc_flush_user_range);
+EXPORT_SYMBOL(__cpuc_coherent_kern_range);
+EXPORT_SYMBOL(__cpuc_flush_dcache_area);
+#else
+EXPORT_SYMBOL(cpu_cache);
+#endif
+
+#ifdef CONFIG_MMU
+#ifndef MULTI_USER
+EXPORT_SYMBOL(__cpu_clear_user_highpage);
+EXPORT_SYMBOL(__cpu_copy_user_highpage);
+#else
+EXPORT_SYMBOL(cpu_user);
+#endif
+#endif
+
+/*
+ * No module should need to touch the TLB (and currently
+ * no modules do. We export this for "loadkernel" support
+ * (booting a new kernel from within a running kernel.)
+ */
+#ifdef MULTI_TLB
+EXPORT_SYMBOL(cpu_tlb);
+#endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v6.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v6.S
new file mode 100644
index 0000000..4d2e447
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v6.S
@@ -0,0 +1,296 @@
+/*
+ * linux/arch/arm/mm/proc-v6.S
+ *
+ * Copyright (C) 2001 Deep Blue Solutions Ltd.
+ * Modified by Catalin Marinas for noMMU support
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This is the "shell" of the ARMv6 processor support.
+ */
+#include <linux/init.h>
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+
+#include "proc-macros.S"
+
+#define D_CACHE_LINE_SIZE 32
+
+#define TTB_C (1 << 0)
+#define TTB_S (1 << 1)
+#define TTB_IMP (1 << 2)
+#define TTB_RGN_NC (0 << 3)
+#define TTB_RGN_WBWA (1 << 3)
+#define TTB_RGN_WT (2 << 3)
+#define TTB_RGN_WB (3 << 3)
+
+#define TTB_FLAGS_UP TTB_RGN_WBWA
+#define PMD_FLAGS_UP PMD_SECT_WB
+#define TTB_FLAGS_SMP TTB_RGN_WBWA|TTB_S
+#define PMD_FLAGS_SMP PMD_SECT_WBWA|PMD_SECT_S
+
+ENTRY(cpu_v6_proc_init)
+ mov pc, lr
+
+ENTRY(cpu_v6_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x0006 @ .............ca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_v6_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * - loc - location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_v6_reset)
+ mrc p15, 0, r1, c1, c0, 0 @ ctrl register
+ bic r1, r1, #0x1 @ ...............m
+ mcr p15, 0, r1, c1, c0, 0 @ disable MMU
+ mov r1, #0
+ mcr p15, 0, r1, c7, c5, 4 @ ISB
+ mov pc, r0
+ENDPROC(cpu_v6_reset)
+ .popsection
+
+/*
+ * cpu_v6_do_idle()
+ *
+ * Idle the processor (eg, wait for interrupt).
+ *
+ * IRQs are already disabled.
+ */
+ENTRY(cpu_v6_do_idle)
+ mov r1, #0
+ mcr p15, 0, r1, c7, c10, 4 @ DWB - WFI may enter a low-power mode
+ mcr p15, 0, r1, c7, c0, 4 @ wait for interrupt
+ mov pc, lr
+
+ENTRY(cpu_v6_dcache_clean_area)
+#ifndef TLB_CAN_READ_FROM_L1_CACHE
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #D_CACHE_LINE_SIZE
+ subs r1, r1, #D_CACHE_LINE_SIZE
+ bhi 1b
+#endif
+ mov pc, lr
+
+/*
+ * cpu_arm926_switch_mm(pgd_phys, tsk)
+ *
+ * Set the translation table base pointer to be pgd_phys
+ *
+ * - pgd_phys - physical address of new TTB
+ *
+ * It is assumed that:
+ * - we are not using split page tables
+ */
+ENTRY(cpu_v6_switch_mm)
+#ifdef CONFIG_MMU
+ mov r2, #0
+ ldr r1, [r1, #MM_CONTEXT_ID] @ get mm->context.id
+ ALT_SMP(orr r0, r0, #TTB_FLAGS_SMP)
+ ALT_UP(orr r0, r0, #TTB_FLAGS_UP)
+ mcr p15, 0, r2, c7, c5, 6 @ flush BTAC/BTB
+ mcr p15, 0, r2, c7, c10, 4 @ drain write buffer
+ mcr p15, 0, r0, c2, c0, 0 @ set TTB 0
+ mcr p15, 0, r1, c13, c0, 1 @ set context ID
+#endif
+ mov pc, lr
+
+/*
+ * cpu_v6_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a level 2 translation table entry.
+ *
+ * - ptep - pointer to level 2 translation table entry
+ * (hardware version is stored at -1024 bytes)
+ * - pte - PTE value to store
+ * - ext - value for extended PTE bits
+ */
+ armv6_mt_table cpu_v6
+
+ENTRY(cpu_v6_set_pte_ext)
+#ifdef CONFIG_MMU
+ armv6_set_pte_ext cpu_v6
+#endif
+ mov pc, lr
+
+/* Suspend/resume support: taken from arch/arm/mach-s3c64xx/sleep.S */
+.globl cpu_v6_suspend_size
+.equ cpu_v6_suspend_size, 4 * 6
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_v6_do_suspend)
+ stmfd sp!, {r4 - r9, lr}
+ mrc p15, 0, r4, c13, c0, 0 @ FCSE/PID
+ mrc p15, 0, r5, c3, c0, 0 @ Domain ID
+ mrc p15, 0, r6, c2, c0, 1 @ Translation table base 1
+ mrc p15, 0, r7, c1, c0, 1 @ auxiliary control register
+ mrc p15, 0, r8, c1, c0, 2 @ co-processor access control
+ mrc p15, 0, r9, c1, c0, 0 @ control register
+ stmia r0, {r4 - r9}
+ ldmfd sp!, {r4- r9, pc}
+ENDPROC(cpu_v6_do_suspend)
+
+ENTRY(cpu_v6_do_resume)
+ mov ip, #0
+ mcr p15, 0, ip, c7, c14, 0 @ clean+invalidate D cache
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c7, c15, 0 @ clean+invalidate cache
+ mcr p15, 0, ip, c7, c10, 4 @ drain write buffer
+ mcr p15, 0, ip, c13, c0, 1 @ set reserved context ID
+ ldmia r0, {r4 - r9}
+ mcr p15, 0, r4, c13, c0, 0 @ FCSE/PID
+ mcr p15, 0, r5, c3, c0, 0 @ Domain ID
+ ALT_SMP(orr r1, r1, #TTB_FLAGS_SMP)
+ ALT_UP(orr r1, r1, #TTB_FLAGS_UP)
+ mcr p15, 0, r1, c2, c0, 0 @ Translation table base 0
+ mcr p15, 0, r6, c2, c0, 1 @ Translation table base 1
+ mcr p15, 0, r7, c1, c0, 1 @ auxiliary control register
+ mcr p15, 0, r8, c1, c0, 2 @ co-processor access control
+ mcr p15, 0, ip, c2, c0, 2 @ TTB control register
+ mcr p15, 0, ip, c7, c5, 4 @ ISB
+ mov r0, r9 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_v6_do_resume)
+#endif
+
+ string cpu_v6_name, "ARMv6-compatible processor"
+
+ .align
+
+ __CPUINIT
+
+/*
+ * __v6_setup
+ *
+ * Initialise TLB, Caches, and MMU state ready to switch the MMU
+ * on. Return in r0 the new CP15 C1 control register setting.
+ *
+ * We automatically detect if we have a Harvard cache, and use the
+ * Harvard cache control instructions insead of the unified cache
+ * control instructions.
+ *
+ * This should be able to cover all ARMv6 cores.
+ *
+ * It is assumed that:
+ * - cache type register is implemented
+ */
+__v6_setup:
+#ifdef CONFIG_SMP
+ ALT_SMP(mrc p15, 0, r0, c1, c0, 1) @ Enable SMP/nAMP mode
+ ALT_UP(nop)
+ orr r0, r0, #0x20
+ ALT_SMP(mcr p15, 0, r0, c1, c0, 1)
+ ALT_UP(nop)
+#endif
+
+ mov r0, #0
+ mcr p15, 0, r0, c7, c14, 0 @ clean+invalidate D cache
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, r0, c7, c15, 0 @ clean+invalidate cache
+#ifdef CONFIG_MMU
+ mcr p15, 0, r0, c8, c7, 0 @ invalidate I + D TLBs
+ mcr p15, 0, r0, c2, c0, 2 @ TTB control register
+ ALT_SMP(orr r4, r4, #TTB_FLAGS_SMP)
+ ALT_UP(orr r4, r4, #TTB_FLAGS_UP)
+ ALT_SMP(orr r8, r8, #TTB_FLAGS_SMP)
+ ALT_UP(orr r8, r8, #TTB_FLAGS_UP)
+ mcr p15, 0, r8, c2, c0, 1 @ load TTB1
+#endif /* CONFIG_MMU */
+ mcr p15, 0, r0, c7, c10, 4 @ drain write buffer and
+ @ complete invalidations
+ adr r5, v6_crval
+ ldmia r5, {r5, r6}
+#ifdef CONFIG_CPU_ENDIAN_BE8
+ orr r6, r6, #1 << 25 @ big-endian page tables
+#endif
+ mrc p15, 0, r0, c1, c0, 0 @ read control register
+ bic r0, r0, r5 @ clear bits them
+ orr r0, r0, r6 @ set them
+#ifdef CONFIG_ARM_ERRATA_364296
+ /*
+ * Workaround for the 364296 ARM1136 r0p2 erratum (possible cache data
+ * corruption with hit-under-miss enabled). The conditional code below
+ * (setting the undocumented bit 31 in the auxiliary control register
+ * and the FI bit in the control register) disables hit-under-miss
+ * without putting the processor into full low interrupt latency mode.
+ */
+ ldr r6, =0x4107b362 @ id for ARM1136 r0p2
+ mrc p15, 0, r5, c0, c0, 0 @ get processor id
+ teq r5, r6 @ check for the faulty core
+ mrceq p15, 0, r5, c1, c0, 1 @ load aux control reg
+ orreq r5, r5, #(1 << 31) @ set the undocumented bit 31
+ mcreq p15, 0, r5, c1, c0, 1 @ write aux control reg
+ orreq r0, r0, #(1 << 21) @ low interrupt latency configuration
+#endif
+ mov pc, lr @ return to head.S:__ret
+
+ /*
+ * V X F I D LR
+ * .... ...E PUI. .T.T 4RVI ZFRS BLDP WCAM
+ * rrrr rrrx xxx0 0101 xxxx xxxx x111 xxxx < forced
+ * 0 110 0011 1.00 .111 1101 < we want
+ */
+ .type v6_crval, #object
+v6_crval:
+ crval clear=0x01e0fb7f, mmuset=0x00c0387d, ucset=0x00c0187c
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions v6, dabort=v6_early_abort, pabort=v6_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv6"
+ string cpu_elf_name, "v6"
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ /*
+ * Match any ARMv6 processor core.
+ */
+ .type __v6_proc_info, #object
+__v6_proc_info:
+ .long 0x0007b000
+ .long 0x0007f000
+ ALT_SMP(.long \
+ PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ | \
+ PMD_FLAGS_SMP)
+ ALT_UP(.long \
+ PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ | \
+ PMD_FLAGS_UP)
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_XN | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __v6_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ /* See also feat_v6_fixup() for HWCAP_TLS */
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP|HWCAP_JAVA|HWCAP_TLS
+ .long cpu_v6_name
+ .long v6_processor_functions
+ .long v6wbi_tlb_fns
+ .long v6_user_fns
+ .long v6_cache_fns
+ .size __v6_proc_info, . - __v6_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7-2level.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7-2level.S
new file mode 100644
index 0000000..42ac069
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7-2level.S
@@ -0,0 +1,166 @@
+/*
+ * arch/arm/mm/proc-v7-2level.S
+ *
+ * Copyright (C) 2001 Deep Blue Solutions Ltd.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ */
+
+#define TTB_S (1 << 1)
+#define TTB_RGN_NC (0 << 3)
+#define TTB_RGN_OC_WBWA (1 << 3)
+#define TTB_RGN_OC_WT (2 << 3)
+#define TTB_RGN_OC_WB (3 << 3)
+#define TTB_NOS (1 << 5)
+#define TTB_IRGN_NC ((0 << 0) | (0 << 6))
+#define TTB_IRGN_WBWA ((0 << 0) | (1 << 6))
+#define TTB_IRGN_WT ((1 << 0) | (0 << 6))
+#define TTB_IRGN_WB ((1 << 0) | (1 << 6))
+
+/* PTWs cacheable, inner WB not shareable, outer WB not shareable */
+#define TTB_FLAGS_UP TTB_IRGN_WB|TTB_RGN_OC_WB
+#define PMD_FLAGS_UP PMD_SECT_WB
+
+/* PTWs cacheable, inner WBWA shareable, outer WBWA not shareable */
+#define TTB_FLAGS_SMP TTB_IRGN_WBWA|TTB_S|TTB_NOS|TTB_RGN_OC_WBWA
+#define PMD_FLAGS_SMP PMD_SECT_WBWA|PMD_SECT_S
+
+/*
+ * cpu_v7_switch_mm(pgd_phys, tsk)
+ *
+ * Set the translation table base pointer to be pgd_phys
+ *
+ * - pgd_phys - physical address of new TTB
+ *
+ * It is assumed that:
+ * - we are not using split page tables
+ */
+ENTRY(cpu_v7_switch_mm)
+#ifdef CONFIG_MMU
+ mov r2, #0
+ ldr r1, [r1, #MM_CONTEXT_ID] @ get mm->context.id
+ ALT_SMP(orr r0, r0, #TTB_FLAGS_SMP)
+ ALT_UP(orr r0, r0, #TTB_FLAGS_UP)
+#ifdef CONFIG_ARM_ERRATA_430973
+ mcr p15, 0, r2, c7, c5, 6 @ flush BTAC/BTB
+#endif
+#ifdef CONFIG_ARM_ERRATA_754322
+ dsb
+#endif
+ mcr p15, 0, r1, c13, c0, 1 @ set context ID
+ isb
+ mcr p15, 0, r0, c2, c0, 0 @ set TTB 0
+ isb
+#endif
+ mov pc, lr
+ENDPROC(cpu_v7_switch_mm)
+
+/*
+ * cpu_v7_set_pte_ext(ptep, pte)
+ *
+ * Set a level 2 translation table entry.
+ *
+ * - ptep - pointer to level 2 translation table entry
+ * (hardware version is stored at +2048 bytes)
+ * - pte - PTE value to store
+ * - ext - value for extended PTE bits
+ */
+ENTRY(cpu_v7_set_pte_ext)
+#ifdef CONFIG_MMU
+ str r1, [r0] @ linux version
+
+ bic r3, r1, #0x000003f0
+ bic r3, r3, #PTE_TYPE_MASK
+ orr r3, r3, r2
+ orr r3, r3, #PTE_EXT_AP0 | 2
+
+ tst r1, #1 << 4
+ orrne r3, r3, #PTE_EXT_TEX(1)
+
+ eor r1, r1, #L_PTE_DIRTY
+ tst r1, #L_PTE_RDONLY | L_PTE_DIRTY
+ orrne r3, r3, #PTE_EXT_APX
+
+ tst r1, #L_PTE_USER
+ orrne r3, r3, #PTE_EXT_AP1
+#ifdef CONFIG_CPU_USE_DOMAINS
+ @ allow kernel read/write access to read-only user pages
+ tstne r3, #PTE_EXT_APX
+ bicne r3, r3, #PTE_EXT_APX | PTE_EXT_AP0
+#endif
+
+ tst r1, #L_PTE_XN
+ orrne r3, r3, #PTE_EXT_XN
+
+ tst r1, #L_PTE_YOUNG
+ tstne r1, #L_PTE_PRESENT
+ moveq r3, #0
+
+ ARM( str r3, [r0, #2048]! )
+ THUMB( add r0, r0, #2048 )
+ THUMB( str r3, [r0] )
+ mcr p15, 0, r0, c7, c10, 1 @ flush_pte
+#endif
+ mov pc, lr
+ENDPROC(cpu_v7_set_pte_ext)
+
+ /*
+ * Memory region attributes with SCTLR.TRE=1
+ *
+ * n = TEX[0],C,B
+ * TR = PRRR[2n+1:2n] - memory type
+ * IR = NMRR[2n+1:2n] - inner cacheable property
+ * OR = NMRR[2n+17:2n+16] - outer cacheable property
+ *
+ * n TR IR OR
+ * UNCACHED 000 00
+ * BUFFERABLE 001 10 00 00
+ * WRITETHROUGH 010 10 10 10
+ * WRITEBACK 011 10 11 11
+ * reserved 110
+ * WRITEALLOC 111 10 01 01
+ * DEV_SHARED 100 01
+ * DEV_NONSHARED 100 01
+ * DEV_WC 001 10
+ * DEV_CACHED 011 10
+ *
+ * Other attributes:
+ *
+ * DS0 = PRRR[16] = 0 - device shareable property
+ * DS1 = PRRR[17] = 1 - device shareable property
+ * NS0 = PRRR[18] = 0 - normal shareable property
+ * NS1 = PRRR[19] = 1 - normal shareable property
+ * NOS = PRRR[24+n] = 1 - not outer shareable
+ */
+.equ PRRR, 0xff0a81a8
+.equ NMRR, 0x40e040e0
+
+ /*
+ * Macro for setting up the TTBRx and TTBCR registers.
+ * - \ttb0 and \ttb1 updated with the corresponding flags.
+ */
+ .macro v7_ttb_setup, zero, ttbr0, ttbr1, tmp
+ mcr p15, 0, \zero, c2, c0, 2 @ TTB control register
+ ALT_SMP(orr \ttbr0, \ttbr0, #TTB_FLAGS_SMP)
+ ALT_UP(orr \ttbr0, \ttbr0, #TTB_FLAGS_UP)
+ ALT_SMP(orr \ttbr1, \ttbr1, #TTB_FLAGS_SMP)
+ ALT_UP(orr \ttbr1, \ttbr1, #TTB_FLAGS_UP)
+ mcr p15, 0, \ttbr1, c2, c0, 1 @ load TTB1
+ .endm
+
+ __CPUINIT
+
+ /* AT
+ * TFR EV X F I D LR S
+ * .EEE ..EE PUI. .T.T 4RVI ZWRS BLDP WCAM
+ * rxxx rrxx xxx0 0101 xxxx xxxx x111 xxxx < forced
+ * 1 0 110 0011 1100 .111 1101 < we want
+ */
+ .align 2
+ .type v7_crval, #object
+v7_crval:
+ crval clear=0x0120c302, mmuset=0x10c03c7d, ucset=0x00c01c7c
+
+ .previous
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7-3level.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7-3level.S
new file mode 100644
index 0000000..8de0f1d
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7-3level.S
@@ -0,0 +1,150 @@
+/*
+ * arch/arm/mm/proc-v7-3level.S
+ *
+ * Copyright (C) 2001 Deep Blue Solutions Ltd.
+ * Copyright (C) 2011 ARM Ltd.
+ * Author: Catalin Marinas <catalin.marinas@arm.com>
+ * based on arch/arm/mm/proc-v7-2level.S
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ */
+
+#define TTB_IRGN_NC (0 << 8)
+#define TTB_IRGN_WBWA (1 << 8)
+#define TTB_IRGN_WT (2 << 8)
+#define TTB_IRGN_WB (3 << 8)
+#define TTB_RGN_NC (0 << 10)
+#define TTB_RGN_OC_WBWA (1 << 10)
+#define TTB_RGN_OC_WT (2 << 10)
+#define TTB_RGN_OC_WB (3 << 10)
+#define TTB_S (3 << 12)
+#define TTB_EAE (1 << 31)
+
+/* PTWs cacheable, inner WB not shareable, outer WB not shareable */
+#define TTB_FLAGS_UP (TTB_IRGN_WB|TTB_RGN_OC_WB)
+#define PMD_FLAGS_UP (PMD_SECT_WB)
+
+/* PTWs cacheable, inner WBWA shareable, outer WBWA not shareable */
+#define TTB_FLAGS_SMP (TTB_IRGN_WBWA|TTB_S|TTB_RGN_OC_WBWA)
+#define PMD_FLAGS_SMP (PMD_SECT_WBWA|PMD_SECT_S)
+
+/*
+ * cpu_v7_switch_mm(pgd_phys, tsk)
+ *
+ * Set the translation table base pointer to be pgd_phys (physical address of
+ * the new TTB).
+ */
+ENTRY(cpu_v7_switch_mm)
+#ifdef CONFIG_MMU
+ ldr r1, [r1, #MM_CONTEXT_ID] @ get mm->context.id
+ and r3, r1, #0xff
+ mov r3, r3, lsl #(48 - 32) @ ASID
+ mcrr p15, 0, r0, r3, c2 @ set TTB 0
+ isb
+#endif
+ mov pc, lr
+ENDPROC(cpu_v7_switch_mm)
+
+/*
+ * cpu_v7_set_pte_ext(ptep, pte)
+ *
+ * Set a level 2 translation table entry.
+ * - ptep - pointer to level 3 translation table entry
+ * - pte - PTE value to store (64-bit in r2 and r3)
+ */
+ENTRY(cpu_v7_set_pte_ext)
+#ifdef CONFIG_MMU
+ tst r2, #L_PTE_PRESENT
+ beq 1f
+ tst r3, #1 << (55 - 32) @ L_PTE_DIRTY
+ orreq r2, #L_PTE_RDONLY
+1: strd r2, r3, [r0]
+ mcr p15, 0, r0, c7, c10, 1 @ flush_pte
+#endif
+ mov pc, lr
+ENDPROC(cpu_v7_set_pte_ext)
+
+ /*
+ * Memory region attributes for LPAE (defined in pgtable-3level.h):
+ *
+ * n = AttrIndx[2:0]
+ *
+ * n MAIR
+ * UNCACHED 000 00000000
+ * BUFFERABLE 001 01000100
+ * DEV_WC 001 01000100
+ * WRITETHROUGH 010 10101010
+ * WRITEBACK 011 11101110
+ * DEV_CACHED 011 11101110
+ * DEV_SHARED 100 00000100
+ * DEV_NONSHARED 100 00000100
+ * unused 101
+ * unused 110
+ * WRITEALLOC 111 11111111
+ */
+.equ PRRR, 0xeeaa4400 @ MAIR0
+.equ NMRR, 0xff000004 @ MAIR1
+
+ /*
+ * Macro for setting up the TTBRx and TTBCR registers.
+ * - \ttbr1 updated.
+ */
+ .macro v7_ttb_setup, zero, ttbr0, ttbr1, tmp
+ ldr \tmp, =swapper_pg_dir @ swapper_pg_dir virtual address
+ cmp \ttbr1, \tmp @ PHYS_OFFSET > PAGE_OFFSET? (branch below)
+ mrc p15, 0, \tmp, c2, c0, 2 @ TTB control register
+ orr \tmp, \tmp, #TTB_EAE
+ ALT_SMP(orr \tmp, \tmp, #TTB_FLAGS_SMP)
+ ALT_UP(orr \tmp, \tmp, #TTB_FLAGS_UP)
+ ALT_SMP(orr \tmp, \tmp, #TTB_FLAGS_SMP << 16)
+ ALT_UP(orr \tmp, \tmp, #TTB_FLAGS_UP << 16)
+ /*
+ * TTBR0/TTBR1 split (PAGE_OFFSET):
+ * 0x40000000: T0SZ = 2, T1SZ = 0 (not used)
+ * 0x80000000: T0SZ = 0, T1SZ = 1
+ * 0xc0000000: T0SZ = 0, T1SZ = 2
+ *
+ * Only use this feature if PHYS_OFFSET <= PAGE_OFFSET, otherwise
+ * booting secondary CPUs would end up using TTBR1 for the identity
+ * mapping set up in TTBR0.
+ */
+ bhi 9001f @ PHYS_OFFSET > PAGE_OFFSET?
+ orr \tmp, \tmp, #(((PAGE_OFFSET >> 30) - 1) << 16) @ TTBCR.T1SZ
+#if defined CONFIG_VMSPLIT_2G
+ /* PAGE_OFFSET == 0x80000000, T1SZ == 1 */
+ add \ttbr1, \ttbr1, #1 << 4 @ skip two L1 entries
+#elif defined CONFIG_VMSPLIT_3G
+ /* PAGE_OFFSET == 0xc0000000, T1SZ == 2 */
+ add \ttbr1, \ttbr1, #4096 * (1 + 3) @ only L2 used, skip pgd+3*pmd
+#endif
+ /* CONFIG_VMSPLIT_1G does not need TTBR1 adjustment */
+9001: mcr p15, 0, \tmp, c2, c0, 2 @ TTB control register
+ mcrr p15, 1, \ttbr1, \zero, c2 @ load TTBR1
+ .endm
+
+ __CPUINIT
+
+ /*
+ * AT
+ * TFR EV X F IHD LR S
+ * .EEE ..EE PUI. .TAT 4RVI ZWRS BLDP WCAM
+ * rxxx rrxx xxx0 0101 xxxx xxxx x111 xxxx < forced
+ * 11 0 110 1 0011 1100 .111 1101 < we want
+ */
+ .align 2
+ .type v7_crval, #object
+v7_crval:
+ crval clear=0x0120c302, mmuset=0x30c23c7d, ucset=0x00c01c7c
+
+ .previous
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7.S
new file mode 100644
index 0000000..bc8f755
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-v7.S
@@ -0,0 +1,378 @@
+/*
+ * linux/arch/arm/mm/proc-v7.S
+ *
+ * Copyright (C) 2001 Deep Blue Solutions Ltd.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * This is the "shell" of the ARMv7 processor support.
+ */
+#include <linux/init.h>
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/pgtable.h>
+
+#include "proc-macros.S"
+
+#ifdef CONFIG_ARM_LPAE
+#include "proc-v7-3level.S"
+#else
+#include "proc-v7-2level.S"
+#endif
+
+ENTRY(cpu_v7_proc_init)
+ mov pc, lr
+ENDPROC(cpu_v7_proc_init)
+
+ENTRY(cpu_v7_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1000 @ ...i............
+ bic r0, r0, #0x0006 @ .............ca.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+ENDPROC(cpu_v7_proc_fin)
+
+/*
+ * cpu_v7_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * - loc - location to jump to for soft reset
+ *
+ * This code must be executed using a flat identity mapping with
+ * caches disabled.
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_v7_reset)
+ mrc p15, 0, r1, c1, c0, 0 @ ctrl register
+ bic r1, r1, #0x1 @ ...............m
+ THUMB( bic r1, r1, #1 << 30 ) @ SCTLR.TE (Thumb exceptions)
+ mcr p15, 0, r1, c1, c0, 0 @ disable MMU
+ isb
+ mov pc, r0
+ENDPROC(cpu_v7_reset)
+ .popsection
+
+/*
+ * cpu_v7_do_idle()
+ *
+ * Idle the processor (eg, wait for interrupt).
+ *
+ * IRQs are already disabled.
+ */
+ENTRY(cpu_v7_do_idle)
+ dsb @ WFI may enter a low-power mode
+ wfi
+ mov pc, lr
+ENDPROC(cpu_v7_do_idle)
+
+ENTRY(cpu_v7_dcache_clean_area)
+#ifndef TLB_CAN_READ_FROM_L1_CACHE
+ dcache_line_size r2, r3
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, r2
+ subs r1, r1, r2
+ bhi 1b
+ dsb
+#endif
+ mov pc, lr
+ENDPROC(cpu_v7_dcache_clean_area)
+
+ string cpu_v7_name, "ARMv7 Processor"
+ .align
+
+/* Suspend/resume support: derived from arch/arm/mach-s5pv210/sleep.S */
+.globl cpu_v7_suspend_size
+.equ cpu_v7_suspend_size, 4 * 8
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_v7_do_suspend)
+ stmfd sp!, {r4 - r10, lr}
+ mrc p15, 0, r4, c13, c0, 0 @ FCSE/PID
+ mrc p15, 0, r5, c13, c0, 3 @ User r/o thread ID
+ stmia r0!, {r4 - r5}
+ mrc p15, 0, r6, c3, c0, 0 @ Domain ID
+ mrc p15, 0, r7, c2, c0, 1 @ TTB 1
+ mrc p15, 0, r11, c2, c0, 2 @ TTB control register
+ mrc p15, 0, r8, c1, c0, 0 @ Control register
+ mrc p15, 0, r9, c1, c0, 1 @ Auxiliary control register
+ mrc p15, 0, r10, c1, c0, 2 @ Co-processor access control
+ stmia r0, {r6 - r11}
+ ldmfd sp!, {r4 - r10, pc}
+ENDPROC(cpu_v7_do_suspend)
+
+ENTRY(cpu_v7_do_resume)
+ mov ip, #0
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate TLBs
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate I cache
+ mcr p15, 0, ip, c13, c0, 1 @ set reserved context ID
+ ldmia r0!, {r4 - r5}
+ mcr p15, 0, r4, c13, c0, 0 @ FCSE/PID
+ mcr p15, 0, r5, c13, c0, 3 @ User r/o thread ID
+ ldmia r0, {r6 - r11}
+ mcr p15, 0, r6, c3, c0, 0 @ Domain ID
+#ifndef CONFIG_ARM_LPAE
+ ALT_SMP(orr r1, r1, #TTB_FLAGS_SMP)
+ ALT_UP(orr r1, r1, #TTB_FLAGS_UP)
+#endif
+ mcr p15, 0, r1, c2, c0, 0 @ TTB 0
+ mcr p15, 0, r7, c2, c0, 1 @ TTB 1
+ mcr p15, 0, r11, c2, c0, 2 @ TTB control register
+ mrc p15, 0, r4, c1, c0, 1 @ Read Auxiliary control register
+ teq r4, r9 @ Is it already set?
+ mcrne p15, 0, r9, c1, c0, 1 @ No, so write it
+ mcr p15, 0, r10, c1, c0, 2 @ Co-processor access control
+ ldr r4, =PRRR @ PRRR
+ ldr r5, =NMRR @ NMRR
+ mcr p15, 0, r4, c10, c2, 0 @ write PRRR
+ mcr p15, 0, r5, c10, c2, 1 @ write NMRR
+ isb
+ dsb
+ mov r0, r8 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_v7_do_resume)
+#endif
+
+ __CPUINIT
+
+/*
+ * __v7_setup
+ *
+ * Initialise TLB, Caches, and MMU state ready to switch the MMU
+ * on. Return in r0 the new CP15 C1 control register setting.
+ *
+ * This should be able to cover all ARMv7 cores.
+ *
+ * It is assumed that:
+ * - cache type register is implemented
+ */
+__v7_ca5mp_setup:
+__v7_ca9mp_setup:
+ mov r10, #(1 << 0) @ TLB ops broadcasting
+ b 1f
+__v7_ca7mp_setup:
+__v7_ca15mp_setup:
+ mov r10, #0
+1:
+#ifdef CONFIG_SMP
+ ALT_SMP(mrc p15, 0, r0, c1, c0, 1)
+ ALT_UP(mov r0, #(1 << 6)) @ fake it for UP
+ tst r0, #(1 << 6) @ SMP/nAMP mode enabled?
+ orreq r0, r0, #(1 << 6) @ Enable SMP/nAMP mode
+ orreq r0, r0, r10 @ Enable CPU-specific SMP bits
+ mcreq p15, 0, r0, c1, c0, 1
+#endif
+__v7_setup:
+ adr r12, __v7_setup_stack @ the local stack
+ stmia r12, {r0-r5, r7, r9, r11, lr}
+ @bl v7_flush_dcache_all
+ bl v7_invalidate_dcache_all @ fix D-Cache bug on zx297510
+ ldmia r12, {r0-r5, r7, r9, r11, lr}
+
+ mrc p15, 0, r0, c0, c0, 0 @ read main ID register
+ and r10, r0, #0xff000000 @ ARM?
+ teq r10, #0x41000000
+ bne 3f
+ and r5, r0, #0x00f00000 @ variant
+ and r6, r0, #0x0000000f @ revision
+ orr r6, r6, r5, lsr #20-4 @ combine variant and revision
+ ubfx r0, r0, #4, #12 @ primary part number
+
+ /* Cortex-A8 Errata */
+ ldr r10, =0x00000c08 @ Cortex-A8 primary part number
+ teq r0, r10
+ bne 2f
+#ifdef CONFIG_ARM_ERRATA_430973
+ teq r5, #0x00100000 @ only present in r1p*
+ mrceq p15, 0, r10, c1, c0, 1 @ read aux control register
+ orreq r10, r10, #(1 << 6) @ set IBE to 1
+ mcreq p15, 0, r10, c1, c0, 1 @ write aux control register
+#endif
+#ifdef CONFIG_ARM_ERRATA_458693
+ teq r6, #0x20 @ only present in r2p0
+ mrceq p15, 0, r10, c1, c0, 1 @ read aux control register
+ orreq r10, r10, #(1 << 5) @ set L1NEON to 1
+ orreq r10, r10, #(1 << 9) @ set PLDNOP to 1
+ mcreq p15, 0, r10, c1, c0, 1 @ write aux control register
+#endif
+#ifdef CONFIG_ARM_ERRATA_460075
+ teq r6, #0x20 @ only present in r2p0
+ mrceq p15, 1, r10, c9, c0, 2 @ read L2 cache aux ctrl register
+ tsteq r10, #1 << 22
+ orreq r10, r10, #(1 << 22) @ set the Write Allocate disable bit
+ mcreq p15, 1, r10, c9, c0, 2 @ write the L2 cache aux ctrl register
+#endif
+ b 3f
+
+ /* Cortex-A9 Errata */
+2: ldr r10, =0x00000c09 @ Cortex-A9 primary part number
+ teq r0, r10
+ bne 3f
+#ifdef CONFIG_ARM_ERRATA_742230
+ cmp r6, #0x22 @ only present up to r2p2
+ mrcle p15, 0, r10, c15, c0, 1 @ read diagnostic register
+ orrle r10, r10, #1 << 4 @ set bit #4
+ mcrle p15, 0, r10, c15, c0, 1 @ write diagnostic register
+#endif
+#ifdef CONFIG_ARM_ERRATA_742231
+ teq r6, #0x20 @ present in r2p0
+ teqne r6, #0x21 @ present in r2p1
+ teqne r6, #0x22 @ present in r2p2
+ mrceq p15, 0, r10, c15, c0, 1 @ read diagnostic register
+ orreq r10, r10, #1 << 12 @ set bit #12
+ orreq r10, r10, #1 << 22 @ set bit #22
+ mcreq p15, 0, r10, c15, c0, 1 @ write diagnostic register
+#endif
+#ifdef CONFIG_ARM_ERRATA_743622
+ teq r5, #0x00200000 @ only present in r2p*
+ mrceq p15, 0, r10, c15, c0, 1 @ read diagnostic register
+ orreq r10, r10, #1 << 6 @ set bit #6
+ mcreq p15, 0, r10, c15, c0, 1 @ write diagnostic register
+#endif
+#if defined(CONFIG_ARM_ERRATA_751472) && defined(CONFIG_SMP)
+ ALT_SMP(cmp r6, #0x30) @ present prior to r3p0
+ ALT_UP_B(1f)
+ mrclt p15, 0, r10, c15, c0, 1 @ read diagnostic register
+ orrlt r10, r10, #1 << 11 @ set bit #11
+ mcrlt p15, 0, r10, c15, c0, 1 @ write diagnostic register
+1:
+#endif
+
+3: mov r10, #0
+ mcr p15, 0, r10, c7, c5, 0 @ I+BTB cache invalidate
+ @mcr p15, 0, r10, c7, c1, 0 @ invalidate entire I cache zx297510
+ @mcr p15, 0, r10, c7, c1, 6 @ invalidate entire BPA zx297510
+#ifdef CONFIG_MMU
+ mcr p15, 0, r10, c8, c7, 0 @ invalidate I + D TLBs
+ v7_ttb_setup r10, r4, r8, r5 @ TTBCR, TTBRx setup
+ ldr r5, =PRRR @ PRRR
+ ldr r6, =NMRR @ NMRR
+ mcr p15, 0, r5, c10, c2, 0 @ write PRRR
+ mcr p15, 0, r6, c10, c2, 1 @ write NMRR
+#endif
+ dsb @ Complete invalidations
+#ifndef CONFIG_ARM_THUMBEE
+ mrc p15, 0, r0, c0, c1, 0 @ read ID_PFR0 for ThumbEE
+ and r0, r0, #(0xf << 12) @ ThumbEE enabled field
+ teq r0, #(1 << 12) @ check if ThumbEE is present
+ bne 1f
+ mov r5, #0
+ mcr p14, 6, r5, c1, c0, 0 @ Initialize TEEHBR to 0
+ mrc p14, 6, r0, c0, c0, 0 @ load TEECR
+ orr r0, r0, #1 @ set the 1st bit in order to
+ mcr p14, 6, r0, c0, c0, 0 @ stop userspace TEEHBR access
+1:
+#endif
+ adr r5, v7_crval
+ ldmia r5, {r5, r6}
+#ifdef CONFIG_CPU_ENDIAN_BE8
+ orr r6, r6, #1 << 25 @ big-endian page tables
+#endif
+#ifdef CONFIG_SWP_EMULATE
+ orr r5, r5, #(1 << 10) @ set SW bit in "clear"
+ bic r6, r6, #(1 << 10) @ clear it in "mmuset"
+#endif
+ mrc p15, 0, r0, c1, c0, 0 @ read control register
+ bic r0, r0, r5 @ clear bits them
+ orr r0, r0, r6 @ set them
+ THUMB( orr r0, r0, #1 << 30 ) @ Thumb exceptions
+ mov pc, lr @ return to head.S:__ret
+ENDPROC(__v7_setup)
+
+ .align 2
+__v7_setup_stack:
+ .space 4 * 11 @ 11 registers
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions v7, dabort=v7_early_abort, pabort=v7_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv7"
+ string cpu_elf_name, "v7"
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+ /*
+ * Standard v7 proc info content
+ */
+.macro __v7_proc initfunc, mm_mmuflags = 0, io_mmuflags = 0, hwcaps = 0
+ ALT_SMP(.long PMD_TYPE_SECT | PMD_SECT_AP_WRITE | PMD_SECT_AP_READ | \
+ PMD_SECT_AF | PMD_FLAGS_SMP | \mm_mmuflags)
+ ALT_UP(.long PMD_TYPE_SECT | PMD_SECT_AP_WRITE | PMD_SECT_AP_READ | \
+ PMD_SECT_AF | PMD_FLAGS_UP | \mm_mmuflags)
+ .long PMD_TYPE_SECT | PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ | PMD_SECT_AF | \io_mmuflags
+ W(b) \initfunc
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP | HWCAP_HALF | HWCAP_THUMB | HWCAP_FAST_MULT | \
+ HWCAP_EDSP | HWCAP_TLS | \hwcaps
+ .long cpu_v7_name
+ .long v7_processor_functions
+ .long v7wbi_tlb_fns
+ .long v6_user_fns
+ .long v7_cache_fns
+.endm
+
+#ifndef CONFIG_ARM_LPAE
+ /*
+ * ARM Ltd. Cortex A5 processor.
+ */
+ .type __v7_ca5mp_proc_info, #object
+__v7_ca5mp_proc_info:
+ .long 0x410fc050
+ .long 0xff0ffff0
+ __v7_proc __v7_ca5mp_setup
+ .size __v7_ca5mp_proc_info, . - __v7_ca5mp_proc_info
+
+ /*
+ * ARM Ltd. Cortex A9 processor.
+ */
+ .type __v7_ca9mp_proc_info, #object
+__v7_ca9mp_proc_info:
+ .long 0x410fc090
+ .long 0xff0ffff0
+ __v7_proc __v7_ca9mp_setup
+ .size __v7_ca9mp_proc_info, . - __v7_ca9mp_proc_info
+#endif /* CONFIG_ARM_LPAE */
+
+ /*
+ * ARM Ltd. Cortex A7 processor.
+ */
+ .type __v7_ca7mp_proc_info, #object
+__v7_ca7mp_proc_info:
+ .long 0x410fc070
+ .long 0xff0ffff0
+ __v7_proc __v7_ca7mp_setup, hwcaps = HWCAP_IDIV
+ .size __v7_ca7mp_proc_info, . - __v7_ca7mp_proc_info
+
+ /*
+ * ARM Ltd. Cortex A15 processor.
+ */
+ .type __v7_ca15mp_proc_info, #object
+__v7_ca15mp_proc_info:
+ .long 0x410fc0f0
+ .long 0xff0ffff0
+ __v7_proc __v7_ca15mp_setup, hwcaps = HWCAP_IDIV
+ .size __v7_ca15mp_proc_info, . - __v7_ca15mp_proc_info
+
+ /*
+ * Match any ARMv7 processor core.
+ */
+ .type __v7_proc_info, #object
+__v7_proc_info:
+ .long 0x000f0000 @ Required ID value
+ .long 0x000f0000 @ Mask for ID
+ __v7_proc __v7_setup
+ .size __v7_proc_info, . - __v7_proc_info
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-xsc3.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-xsc3.S
new file mode 100644
index 0000000..a2d1e86
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-xsc3.S
@@ -0,0 +1,531 @@
+/*
+ * linux/arch/arm/mm/proc-xsc3.S
+ *
+ * Original Author: Matthew Gilbert
+ * Current Maintainer: Lennert Buytenhek <buytenh@wantstofly.org>
+ *
+ * Copyright 2004 (C) Intel Corp.
+ * Copyright 2005 (C) MontaVista Software, Inc.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * MMU functions for the Intel XScale3 Core (XSC3). The XSC3 core is
+ * an extension to Intel's original XScale core that adds the following
+ * features:
+ *
+ * - ARMv6 Supersections
+ * - Low Locality Reference pages (replaces mini-cache)
+ * - 36-bit addressing
+ * - L2 cache
+ * - Cache coherency if chipset supports it
+ *
+ * Based on original XScale code by Nicolas Pitre.
+ */
+
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be flushed. If the
+ * area is larger than this, then we flush the whole cache.
+ */
+#define MAX_AREA_SIZE 32768
+
+/*
+ * The cache line size of the L1 I, L1 D and unified L2 cache.
+ */
+#define CACHELINESIZE 32
+
+/*
+ * The size of the L1 D cache.
+ */
+#define CACHESIZE 32768
+
+/*
+ * This macro is used to wait for a CP15 write and is needed when we
+ * have to ensure that the last operation to the coprocessor was
+ * completed before continuing with operation.
+ */
+ .macro cpwait_ret, lr, rd
+ mrc p15, 0, \rd, c2, c0, 0 @ arbitrary read of cp15
+ sub pc, \lr, \rd, LSR #32 @ wait for completion and
+ @ flush instruction pipeline
+ .endm
+
+/*
+ * This macro cleans and invalidates the entire L1 D cache.
+ */
+
+ .macro clean_d_cache rd, rs
+ mov \rd, #0x1f00
+ orr \rd, \rd, #0x00e0
+1: mcr p15, 0, \rd, c7, c14, 2 @ clean/invalidate L1 D line
+ adds \rd, \rd, #0x40000000
+ bcc 1b
+ subs \rd, \rd, #0x20
+ bpl 1b
+ .endm
+
+ .text
+
+/*
+ * cpu_xsc3_proc_init()
+ *
+ * Nothing too exciting at the moment
+ */
+ENTRY(cpu_xsc3_proc_init)
+ mov pc, lr
+
+/*
+ * cpu_xsc3_proc_fin()
+ */
+ENTRY(cpu_xsc3_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1800 @ ...IZ...........
+ bic r0, r0, #0x0006 @ .............CA.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_xsc3_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_xsc3_reset)
+ mov r1, #PSR_F_BIT|PSR_I_BIT|SVC_MODE
+ msr cpsr_c, r1 @ reset CPSR
+ mrc p15, 0, r1, c1, c0, 0 @ ctrl register
+ bic r1, r1, #0x3900 @ ..VIZ..S........
+ bic r1, r1, #0x0086 @ ........B....CA.
+ mcr p15, 0, r1, c1, c0, 0 @ ctrl register
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate L1 caches and BTB
+ bic r1, r1, #0x0001 @ ...............M
+ mcr p15, 0, r1, c1, c0, 0 @ ctrl register
+ @ CAUTION: MMU turned off from this point. We count on the pipeline
+ @ already containing those two last instructions to survive.
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I and D TLBs
+ mov pc, r0
+ENDPROC(cpu_xsc3_reset)
+ .popsection
+
+/*
+ * cpu_xsc3_do_idle()
+ *
+ * Cause the processor to idle
+ *
+ * For now we do nothing but go to idle mode for every case
+ *
+ * XScale supports clock switching, but using idle mode support
+ * allows external hardware to react to system state changes.
+ */
+ .align 5
+
+ENTRY(cpu_xsc3_do_idle)
+ mov r0, #1
+ mcr p14, 0, r0, c7, c0, 0 @ go to idle
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(xsc3_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(xsc3_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(xsc3_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(xsc3_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+ clean_d_cache r0, r1
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ invalidate L1 I cache and BTB
+ mcrne p15, 0, ip, c7, c10, 4 @ data write barrier
+ mcrne p15, 0, ip, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, vm_flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - vma - vma_area_struct describing address space
+ */
+ .align 5
+ENTRY(xsc3_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #MAX_AREA_SIZE
+ bhs __flush_whole_cache
+
+1: tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c7, c5, 1 @ invalidate L1 I line
+ mcr p15, 0, r0, c7, c14, 1 @ clean/invalidate L1 D line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 6 @ invalidate BTB
+ mcrne p15, 0, ip, c7, c10, 4 @ data write barrier
+ mcrne p15, 0, ip, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the I cache and the D cache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * Note: single I-cache line invalidation isn't used here since
+ * it also trashes the mini I-cache used by JTAG debuggers.
+ */
+ENTRY(xsc3_coherent_kern_range)
+/* FALLTHROUGH */
+ENTRY(xsc3_coherent_user_range)
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean L1 D line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate L1 I cache and BTB
+ mcr p15, 0, r0, c7, c10, 4 @ data write barrier
+ mcr p15, 0, r0, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache.
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(xsc3_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean/invalidate L1 D line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate L1 I cache and BTB
+ mcr p15, 0, r0, c7, c10, 4 @ data write barrier
+ mcr p15, 0, r0, c7, c5, 4 @ prefetch flush
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+xsc3_dma_inv_range:
+ tst r0, #CACHELINESIZE - 1
+ bic r0, r0, #CACHELINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean L1 D line
+ tst r1, #CACHELINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean L1 D line
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate L1 D line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ data write barrier
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+xsc3_dma_clean_range:
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean L1 D line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ data write barrier
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(xsc3_dma_flush_range)
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c14, 1 @ clean/invalidate L1 D line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ data write barrier
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(xsc3_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq xsc3_dma_clean_range
+ bcs xsc3_dma_inv_range
+ b xsc3_dma_flush_range
+ENDPROC(xsc3_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(xsc3_dma_unmap_area)
+ mov pc, lr
+ENDPROC(xsc3_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions xsc3
+
+ENTRY(cpu_xsc3_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean L1 D line
+ add r0, r0, #CACHELINESIZE
+ subs r1, r1, #CACHELINESIZE
+ bhi 1b
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_xsc3_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_xsc3_switch_mm)
+ clean_d_cache r1, r2
+ mcr p15, 0, ip, c7, c5, 0 @ invalidate L1 I cache and BTB
+ mcr p15, 0, ip, c7, c10, 4 @ data write barrier
+ mcr p15, 0, ip, c7, c5, 4 @ prefetch flush
+ orr r0, r0, #0x18 @ cache the page table in L2
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I and D TLBs
+ cpwait_ret lr, ip
+
+/*
+ * cpu_xsc3_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ */
+cpu_xsc3_mt_table:
+ .long 0x00 @ L_PTE_MT_UNCACHED
+ .long PTE_EXT_TEX(1) @ L_PTE_MT_BUFFERABLE
+ .long PTE_EXT_TEX(5) | PTE_CACHEABLE @ L_PTE_MT_WRITETHROUGH
+ .long PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_WRITEBACK
+ .long PTE_EXT_TEX(1) | PTE_BUFFERABLE @ L_PTE_MT_DEV_SHARED
+ .long 0x00 @ unused
+ .long 0x00 @ L_PTE_MT_MINICACHE (not present)
+ .long PTE_EXT_TEX(5) | PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_WRITEALLOC (not present?)
+ .long 0x00 @ unused
+ .long PTE_EXT_TEX(1) @ L_PTE_MT_DEV_WC
+ .long 0x00 @ unused
+ .long PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_DEV_CACHED
+ .long PTE_EXT_TEX(2) @ L_PTE_MT_DEV_NONSHARED
+ .long 0x00 @ unused
+ .long 0x00 @ unused
+ .long 0x00 @ unused
+
+ .align 5
+ENTRY(cpu_xsc3_set_pte_ext)
+ xscale_set_pte_ext_prologue
+
+ tst r1, #L_PTE_SHARED @ shared?
+ and r1, r1, #L_PTE_MT_MASK
+ adr ip, cpu_xsc3_mt_table
+ ldr ip, [ip, r1]
+ orrne r2, r2, #PTE_EXT_COHERENT @ interlock: mask in coherent bit
+ bic r2, r2, #0x0c @ clear old C,B bits
+ orr r2, r2, ip
+
+ xscale_set_pte_ext_epilogue
+ mov pc, lr
+
+ .ltorg
+ .align
+
+.globl cpu_xsc3_suspend_size
+.equ cpu_xsc3_suspend_size, 4 * 6
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_xsc3_do_suspend)
+ stmfd sp!, {r4 - r9, lr}
+ mrc p14, 0, r4, c6, c0, 0 @ clock configuration, for turbo mode
+ mrc p15, 0, r5, c15, c1, 0 @ CP access reg
+ mrc p15, 0, r6, c13, c0, 0 @ PID
+ mrc p15, 0, r7, c3, c0, 0 @ domain ID
+ mrc p15, 0, r8, c1, c0, 1 @ auxiliary control reg
+ mrc p15, 0, r9, c1, c0, 0 @ control reg
+ bic r4, r4, #2 @ clear frequency change bit
+ stmia r0, {r4 - r9} @ store cp regs
+ ldmia sp!, {r4 - r9, pc}
+ENDPROC(cpu_xsc3_do_suspend)
+
+ENTRY(cpu_xsc3_do_resume)
+ ldmia r0, {r4 - r9} @ load cp regs
+ mov ip, #0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I & D caches, BTB
+ mcr p15, 0, ip, c7, c10, 4 @ drain write (&fill) buffer
+ mcr p15, 0, ip, c7, c5, 4 @ flush prefetch buffer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ mcr p14, 0, r4, c6, c0, 0 @ clock configuration, turbo mode.
+ mcr p15, 0, r5, c15, c1, 0 @ CP access reg
+ mcr p15, 0, r6, c13, c0, 0 @ PID
+ mcr p15, 0, r7, c3, c0, 0 @ domain ID
+ orr r1, r1, #0x18 @ cache the page table in L2
+ mcr p15, 0, r1, c2, c0, 0 @ translation table base addr
+ mcr p15, 0, r8, c1, c0, 1 @ auxiliary control reg
+ mov r0, r9 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_xsc3_do_resume)
+#endif
+
+ __CPUINIT
+
+ .type __xsc3_setup, #function
+__xsc3_setup:
+ mov r0, #PSR_F_BIT|PSR_I_BIT|SVC_MODE
+ msr cpsr_c, r0
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate L1 caches and BTB
+ mcr p15, 0, ip, c7, c10, 4 @ data write barrier
+ mcr p15, 0, ip, c7, c5, 4 @ prefetch flush
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I and D TLBs
+ orr r4, r4, #0x18 @ cache the page table in L2
+ mcr p15, 0, r4, c2, c0, 0 @ load page table pointer
+
+ mov r0, #1 << 6 @ cp6 access for early sched_clock
+ mcr p15, 0, r0, c15, c1, 0 @ write CP access register
+
+ mrc p15, 0, r0, c1, c0, 1 @ get auxiliary control reg
+ and r0, r0, #2 @ preserve bit P bit setting
+ orr r0, r0, #(1 << 10) @ enable L2 for LLR cache
+ mcr p15, 0, r0, c1, c0, 1 @ set auxiliary control reg
+
+ adr r5, xsc3_crval
+ ldmia r5, {r5, r6}
+
+#ifdef CONFIG_CACHE_XSC3L2
+ mrc p15, 1, r0, c0, c0, 1 @ get L2 present information
+ ands r0, r0, #0xf8
+ orrne r6, r6, #(1 << 26) @ enable L2 if present
+#endif
+
+ mrc p15, 0, r0, c1, c0, 0 @ get control register
+ bic r0, r0, r5 @ ..V. ..R. .... ..A.
+ orr r0, r0, r6 @ ..VI Z..S .... .C.M (mmu)
+ @ ...I Z..S .... .... (uc)
+ mov pc, lr
+
+ .size __xsc3_setup, . - __xsc3_setup
+
+ .type xsc3_crval, #object
+xsc3_crval:
+ crval clear=0x04002202, mmuset=0x00003905, ucset=0x00001900
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions xsc3, dabort=v5t_early_abort, pabort=legacy_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5"
+ string cpu_xsc3_name, "XScale-V3 based processor"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro xsc3_proc_info name:req, cpu_val:req, cpu_mask:req
+ .type __\name\()_proc_info,#object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __xsc3_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP
+ .long cpu_xsc3_name
+ .long xsc3_processor_functions
+ .long v4wbi_tlb_fns
+ .long xsc3_mc_user_fns
+ .long xsc3_cache_fns
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ xsc3_proc_info xsc3, 0x69056000, 0xffffe000
+
+/* Note: PXA935 changed its implementor ID from Intel to Marvell */
+ xsc3_proc_info xsc3_pxa935, 0x56056000, 0xffffe000
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-xscale.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-xscale.S
new file mode 100644
index 0000000..98646d0
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/proc-xscale.S
@@ -0,0 +1,658 @@
+/*
+ * linux/arch/arm/mm/proc-xscale.S
+ *
+ * Author: Nicolas Pitre
+ * Created: November 2000
+ * Copyright: (C) 2000, 2001 MontaVista Software Inc.
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * MMU functions for the Intel XScale CPUs
+ *
+ * 2001 Aug 21:
+ * some contributions by Brett Gaines <brett.w.gaines@intel.com>
+ * Copyright 2001 by Intel Corp.
+ *
+ * 2001 Sep 08:
+ * Completely revisited, many important fixes
+ * Nicolas Pitre <nico@fluxnic.net>
+ */
+
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/assembler.h>
+#include <asm/hwcap.h>
+#include <asm/pgtable.h>
+#include <asm/pgtable-hwdef.h>
+#include <asm/page.h>
+#include <asm/ptrace.h>
+#include "proc-macros.S"
+
+/*
+ * This is the maximum size of an area which will be flushed. If the area
+ * is larger than this, then we flush the whole cache
+ */
+#define MAX_AREA_SIZE 32768
+
+/*
+ * the cache line size of the I and D cache
+ */
+#define CACHELINESIZE 32
+
+/*
+ * the size of the data cache
+ */
+#define CACHESIZE 32768
+
+/*
+ * Virtual address used to allocate the cache when flushed
+ *
+ * This must be an address range which is _never_ used. It should
+ * apparently have a mapping in the corresponding page table for
+ * compatibility with future CPUs that _could_ require it. For instance we
+ * don't care.
+ *
+ * This must be aligned on a 2*CACHESIZE boundary. The code selects one of
+ * the 2 areas in alternance each time the clean_d_cache macro is used.
+ * Without this the XScale core exhibits cache eviction problems and no one
+ * knows why.
+ *
+ * Reminder: the vector table is located at 0xffff0000-0xffff0fff.
+ */
+#define CLEAN_ADDR 0xfffe0000
+
+/*
+ * This macro is used to wait for a CP15 write and is needed
+ * when we have to ensure that the last operation to the co-pro
+ * was completed before continuing with operation.
+ */
+ .macro cpwait, rd
+ mrc p15, 0, \rd, c2, c0, 0 @ arbitrary read of cp15
+ mov \rd, \rd @ wait for completion
+ sub pc, pc, #4 @ flush instruction pipeline
+ .endm
+
+ .macro cpwait_ret, lr, rd
+ mrc p15, 0, \rd, c2, c0, 0 @ arbitrary read of cp15
+ sub pc, \lr, \rd, LSR #32 @ wait for completion and
+ @ flush instruction pipeline
+ .endm
+
+/*
+ * This macro cleans the entire dcache using line allocate.
+ * The main loop has been unrolled to reduce loop overhead.
+ * rd and rs are two scratch registers.
+ */
+ .macro clean_d_cache, rd, rs
+ ldr \rs, =clean_addr
+ ldr \rd, [\rs]
+ eor \rd, \rd, #CACHESIZE
+ str \rd, [\rs]
+ add \rs, \rd, #CACHESIZE
+1: mcr p15, 0, \rd, c7, c2, 5 @ allocate D cache line
+ add \rd, \rd, #CACHELINESIZE
+ mcr p15, 0, \rd, c7, c2, 5 @ allocate D cache line
+ add \rd, \rd, #CACHELINESIZE
+ mcr p15, 0, \rd, c7, c2, 5 @ allocate D cache line
+ add \rd, \rd, #CACHELINESIZE
+ mcr p15, 0, \rd, c7, c2, 5 @ allocate D cache line
+ add \rd, \rd, #CACHELINESIZE
+ teq \rd, \rs
+ bne 1b
+ .endm
+
+ .data
+clean_addr: .word CLEAN_ADDR
+
+ .text
+
+/*
+ * cpu_xscale_proc_init()
+ *
+ * Nothing too exciting at the moment
+ */
+ENTRY(cpu_xscale_proc_init)
+ @ enable write buffer coalescing. Some bootloader disable it
+ mrc p15, 0, r1, c1, c0, 1
+ bic r1, r1, #1
+ mcr p15, 0, r1, c1, c0, 1
+ mov pc, lr
+
+/*
+ * cpu_xscale_proc_fin()
+ */
+ENTRY(cpu_xscale_proc_fin)
+ mrc p15, 0, r0, c1, c0, 0 @ ctrl register
+ bic r0, r0, #0x1800 @ ...IZ...........
+ bic r0, r0, #0x0006 @ .............CA.
+ mcr p15, 0, r0, c1, c0, 0 @ disable caches
+ mov pc, lr
+
+/*
+ * cpu_xscale_reset(loc)
+ *
+ * Perform a soft reset of the system. Put the CPU into the
+ * same state as it would be if it had been reset, and branch
+ * to what would be the reset vector.
+ *
+ * loc: location to jump to for soft reset
+ *
+ * Beware PXA270 erratum E7.
+ */
+ .align 5
+ .pushsection .idmap.text, "ax"
+ENTRY(cpu_xscale_reset)
+ mov r1, #PSR_F_BIT|PSR_I_BIT|SVC_MODE
+ msr cpsr_c, r1 @ reset CPSR
+ mcr p15, 0, r1, c10, c4, 1 @ unlock I-TLB
+ mcr p15, 0, r1, c8, c5, 0 @ invalidate I-TLB
+ mrc p15, 0, r1, c1, c0, 0 @ ctrl register
+ bic r1, r1, #0x0086 @ ........B....CA.
+ bic r1, r1, #0x3900 @ ..VIZ..S........
+ sub pc, pc, #4 @ flush pipeline
+ @ *** cache line aligned ***
+ mcr p15, 0, r1, c1, c0, 0 @ ctrl register
+ bic r1, r1, #0x0001 @ ...............M
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I,D caches & BTB
+ mcr p15, 0, r1, c1, c0, 0 @ ctrl register
+ @ CAUTION: MMU turned off from this point. We count on the pipeline
+ @ already containing those two last instructions to survive.
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ mov pc, r0
+ENDPROC(cpu_xscale_reset)
+ .popsection
+
+/*
+ * cpu_xscale_do_idle()
+ *
+ * Cause the processor to idle
+ *
+ * For now we do nothing but go to idle mode for every case
+ *
+ * XScale supports clock switching, but using idle mode support
+ * allows external hardware to react to system state changes.
+ */
+ .align 5
+
+ENTRY(cpu_xscale_do_idle)
+ mov r0, #1
+ mcr p14, 0, r0, c7, c0, 0 @ Go to IDLE
+ mov pc, lr
+
+/* ================================= CACHE ================================ */
+
+/*
+ * flush_icache_all()
+ *
+ * Unconditionally clean and invalidate the entire icache.
+ */
+ENTRY(xscale_flush_icache_all)
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ invalidate I cache
+ mov pc, lr
+ENDPROC(xscale_flush_icache_all)
+
+/*
+ * flush_user_cache_all()
+ *
+ * Invalidate all cache entries in a particular address
+ * space.
+ */
+ENTRY(xscale_flush_user_cache_all)
+ /* FALLTHROUGH */
+
+/*
+ * flush_kern_cache_all()
+ *
+ * Clean and invalidate the entire cache.
+ */
+ENTRY(xscale_flush_kern_cache_all)
+ mov r2, #VM_EXEC
+ mov ip, #0
+__flush_whole_cache:
+ clean_d_cache r0, r1
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 0 @ Invalidate I cache & BTB
+ mcrne p15, 0, ip, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * flush_user_cache_range(start, end, vm_flags)
+ *
+ * Invalidate a range of cache entries in the specified
+ * address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - vma - vma_area_struct describing address space
+ */
+ .align 5
+ENTRY(xscale_flush_user_cache_range)
+ mov ip, #0
+ sub r3, r1, r0 @ calculate total size
+ cmp r3, #MAX_AREA_SIZE
+ bhs __flush_whole_cache
+
+1: tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c7, c5, 1 @ Invalidate I cache line
+ mcr p15, 0, r0, c7, c10, 1 @ Clean D cache line
+ mcr p15, 0, r0, c7, c6, 1 @ Invalidate D cache line
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ tst r2, #VM_EXEC
+ mcrne p15, 0, ip, c7, c5, 6 @ Invalidate BTB
+ mcrne p15, 0, ip, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * coherent_kern_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ *
+ * Note: single I-cache line invalidation isn't used here since
+ * it also trashes the mini I-cache used by JTAG debuggers.
+ */
+ENTRY(xscale_coherent_kern_range)
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ Invalidate I cache & BTB
+ mcr p15, 0, r0, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * coherent_user_range(start, end)
+ *
+ * Ensure coherency between the Icache and the Dcache in the
+ * region described by start. If you have non-snooping
+ * Harvard caches, you need to implement this function.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(xscale_coherent_user_range)
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c5, 1 @ Invalidate I cache entry
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 6 @ Invalidate BTB
+ mcr p15, 0, r0, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * flush_kern_dcache_area(void *addr, size_t size)
+ *
+ * Ensure no D cache aliasing occurs, either with itself or
+ * the I cache
+ *
+ * - addr - kernel address
+ * - size - region size
+ */
+ENTRY(xscale_flush_kern_dcache_area)
+ add r1, r0, r1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mov r0, #0
+ mcr p15, 0, r0, c7, c5, 0 @ Invalidate I cache & BTB
+ mcr p15, 0, r0, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * dma_inv_range(start, end)
+ *
+ * Invalidate (discard) the specified virtual address range.
+ * May not write back any entries. If 'start' or 'end'
+ * are not cache line aligned, those lines must be written
+ * back.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+xscale_dma_inv_range:
+ tst r0, #CACHELINESIZE - 1
+ bic r0, r0, #CACHELINESIZE - 1
+ mcrne p15, 0, r0, c7, c10, 1 @ clean D entry
+ tst r1, #CACHELINESIZE - 1
+ mcrne p15, 0, r1, c7, c10, 1 @ clean D entry
+1: mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * dma_clean_range(start, end)
+ *
+ * Clean the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+xscale_dma_clean_range:
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * dma_flush_range(start, end)
+ *
+ * Clean and invalidate the specified virtual address range.
+ *
+ * - start - virtual start address
+ * - end - virtual end address
+ */
+ENTRY(xscale_dma_flush_range)
+ bic r0, r0, #CACHELINESIZE - 1
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ mcr p15, 0, r0, c7, c6, 1 @ invalidate D entry
+ add r0, r0, #CACHELINESIZE
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r0, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mov pc, lr
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(xscale_dma_map_area)
+ add r1, r1, r0
+ cmp r2, #DMA_TO_DEVICE
+ beq xscale_dma_clean_range
+ bcs xscale_dma_inv_range
+ b xscale_dma_flush_range
+ENDPROC(xscale_dma_map_area)
+
+/*
+ * dma_map_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(xscale_80200_A0_A1_dma_map_area)
+ add r1, r1, r0
+ teq r2, #DMA_TO_DEVICE
+ beq xscale_dma_clean_range
+ b xscale_dma_flush_range
+ENDPROC(xscale_80200_A0_A1_dma_map_area)
+
+/*
+ * dma_unmap_area(start, size, dir)
+ * - start - kernel virtual start address
+ * - size - size of region
+ * - dir - DMA direction
+ */
+ENTRY(xscale_dma_unmap_area)
+ mov pc, lr
+ENDPROC(xscale_dma_unmap_area)
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions xscale
+
+/*
+ * On stepping A0/A1 of the 80200, invalidating D-cache by line doesn't
+ * clear the dirty bits, which means that if we invalidate a dirty line,
+ * the dirty data can still be written back to external memory later on.
+ *
+ * The recommended workaround is to always do a clean D-cache line before
+ * doing an invalidate D-cache line, so on the affected processors,
+ * dma_inv_range() is implemented as dma_flush_range().
+ *
+ * See erratum #25 of "Intel 80200 Processor Specification Update",
+ * revision January 22, 2003, available at:
+ * http://www.intel.com/design/iio/specupdt/273415.htm
+ */
+.macro a0_alias basename
+ .globl xscale_80200_A0_A1_\basename
+ .type xscale_80200_A0_A1_\basename , %function
+ .equ xscale_80200_A0_A1_\basename , xscale_\basename
+.endm
+
+/*
+ * Most of the cache functions are unchanged for these processor revisions.
+ * Export suitable alias symbols for the unchanged functions:
+ */
+ a0_alias flush_icache_all
+ a0_alias flush_user_cache_all
+ a0_alias flush_kern_cache_all
+ a0_alias flush_user_cache_range
+ a0_alias coherent_kern_range
+ a0_alias coherent_user_range
+ a0_alias flush_kern_dcache_area
+ a0_alias dma_flush_range
+ a0_alias dma_unmap_area
+
+ @ define struct cpu_cache_fns (see <asm/cacheflush.h> and proc-macros.S)
+ define_cache_functions xscale_80200_A0_A1
+
+ENTRY(cpu_xscale_dcache_clean_area)
+1: mcr p15, 0, r0, c7, c10, 1 @ clean D entry
+ add r0, r0, #CACHELINESIZE
+ subs r1, r1, #CACHELINESIZE
+ bhi 1b
+ mov pc, lr
+
+/* =============================== PageTable ============================== */
+
+/*
+ * cpu_xscale_switch_mm(pgd)
+ *
+ * Set the translation base pointer to be as described by pgd.
+ *
+ * pgd: new page tables
+ */
+ .align 5
+ENTRY(cpu_xscale_switch_mm)
+ clean_d_cache r1, r2
+ mcr p15, 0, ip, c7, c5, 0 @ Invalidate I cache & BTB
+ mcr p15, 0, ip, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mcr p15, 0, r0, c2, c0, 0 @ load page table pointer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ cpwait_ret lr, ip
+
+/*
+ * cpu_xscale_set_pte_ext(ptep, pte, ext)
+ *
+ * Set a PTE and flush it out
+ *
+ * Errata 40: must set memory to write-through for user read-only pages.
+ */
+cpu_xscale_mt_table:
+ .long 0x00 @ L_PTE_MT_UNCACHED
+ .long PTE_BUFFERABLE @ L_PTE_MT_BUFFERABLE
+ .long PTE_CACHEABLE @ L_PTE_MT_WRITETHROUGH
+ .long PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_WRITEBACK
+ .long PTE_EXT_TEX(1) | PTE_BUFFERABLE @ L_PTE_MT_DEV_SHARED
+ .long 0x00 @ unused
+ .long PTE_EXT_TEX(1) | PTE_CACHEABLE @ L_PTE_MT_MINICACHE
+ .long PTE_EXT_TEX(1) | PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_WRITEALLOC
+ .long 0x00 @ unused
+ .long PTE_BUFFERABLE @ L_PTE_MT_DEV_WC
+ .long 0x00 @ unused
+ .long PTE_CACHEABLE | PTE_BUFFERABLE @ L_PTE_MT_DEV_CACHED
+ .long 0x00 @ L_PTE_MT_DEV_NONSHARED
+ .long 0x00 @ unused
+ .long 0x00 @ unused
+ .long 0x00 @ unused
+
+ .align 5
+ENTRY(cpu_xscale_set_pte_ext)
+ xscale_set_pte_ext_prologue
+
+ @
+ @ Erratum 40: must set memory to write-through for user read-only pages
+ @
+ and ip, r1, #(L_PTE_MT_MASK | L_PTE_USER | L_PTE_RDONLY) & ~(4 << 2)
+ teq ip, #L_PTE_MT_WRITEBACK | L_PTE_USER | L_PTE_RDONLY
+
+ moveq r1, #L_PTE_MT_WRITETHROUGH
+ and r1, r1, #L_PTE_MT_MASK
+ adr ip, cpu_xscale_mt_table
+ ldr ip, [ip, r1]
+ bic r2, r2, #0x0c
+ orr r2, r2, ip
+
+ xscale_set_pte_ext_epilogue
+ mov pc, lr
+
+ .ltorg
+ .align
+
+.globl cpu_xscale_suspend_size
+.equ cpu_xscale_suspend_size, 4 * 6
+#ifdef CONFIG_ARM_CPU_SUSPEND
+ENTRY(cpu_xscale_do_suspend)
+ stmfd sp!, {r4 - r9, lr}
+ mrc p14, 0, r4, c6, c0, 0 @ clock configuration, for turbo mode
+ mrc p15, 0, r5, c15, c1, 0 @ CP access reg
+ mrc p15, 0, r6, c13, c0, 0 @ PID
+ mrc p15, 0, r7, c3, c0, 0 @ domain ID
+ mrc p15, 0, r8, c1, c0, 1 @ auxiliary control reg
+ mrc p15, 0, r9, c1, c0, 0 @ control reg
+ bic r4, r4, #2 @ clear frequency change bit
+ stmia r0, {r4 - r9} @ store cp regs
+ ldmfd sp!, {r4 - r9, pc}
+ENDPROC(cpu_xscale_do_suspend)
+
+ENTRY(cpu_xscale_do_resume)
+ ldmia r0, {r4 - r9} @ load cp regs
+ mov ip, #0
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I & D TLBs
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I & D caches, BTB
+ mcr p14, 0, r4, c6, c0, 0 @ clock configuration, turbo mode.
+ mcr p15, 0, r5, c15, c1, 0 @ CP access reg
+ mcr p15, 0, r6, c13, c0, 0 @ PID
+ mcr p15, 0, r7, c3, c0, 0 @ domain ID
+ mcr p15, 0, r1, c2, c0, 0 @ translation table base addr
+ mcr p15, 0, r8, c1, c0, 1 @ auxiliary control reg
+ mov r0, r9 @ control register
+ b cpu_resume_mmu
+ENDPROC(cpu_xscale_do_resume)
+#endif
+
+ __CPUINIT
+
+ .type __xscale_setup, #function
+__xscale_setup:
+ mcr p15, 0, ip, c7, c7, 0 @ invalidate I, D caches & BTB
+ mcr p15, 0, ip, c7, c10, 4 @ Drain Write (& Fill) Buffer
+ mcr p15, 0, ip, c8, c7, 0 @ invalidate I, D TLBs
+ mov r0, #1 << 6 @ cp6 for IOP3xx and Bulverde
+ orr r0, r0, #1 << 13 @ Its undefined whether this
+ mcr p15, 0, r0, c15, c1, 0 @ affects USR or SVC modes
+
+ adr r5, xscale_crval
+ ldmia r5, {r5, r6}
+ mrc p15, 0, r0, c1, c0, 0 @ get control register
+ bic r0, r0, r5
+ orr r0, r0, r6
+ mov pc, lr
+ .size __xscale_setup, . - __xscale_setup
+
+ /*
+ * R
+ * .RVI ZFRS BLDP WCAM
+ * ..11 1.01 .... .101
+ *
+ */
+ .type xscale_crval, #object
+xscale_crval:
+ crval clear=0x00003b07, mmuset=0x00003905, ucset=0x00001900
+
+ __INITDATA
+
+ @ define struct processor (see <asm/proc-fns.h> and proc-macros.S)
+ define_processor_functions xscale, dabort=v5t_early_abort, pabort=legacy_pabort, suspend=1
+
+ .section ".rodata"
+
+ string cpu_arch_name, "armv5te"
+ string cpu_elf_name, "v5"
+
+ string cpu_80200_A0_A1_name, "XScale-80200 A0/A1"
+ string cpu_80200_name, "XScale-80200"
+ string cpu_80219_name, "XScale-80219"
+ string cpu_8032x_name, "XScale-IOP8032x Family"
+ string cpu_8033x_name, "XScale-IOP8033x Family"
+ string cpu_pxa250_name, "XScale-PXA250"
+ string cpu_pxa210_name, "XScale-PXA210"
+ string cpu_ixp42x_name, "XScale-IXP42x Family"
+ string cpu_ixp43x_name, "XScale-IXP43x Family"
+ string cpu_ixp46x_name, "XScale-IXP46x Family"
+ string cpu_ixp2400_name, "XScale-IXP2400"
+ string cpu_ixp2800_name, "XScale-IXP2800"
+ string cpu_pxa255_name, "XScale-PXA255"
+ string cpu_pxa270_name, "XScale-PXA270"
+
+ .align
+
+ .section ".proc.info.init", #alloc, #execinstr
+
+.macro xscale_proc_info name:req, cpu_val:req, cpu_mask:req, cpu_name:req, cache
+ .type __\name\()_proc_info,#object
+__\name\()_proc_info:
+ .long \cpu_val
+ .long \cpu_mask
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_BUFFERABLE | \
+ PMD_SECT_CACHEABLE | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ .long PMD_TYPE_SECT | \
+ PMD_SECT_AP_WRITE | \
+ PMD_SECT_AP_READ
+ b __xscale_setup
+ .long cpu_arch_name
+ .long cpu_elf_name
+ .long HWCAP_SWP|HWCAP_HALF|HWCAP_THUMB|HWCAP_FAST_MULT|HWCAP_EDSP
+ .long \cpu_name
+ .long xscale_processor_functions
+ .long v4wbi_tlb_fns
+ .long xscale_mc_user_fns
+ .ifb \cache
+ .long xscale_cache_fns
+ .else
+ .long \cache
+ .endif
+ .size __\name\()_proc_info, . - __\name\()_proc_info
+.endm
+
+ xscale_proc_info 80200_A0_A1, 0x69052000, 0xfffffffe, cpu_80200_name, \
+ cache=xscale_80200_A0_A1_cache_fns
+ xscale_proc_info 80200, 0x69052000, 0xfffffff0, cpu_80200_name
+ xscale_proc_info 80219, 0x69052e20, 0xffffffe0, cpu_80219_name
+ xscale_proc_info 8032x, 0x69052420, 0xfffff7e0, cpu_8032x_name
+ xscale_proc_info 8033x, 0x69054010, 0xfffffd30, cpu_8033x_name
+ xscale_proc_info pxa250, 0x69052100, 0xfffff7f0, cpu_pxa250_name
+ xscale_proc_info pxa210, 0x69052120, 0xfffff3f0, cpu_pxa210_name
+ xscale_proc_info ixp2400, 0x69054190, 0xfffffff0, cpu_ixp2400_name
+ xscale_proc_info ixp2800, 0x690541a0, 0xfffffff0, cpu_ixp2800_name
+ xscale_proc_info ixp42x, 0x690541c0, 0xffffffc0, cpu_ixp42x_name
+ xscale_proc_info ixp43x, 0x69054040, 0xfffffff0, cpu_ixp43x_name
+ xscale_proc_info ixp46x, 0x69054200, 0xffffff00, cpu_ixp46x_name
+ xscale_proc_info pxa255, 0x69052d00, 0xfffffff0, cpu_pxa255_name
+ xscale_proc_info pxa270, 0x69054110, 0xfffffff0, cpu_pxa270_name
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/ramdump_v7.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/ramdump_v7.c
new file mode 100755
index 0000000..4286b87
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/ramdump_v7.c
@@ -0,0 +1,617 @@
+/*******************************************************************************
+* °æÈ¨ËùÓÐ (C)2016, ÖÐÐËͨѶ¹É·ÝÓÐÏÞ¹«Ë¾¡£
+*
+* ÎļþÃû³Æ: ramdump_v7.c
+* Îļþ±êʶ: ramdump_v7.c
+* ÄÚÈÝÕªÒª: ramdump armv7´¦ÀíÆ÷ʵÏÖ
+*
+* ÐÞ¸ÄÈÕÆÚ °æ±¾ºÅ Ð޸ıê¼Ç ÐÞ¸ÄÈË ÐÞ¸ÄÄÚÈÝ
+* ------------------------------------------------------------------------------
+* 2016/6/10 V1.0 Create ÕÔ¾ü¿ü ´´½¨
+*
+*******************************************************************************/
+
+/*******************************************************************************
+* Í·Îļþ *
+*******************************************************************************/
+#include "ramdump_pub.h"
+#include "ramdump_oss.h"
+#include <asm/cacheflush.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/*******************************************************************************
+* Íⲿº¯ÊýÉùÃ÷ *
+*******************************************************************************/
+#ifdef _OS_LINUX
+//extern void armv7_clean_dcache_l1(void);
+extern void armv7_clean_dcache_all(void);
+extern void v7_flush_dcache_all(void);
+#endif
+
+/*******************************************************************************
+* ³£Á¿¶¨Òå *
+*******************************************************************************/
+
+/*******************************************************************************
+* ºê¶¨Òå *
+*******************************************************************************/
+#define RAMDUMP_REG_NR (15) /* R0-R14 */
+#define RAMDUMP_FIQ_REG_START (8) /* R8 */
+#define RAMDUMP_FIQ_REG_END (13) /* R12 */
+
+#define RAMDUMP_ARM_USR_MOD (0xd0)
+#define RAMDUMP_ARM_SVC_MOD (0xd3)
+
+/* code & data done instr */
+#define ramdump_dsb() asm volatile("dsb" : : : "memory")
+
+#ifndef __stringify
+#define __stringify_1(x...) #x
+#define __stringify(x...) __stringify_1(x)
+#endif
+
+/* CP15 */
+#ifndef __ACCESS_CP15
+#define __ACCESS_CP15(CRn, Op1, CRm, Op2) p15, Op1, %0, CRn, CRm, Op2
+#endif
+
+#ifdef __USE_MMU__
+/* mmu control regs */
+#define MMU_SCTLR __ACCESS_CP15(c1, 0, c0, 0)
+#define MMU_TTBCR __ACCESS_CP15(c2, 0, c0, 2)
+#define MMU_DACR __ACCESS_CP15(c3, 0, c0, 0)
+#define MMU_TTBR0 __ACCESS_CP15(c2, 0, c0, 0)
+#define MMU_TTBR1 __ACCESS_CP15(c2, 0, c0, 1)
+#elif defined (__USE_MPU__) //#ifdef __USE_MMU__
+/* mpu control regs */
+#define MPU_TYPE_REGISTER_DREGION_POS (8)
+
+#define MPU_REGION_NUM __ACCESS_CP15(c6, 0, c2, 0)
+#define MPU_REGION_BASE __ACCESS_CP15(c6, 0, c1, 0)
+#define MPU_REGION_ATTR __ACCESS_CP15(c6, 0, c1, 4)
+#define MPU_REGION_SIZE __ACCESS_CP15(c6, 0, c1, 2)
+#define MPU_REGION_MAXNUM __ACCESS_CP15(c0, 0, c0, 4)
+#endif //#ifdef __USE_MMU__
+#define MPU_DFSR __ACCESS_CP15(c5, 0, c0, 0)
+#define MPU_DFAR __ACCESS_CP15(c6, 0, c0, 0)
+#define MPU_IFSR __ACCESS_CP15(c5, 0, c0, 1)
+#define MPU_IFAR __ACCESS_CP15(c6, 0, c0, 2)
+
+
+#ifndef TOS_ARCH_DCACHE_CLEAN_ALL
+#define TOS_ARCH_DCACHE_CLEAN_ALL() \
+ do{ /* this macro can discard dirty cache lines. */ \
+ __asm__ volatile ( \
+ "mrc p15, 1, r0, c0, c0, 1;" \
+ "ands r3, r0, #0x07000000;" \
+ "mov r3, r3, lsr #23;" \
+ "beq 5f;" \
+ "mov r10, #0;" \
+ "1:" \
+ "add r2, r10, r10, lsr #1;" \
+ "mov r1, r0, lsr r2;" \
+ "and r1, r1, #7;" \
+ "cmp r1, #2;" \
+ "blt 4f;" \
+ "mcr p15, 2, r10, c0, c0, 0;" \
+ "isb;" \
+ "mrc p15, 1, r1, c0, c0, 0;" \
+ "and r2, r1, #7;" \
+ "add r2, r2, #4;" \
+ "ldr r4, =0x3FF;" \
+ "ands r4, r4, r1, lsr #3;" \
+ "clz r5, r4;" \
+ "mov r9, r4;" \
+ "2:" \
+ "ldr r7, =0x00007FFF;" \
+ "ands r7, r7, r1, lsr #13;" \
+ "3:" \
+ "orr r11, r10, r9, lsl r5;" \
+ "orr r11, r11, r7, lsl r2;" \
+ "mcr p15, 0, r11, c7, c10, 2;" \
+ "subs r7, r7, #1;" \
+ "bge 3b;" \
+ "subs r9, r9, #1;" \
+ "bge 2b;" \
+ "4:" \
+ "add r10, r10, #2;" \
+ "cmp r3, r10;" \
+ "bgt 1b;" \
+ "dsb;" \
+ "5:" \
+ : \
+ : \
+ : "r0", "r1", "r2", "r3", "r4", "r5", "r7", "r9", "r10", "r11" /* Clobber list */ \
+ ); \
+ }while(0);
+#endif
+/*******************************************************************************
+* Êý¾ÝÀàÐͶ¨Òå *
+*******************************************************************************/
+/*
+ * arm cpu mode pub regs
+ */
+typedef struct
+{
+ unsigned long sp;
+ unsigned long lr;
+ unsigned long spsr;
+} ramdump_arm_com_regs;
+/*
+ * arm fiq mode regs
+ */
+typedef struct
+{
+ unsigned long fiq_r8;
+ unsigned long fiq_r9;
+ unsigned long fiq_r10;
+ unsigned long fiq_r11;
+ unsigned long fiq_r12;
+ ramdump_arm_com_regs fiq_com;
+} ramdump_arm_fiq_regs;
+/*
+ * arm cpu modes info record
+ */
+typedef struct
+{
+ unsigned long regs[13]; /* r0-r12*/
+
+ ramdump_arm_com_regs sys;
+ ramdump_arm_com_regs svc;
+ ramdump_arm_com_regs abt;
+ ramdump_arm_com_regs udf;
+ ramdump_arm_com_regs irq;
+ ramdump_arm_fiq_regs fiq;
+} ramdump_arm_regs;
+
+/*******************************************************************************
+* ¾Ö²¿¾²Ì¬±äÁ¿¶¨Òå *
+*******************************************************************************/
+/*
+ * arm cpu sys mod, except usr, we have special handle
+ */
+static const unsigned long arm_sys_modes[] =
+{
+ 0xdf, /* SYS */
+ 0xd3, /* SVC */
+ 0xd7, /* ABT */
+ 0xdb, /* UND */
+ 0xd2, /* IRQ */
+ 0xd1, /* FIQ */
+};
+
+/*******************************************************************************
+* È«¾Ö±äÁ¿¶¨Òå *
+*******************************************************************************/
+ramdump_arm_regs arm_all_modes_regs;
+
+/*******************************************************************************
+* ¾Ö²¿º¯ÊýʵÏÖ *
+*******************************************************************************/
+
+#ifdef __USE_MMU__
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armv7_get_SCTLR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: void
+* ÆäËü˵Ã÷: armv7 mmu SCTLR registers recover
+*******************************************************************************/
+static unsigned long armv7_get_SCTLR(void)
+{
+ unsigned long scrtlr_reg;
+
+ asm volatile("mrc " __stringify(MMU_SCTLR) : "=r" (scrtlr_reg));
+
+ return scrtlr_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armv7_get_TTBCR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: ttbcr value
+* ÆäËü˵Ã÷: armv7 mmu Control registers recover
+*******************************************************************************/
+static unsigned long armv7_get_TTBCR(void)
+{
+ unsigned long ttbcr_reg;
+
+ asm volatile("mrc " __stringify(MMU_TTBCR) : "=r" (ttbcr_reg));
+
+ return ttbcr_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armv7_get_DACR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: dacr value
+* ÆäËü˵Ã÷: armv7 mmu Domain registers recover
+*******************************************************************************/
+static unsigned long armv7_get_DACR(void)
+{
+ unsigned long dacr_reg;
+
+ asm volatile("mrc " __stringify(MMU_DACR) : "=r" (dacr_reg));
+
+ return dacr_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armv7_get_TTBR0
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: ttbr0 value
+* ÆäËü˵Ã÷: armv7 mmu TTBR0 registers recover
+*******************************************************************************/
+static unsigned long armv7_get_TTBR0(void)
+{
+ unsigned long ttbr0_reg;
+
+ asm volatile("mrc " __stringify(MMU_TTBR0) : "=r" (ttbr0_reg));
+
+ return ttbr0_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armv7_get_TTBR1
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: ttbr1 value
+* ÆäËü˵Ã÷: armv7 mmu TTBR1 registers recover
+*******************************************************************************/
+static unsigned long armv7_get_TTBR1(void)
+{
+ unsigned long ttbr1_reg;
+
+ asm volatile("mrc " __stringify(MMU_TTBR1) : "=r" (ttbr1_reg));
+
+ return ttbr1_reg;
+}
+
+#elif defined (__USE_MPU__) // #ifdef __USE_MMU__
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_set_RegionNum
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) nr: number
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: region set nr
+* ÆäËü˵Ã÷: armv7 mpu set region number, select region
+*******************************************************************************/
+static void armr7_mpu_region_set_nr(unsigned long nr)
+{
+ unsigned long region_num;
+
+ asm volatile("mrc " __stringify(MPU_REGION_NUM) : "=r" (region_num));
+
+ return region_num;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_RegionBase
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: region base
+* ÆäËü˵Ã÷: armv7 mpu get region base address
+*******************************************************************************/
+static unsigned long armr7_mpu_region_get_base(void)
+{
+ unsigned long region_base;
+
+ asm volatile("mrc " __stringify(MPU_REGION_BASE) : "=r" (region_base));
+
+ return region_base;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_RegionAttr
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: region attr
+* ÆäËü˵Ã÷: armv7 mpu get region attribution
+*******************************************************************************/
+static unsigned long armr7_mpu_region_get_attr(void)
+{
+ unsigned long region_attr;
+
+ asm volatile("mrc " __stringify(MPU_REGION_ATTR) : "=r" (region_attr));
+
+ return region_attr;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_RegionSize
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: region size
+* ÆäËü˵Ã÷: armv7 mpu get region size and enable reg
+*******************************************************************************/
+static unsigned long armr7_mpu_region_get_size(void)
+{
+ unsigned long region_size;
+
+ asm volatile("mrc " __stringify(MPU_REGION_SIZE) : "=r" (region_size));
+
+ return region_size;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_RegionMaxNum
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: region max number
+* ÆäËü˵Ã÷: armv7 mpu get region max num
+*******************************************************************************/
+static unsigned long armr7_mpu_region_get_max_nr(void)
+{
+ unsigned long region_max_num;
+
+ asm volatile("mrc " __stringify(MPU_REGION_MAXNUM) : "=r" (region_max_num));
+
+ return (region_max_num >> 8);
+}
+#endif // #ifdef __USE_MMU__
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_DFSR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: dfsr value
+* ÆäËü˵Ã÷: armv7 mpu get DFSR
+*******************************************************************************/
+static unsigned long armr7_mpu_get_DFSR(void)
+{
+ unsigned long dfsr_reg;
+
+ asm volatile("mrc " __stringify(MPU_DFSR) : "=r" (dfsr_reg));
+
+ return dfsr_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_DFAR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: dfar value
+* ÆäËü˵Ã÷: armv7 mpu get DFAR
+*******************************************************************************/
+static unsigned long armr7_mpu_get_DFAR(void)
+{
+ unsigned long dfar_reg;
+
+ asm volatile("mrc " __stringify(MPU_DFAR) : "=r" (dfar_reg));
+
+ return dfar_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_IFSR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: ifsr value
+* ÆäËü˵Ã÷: armv7 mpu get IFSR
+*******************************************************************************/
+static unsigned long armr7_mpu_get_IFSR(void)
+{
+ unsigned long ifsr_reg;
+
+ asm volatile("mrc " __stringify(MPU_IFSR) : "=r" (ifsr_reg));
+
+ return ifsr_reg;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armr7_mpu_get_IFAR
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: unsigned long: ifar value
+* ÆäËü˵Ã÷: armv7 mpu get IFAR
+*******************************************************************************/
+static unsigned long armr7_mpu_get_IFAR(void)
+{
+ unsigned long ifar_reg;
+
+ asm volatile("mrc " __stringify(MPU_IFAR) : "=r" (ifar_reg));
+
+ return ifar_reg;
+}
+
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: arm_store_sys_regs
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) mem: addr points to buf start
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: addr: changed addr
+* ÆäËü˵Ã÷:
+*******************************************************************************/
+static unsigned char *arm_store_sys_regs(unsigned char *mem)
+{
+ unsigned long *fiq_regs = NULL;
+ ramdump_arm_com_regs *ptr_mode_regs = NULL;
+ unsigned long fiq_regs_nr = RAMDUMP_FIQ_REG_START;
+ unsigned long arm_sys_mode_nr = 0;
+
+ //SYS/SVC/ABT/UND/IRQ
+ ptr_mode_regs = (ramdump_arm_com_regs*)(&arm_all_modes_regs.sys);
+ do {
+ mem += sprintf(mem, "r.s cpsr 0x%lx\n", (unsigned long)arm_sys_modes[arm_sys_mode_nr]);
+ mem += sprintf(mem, "r.s r13 0x%lx\n", (unsigned long)(ptr_mode_regs->sp));
+ mem += sprintf(mem, "r.s r14 0x%lx\n", (unsigned long)(ptr_mode_regs->lr));
+ mem += sprintf(mem, "r.s spsr 0x%lx\n", (unsigned long)(ptr_mode_regs->spsr));
+ ptr_mode_regs++;
+ arm_sys_mode_nr++;
+ } while (arm_sys_mode_nr < (RAMDUMP_ARRAY_NR(arm_sys_modes) - 1));
+
+ //FIQ r8-r12
+ mem += sprintf(mem, "r.s cpsr 0x%lx\n", (unsigned long)arm_sys_modes[arm_sys_mode_nr]);
+ fiq_regs = ((unsigned long*)&arm_all_modes_regs.fiq.fiq_r8);
+ do {
+ mem += sprintf(mem, "r.s r%d 0x%lx\n", fiq_regs_nr, *(fiq_regs));
+ fiq_regs++;
+ fiq_regs_nr++;
+ } while (fiq_regs_nr < RAMDUMP_FIQ_REG_END);
+
+ //FIQ r13-r14/cpsr
+ ptr_mode_regs = &arm_all_modes_regs.fiq.fiq_com;
+ mem += sprintf(mem, "r.s r13 0x%lx\n", (unsigned long)(ptr_mode_regs->sp));
+ mem += sprintf(mem, "r.s r14 0x%lx\n", (unsigned long)(ptr_mode_regs->lr));
+ mem += sprintf(mem, "r.s spsr 0x%lx\n", (unsigned long)(ptr_mode_regs->spsr));
+
+ return mem;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: arm_store_cur_regs
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) mem: addr points to buf start
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: addr: changed addr
+* ÆäËü˵Ã÷:
+*******************************************************************************/
+static unsigned char *arm_store_cur_regs(unsigned char *mem)
+{
+ unsigned long cnt;
+ unsigned long *svc_regs = (unsigned long *)arm_all_modes_regs.regs;
+
+ mem += sprintf(mem, "r.s cpsr 0x%lx\n", (unsigned long)RAMDUMP_ARM_SVC_MOD);
+ for (cnt = 0x00; cnt < RAMDUMP_ARRAY_NR(arm_all_modes_regs.regs); cnt++)
+ mem += sprintf(mem, "r.s r%d 0x%lx\n", cnt, *svc_regs++);
+ mem += sprintf(mem, "r.s r13 0x%lx\n", arm_all_modes_regs.svc.sp);
+ mem += sprintf(mem, "r.s r14 0x%lx\n", arm_all_modes_regs.svc.lr);
+ mem += sprintf(mem, "r.s pc 0x%lx\n", arm_all_modes_regs.svc.lr);
+ mem += sprintf(mem, "r.s spsr 0x%lx\n", arm_all_modes_regs.svc.spsr);
+
+ return mem;
+}
+
+/*******************************************************************************
+* È«¾Öº¯ÊýʵÏÖ *
+*******************************************************************************/
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: ramdump_arch_clean_and_invalid_caches
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: void
+* ÆäËü˵Ã÷: This function is used for arm clean and invalid caches
+*******************************************************************************/
+void ramdump_arch_clean_and_invalid_caches(void)
+{
+#ifdef _OS_TOS
+ TOS_CACHE_CLEAN_INVALIDATE_ALL();
+#endif
+}
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: ramdump_arch_clean_caches
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) void
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: void
+* ÆäËü˵Ã÷: This function is used for arm clean caches
+*******************************************************************************/
+void ramdump_arch_clean_caches(void)
+{
+#ifdef _OS_LINUX
+ #if 0
+ /* clean l1 cache */
+ armv7_clean_dcache_l1();
+ ramdump_dsb();
+ /*
+ * clean l2 caches
+ */
+ outer_flush_all();
+ ramdump_dsb();
+ #endif
+ //v7_flush_dcache_all();
+ flush_cache_all();
+ outer_flush_all();
+#elif defined (_OS_TOS)
+ TOS_ARCH_DCACHE_CLEAN_ALL();
+#endif
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: ramdump_arch_store_modes_regs
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) mem: addr points to buf start
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: addr: changed addr
+* ÆäËü˵Ã÷: This function is used for linux clean caches
+*******************************************************************************/
+unsigned char *ramdump_arch_store_modes_regs(unsigned char *mem)
+{
+ // store privileged regs
+ mem = arm_store_sys_regs(mem);
+
+ // store usr regs, user app is running in svc mod
+ mem = arm_store_cur_regs(mem);
+
+ return mem;
+}
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: ramdump_arch_store_mm_regs
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý) mem: addr points to buf start
+* (´«³ö²ÎÊý) void
+* ·µ »Ø Öµ: addr: changed addr
+* ÆäËü˵Ã÷: This function is used for linux clean caches
+*******************************************************************************/
+unsigned char *ramdump_arch_store_mm_regs(unsigned char *mem)
+{
+#ifdef __USE_MMU__
+
+ mem += sprintf(mem, "per.s c15:0x1 %%long %#lx\r\n", armv7_get_SCTLR());
+ mem += sprintf(mem, "per.s c15:0x2 %%long %#lx\r\n", armv7_get_TTBR0());
+ mem += sprintf(mem, "per.s c15:0x102 %%long %#lx\r\n", armv7_get_TTBR1());
+ mem += sprintf(mem, "per.s c15:0x202 %%long %#lx\r\n", armv7_get_TTBCR());
+ mem += sprintf(mem, "per.s c15:0x3 %%long %#lx\r\n", armv7_get_DACR());
+
+#elif defined (__USE_MPU__) //#ifdef __USE_MMU__
+
+ unsigned long i = 0;
+
+ mem += sprintf(mem, "per.s c15:0x4 %%long %#lx\r\n", (unsigned long)((armr7_mpu_region_get_max_nr() << MPU_TYPE_REGISTER_DREGION_POS)));
+ for(i = 0; i < armr7_mpu_region_get_max_nr(); i++)
+ {
+ mem += sprintf(mem, "per.s c15:0x26 %%long %#lx\r\n", (unsigned long)i);
+ armr7_mpu_region_set_nr(i);
+ mem += sprintf(mem, "per.s c15:0x16 %%long %#lx\r\n", (unsigned long)(armr7_mpu_region_get_base()));
+ mem += sprintf(mem, "per.s c15:0x216 %%long %#lx\r\n", (unsigned long)(armr7_mpu_region_get_size()));
+ mem += sprintf(mem, "per.s c15:0x416 %%long %#lx\r\n", (unsigned long)(armr7_mpu_region_get_attr()));
+ }
+#endif //#ifdef __USE_MMU__
+
+ /* DFSR/DFAR IFSR/IFAR */
+ mem += sprintf(mem, "per.s c15:0x5 %%long %#lx\r\n", (unsigned long)(armr7_mpu_get_DFSR()));
+ mem += sprintf(mem, "per.s c15:0x6 %%long %#lx\r\n", (unsigned long)(armr7_mpu_get_DFAR()));
+ mem += sprintf(mem, "per.s c15:0x105 %%long %#lx\r\n", (unsigned long)(armr7_mpu_get_IFSR()));
+ mem += sprintf(mem, "per.s c15:0x206 %%long %#lx\r\n", (unsigned long)(armr7_mpu_get_IFAR()));
+
+ return mem;
+}
+
+#ifdef __cplusplus
+}
+#endif
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/ramdump_v7_asm.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/ramdump_v7_asm.S
new file mode 100755
index 0000000..00f33f4
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/ramdump_v7_asm.S
@@ -0,0 +1,147 @@
+/*******************************************************************************
+* °æÈ¨ËùÓÐ (C)2015, ÖÐÐËͨѶ¹É·ÝÓÐÏÞ¹«Ë¾¡£
+*
+* ÎļþÃû³Æ: ramdump_v7_asm.S
+* Îļþ±êʶ: ramdump_v7_asm.S
+* ÄÚÈÝÕªÒª:
+*
+* ÐÞ¸ÄÈÕÆÚ °æ±¾ºÅ Ð޸ıê¼Ç ÐÞ¸ÄÈË ÐÞ¸ÄÄÚÈÝ
+* ------------------------------------------------------------------------------
+* 2016/06/20 V1.0 Create ÕÔ¾ü¿ü ´´½¨
+*
+*******************************************************************************/
+
+/*******************************************************************************
+* Í·Îļþ *
+*******************************************************************************/
+
+/*******************************************************************************
+* ³£Á¿¶¨Òå *
+*******************************************************************************/
+
+/*******************************************************************************
+* ºê¶¨Òå *
+*******************************************************************************/
+
+/*******************************************************************************
+* Êý¾ÝÀàÐͶ¨Òå *
+*******************************************************************************/
+
+/*******************************************************************************
+* ¾Ö²¿º¯ÊýÉùÃ÷ *
+*******************************************************************************/
+
+/*******************************************************************************
+* ¾Ö²¿¾²Ì¬±äÁ¿¶¨Òå *
+*******************************************************************************/
+
+/*******************************************************************************
+* È«¾Ö±äÁ¿¶¨Òå *
+*******************************************************************************/
+.extern arm_all_modes_regs
+
+.global ramdump_arch_save_all_regs
+.global armv7_clean_dcache_l1
+
+.arm
+/*******************************************************************************
+* ¾Ö²¿º¯ÊýʵÏÖ *
+*******************************************************************************/
+
+/*******************************************************************************
+* È«¾Öº¯ÊýʵÏÖ *
+*******************************************************************************/
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: ramdump_arch_save_all_regs
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý)
+* (´«³ö²ÎÊý)
+* ·µ »Ø Öµ:
+* ÆäËü˵Ã÷: This function is used for linux ramdump registers recover
+* usr mode doesn`t need to store,we have special handle
+*******************************************************************************/
+.text
+.balign 4
+.type ramdump_arch_save_all_regs, %function
+ramdump_arch_save_all_regs:
+ push {r14}
+ ldr r14, =arm_all_modes_regs
+ stm r14!, {r0-r12} /* ±£´ær0-r12 */
+ mov r0, r14 /* ±£´ær14ÖÁr0£¬ºóÐøÒÔr0Ϊ»ùµØÖ·Ñ¹Õ» */
+ ldr r14, [r13], #4 /* »¹Ôr13,r14 */
+ mrs r1, CPSR /* ±£´æcpsrÖÁr1 */
+ msr CPSR_c, #0xdf /* SYS mode */
+ stm r0!, {r13, r14} /* ½«{r13,r14}ÈëÕ» */
+//mrs r2, SPSR
+ str r2, [r0], #4 /* ½«SPSRÈëÕ» */
+ msr CPSR_c, #0xd3 /* svc mode */
+ stm r0!, {r13, r14} /* ½«{r13,r14} */
+ mrs r2, SPSR
+ str r2, [r0], #4 /* ½«SPSRÈëÕ» */
+ msr CPSR_c, #0xd7 /* ABT mode */
+ mrs r2, SPSR
+ stm r0!, {r13, r14}
+ str r2, [r0], #4
+ msr CPSR_c, #0xdb /* UND mode */
+ mrs r2, SPSR
+ stm r0!, {r13, r14}
+ str r2, [r0], #4
+ msr CPSR_c, #0xd2 /* IRQ mode */
+ mrs r2, SPSR
+ stm r0!, {r13, r14}
+ str r2, [r0], #4
+ msr CPSR_c, #0xd1 /* FIQ mode */
+ mrs r2, SPSR
+ stm r0!, {r8-r14}
+ str r2, [r0], #4
+ msr CPSR_c, r1 /* »¹ÔCPRS */
+ ldr r14, =arm_all_modes_regs /* »¹Ô¼Ä´æÆ÷ */
+ ldm r14!, {r0-r12} /* »¹Ôr0-r12£¬r13µÄֵ֮ǰÒÑ»¹Ô */
+ ldmdb r13, {R14} /* »¹Ôr14 */
+ bx r14 /* ·µ»Ø */
+
+/*******************************************************************************
+* ¹¦ÄÜÃèÊö: armv7_clean_dcache_l1
+* ²ÎÊý˵Ã÷:
+* (´«Èë²ÎÊý)
+* (´«³ö²ÎÊý)
+* ·µ »Ø Öµ:
+* ÆäËü˵Ã÷: This function is used for linux clean l1 cache
+*******************************************************************************/
+.type armv7_clean_dcache_l1, %function
+armv7_clean_dcache_l1:
+ stmfd sp!, {r4, lr}
+
+ mov r0, #0 /* Select L1 Data/Unified cache */
+ mcr p15,2,r0,c0,c0,0
+ mrc p15,1,r0,c0,c0,0 /* Read size (CCSIDR) */
+ ubfx r3, r0, #13, #15 /* sets - 1 */
+ add r3, r3, #1 /* sets */
+ ubfx r4, r0, #0, #3 /* log2(words per line) - 2 */
+ add r4, r4, #4 /* set shift = log2(bytes per line) */
+ ubfx r2, r0, #3, #10 /* ways - 1 */
+ clz r12, r2 /* way shift */
+ add r2, r2, #1 /* ways */
+
+ /* r2,r3 inner, outer loop targets, r1 inner loop counter, r0 zero */
+0:
+ cmp r3, #0
+ beq 20f
+ sub r3, r3, #1
+ mov r1, r2
+
+10:
+ cmp r1, #0
+ beq 0b
+ sub r1, r1, #1
+ mov r0, r1, lsl r12 /* Fill in Way field */
+ orr r0, r0, r3, lsl r4 /* Fill in Set field */
+ mcr p15,0,r0,c7,c10,2 /* DCCSW */
+ b 10b
+
+20:
+ dsb
+ pop {r4, lr}
+ bx lr
+
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/rodata.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/rodata.c
new file mode 100755
index 0000000..bbb7551
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/rodata.c
@@ -0,0 +1,139 @@
+#include <linux/kernel.h>
+#include <linux/mm.h>
+#include <linux/module.h>
+
+#include <asm/cache.h>
+#include <asm/pgtable.h>
+#include <asm/rodata.h>
+#include <asm/sections.h>
+#include <asm/tlbflush.h>
+
+#include "mm.h"
+
+static int kernel_set_to_readonly __read_mostly;
+
+static int set_page_attributes(unsigned long virt, int numpages,
+ pte_t (*f)(pte_t))
+{
+ pmd_t *pmd;
+ pte_t *pte;
+ unsigned long start = virt;
+ unsigned long end = virt + (numpages << PAGE_SHIFT);
+ unsigned long pmd_end;
+
+ while (virt < end) {
+ pmd = pmd_off_k(virt);
+ pmd_end = min(ALIGN(virt + 1, PMD_SIZE), end);
+
+ if ((pmd_val(*pmd) & PMD_TYPE_MASK) != PMD_TYPE_TABLE) {
+ pr_err("%s: pmd %p=%08lx for %08lx not page table\n",
+ __func__, pmd, pmd_val(*pmd), virt);
+ virt = pmd_end;
+ continue;
+ }
+
+ while (virt < pmd_end) {
+ pte = pte_offset_kernel(pmd, virt);
+ set_pte_ext(pte, f(*pte), 0);
+ virt += PAGE_SIZE;
+ }
+ }
+
+ flush_tlb_kernel_range(start, end);
+
+ return 0;
+}
+
+int set_memory_rw(unsigned long virt, int numpages)
+{
+ return set_page_attributes(virt, numpages, pte_mkwrite);
+}
+EXPORT_SYMBOL(set_memory_rw);
+
+int set_memory_ro(unsigned long virt, int numpages)
+{
+ return set_page_attributes(virt, numpages, pte_wrprotect);
+}
+EXPORT_SYMBOL(set_memory_ro);
+
+#ifdef CONFIG_DEBUG_RODATA_TEST
+static const int rodata_test_data = 0xC3;
+
+static noinline void rodata_test(void)
+{
+ int re;
+
+ pr_info("%s: attempting to write to read-only section:\n", __func__);
+
+ if (*(volatile int *)&rodata_test_data != 0xC3) {
+ pr_err("read only data changed before test\n");
+ return;
+ }
+
+ asm volatile(
+ "0: str %[zero], [%[rodata_test_data]]\n"
+ " mov %[result], #0xFF\n"
+ " b 2f\n"
+ "1: mov %[result], #1\n"
+ "2:\n"
+
+ ".pushsection __ex_table, \"a\"\n"
+ " .long 0b, 1b\n"
+ ".popsection\n"
+
+ : [re] "=r" (re)
+ : [rodata_test_data] "r" (&rodata_test_data), [zero] "r" (0)
+ : "memory"
+ );
+
+ if (re == 1)
+ pr_info("write to read-only section trapped, success\n");
+ else
+ pr_err("write to read-only section NOT trapped, test failed\n");
+
+ if (*(volatile int *)&rodata_test_data != 0xC3)
+ pr_err("read only data changed during write\n");
+}
+#else
+static inline void rodata_test(void) { }
+#endif
+
+void set_kernel_text_ro(void)
+{
+ unsigned long start_addr = PAGE_ALIGN((unsigned long)_text);
+ unsigned long size = PAGE_ALIGN((unsigned long)__end_rodata) - start_addr;
+
+ if (!kernel_set_to_readonly)
+ return;
+
+ pr_info_once("Write protecting the kernel text section %lx - %lx\n",
+ start_addr, start_addr + size);
+
+ pr_debug("Set kernel text: %lx - %lx to read only\n",
+ start_addr, start_addr + size);
+
+ set_memory_ro(start_addr, size >> PAGE_SHIFT);
+}
+
+void set_kernel_text_rw(void)
+{
+ unsigned long start_addr = PAGE_ALIGN((unsigned long)_text);
+ unsigned long size = PAGE_ALIGN((unsigned long)__end_rodata) - start_addr;
+
+ if (!kernel_set_to_readonly)
+ return;
+
+ pr_debug("Set kernel text: %lx - %lx to read-write\n",
+ start_addr, start_addr + size);
+
+ set_memory_rw(start_addr, size >> PAGE_SHIFT);
+}
+
+void mark_rodata_ro(void)
+{
+ kernel_set_to_readonly = 1;
+
+ set_kernel_text_ro();
+
+ rodata_test();
+}
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-fa.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-fa.S
new file mode 100644
index 0000000..d3ddcf9
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-fa.S
@@ -0,0 +1,69 @@
+/*
+ * linux/arch/arm/mm/tlb-fa.S
+ *
+ * Copyright (C) 2005 Faraday Corp.
+ * Copyright (C) 2008-2009 Paulius Zaleckas <paulius.zaleckas@teltonika.lt>
+ *
+ * Based on tlb-v4wbi.S:
+ * Copyright (C) 1997-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 4, Faraday variation.
+ * This assume an unified TLBs, with a write buffer, and branch target buffer (BTB)
+ *
+ * Processors: FA520 FA526 FA626
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/asm-offsets.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+
+/*
+ * flush_user_tlb_range(start, end, mm)
+ *
+ * Invalidate a range of TLB entries in the specified address space.
+ *
+ * - start - range start address
+ * - end - range end address
+ * - mm - mm_struct describing address space
+ */
+ .align 4
+ENTRY(fa_flush_user_tlb_range)
+ vma_vm_mm ip, r2
+ act_mm r3 @ get current->active_mm
+ eors r3, ip, r3 @ == mm ?
+ movne pc, lr @ no, we dont do anything
+ mov r3, #0
+ mcr p15, 0, r3, c7, c10, 4 @ drain WB
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: mcr p15, 0, r0, c8, c7, 1 @ invalidate UTLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r3, c7, c10, 4 @ data write barrier
+ mov pc, lr
+
+
+ENTRY(fa_flush_kern_tlb_range)
+ mov r3, #0
+ mcr p15, 0, r3, c7, c10, 4 @ drain WB
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: mcr p15, 0, r0, c8, c7, 1 @ invalidate UTLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r3, c7, c10, 4 @ data write barrier
+ mcr p15, 0, r3, c7, c5, 4 @ prefetch flush (isb)
+ mov pc, lr
+
+ __INITDATA
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions fa, fa_tlb_flags
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v3.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v3.S
new file mode 100644
index 0000000..d253995
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v3.S
@@ -0,0 +1,48 @@
+/*
+ * linux/arch/arm/mm/tlbv3.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 3 TLB handling functions.
+ *
+ * Processors: ARM610, ARM710.
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/asm-offsets.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+ .align 5
+/*
+ * v3_flush_user_tlb_range(start, end, mm)
+ *
+ * Invalidate a range of TLB entries in the specified address space.
+ *
+ * - start - range start address
+ * - end - range end address
+ * - mm - mm_struct describing address space
+ */
+ .align 5
+ENTRY(v3_flush_user_tlb_range)
+ vma_vm_mm r2, r2
+ act_mm r3 @ get current->active_mm
+ teq r2, r3 @ == mm ?
+ movne pc, lr @ no, we dont do anything
+ENTRY(v3_flush_kern_tlb_range)
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: mcr p15, 0, r0, c6, c0, 0 @ invalidate TLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+ __INITDATA
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions v3, v3_tlb_flags
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4.S
new file mode 100644
index 0000000..17a025a
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4.S
@@ -0,0 +1,61 @@
+/*
+ * linux/arch/arm/mm/tlbv4.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 4 TLB handling functions.
+ * These assume a split I/D TLBs, and no write buffer.
+ *
+ * Processors: ARM720T
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/asm-offsets.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+ .align 5
+/*
+ * v4_flush_user_tlb_range(start, end, mm)
+ *
+ * Invalidate a range of TLB entries in the specified user address space.
+ *
+ * - start - range start address
+ * - end - range end address
+ * - mm - mm_struct describing address space
+ */
+ .align 5
+ENTRY(v4_flush_user_tlb_range)
+ vma_vm_mm ip, r2
+ act_mm r3 @ get current->active_mm
+ eors r3, ip, r3 @ == mm ?
+ movne pc, lr @ no, we dont do anything
+.v4_flush_kern_tlb_range:
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: mcr p15, 0, r0, c8, c7, 1 @ invalidate TLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+/*
+ * v4_flush_kern_tlb_range(start, end)
+ *
+ * Invalidate a range of TLB entries in the specified kernel
+ * address range.
+ *
+ * - start - virtual address (may not be aligned)
+ * - end - virtual address (may not be aligned)
+ */
+.globl v4_flush_kern_tlb_range
+.equ v4_flush_kern_tlb_range, .v4_flush_kern_tlb_range
+
+ __INITDATA
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions v4, v4_tlb_flags
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4wb.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4wb.S
new file mode 100644
index 0000000..c04598f
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4wb.S
@@ -0,0 +1,73 @@
+/*
+ * linux/arch/arm/mm/tlbv4wb.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 4 TLB handling functions.
+ * These assume a split I/D TLBs w/o I TLB entry, with a write buffer.
+ *
+ * Processors: SA110 SA1100 SA1110
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/asm-offsets.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+ .align 5
+/*
+ * v4wb_flush_user_tlb_range(start, end, mm)
+ *
+ * Invalidate a range of TLB entries in the specified address space.
+ *
+ * - start - range start address
+ * - end - range end address
+ * - mm - mm_struct describing address space
+ */
+ .align 5
+ENTRY(v4wb_flush_user_tlb_range)
+ vma_vm_mm ip, r2
+ act_mm r3 @ get current->active_mm
+ eors r3, ip, r3 @ == mm ?
+ movne pc, lr @ no, we dont do anything
+ vma_vm_flags r2, r2
+ mcr p15, 0, r3, c7, c10, 4 @ drain WB
+ tst r2, #VM_EXEC
+ mcrne p15, 0, r3, c8, c5, 0 @ invalidate I TLB
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: mcr p15, 0, r0, c8, c6, 1 @ invalidate D TLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+/*
+ * v4_flush_kern_tlb_range(start, end)
+ *
+ * Invalidate a range of TLB entries in the specified kernel
+ * address range.
+ *
+ * - start - virtual address (may not be aligned)
+ * - end - virtual address (may not be aligned)
+ */
+ENTRY(v4wb_flush_kern_tlb_range)
+ mov r3, #0
+ mcr p15, 0, r3, c7, c10, 4 @ drain WB
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+ mcr p15, 0, r3, c8, c5, 0 @ invalidate I TLB
+1: mcr p15, 0, r0, c8, c6, 1 @ invalidate D TLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+ __INITDATA
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions v4wb, v4wb_tlb_flags
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4wbi.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4wbi.S
new file mode 100644
index 0000000..1f6062b
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v4wbi.S
@@ -0,0 +1,64 @@
+/*
+ * linux/arch/arm/mm/tlbv4wbi.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 4 and version 5 TLB handling functions.
+ * These assume a split I/D TLBs, with a write buffer.
+ *
+ * Processors: ARM920 ARM922 ARM925 ARM926 XScale
+ */
+#include <linux/linkage.h>
+#include <linux/init.h>
+#include <asm/asm-offsets.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+/*
+ * v4wb_flush_user_tlb_range(start, end, mm)
+ *
+ * Invalidate a range of TLB entries in the specified address space.
+ *
+ * - start - range start address
+ * - end - range end address
+ * - mm - mm_struct describing address space
+ */
+ .align 5
+ENTRY(v4wbi_flush_user_tlb_range)
+ vma_vm_mm ip, r2
+ act_mm r3 @ get current->active_mm
+ eors r3, ip, r3 @ == mm ?
+ movne pc, lr @ no, we dont do anything
+ mov r3, #0
+ mcr p15, 0, r3, c7, c10, 4 @ drain WB
+ vma_vm_flags r2, r2
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: tst r2, #VM_EXEC
+ mcrne p15, 0, r0, c8, c5, 1 @ invalidate I TLB entry
+ mcr p15, 0, r0, c8, c6, 1 @ invalidate D TLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+ENTRY(v4wbi_flush_kern_tlb_range)
+ mov r3, #0
+ mcr p15, 0, r3, c7, c10, 4 @ drain WB
+ bic r0, r0, #0x0ff
+ bic r0, r0, #0xf00
+1: mcr p15, 0, r0, c8, c5, 1 @ invalidate I TLB entry
+ mcr p15, 0, r0, c8, c6, 1 @ invalidate D TLB entry
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mov pc, lr
+
+ __INITDATA
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions v4wbi, v4wbi_tlb_flags
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v6.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v6.S
new file mode 100644
index 0000000..eca07f5
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v6.S
@@ -0,0 +1,92 @@
+/*
+ * linux/arch/arm/mm/tlb-v6.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 6 TLB handling functions.
+ * These assume a split I/D TLB.
+ */
+#include <linux/init.h>
+#include <linux/linkage.h>
+#include <asm/asm-offsets.h>
+#include <asm/page.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+#define HARVARD_TLB
+
+/*
+ * v6wbi_flush_user_tlb_range(start, end, vma)
+ *
+ * Invalidate a range of TLB entries in the specified address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - vma - vma_struct describing address range
+ *
+ * It is assumed that:
+ * - the "Invalidate single entry" instruction will invalidate
+ * both the I and the D TLBs on Harvard-style TLBs
+ */
+ENTRY(v6wbi_flush_user_tlb_range)
+ vma_vm_mm r3, r2 @ get vma->vm_mm
+ mov ip, #0
+ mmid r3, r3 @ get vm_mm->context.id
+ mcr p15, 0, ip, c7, c10, 4 @ drain write buffer
+ mov r0, r0, lsr #PAGE_SHIFT @ align address
+ mov r1, r1, lsr #PAGE_SHIFT
+ asid r3, r3 @ mask ASID
+ orr r0, r3, r0, lsl #PAGE_SHIFT @ Create initial MVA
+ mov r1, r1, lsl #PAGE_SHIFT
+ vma_vm_flags r2, r2 @ get vma->vm_flags
+1:
+#ifdef HARVARD_TLB
+ mcr p15, 0, r0, c8, c6, 1 @ TLB invalidate D MVA (was 1)
+ tst r2, #VM_EXEC @ Executable area ?
+ mcrne p15, 0, r0, c8, c5, 1 @ TLB invalidate I MVA (was 1)
+#else
+ mcr p15, 0, r0, c8, c7, 1 @ TLB invalidate MVA (was 1)
+#endif
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, ip, c7, c10, 4 @ data synchronization barrier
+ mov pc, lr
+
+/*
+ * v6wbi_flush_kern_tlb_range(start,end)
+ *
+ * Invalidate a range of kernel TLB entries
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ */
+ENTRY(v6wbi_flush_kern_tlb_range)
+ mov r2, #0
+ mcr p15, 0, r2, c7, c10, 4 @ drain write buffer
+ mov r0, r0, lsr #PAGE_SHIFT @ align address
+ mov r1, r1, lsr #PAGE_SHIFT
+ mov r0, r0, lsl #PAGE_SHIFT
+ mov r1, r1, lsl #PAGE_SHIFT
+1:
+#ifdef HARVARD_TLB
+ mcr p15, 0, r0, c8, c6, 1 @ TLB invalidate D MVA
+ mcr p15, 0, r0, c8, c5, 1 @ TLB invalidate I MVA
+#else
+ mcr p15, 0, r0, c8, c7, 1 @ TLB invalidate MVA
+#endif
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ mcr p15, 0, r2, c7, c10, 4 @ data synchronization barrier
+ mcr p15, 0, r2, c7, c5, 4 @ prefetch flush (isb)
+ mov pc, lr
+
+ __INIT
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions v6wbi, v6wbi_tlb_flags
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v7.S b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v7.S
new file mode 100644
index 0000000..ea94765
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/tlb-v7.S
@@ -0,0 +1,95 @@
+/*
+ * linux/arch/arm/mm/tlb-v7.S
+ *
+ * Copyright (C) 1997-2002 Russell King
+ * Modified for ARMv7 by Catalin Marinas
+ *
+ * This program is free software; you can redistribute it and/or modify
+ * it under the terms of the GNU General Public License version 2 as
+ * published by the Free Software Foundation.
+ *
+ * ARM architecture version 6 TLB handling functions.
+ * These assume a split I/D TLB.
+ */
+#include <linux/init.h>
+#include <linux/linkage.h>
+#include <asm/assembler.h>
+#include <asm/asm-offsets.h>
+#include <asm/page.h>
+#include <asm/tlbflush.h>
+#include "proc-macros.S"
+
+/*
+ * v7wbi_flush_user_tlb_range(start, end, vma)
+ *
+ * Invalidate a range of TLB entries in the specified address space.
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ * - vma - vma_struct describing address range
+ *
+ * It is assumed that:
+ * - the "Invalidate single entry" instruction will invalidate
+ * both the I and the D TLBs on Harvard-style TLBs
+ */
+ENTRY(v7wbi_flush_user_tlb_range)
+ vma_vm_mm r3, r2 @ get vma->vm_mm
+ mmid r3, r3 @ get vm_mm->context.id
+ dsb
+ mov r0, r0, lsr #PAGE_SHIFT @ align address
+ mov r1, r1, lsr #PAGE_SHIFT
+ asid r3, r3 @ mask ASID
+#ifdef CONFIG_ARM_ERRATA_720789
+ ALT_SMP(W(mov) r3, #0 )
+ ALT_UP(W(nop) )
+#endif
+ orr r0, r3, r0, lsl #PAGE_SHIFT @ Create initial MVA
+ mov r1, r1, lsl #PAGE_SHIFT
+1:
+#ifdef CONFIG_ARM_ERRATA_720789
+ ALT_SMP(mcr p15, 0, r0, c8, c3, 3) @ TLB invalidate U MVA all ASID (shareable)
+#else
+ ALT_SMP(mcr p15, 0, r0, c8, c3, 1) @ TLB invalidate U MVA (shareable)
+#endif
+ ALT_UP(mcr p15, 0, r0, c8, c7, 1) @ TLB invalidate U MVA
+
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ dsb
+ mov pc, lr
+ENDPROC(v7wbi_flush_user_tlb_range)
+
+/*
+ * v7wbi_flush_kern_tlb_range(start,end)
+ *
+ * Invalidate a range of kernel TLB entries
+ *
+ * - start - start address (may not be aligned)
+ * - end - end address (exclusive, may not be aligned)
+ */
+ENTRY(v7wbi_flush_kern_tlb_range)
+ dsb
+ mov r0, r0, lsr #PAGE_SHIFT @ align address
+ mov r1, r1, lsr #PAGE_SHIFT
+ mov r0, r0, lsl #PAGE_SHIFT
+ mov r1, r1, lsl #PAGE_SHIFT
+1:
+#ifdef CONFIG_ARM_ERRATA_720789
+ ALT_SMP(mcr p15, 0, r0, c8, c3, 3) @ TLB invalidate U MVA all ASID (shareable)
+#else
+ ALT_SMP(mcr p15, 0, r0, c8, c3, 1) @ TLB invalidate U MVA (shareable)
+#endif
+ ALT_UP(mcr p15, 0, r0, c8, c7, 1) @ TLB invalidate U MVA
+ add r0, r0, #PAGE_SZ
+ cmp r0, r1
+ blo 1b
+ dsb
+ isb
+ mov pc, lr
+ENDPROC(v7wbi_flush_kern_tlb_range)
+
+ __INIT
+
+ /* define struct cpu_tlb_fns (see <asm/tlbflush.h> and proc-macros.S) */
+ define_tlb_functions v7wbi, v7wbi_tlb_flags_up, flags_smp=v7wbi_tlb_flags_smp
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/vmregion.c b/ap/os/linux/linux-3.4.x/arch/arm/mm/vmregion.c
new file mode 100644
index 0000000..a631016
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/vmregion.c
@@ -0,0 +1,205 @@
+#include <linux/fs.h>
+#include <linux/spinlock.h>
+#include <linux/list.h>
+#include <linux/proc_fs.h>
+#include <linux/seq_file.h>
+#include <linux/slab.h>
+
+#include "vmregion.h"
+
+/*
+ * VM region handling support.
+ *
+ * This should become something generic, handling VM region allocations for
+ * vmalloc and similar (ioremap, module space, etc).
+ *
+ * I envisage vmalloc()'s supporting vm_struct becoming:
+ *
+ * struct vm_struct {
+ * struct vmregion region;
+ * unsigned long flags;
+ * struct page **pages;
+ * unsigned int nr_pages;
+ * unsigned long phys_addr;
+ * };
+ *
+ * get_vm_area() would then call vmregion_alloc with an appropriate
+ * struct vmregion head (eg):
+ *
+ * struct vmregion vmalloc_head = {
+ * .vm_list = LIST_HEAD_INIT(vmalloc_head.vm_list),
+ * .vm_start = VMALLOC_START,
+ * .vm_end = VMALLOC_END,
+ * };
+ *
+ * However, vmalloc_head.vm_start is variable (typically, it is dependent on
+ * the amount of RAM found at boot time.) I would imagine that get_vm_area()
+ * would have to initialise this each time prior to calling vmregion_alloc().
+ */
+
+struct arm_vmregion *
+arm_vmregion_alloc(struct arm_vmregion_head *head, size_t align,
+ size_t size, gfp_t gfp, const void *caller)
+{
+ unsigned long start = head->vm_start, addr = head->vm_end;
+ unsigned long flags;
+ struct arm_vmregion *c, *new;
+
+ if (head->vm_end - head->vm_start < size) {
+ printk(KERN_WARNING "%s: allocation too big (requested %#x)\n",
+ __func__, size);
+ goto out;
+ }
+
+ new = kmalloc(sizeof(struct arm_vmregion), gfp);
+ if (!new)
+ goto out;
+
+ new->caller = caller;
+
+ spin_lock_irqsave(&head->vm_lock, flags);
+
+ addr = rounddown(addr - size, align);
+ list_for_each_entry_reverse(c, &head->vm_list, vm_list) {
+ if (addr >= c->vm_end)
+ goto found;
+ addr = rounddown(c->vm_start - size, align);
+ if (addr < start)
+ goto nospc;
+ }
+
+ found:
+ /*
+ * Insert this entry after the one we found.
+ */
+ list_add(&new->vm_list, &c->vm_list);
+ new->vm_start = addr;
+ new->vm_end = addr + size;
+ new->vm_active = 1;
+
+ spin_unlock_irqrestore(&head->vm_lock, flags);
+ return new;
+
+ nospc:
+ spin_unlock_irqrestore(&head->vm_lock, flags);
+ kfree(new);
+ out:
+ return NULL;
+}
+
+static struct arm_vmregion *__arm_vmregion_find(struct arm_vmregion_head *head, unsigned long addr)
+{
+ struct arm_vmregion *c;
+
+ list_for_each_entry(c, &head->vm_list, vm_list) {
+ if (c->vm_active && c->vm_start == addr)
+ goto out;
+ }
+ c = NULL;
+ out:
+ return c;
+}
+
+struct arm_vmregion *arm_vmregion_find(struct arm_vmregion_head *head, unsigned long addr)
+{
+ struct arm_vmregion *c;
+ unsigned long flags;
+
+ spin_lock_irqsave(&head->vm_lock, flags);
+ c = __arm_vmregion_find(head, addr);
+ spin_unlock_irqrestore(&head->vm_lock, flags);
+ return c;
+}
+
+struct arm_vmregion *arm_vmregion_find_remove(struct arm_vmregion_head *head, unsigned long addr)
+{
+ struct arm_vmregion *c;
+ unsigned long flags;
+
+ spin_lock_irqsave(&head->vm_lock, flags);
+ c = __arm_vmregion_find(head, addr);
+ if (c)
+ c->vm_active = 0;
+ spin_unlock_irqrestore(&head->vm_lock, flags);
+ return c;
+}
+
+void arm_vmregion_free(struct arm_vmregion_head *head, struct arm_vmregion *c)
+{
+ unsigned long flags;
+
+ spin_lock_irqsave(&head->vm_lock, flags);
+ list_del(&c->vm_list);
+ spin_unlock_irqrestore(&head->vm_lock, flags);
+
+ kfree(c);
+}
+
+#ifdef CONFIG_PROC_FS
+static int arm_vmregion_show(struct seq_file *m, void *p)
+{
+ struct arm_vmregion *c = list_entry(p, struct arm_vmregion, vm_list);
+
+ seq_printf(m, "0x%08lx-0x%08lx %7lu", c->vm_start, c->vm_end,
+ c->vm_end - c->vm_start);
+ if (c->caller)
+ seq_printf(m, " %pS", (void *)c->caller);
+ seq_putc(m, '\n');
+ return 0;
+}
+
+static void *arm_vmregion_start(struct seq_file *m, loff_t *pos)
+{
+ struct arm_vmregion_head *h = m->private;
+ spin_lock_irq(&h->vm_lock);
+ return seq_list_start(&h->vm_list, *pos);
+}
+
+static void *arm_vmregion_next(struct seq_file *m, void *p, loff_t *pos)
+{
+ struct arm_vmregion_head *h = m->private;
+ return seq_list_next(p, &h->vm_list, pos);
+}
+
+static void arm_vmregion_stop(struct seq_file *m, void *p)
+{
+ struct arm_vmregion_head *h = m->private;
+ spin_unlock_irq(&h->vm_lock);
+}
+
+static const struct seq_operations arm_vmregion_ops = {
+ .start = arm_vmregion_start,
+ .stop = arm_vmregion_stop,
+ .next = arm_vmregion_next,
+ .show = arm_vmregion_show,
+};
+
+static int arm_vmregion_open(struct inode *inode, struct file *file)
+{
+ struct arm_vmregion_head *h = PDE(inode)->data;
+ int ret = seq_open(file, &arm_vmregion_ops);
+ if (!ret) {
+ struct seq_file *m = file->private_data;
+ m->private = h;
+ }
+ return ret;
+}
+
+static const struct file_operations arm_vmregion_fops = {
+ .open = arm_vmregion_open,
+ .read = seq_read,
+ .llseek = seq_lseek,
+ .release = seq_release,
+};
+
+int arm_vmregion_create_proc(const char *path, struct arm_vmregion_head *h)
+{
+ proc_create_data(path, S_IRUSR, NULL, &arm_vmregion_fops, h);
+ return 0;
+}
+#else
+int arm_vmregion_create_proc(const char *path, struct arm_vmregion_head *h)
+{
+ return 0;
+}
+#endif
diff --git a/ap/os/linux/linux-3.4.x/arch/arm/mm/vmregion.h b/ap/os/linux/linux-3.4.x/arch/arm/mm/vmregion.h
new file mode 100644
index 0000000..162be66
--- /dev/null
+++ b/ap/os/linux/linux-3.4.x/arch/arm/mm/vmregion.h
@@ -0,0 +1,32 @@
+#ifndef VMREGION_H
+#define VMREGION_H
+
+#include <linux/spinlock.h>
+#include <linux/list.h>
+
+struct page;
+
+struct arm_vmregion_head {
+ spinlock_t vm_lock;
+ struct list_head vm_list;
+ unsigned long vm_start;
+ unsigned long vm_end;
+};
+
+struct arm_vmregion {
+ struct list_head vm_list;
+ unsigned long vm_start;
+ unsigned long vm_end;
+ struct page *vm_pages;
+ int vm_active;
+ const void *caller;
+};
+
+struct arm_vmregion *arm_vmregion_alloc(struct arm_vmregion_head *, size_t, size_t, gfp_t, const void *);
+struct arm_vmregion *arm_vmregion_find(struct arm_vmregion_head *, unsigned long);
+struct arm_vmregion *arm_vmregion_find_remove(struct arm_vmregion_head *, unsigned long);
+void arm_vmregion_free(struct arm_vmregion_head *, struct arm_vmregion *);
+
+int arm_vmregion_create_proc(const char *, struct arm_vmregion_head *);
+
+#endif